- InChI
- InChI=1S/C6H12O2/c1-3-4-5-6(7)8-2/h3-5H2,1-2H3
- InChI Key
- HNBDRPTVWVGKBR-UHFFFAOYSA-N
- Formula
- C6H12O2
- SMILES
- CCCCC(=O)OC
- Molecular Weight1
- 116.16
- CAS
- 624-24-8
- Other Names
-
- CH3(CH2)3COOCH3
- Methyl ester of pentanoic acid
- Methyl n-valerate
- Methyl pentanoate
- Methyl valerianate
- Pentanoic acid, methyl ester
- Propyl propanoate
- Valeric acid, methyl ester
- n-Valeric acid methyl ester
- valeric acid methyl ester
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔcH°liquid | [-3561.70; -3548.00] | kJ/mol |
|
| ΔcH°liquid | -3561.70 ± 0.60 | kJ/mol | NIST |
| ΔcH°liquid | -3548.00 | kJ/mol | NIST |
| ΔfG° | -234.28 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | [-485.00; -472.00] | kJ/mol |
|
| ΔfH°gas | -472.00 ± 2.00 | kJ/mol | NIST |
| ΔfH°gas | -485.00 ± 2.00 | kJ/mol | NIST |
| ΔfH°liquid | [-527.00; -514.20] | kJ/mol |
|
| ΔfH°liquid | -514.20 ± 7.10 | kJ/mol | NIST |
| ΔfH°liquid | -527.00 | kJ/mol | NIST |
| ΔfusH° | 14.08 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 38.11 | kJ/mol | Joback Calculated Property |
| IE | 10.40 ± 0.20 | eV | NIST |
| log10WS | [-1.36; -1.34] |
|
|
| log10WS | -1.36 | Aq. Sol... | |
| log10WS | -1.34 | Estimat... | |
| logPoct/wat | 1.350 | Crippen Calculated Property | |
| McVol | 102.840 | ml/mol | McGowan Calculated Property |
| Pc | 3190.00 ± 202.65 | kPa | NIST |
| ρc | 278.78 ± 19.75 | kg/m3 | NIST |
| Inp | [784.00; 852.00] |
|
|
| Inp | 822.80 | NIST | |
| Inp | 821.90 | NIST | |
| Inp | 821.20 | NIST | |
| Inp | 794.00 | NIST | |
| Inp | 802.00 | NIST | |
| Inp | 806.00 | NIST | |
| Inp | 816.00 | NIST | |
| Inp | 807.00 | NIST | |
| Inp | 812.00 | NIST | |
| Inp | 814.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | 806.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 807.00 | NIST | |
| Inp | 823.00 | NIST | |
| Inp | 823.00 | NIST | |
| Inp | 823.00 | NIST | |
| Inp | 825.00 | NIST | |
| Inp | 804.00 | NIST | |
| Inp | 808.80 | NIST | |
| Inp | 807.00 | NIST | |
| Inp | Outlier 852.00 | NIST | |
| Inp | 808.00 | NIST | |
| Inp | 821.00 | NIST | |
| Inp | 825.00 | NIST | |
| Inp | 808.00 | NIST | |
| Inp | 823.00 | NIST | |
| Inp | 809.00 | NIST | |
| Inp | 821.00 | NIST | |
| Inp | 829.10 | NIST | |
| Inp | 823.00 | NIST | |
| Inp | 823.00 | NIST | |
| Inp | 811.00 | NIST | |
| Inp | 806.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 810.00 | NIST | |
| Inp | 807.00 | NIST | |
| Inp | 806.00 | NIST | |
| Inp | Outlier 784.00 | NIST | |
| Inp | 830.00 | NIST | |
| Inp | 807.00 | NIST | |
| Inp | 806.00 | NIST | |
| Inp | 808.00 | NIST | |
| Inp | 823.00 | NIST | |
| Inp | 808.80 | NIST | |
| Inp | 821.00 | NIST | |
| Inp | 822.80 | NIST | |
| Inp | 806.00 | NIST | |
| Inp | 800.00 | NIST | |
| Inp | 830.00 | NIST | |
| I | [1075.00; 1123.00] |
|
|
| I | 1083.00 | NIST | |
| I | Outlier 1123.00 | NIST | |
| I | 1081.00 | NIST | |
| I | 1085.00 | NIST | |
| I | 1089.00 | NIST | |
| I | 1075.00 | NIST | |
| I | 1086.00 | NIST | |
| I | 1096.00 | NIST | |
| I | 1090.00 | NIST | |
| I | 1084.00 | NIST | |
| I | 1090.00 | NIST | |
| I | 1095.00 | NIST | |
| I | 1082.00 | NIST | |
| I | 1087.00 | NIST | |
| I | 1086.00 | NIST | |
| I | 1081.00 | NIST | |
| I | 1085.00 | NIST | |
| I | 1076.00 | NIST | |
| I | 1082.00 | NIST | |
| I | 1083.00 | NIST | |
| I | 1076.00 | NIST | |
| I | Outlier 1109.00 | NIST | |
| I | 1083.00 | NIST | |
| Tboil | 400.48 | K | Vapor L... |
| Tc | [556.70; 566.90] | K |
|
| Tc | 556.70 ± 20.00 | K | NIST |
| Tc | 566.90 ± 20.00 | K | NIST |
| Tfus | 182.50 ± 0.05 | K | NIST |
| Vc | 0.396 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [199.87; 254.27] | J/mol×K | [412.97; 590.55] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 200 210 220 230 240 250 450 500 550 | ||||
| Cp,gas | 199.87 | J/mol×K | 412.97 | Joback Calculated Property |
| Cp,gas | 209.71 | J/mol×K | 442.57 | Joback Calculated Property |
| Cp,gas | 219.25 | J/mol×K | 472.16 | Joback Calculated Property |
| Cp,gas | 228.47 | J/mol×K | 501.76 | Joback Calculated Property |
| Cp,gas | 237.38 | J/mol×K | 531.36 | Joback Calculated Property |
| Cp,gas | 245.98 | J/mol×K | 560.96 | Joback Calculated Property |
| Cp,gas | 254.27 | J/mol×K | 590.55 | Joback Calculated Property |
| Cp,liquid | [226.11; 229.30] | J/mol×K | [298.15; 298.15] |
|
| Cp,liquid | 226.11 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 229.30 | J/mol×K | 298.15 | NIST |
| η | [0.0005510; 0.0008160] | Pa×s | [283.15; 313.15] |
|
|
T(K) Dynamic viscosity (Pa×s) 5.50e-4 6.00e-4 6.50e-4 7.00e-4 7.50e-4 8.00e-4 290 300 310 | ||||
| η | 0.0008160 | Pa×s | 283.15 | A Study... |
| η | 0.0007120 | Pa×s | 293.15 | A Study... |
| η | 0.0006610 | Pa×s | 298.15 | A Study... |
| η | 0.0006230 | Pa×s | 303.15 | A Study... |
| η | 0.0005510 | Pa×s | 313.15 | A Study... |
| ΔvapH | [39.20; 44.40] | kJ/mol | [350.00; 414.00] |
|
|
T(K) Enthalpy of vaporization at a given temperature (kJ/mol) 39 40 41 42 43 44 360 380 400 | ||||
| ΔvapH | 41.30 | kJ/mol | 350.00 | NIST |
| ΔvapH | 42.50 | kJ/mol | 354.00 | NIST |
| ΔvapH | 44.10 ± 0.10 | kJ/mol | 382.50 | NIST |
| ΔvapH | 39.20 | kJ/mol | 390.50 | NIST |
| ΔvapH | 44.40 | kJ/mol | 414.00 | NIST |
| Pvap | [0.34; 101.30] | kPa | [274.90; 400.48] |
|
|
T(K) Vapor pressure (kPa) 0 20 40 60 80 100 300 350 400 | ||||
| Pvap | 0.34 | kPa | 274.90 | Transpi... |
| Pvap | 0.34 | kPa | 275.20 | Transpi... |
| Pvap | 0.42 | kPa | 278.20 | Transpi... |
| Pvap | 0.46 | kPa | 279.40 | Transpi... |
| Pvap | 0.52 | kPa | 281.20 | Transpi... |
| Pvap | 0.56 | kPa | 282.60 | Transpi... |
| Pvap | 0.64 | kPa | 284.20 | Transpi... |
| Pvap | 0.60 | kPa | 284.30 | Transpi... |
| Pvap | 0.62 | kPa | 284.50 | Transpi... |
| Pvap | 0.69 | kPa | 285.50 | Transpi... |
| Pvap | 0.75 | kPa | 287.40 | Transpi... |
| Pvap | 0.78 | kPa | 288.40 | Transpi... |
| Pvap | 0.79 | kPa | 288.40 | Transpi... |
| Pvap | 0.82 | kPa | 288.50 | Transpi... |
| Pvap | 0.83 | kPa | 288.70 | Transpi... |
| Pvap | 0.87 | kPa | 289.20 | Transpi... |
| Pvap | 0.93 | kPa | 290.30 | Transpi... |
| Pvap | 1.03 | kPa | 292.40 | Transpi... |
| Pvap | 1.09 | kPa | 293.30 | Transpi... |
| Pvap | 1.13 | kPa | 293.40 | Transpi... |
| Pvap | 1.23 | kPa | 294.50 | Transpi... |
| Pvap | 1.33 | kPa | 296.20 | Transpi... |
| Pvap | 1.51 | kPa | 297.50 | Transpi... |
| Pvap | 1.52 | kPa | 298.30 | Transpi... |
| Pvap | 1.61 | kPa | 299.20 | Transpi... |
| Pvap | 1.58 | kPa | 299.20 | Transpi... |
| Pvap | 1.97 | kPa | 302.20 | Transpi... |
| Pvap | 1.94 | kPa | 302.20 | Transpi... |
| Pvap | 2.27 | kPa | 305.20 | Transpi... |
| Pvap | 2.65 | kPa | 308.20 | Transpi... |
| Pvap | 3.11 | kPa | 311.20 | Transpi... |
| Pvap | 29.41 | kPa | 361.82 | Vapor L... |
| Pvap | 35.06 | kPa | 366.70 | Vapor L... |
| Pvap | 40.47 | kPa | 370.86 | Vapor L... |
| Pvap | 45.81 | kPa | 374.53 | Vapor L... |
| Pvap | 52.83 | kPa | 378.84 | Vapor L... |
| Pvap | 59.35 | kPa | 382.55 | Vapor L... |
| Pvap | 60.00 | kPa | 383.29 | Vapor L... |
| Pvap | 69.02 | kPa | 387.18 | Vapor L... |
| Pvap | 77.71 | kPa | 391.14 | Vapor L... |
| Pvap | 88.17 | kPa | 395.42 | Vapor L... |
| Pvap | 95.08 | kPa | 398.03 | Vapor L... |
| Pvap | 100.40 | kPa | 400.07 | Vapor L... |
| Pvap | 101.30 | kPa | 400.48 | Vapor L... |
| n0 | [1.39470; 1.39710] | [298.15; 298.15] |
|
|
|
T(K) Refractive Index 1.39 1.4 1.4 1.4 1.4 1.4 | ||||
| n0 | 1.39500 | 298.15 | Thermod... | |
| n0 | 1.39520 | 298.15 | Mixing ... | |
| n0 | 1.39680 | 298.15 | A Study... | |
| n0 | 1.39470 | 298.15 | Isobari... | |
| n0 | 1.39710 | 298.15 | Vapor-L... | |
| n0 | 1.39710 | 298.15 | Vapor-L... | |
| ρl | 885.66 | kg/m3 | 298.15 | Densiti... |
| λ | [0.12; 0.14] | W/m×K | [285.55; 362.16] |
|
|
T(K) Liquid thermal conductivity (W/m×K) 0.12 0.13 0.13 0.14 0.14 0.15 300 320 340 360 | ||||
| λ | 0.14 | W/m×K | 285.55 | Experim... |
| λ | 0.14 | W/m×K | 290.39 | Experim... |
| λ | 0.14 | W/m×K | 295.51 | Experim... |
| λ | 0.14 | W/m×K | 298.99 | Experim... |
| λ | 0.14 | W/m×K | 305.50 | Experim... |
| λ | 0.13 | W/m×K | 312.35 | Experim... |
| λ | 0.13 | W/m×K | 320.42 | Experim... |
| λ | 0.13 | W/m×K | 327.35 | Experim... |
| λ | 0.13 | W/m×K | 333.50 | Experim... |
| λ | 0.12 | W/m×K | 340.41 | Experim... |
| λ | 0.12 | W/m×K | 348.36 | Experim... |
| λ | 0.12 | W/m×K | 355.39 | Experim... |
| λ | 0.12 | W/m×K | 362.16 | Experim... |
Datasets
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 100.00 | 890.18 |
| 293.15 | 1000.00 | 890.39 |
| 293.15 | 3000.00 | 892.23 |
| 293.15 | 5000.00 | 893.59 |
| 293.15 | 10000.00 | 897.77 |
| 293.15 | 15000.00 | 901.59 |
| 293.15 | 20000.00 | 905.28 |
| 293.15 | 25000.00 | 908.91 |
| 293.15 | 30000.00 | 912.4 |
| 293.15 | 35000.00 | 915.63 |
| 293.15 | 40000.00 | 918.78 |
| 293.15 | 50000.00 | 925.12 |
| 293.15 | 60000.00 | 930.63 |
| 303.15 | 100.00 | 879.57 |
| 303.15 | 1000.00 | 880.52 |
| 303.15 | 3000.00 | 882.29 |
| 303.15 | 5000.00 | 884.05 |
| 303.15 | 10000.00 | 888.3 |
| 303.15 | 15000.00 | 892.37 |
| 303.15 | 20000.00 | 896.14 |
| 303.15 | 25000.00 | 899.89 |
| 303.15 | 30000.00 | 903.55 |
| 303.15 | 35000.00 | 906.97 |
| 303.15 | 40000.00 | 910.27 |
| 303.15 | 50000.00 | 916.73 |
| 303.15 | 60000.00 | 922.74 |
| 313.15 | 100.00 | 869.49 |
| 313.15 | 1000.00 | 869.89 |
| 313.15 | 3000.00 | 871.87 |
| 313.15 | 5000.00 | 873.76 |
| 313.15 | 10000.00 | 878.33 |
| 313.15 | 15000.00 | 882.44 |
| 313.15 | 20000.00 | 886.62 |
| 313.15 | 25000.00 | 890.61 |
| 313.15 | 30000.00 | 894.38 |
| 313.15 | 35000.00 | 898.09 |
| 313.15 | 40000.00 | 901.45 |
| 313.15 | 50000.00 | 908.24 |
| 313.15 | 60000.00 | 914.32 |
| 323.15 | 100.00 | 858.83 |
| 323.15 | 1000.00 | 859.81 |
| 323.15 | 3000.00 | 861.81 |
| 323.15 | 5000.00 | 863.85 |
| 323.15 | 10000.00 | 868.67 |
| 323.15 | 15000.00 | 873.18 |
| 323.15 | 20000.00 | 877.67 |
| 323.15 | 25000.00 | 881.64 |
| 323.15 | 30000.00 | 885.65 |
| 323.15 | 35000.00 | 889.44 |
| 323.15 | 40000.00 | 893.13 |
| 323.15 | 50000.00 | 900.12 |
| 323.15 | 60000.00 | 906.77 |
| 333.15 | 100.00 | 848.52 |
| 333.15 | 1000.00 | 849.45 |
| 333.15 | 3000.00 | 851.71 |
| 333.15 | 5000.00 | 853.79 |
| 333.15 | 10000.00 | 858.86 |
| 333.15 | 15000.00 | 863.66 |
| 333.15 | 20000.00 | 868.26 |
| 333.15 | 25000.00 | 872.72 |
| 333.15 | 30000.00 | 876.79 |
| 333.15 | 35000.00 | 880.79 |
| 333.15 | 40000.00 | 884.78 |
| 333.15 | 50000.00 | 892.02 |
| 333.15 | 60000.00 | 898.8 |
| 343.15 | 100.00 | 837.8 |
| 343.15 | 1000.00 | 839.04 |
| 343.15 | 3000.00 | 841.41 |
| 343.15 | 5000.00 | 843.76 |
| 343.15 | 10000.00 | 849.05 |
| 343.15 | 15000.00 | 854.23 |
| 343.15 | 20000.00 | 859.25 |
| 343.15 | 25000.00 | 863.69 |
| 343.15 | 30000.00 | 868.17 |
| 343.15 | 35000.00 | 872.41 |
| 343.15 | 40000.00 | 876.28 |
| 343.15 | 50000.00 | 884.03 |
| 343.15 | 60000.00 | 890.84 |
| 353.15 | 100.00 | 827.35 |
| 353.15 | 1000.00 | 828.43 |
| 353.15 | 3000.00 | 831.13 |
| 353.15 | 5000.00 | 833.48 |
| 353.15 | 10000.00 | 839.27 |
| 353.15 | 15000.00 | 844.84 |
| 353.15 | 20000.00 | 849.86 |
| 353.15 | 25000.00 | 854.79 |
| 353.15 | 30000.00 | 859.45 |
| 353.15 | 35000.00 | 863.9 |
| 353.15 | 40000.00 | 868.0 |
| 353.15 | 50000.00 | 875.94 |
| 353.15 | 60000.00 | 883.37 |
| 363.15 | 100.00 | 816.63 |
| 363.15 | 1000.00 | 817.89 |
| 363.15 | 3000.00 | 820.7 |
| 363.15 | 5000.00 | 823.32 |
| 363.15 | 10000.00 | 829.23 |
| 363.15 | 15000.00 | 835.46 |
| 363.15 | 20000.00 | 840.59 |
| 363.15 | 25000.00 | 845.61 |
| 363.15 | 30000.00 | 850.57 |
| 363.15 | 35000.00 | 855.31 |
| 363.15 | 40000.00 | 859.8 |
| 363.15 | 50000.00 | 868.09 |
| 363.15 | 60000.00 | 875.9 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.64] | kPa | [297.44; 438.38] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.40423e+01 | |||
| Coefficient B | -3.36903e+03 | |||
| Coefficient C | -5.25030e+01 | |||
| Temperature range, min. | 297.44 | |||
| Temperature range, max. | 438.38 | |||
|
T(K) Vapor pressure (kPa) 0 50 100 150 200 300 350 400 | ||||
| Pvap | 1.33 | kPa | 297.44 | Calculated Property |
| Pvap | 3.05 | kPa | 313.10 | Calculated Property |
| Pvap | 6.34 | kPa | 328.76 | Calculated Property |
| Pvap | 12.20 | kPa | 344.42 | Calculated Property |
| Pvap | 21.95 | kPa | 360.08 | Calculated Property |
| Pvap | 37.32 | kPa | 375.74 | Calculated Property |
| Pvap | 60.41 | kPa | 391.40 | Calculated Property |
| Pvap | 93.71 | kPa | 407.06 | Calculated Property |
| Pvap | 140.07 | kPa | 422.72 | Calculated Property |
| Pvap | 202.64 | kPa | 438.38 | Calculated Property |
| Pvap | [6.52; 2812.70] | kPa | [318.15; 575.15] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 1.06981e+02 | |||
| Coefficient B | -8.88364e+03 | |||
| Coefficient C | -1.35161e+01 | |||
| Coefficient D | 6.94116e-06 | |||
| Temperature range, min. | 318.15 | |||
| Temperature range, max. | 575.15 | |||
|
T(K) Vapor pressure (kPa) 0 500 1000 1500 2000 2500 3000 400 500 | ||||
| Pvap | 6.52 | kPa | 318.15 | Calculated Property |
| Pvap | 23.20 | kPa | 346.71 | Calculated Property |
| Pvap | 64.54 | kPa | 375.26 | Calculated Property |
| Pvap | 149.08 | kPa | 403.82 | Calculated Property |
| Pvap | 298.76 | kPa | 432.37 | Calculated Property |
| Pvap | 536.55 | kPa | 460.93 | Calculated Property |
| Pvap | 884.91 | kPa | 489.48 | Calculated Property |
| Pvap | 1365.45 | kPa | 518.04 | Calculated Property |
| Pvap | 2000.03 | kPa | 546.59 | Calculated Property |
| Pvap | 2812.70 | kPa | 575.15 | Calculated Property |
Similar Compounds
Find more compounds similar to Methyl valerate.
Mixtures
- Ethane, 1,2-dibromo- + Methyl valerate
- Propane, 1,3-dibromo- + Methyl valerate
- Methyl valerate + Butane, 1,4-dibromo-
- Pentane, 1,5-dibromo- + Methyl valerate
- Hexane, 1,6-dibromo- + Methyl valerate
- Methyl formate + Methyl valerate
- Methyl valerate + Methyl Alcohol
- Methyl formate + Methyl valerate + Methyl Alcohol
- Methyl valerate + Water
- Octane + Methyl valerate
- Methyl valerate + Pentane, 2,2,4-trimethyl-
- Methyl valerate + Acetic acid, methyl ester
- Octane + Methyl valerate + Acetic acid, methyl ester
- Methyl valerate + Pentane, 2,2,4-trimethyl- + Acetic acid, methyl ester
- Methyl valerate + Heptane
- Methyl valerate + 1-Hexanol
- Octane + Methyl valerate + 1-Hexanol
- Acetonitrile + Methyl valerate
- Propanenitrile + Methyl valerate
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Transpiration method: Vapor pressures and enthalpies of vaporization of some low-boiling esters
- High-pressure liquid densities of fatty acid methyl esters: Measurement and prediction with the PC-SAFT equation of state
- Thermodynamic study of (alkyl esters + alpha,omega-alkyl dihalides) IV: Hex and Vex for 25 binary mixtures {xC(u-1)H(2u-1)CO2CH3 + (1-x)alpha,omega-BrCH2(CH2)(v-2)CH2Br}, where u = 1 to 5, alpha = 1 and v = omega = 2 to 6
- Mixing thermodynamic properties of ester-containing solutions: A study on the ternary (methyl alkanoate (pentanoate and methanoate) + methanol) and the corresponding binaries. New contributions to the (ester + ester) interactions
- Densities and interfacial tensions for fatty acid methyl esters (from methyl formate to methyl heptanoate) + water demixed mixtures at atmospheric pressure conditions
- Experimental investigations on the liquid thermal conductivity of five saturated fatty acid methyl esters components of biodiesel
- A Study on Alkane + Ester + Ester Systems. Physicochemical Behavior of Binaries and Ternaries of Octane or Iso-octane with Methyl Esters (Ethanoate, Butanoate, Pentanoate)
- Vapor Liquid Equilibria Measurements for the Five Linear C6 Esters with n-Octane
- Isobaric Vapor-Liquid Equilibria and Excess Properties for the Binary Systems of Methyl Esters + Heptane
- A Study on Properties Derived from Densities and Viscosities for the Ternary Systems (Methyl Pentanoate or Methyl Heptanoate) + n-Octane + 1-Hexanol and their Binary Subsystems at Various Temperatures.
- Thermodynamic Properties of Mixtures Containing Ionic Liquids. 8. Activity Coefficients at Infinite Dilution of Hydrocarbons, Alcohols, Esters, and Aldehydes in 1-Hexyl-3-methylimidazolium Bis(trifluoromethylsulfonyl) Imide Using Gas-Liquid Chromatography
- Thermodynamic Properties of Mixtures Containing Ionic Liquids. 9. Activity Coefficients at Infinite Dilution of Hydrocarbons, Alcohols, Esters, and Aldehydes in Trimethyl-butylammonium Bis(trifluoromethylsulfonyl) Imide Using Gas-Liquid Chromatography and Static Method
- Vapor-Liquid Equilibrium Data for the Binary Methyl Esters (Butyrate, Pentanoate, and Hexanoate) (1) + Acetonitrile (2) Systems at 93.32 kPa
- Experimental Study of Thermodynamic Properties of Mixtures Containing Ionic Liquid 1-Ethyl-3-methylimidazolium Ethyl Sulfate Using Gas-Liquid Chromatography and Transpiration Method
- Vapor-Liquid Equilibrium Data for the Binary Methyl Esters (Butyrate, Pentanoate, and Hexanoate) (1) + Propanenitrile (2) Systems at 93.32 kPa
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.