- InChI
- InChI=1S/C13H26O2/c1-3-4-5-6-7-8-9-10-11-12-13(14)15-2/h3-12H2,1-2H3
- InChI Key
- UQDUPQYQJKYHQI-UHFFFAOYSA-N
- Formula
- C13H26O2
- SMILES
- CCCCCCCCCCCC(=O)OC
- Molecular Weight1
- 214.34
- CAS
- 111-82-0
- Other Names
-
- Lauric acid, methyl ester
- Metholene 2296
- Methyl dodecanoate
- Methyl dodecylate
- Methyl laurate
- Methyl laurinate
- Methyl n-dodecanoate
- NSC 5027
- Uniphat A40
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔsubH : Enthalpy of sublimation at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- csound,fluid : Speed of sound in fluid (m/s).
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Pressure Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔcH°liquid | [-8137.80; -8117.00] | kJ/mol |
|
| ΔcH°liquid | -8117.00 ± 0.40 | kJ/mol | NIST |
| ΔcH°liquid | -8137.80 ± 1.60 | kJ/mol | NIST |
| ΔfG° | -175.34 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -556.45 | kJ/mol | Joback Calculated Property |
| ΔfusH° | 43.15 | kJ/mol | Heat Ca... |
| ΔvapH° | [76.50; 77.20] | kJ/mol |
|
| ΔvapH° | 77.17 | kJ/mol | NIST |
| ΔvapH° | 76.60 ± 0.40 | kJ/mol | NIST |
| ΔvapH° | 76.80 | kJ/mol | NIST |
| ΔvapH° | 76.50 ± 0.70 | kJ/mol | NIST |
| ΔvapH° | 77.17 ± 0.56 | kJ/mol | NIST |
| ΔvapH° | 77.20 ± 0.60 | kJ/mol | NIST |
| log10WS | [-4.69; -4.69] |
|
|
| log10WS | -4.69 | Aq. Sol... | |
| log10WS | -4.69 | Estimat... | |
| logPoct/wat | 4.080 | Crippen Calculated Property | |
| McVol | 201.470 | ml/mol | McGowan Calculated Property |
| Pc | 1707.53 | kPa | Joback Calculated Property |
| Inp | [256.90; 1533.00] |
|
|
| Inp | 1514.90 | NIST | |
| Inp | 1510.00 | NIST | |
| Inp | 1518.00 | NIST | |
| Inp | 1508.00 | NIST | |
| Inp | 1513.00 | NIST | |
| Inp | 1513.00 | NIST | |
| Inp | 1527.00 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1527.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | 1527.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1505.00 | NIST | |
| Inp | 1506.00 | NIST | |
| Inp | 1506.00 | NIST | |
| Inp | 1506.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | 1524.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1527.00 | NIST | |
| Inp | 1513.00 | NIST | |
| Inp | 1521.30 | NIST | |
| Inp | 1521.70 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1527.00 | NIST | |
| Inp | 1514.00 | NIST | |
| Inp | 1506.00 | NIST | |
| Inp | 1503.00 | NIST | |
| Inp | 1501.00 | NIST | |
| Inp | 1523.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1526.80 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1521.00 | NIST | |
| Inp | 1510.00 | NIST | |
| Inp | 1533.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1508.00 | NIST | |
| Inp | 1508.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | 1505.00 | NIST | |
| Inp | 1506.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | 1510.00 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1532.00 | NIST | |
| Inp | 1532.00 | NIST | |
| Inp | 1508.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1521.00 | NIST | |
| Inp | 1528.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1528.00 | NIST | |
| Inp | 1531.00 | NIST | |
| Inp | 1517.00 | NIST | |
| Inp | 1510.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | Outlier 258.35 | NIST | |
| Inp | Outlier 260.37 | NIST | |
| Inp | Outlier 265.90 | NIST | |
| Inp | Outlier 265.80 | NIST | |
| Inp | Outlier 265.90 | NIST | |
| Inp | Outlier 256.90 | NIST | |
| Inp | Outlier 260.05 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1528.00 | NIST | |
| Inp | 1501.00 | NIST | |
| Inp | 1521.00 | NIST | |
| Inp | 1508.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1514.90 | NIST | |
| Inp | 1513.00 | NIST | |
| Inp | 1521.30 | NIST | |
| Inp | 1506.00 | NIST | |
| I | [1770.00; 1834.00] |
|
|
| I | 1802.00 | NIST | |
| I | Outlier 1834.00 | NIST | |
| I | Outlier 1770.00 | NIST | |
| I | 1798.00 | NIST | |
| I | 1805.90 | NIST | |
| I | 1807.10 | NIST | |
| I | 1813.00 | NIST | |
| I | 1784.90 | NIST | |
| I | 1801.50 | NIST | |
| I | 1806.70 | NIST | |
| I | 1819.70 | NIST | |
| I | 1785.00 | NIST | |
| I | 1801.00 | NIST | |
| I | 1800.00 | NIST | |
| I | 1813.00 | NIST | |
| I | 1785.00 | NIST | |
| I | 1812.00 | NIST | |
| I | 1805.00 | NIST | |
| I | 1810.00 | NIST | |
| I | 1804.00 | NIST | |
| I | 1800.00 | NIST | |
| I | 1804.00 | NIST | |
| I | 1793.00 | NIST | |
| I | 1808.00 | NIST | |
| I | 1806.00 | NIST | |
| I | Outlier 1770.00 | NIST | |
| I | 1814.00 | NIST | |
| I | 1814.00 | NIST | |
| I | 1791.00 | NIST | |
| I | 1808.00 | NIST | |
| I | 1811.00 | NIST | |
| I | 1804.00 | NIST | |
| I | 1793.00 | NIST | |
| I | 1809.00 | NIST | |
| I | 1793.00 | NIST | |
| I | 1785.00 | NIST | |
| I | 1815.00 | NIST | |
| I | 1800.00 | NIST | |
| I | 1800.00 | NIST | |
| I | 1804.00 | NIST | |
| I | 1815.00 | NIST | |
| I | 1802.00 | NIST | |
| I | 1807.10 | NIST | |
| I | 1819.70 | NIST | |
| I | 1808.00 | NIST | |
| I | 1791.00 | NIST | |
| I | 1785.00 | NIST | |
| Tboil | 540.00 | K | KDB |
| Tc | [712.00; 712.15] | K |
|
| Tc | 712.00 | K | KDB |
| Tc | 712.15 ± 3.00 | K | NIST |
| Tfus | [278.00; 278.45] | K |
|
| Tfus | 278.25 | K | Aq. Sol... |
| Tfus | 278.30 | K | KDB |
| Tfus | 278.45 ± 0.35 | K | NIST |
| Tfus | 278.00 ± 0.05 | K | NIST |
| Vc | 0.787 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [514.80; 603.14] | J/mol×K | [573.13; 741.92] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 520 540 560 580 600 600 650 700 | ||||
| Cp,gas | 514.80 | J/mol×K | 573.13 | Joback Calculated Property |
| Cp,gas | 531.11 | J/mol×K | 601.26 | Joback Calculated Property |
| Cp,gas | 546.77 | J/mol×K | 629.39 | Joback Calculated Property |
| Cp,gas | 561.79 | J/mol×K | 657.52 | Joback Calculated Property |
| Cp,gas | 576.19 | J/mol×K | 685.66 | Joback Calculated Property |
| Cp,gas | 589.97 | J/mol×K | 713.79 | Joback Calculated Property |
| Cp,gas | 603.14 | J/mol×K | 741.92 | Joback Calculated Property |
| Cp,liquid | [449.00; 486.80] | J/mol×K | [303.15; 373.15] |
|
|
T(K) Liquid phase heat capacity (J/mol×K) 450 460 470 480 490 320 340 360 | ||||
| Cp,liquid | 449.00 | J/mol×K | 303.15 | Heat ca... |
| Cp,liquid | 452.80 | J/mol×K | 313.15 | Heat ca... |
| Cp,liquid | 457.40 | J/mol×K | 323.15 | Heat ca... |
| Cp,liquid | 462.60 | J/mol×K | 333.15 | Heat ca... |
| Cp,liquid | 468.40 | J/mol×K | 343.15 | Heat ca... |
| Cp,liquid | 474.50 | J/mol×K | 353.15 | Heat ca... |
| Cp,liquid | 480.70 | J/mol×K | 363.15 | Heat ca... |
| Cp,liquid | 486.80 | J/mol×K | 373.15 | Heat ca... |
| η | [0.0011002; 0.0040678] | Pa×s | [283.15; 353.15] |
|
|
T(K) Dynamic viscosity (Pa×s) 1.00e-3 1.50e-3 2.00e-3 2.50e-3 3.00e-3 3.50e-3 4.00e-3 300 320 340 | ||||
| η | 0.0040678 | Pa×s | 283.15 | Densiti... |
| η | 0.0035771 | Pa×s | 288.15 | Densiti... |
| η | 0.0030960 | Pa×s | 293.15 | Group C... |
| η | 0.0031668 | Pa×s | 293.15 | Densiti... |
| η | 0.0028237 | Pa×s | 298.15 | Densiti... |
| η | 0.0025356 | Pa×s | 303.15 | Densiti... |
| η | 0.0024750 | Pa×s | 303.15 | Group C... |
| η | 0.0022893 | Pa×s | 308.15 | Densiti... |
| η | 0.0020776 | Pa×s | 313.15 | Densiti... |
| η | 0.0020440 | Pa×s | 313.15 | Group C... |
| η | 0.0018944 | Pa×s | 318.15 | Densiti... |
| η | 0.0016430 | Pa×s | 323.15 | Group C... |
| η | 0.0017347 | Pa×s | 323.15 | Densiti... |
| η | 0.0015948 | Pa×s | 328.15 | Densiti... |
| η | 0.0013830 | Pa×s | 333.15 | Group C... |
| η | 0.0014714 | Pa×s | 333.15 | Densiti... |
| η | 0.0013621 | Pa×s | 338.15 | Densiti... |
| η | 0.0012651 | Pa×s | 343.15 | Densiti... |
| η | 0.0011730 | Pa×s | 343.15 | Group C... |
| η | 0.0011781 | Pa×s | 348.15 | Densiti... |
| η | 0.0011002 | Pa×s | 353.15 | Densiti... |
| ΔsubH | 121.80 ± 2.10 | kJ/mol | 267.50 | NIST |
| ΔvapH | [53.30; 83.60] | kJ/mol | [293.00; 498.00] |
|
|
T(K) Enthalpy of vaporization at a given temperature (kJ/mol) 55 60 65 70 75 80 85 300 400 500 | ||||
| ΔvapH | 80.80 | kJ/mol | 293.00 | NIST |
| ΔvapH | 69.33 | kJ/mol | 293.00 | NIST |
| ΔvapH | 75.80 | kJ/mol | 298.15 | the vap... |
| ΔvapH | 83.60 | kJ/mol | 310.00 | NIST |
| ΔvapH | 71.40 | kJ/mol | 350.00 | NIST |
| ΔvapH | 70.70 ± 0.20 | kJ/mol | 356.00 | NIST |
| ΔvapH | 71.40 | kJ/mol | 372.50 | NIST |
| ΔvapH | 74.90 | kJ/mol | 373.50 | NIST |
| ΔvapH | 62.30 | kJ/mol | 406.00 | NIST |
| ΔvapH | 63.60 | kJ/mol | 473.50 | NIST |
| ΔvapH | 53.30 | kJ/mol | 498.00 | NIST |
| Pvap | [6.09e-03; 6.00] | kPa | [322.68; 443.30] |
|
|
T(K) Vapor pressure (kPa) 0 1 2 3 4 5 6 350 400 | ||||
| Pvap | 6.72e-03 | kPa | 322.68 | Experim... |
| Pvap | 6.09e-03 | kPa | 323.80 | Fatty a... |
| Pvap | 7.01e-03 | kPa | 325.90 | Fatty a... |
| Pvap | 8.53e-03 | kPa | 327.90 | Fatty a... |
| Pvap | 9.82e-03 | kPa | 329.90 | Fatty a... |
| Pvap | 0.01 | kPa | 331.80 | Fatty a... |
| Pvap | 0.01 | kPa | 332.79 | Experim... |
| Pvap | 0.01 | kPa | 333.90 | Fatty a... |
| Pvap | 0.02 | kPa | 335.70 | Fatty a... |
| Pvap | 0.02 | kPa | 338.70 | Fatty a... |
| Pvap | 0.02 | kPa | 340.70 | Fatty a... |
| Pvap | 0.03 | kPa | 342.08 | Experim... |
| Pvap | 0.03 | kPa | 344.10 | Fatty a... |
| Pvap | 0.03 | kPa | 345.90 | Fatty a... |
| Pvap | 0.04 | kPa | 349.30 | Fatty a... |
| Pvap | 0.05 | kPa | 351.30 | Fatty a... |
| Pvap | 0.06 | kPa | 353.15 | Isother... |
| Pvap | 0.06 | kPa | 353.19 | Experim... |
| Pvap | 0.06 | kPa | 354.40 | Fatty a... |
| Pvap | 0.07 | kPa | 356.40 | Fatty a... |
| Pvap | 0.08 | kPa | 359.60 | Fatty a... |
| Pvap | 0.10 | kPa | 361.50 | Fatty a... |
| Pvap | 0.12 | kPa | 362.53 | Experim... |
| Pvap | 0.12 | kPa | 363.15 | Isother... |
| Pvap | 0.11 | kPa | 364.70 | Fatty a... |
| Pvap | 0.13 | kPa | 366.70 | Fatty a... |
| Pvap | 0.16 | kPa | 370.00 | Fatty a... |
| Pvap | 0.18 | kPa | 371.80 | Fatty a... |
| Pvap | 0.21 | kPa | 372.57 | Experim... |
| Pvap | 0.22 | kPa | 373.15 | Isother... |
| Pvap | 0.21 | kPa | 374.70 | Fatty a... |
| Pvap | 0.26 | kPa | 378.60 | Fatty a... |
| Pvap | 0.31 | kPa | 381.70 | Fatty a... |
| Pvap | 0.38 | kPa | 382.62 | Experim... |
| Pvap | 0.39 | kPa | 383.15 | Isother... |
| Pvap | 0.41 | kPa | 386.80 | Fatty a... |
| Pvap | 0.49 | kPa | 389.60 | Fatty a... |
| Pvap | 0.53 | kPa | 391.90 | Fatty a... |
| Pvap | 0.64 | kPa | 392.73 | Experim... |
| Pvap | 0.66 | kPa | 393.15 | Isother... |
| Pvap | 0.64 | kPa | 394.90 | Fatty a... |
| Pvap | 0.69 | kPa | 397.00 | Fatty a... |
| Pvap | 0.77 | kPa | 399.20 | Fatty a... |
| Pvap | 0.90 | kPa | 401.30 | Fatty a... |
| Pvap | 1.06 | kPa | 402.73 | Experim... |
| Pvap | 1.08 | kPa | 403.15 | Isother... |
| Pvap | 1.70 | kPa | 412.79 | Experim... |
| Pvap | 1.73 | kPa | 413.15 | Isother... |
| Pvap | 2.00 | kPa | 417.53 | Isobari... |
| Pvap | 2.65 | kPa | 422.61 | Experim... |
| Pvap | 2.69 | kPa | 423.15 | Isother... |
| Pvap | 4.02 | kPa | 432.58 | Experim... |
| Pvap | 4.10 | kPa | 433.15 | Isother... |
| Pvap | 4.00 | kPa | 433.71 | Isobari... |
| Pvap | 5.92 | kPa | 442.50 | Experim... |
| Pvap | 6.00 | kPa | 443.30 | Isobari... |
| n0 | [1.40513; 1.43836] | [278.15; 358.15] |
|
|
|
T(K) Refractive Index 1.41 1.41 1.42 1.42 1.43 1.43 1.44 1.44 300 350 | ||||
| n0 | 1.43836 | 278.15 | Thermop... | |
| n0 | 1.43629 | 283.15 | Thermop... | |
| n0 | 1.43422 | 288.15 | Thermop... | |
| n0 | 1.43216 | 293.15 | Thermop... | |
| n0 | 1.43009 | 298.15 | Thermop... | |
| n0 | 1.42802 | 303.15 | Thermop... | |
| n0 | 1.42594 | 308.15 | Thermop... | |
| n0 | 1.42383 | 313.15 | Thermop... | |
| n0 | 1.42171 | 318.15 | Thermop... | |
| n0 | 1.41959 | 323.15 | Thermop... | |
| n0 | 1.41750 | 328.15 | Thermop... | |
| n0 | 1.41542 | 333.15 | Thermop... | |
| n0 | 1.41334 | 338.15 | Thermop... | |
| n0 | 1.41127 | 343.15 | Thermop... | |
| n0 | 1.40922 | 348.15 | Thermop... | |
| n0 | 1.40717 | 353.15 | Thermop... | |
| n0 | 1.40513 | 358.15 | Thermop... | |
| ρl | [829.90; 869.30] | kg/m3 | [293.15; 343.15] |
|
|
T(K) Liquid Density (kg/m3) 830 840 850 860 870 300 320 340 | ||||
| ρl | 869.22 | kg/m3 | 293.15 | Densiti... |
| ρl | 869.30 | kg/m3 | 293.15 | Measure... |
| ρl | 865.39 | kg/m3 | 298.15 | Measure... |
| ρl | 865.30 | kg/m3 | 298.15 | Densiti... |
| ρl | 861.46 | kg/m3 | 303.15 | Measure... |
| ρl | 861.37 | kg/m3 | 303.15 | Densiti... |
| ρl | 857.53 | kg/m3 | 308.15 | Measure... |
| ρl | 857.44 | kg/m3 | 308.15 | Densiti... |
| ρl | 853.61 | kg/m3 | 313.15 | Measure... |
| ρl | 853.51 | kg/m3 | 313.15 | Densiti... |
| ρl | 849.58 | kg/m3 | 318.15 | Densiti... |
| ρl | 849.69 | kg/m3 | 318.15 | Measure... |
| ρl | 845.76 | kg/m3 | 323.15 | Measure... |
| ρl | 845.65 | kg/m3 | 323.15 | Densiti... |
| ρl | 841.72 | kg/m3 | 328.15 | Densiti... |
| ρl | 837.78 | kg/m3 | 333.15 | Densiti... |
| ρl | 833.84 | kg/m3 | 338.15 | Densiti... |
| ρl | 829.90 | kg/m3 | 343.15 | Densiti... |
| λ | [0.12; 0.15] | W/m×K | [283.81; 402.69] |
|
|
T(K) Liquid thermal conductivity (W/m×K) 0.12 0.13 0.13 0.14 0.14 0.15 0.15 300 350 400 | ||||
| λ | 0.15 | W/m×K | 283.81 | Experim... |
| λ | 0.15 | W/m×K | 284.03 | Experim... |
| λ | 0.15 | W/m×K | 295.89 | Experim... |
| λ | 0.15 | W/m×K | 295.90 | Experim... |
| λ | 0.14 | W/m×K | 306.72 | Experim... |
| λ | 0.14 | W/m×K | 306.79 | Experim... |
| λ | 0.14 | W/m×K | 307.82 | Experim... |
| λ | 0.14 | W/m×K | 307.84 | Experim... |
| λ | 0.14 | W/m×K | 317.62 | Experim... |
| λ | 0.14 | W/m×K | 317.69 | Experim... |
| λ | 0.14 | W/m×K | 327.44 | Experim... |
| λ | 0.14 | W/m×K | 327.69 | Experim... |
| λ | 0.14 | W/m×K | 337.37 | Experim... |
| λ | 0.14 | W/m×K | 337.57 | Experim... |
| λ | 0.13 | W/m×K | 349.53 | Experim... |
| λ | 0.13 | W/m×K | 349.67 | Experim... |
| λ | 0.13 | W/m×K | 359.29 | Experim... |
| λ | 0.13 | W/m×K | 359.31 | Experim... |
| λ | 0.13 | W/m×K | 369.45 | Experim... |
| λ | 0.13 | W/m×K | 369.47 | Experim... |
| λ | 0.13 | W/m×K | 379.17 | Experim... |
| λ | 0.13 | W/m×K | 379.47 | Experim... |
| λ | 0.13 | W/m×K | 390.25 | Experim... |
| λ | 0.12 | W/m×K | 390.33 | Experim... |
| λ | 0.12 | W/m×K | 402.63 | Experim... |
| λ | 0.12 | W/m×K | 402.69 | Experim... |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | [414.20; 535.20] | K | [2.00; 102.00] |
|
| Tboilr | 414.20 | K | 2.00 | NIST |
| Tboilr | 535.20 | K | 102.00 | NIST |
Datasets
- Molar heat capacity at constant pressure, J/K/mol (1)
- Viscosity, Pa*s (1)
- Mass density, kg/m3 (2)
- Speed of sound, m/s (1)
Molar heat capacity at constant pressure, J/K/mol
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
| 100.00 | 313.97 | 442.60 |
| 4040.00 | 313.99 | 441.60 |
| 8070.00 | 314.06 | 439.50 |
| 12160.00 | 314.09 | 438.30 |
| 16180.00 | 314.14 | 436.90 |
| 100.00 | 323.88 | 449.50 |
| 4070.00 | 323.93 | 447.20 |
| 8060.00 | 324.01 | 445.80 |
| 12090.00 | 323.84 | 444.80 |
| 16080.00 | 323.94 | 443.30 |
| 100.00 | 333.88 | 456.40 |
| 4050.00 | 333.96 | 453.60 |
| 8050.00 | 334.00 | 452.10 |
| 12060.00 | 334.05 | 450.50 |
| 16170.00 | 334.11 | 448.00 |
| Reference | ||
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 303.04 | 110.00 | 0.0025 |
| 303.04 | 10512.00 | 0.0029 |
| 302.94 | 20178.00 | 0.0032 |
| 302.70 | 30290.00 | 0.0036 |
| 312.63 | 134.00 | 0.0021 |
| 312.61 | 10214.00 | 0.0023 |
| 312.50 | 20279.00 | 0.0026 |
| 312.33 | 30212.00 | 0.0029 |
| 331.66 | 132.00 | 0.0015 |
| 331.51 | 10354.00 | 0.0017 |
| 331.34 | 20420.00 | 0.0019 |
| 331.07 | 29762.00 | 0.0020 |
| 351.81 | 235.00 | 0.0011 |
| 351.74 | 10090.00 | 0.0013 |
| 351.57 | 20226.00 | 0.0014 |
| 351.24 | 29906.00 | 0.0015 |
| 362.23 | 2921.00 | 0.0010 |
| 361.75 | 10141.00 | 0.0011 |
| 361.60 | 19931.00 | 0.0013 |
| 361.57 | 30100.00 | 0.0014 |
| Reference | ||
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 100.00 | 283.15 | 876.58 |
| 1000.00 | 283.15 | 877.29 |
| 3000.00 | 283.15 | 879.12 |
| 5000.00 | 283.15 | 880.29 |
| 10000.00 | 283.15 | 883.41 |
| 15000.00 | 283.15 | 886.29 |
| 20000.00 | 283.15 | 889.1 |
| 25000.00 | 283.15 | 891.75 |
| 30000.00 | 283.15 | 894.31 |
| 35000.00 | 283.15 | 896.95 |
| 40000.00 | 283.15 | 899.33 |
| 50000.00 | 283.15 | 904.05 |
| 60000.00 | 283.15 | 909.85 |
| 100.00 | 293.15 | 869.3 |
| 1000.00 | 293.15 | 869.79 |
| 3000.00 | 293.15 | 871.19 |
| 5000.00 | 293.15 | 872.09 |
| 10000.00 | 293.15 | 875.46 |
| 15000.00 | 293.15 | 878.42 |
| 20000.00 | 293.15 | 881.47 |
| 25000.00 | 293.15 | 884.32 |
| 30000.00 | 293.15 | 887.1 |
| 35000.00 | 293.15 | 889.69 |
| 40000.00 | 293.15 | 892.27 |
| 50000.00 | 293.15 | 897.52 |
| 60000.00 | 293.15 | 901.95 |
| 100.00 | 303.15 | 860.98 |
| 1000.00 | 303.15 | 861.67 |
| 3000.00 | 303.15 | 863.19 |
| 5000.00 | 303.15 | 864.57 |
| 10000.00 | 303.15 | 867.78 |
| 15000.00 | 303.15 | 871.1 |
| 20000.00 | 303.15 | 874.06 |
| 25000.00 | 303.15 | 876.92 |
| 30000.00 | 303.15 | 879.85 |
| 35000.00 | 303.15 | 882.66 |
| 40000.00 | 303.15 | 885.34 |
| 50000.00 | 303.15 | 890.6 |
| 60000.00 | 303.15 | 895.49 |
| 100.00 | 313.15 | 853.31 |
| 1000.00 | 313.15 | 853.78 |
| 3000.00 | 313.15 | 855.32 |
| 5000.00 | 313.15 | 856.78 |
| 10000.00 | 313.15 | 860.3 |
| 15000.00 | 313.15 | 863.63 |
| 20000.00 | 313.15 | 866.74 |
| 25000.00 | 313.15 | 870.04 |
| 30000.00 | 313.15 | 872.94 |
| 35000.00 | 313.15 | 875.68 |
| 40000.00 | 313.15 | 878.33 |
| 50000.00 | 313.15 | 883.95 |
| 60000.00 | 313.15 | 888.91 |
| 100.00 | 323.15 | 845.42 |
| 1000.00 | 323.15 | 846.17 |
| 3000.00 | 323.15 | 847.65 |
| 5000.00 | 323.15 | 849.19 |
| 10000.00 | 323.15 | 852.91 |
| 15000.00 | 323.15 | 856.38 |
| 20000.00 | 323.15 | 859.88 |
| 25000.00 | 323.15 | 863.01 |
| 30000.00 | 323.15 | 866.2 |
| 35000.00 | 323.15 | 869.19 |
| 40000.00 | 323.15 | 872.15 |
| 50000.00 | 323.15 | 877.67 |
| 60000.00 | 323.15 | 883.06 |
| 100.00 | 333.15 | 837.89 |
| 1000.00 | 333.15 | 838.44 |
| 3000.00 | 333.15 | 840.13 |
| 5000.00 | 333.15 | 841.69 |
| 10000.00 | 333.15 | 845.49 |
| 15000.00 | 333.15 | 849.14 |
| 20000.00 | 333.15 | 852.7 |
| 25000.00 | 333.15 | 856.12 |
| 30000.00 | 333.15 | 859.27 |
| 35000.00 | 333.15 | 862.4 |
| 40000.00 | 333.15 | 865.66 |
| 50000.00 | 333.15 | 871.36 |
| 60000.00 | 333.15 | 876.77 |
| 100.00 | 343.15 | 829.64 |
| 1000.00 | 343.15 | 830.6 |
| 3000.00 | 343.15 | 832.28 |
| 5000.00 | 343.15 | 834.04 |
| 10000.00 | 343.15 | 837.93 |
| 15000.00 | 343.15 | 841.71 |
| 20000.00 | 343.15 | 845.7 |
| 25000.00 | 343.15 | 848.98 |
| 30000.00 | 343.15 | 852.48 |
| 35000.00 | 343.15 | 855.72 |
| 40000.00 | 343.15 | 858.94 |
| 50000.00 | 343.15 | 864.79 |
| 60000.00 | 343.15 | 870.31 |
| 100.00 | 353.15 | 821.96 |
| 1000.00 | 353.15 | 822.7 |
| 3000.00 | 353.15 | 824.65 |
| 5000.00 | 353.15 | 826.36 |
| 10000.00 | 353.15 | 830.59 |
| 15000.00 | 353.15 | 834.55 |
| 20000.00 | 353.15 | 838.32 |
| 25000.00 | 353.15 | 842.04 |
| 30000.00 | 353.15 | 845.62 |
| 35000.00 | 353.15 | 849.06 |
| 40000.00 | 353.15 | 853.14 |
| 50000.00 | 353.15 | 858.49 |
| 60000.00 | 353.15 | 864.35 |
| 100.00 | 363.15 | 813.95 |
| 1000.00 | 363.15 | 814.97 |
| 3000.00 | 363.15 | 816.88 |
| 5000.00 | 363.15 | 818.64 |
| 10000.00 | 363.15 | 822.93 |
| 15000.00 | 363.15 | 827.44 |
| 20000.00 | 363.15 | 831.22 |
| 25000.00 | 363.15 | 834.95 |
| 30000.00 | 363.15 | 838.64 |
| 35000.00 | 363.15 | 842.26 |
| 40000.00 | 363.15 | 845.87 |
| 50000.00 | 363.15 | 852.24 |
| 60000.00 | 363.15 | 858.43 |
| Reference | ||
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 303.10 | 100.00 | 861.8 |
| 303.11 | 3010.00 | 863.7 |
| 303.13 | 6030.00 | 865.7 |
| 303.16 | 9050.00 | 867.9 |
| 303.20 | 12030.00 | 869.8 |
| 303.20 | 15040.00 | 871.7 |
| 312.95 | 100.00 | 853.4 |
| 313.11 | 3030.00 | 855.3 |
| 313.08 | 6050.00 | 857.4 |
| 313.06 | 9040.00 | 859.2 |
| 313.12 | 12030.00 | 861.2 |
| 312.95 | 15050.00 | 863.4 |
| 323.05 | 100.00 | 845.5 |
| 323.17 | 3030.00 | 847.4 |
| 323.30 | 6050.00 | 849.3 |
| 323.33 | 9050.00 | 851.6 |
| 323.27 | 12040.00 | 853.8 |
| 323.40 | 15020.00 | 855.9 |
| 333.15 | 100.00 | 837.8 |
| 333.15 | 3040.00 | 840.3 |
| 333.15 | 6040.00 | 842.3 |
| 333.18 | 9050.00 | 844.7 |
| 333.16 | 12020.00 | 846.9 |
| 333.14 | 15030.00 | 849.0 |
| 343.18 | 100.00 | 829.4 |
| 343.22 | 3020.00 | 831.9 |
| 343.22 | 6020.00 | 833.9 |
| 343.21 | 9040.00 | 836.6 |
| 343.19 | 12060.00 | 838.5 |
| 343.19 | 15050.00 | 841.1 |
| 353.27 | 100.00 | 821.6 |
| 353.28 | 3040.00 | 824.4 |
| 353.23 | 6050.00 | 826.8 |
| 353.26 | 9030.00 | 829.5 |
| 353.18 | 12030.00 | 831.6 |
| 353.16 | 15040.00 | 834.1 |
| Reference | ||
Speed of sound, m/s
Operational condition: Frequency, MHz = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 100.00 | 1351.3 |
| 293.15 | 10000.00 | 1400.9 |
| 293.15 | 20000.00 | 1445.1 |
| 293.15 | 30000.00 | 1486.4 |
| 293.15 | 40000.00 | 1526.9 |
| 293.15 | 50000.00 | 1563.8 |
| 293.15 | 60000.00 | 1600.0 |
| 293.15 | 70000.00 | 1628.6 |
| 293.15 | 80000.00 | 1660.5 |
| 293.15 | 90000.00 | 1690.9 |
| 313.15 | 100.00 | 1276.4 |
| 313.15 | 10000.00 | 1328.0 |
| 313.15 | 20000.00 | 1375.3 |
| 313.15 | 30000.00 | 1420.0 |
| 313.15 | 40000.00 | 1461.6 |
| 313.15 | 50000.00 | 1500.9 |
| 313.15 | 60000.00 | 1537.0 |
| 313.15 | 70000.00 | 1573.3 |
| 313.15 | 80000.00 | 1607.4 |
| 313.15 | 90000.00 | 1637.8 |
| 313.15 | 100000.00 | 1671.1 |
| 313.15 | 120000.00 | 1728.6 |
| 313.15 | 140000.00 | 1784.4 |
| 333.15 | 100.00 | 1205.5 |
| 333.15 | 10000.00 | 1259.6 |
| 333.15 | 20000.00 | 1311.0 |
| 333.15 | 30000.00 | 1357.5 |
| 333.15 | 40000.00 | 1401.0 |
| 333.15 | 50000.00 | 1441.3 |
| 333.15 | 60000.00 | 1480.9 |
| 333.15 | 70000.00 | 1515.7 |
| 333.15 | 80000.00 | 1550.8 |
| 333.15 | 90000.00 | 1585.9 |
| 333.15 | 100000.00 | 1621.9 |
| 333.15 | 120000.00 | 1682.0 |
| 333.15 | 140000.00 | 1739.2 |
| 333.15 | 160000.00 | 1791.8 |
| 333.15 | 180000.00 | 1843.5 |
| 333.15 | 200000.00 | 1893.2 |
| 353.15 | 100.00 | 1133.5 |
| 353.15 | 10000.00 | 1192.2 |
| 353.15 | 20000.00 | 1247.2 |
| 353.15 | 30000.00 | 1295.9 |
| 353.15 | 40000.00 | 1342.5 |
| 353.15 | 50000.00 | 1386.1 |
| 353.15 | 60000.00 | 1426.2 |
| 353.15 | 70000.00 | 1463.8 |
| 353.15 | 80000.00 | 1500.1 |
| 353.15 | 90000.00 | 1534.8 |
| 353.15 | 100000.00 | 1568.3 |
| 353.15 | 120000.00 | 1632.8 |
| 353.15 | 140000.00 | 1690.8 |
| 353.15 | 160000.00 | 1744.4 |
| 353.15 | 180000.00 | 1802.7 |
| 353.15 | 200000.00 | 1851.2 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.66] | kPa | [409.00; 565.34] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.55217e+01 | |||
| Coefficient B | -4.84033e+03 | |||
| Coefficient C | -9.12700e+01 | |||
| Temperature range, min. | 409.00 | |||
| Temperature range, max. | 565.34 | |||
|
T(K) Vapor pressure (kPa) 0 50 100 150 200 450 500 550 | ||||
| Pvap | 1.33 | kPa | 409.00 | Calculated Property |
| Pvap | 2.94 | kPa | 426.37 | Calculated Property |
| Pvap | 5.98 | kPa | 443.74 | Calculated Property |
| Pvap | 11.41 | kPa | 461.11 | Calculated Property |
| Pvap | 20.52 | kPa | 478.48 | Calculated Property |
| Pvap | 35.09 | kPa | 495.86 | Calculated Property |
| Pvap | 57.43 | kPa | 513.23 | Calculated Property |
| Pvap | 90.39 | kPa | 530.60 | Calculated Property |
| Pvap | 137.44 | kPa | 547.97 | Calculated Property |
| Pvap | 202.66 | kPa | 565.34 | Calculated Property |
| Pvap | [5.30e-05; 1771.68] | kPa | [278.15; 712.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 1.80226e+02 | |||
| Coefficient B | -1.60241e+04 | |||
| Coefficient C | -2.36787e+01 | |||
| Coefficient D | 1.04209e-05 | |||
| Temperature range, min. | 278.15 | |||
| Temperature range, max. | 712.00 | |||
|
T(K) Vapor pressure (kPa) 0 500 1000 1500 400 600 | ||||
| Pvap | 5.30e-05 | kPa | 278.15 | Calculated Property |
| Pvap | 8.10e-03 | kPa | 326.36 | Calculated Property |
| Pvap | 0.24 | kPa | 374.56 | Calculated Property |
| Pvap | 2.73 | kPa | 422.77 | Calculated Property |
| Pvap | 16.06 | kPa | 470.97 | Calculated Property |
| Pvap | 61.91 | kPa | 519.18 | Calculated Property |
| Pvap | 179.71 | kPa | 567.38 | Calculated Property |
| Pvap | 431.09 | kPa | 615.59 | Calculated Property |
| Pvap | 910.66 | kPa | 663.79 | Calculated Property |
| Pvap | 1771.68 | kPa | 712.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Dodecanoic acid, methyl ester.
Mixtures
- Dodecanoic acid, methyl ester + Decanoic acid, methyl ester
- Dodecanoic acid, methyl ester + Cyclohexane, methyl-
- Dodecanoic acid, methyl ester + Tetradecane
- Dodecanoic acid, methyl ester + 4,7-Methano-1H-indene, octahydro-
- Cyclohexane, (1-methylethyl)- + Dodecanoic acid, methyl ester
- Cyclohexane, (1-methylethyl)- + Dodecanoic acid, methyl ester + 4,7-Methano-1H-indene, octahydro-
- Dodecanoic acid, methyl ester + Methyl Alcohol
- Ethane + Dodecanoic acid, methyl ester
- Dodecanoic acid, methyl ester + Glycerin + Methyl Alcohol
- 1-Propanol + Dodecanoic acid, methyl ester
- Dodecanoic acid, methyl ester + 1-Butanol
- Dodecanoic acid, methyl ester + 1-Pentanol
- Dodecanoic acid, methyl ester + Octanoic acid, ethyl ester
- Ethanol + Dodecanoic acid, methyl ester + Glycerin
- Dodecanoic acid, methyl ester + Glycerin + Water
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Measurement and correlation of vapor liquid equilibria for methanol + methyl laurate and methanol + methyl myristate systems near critical temperature of methanol
- Phase behaviour of high molecular mass methyl esters in supercritical ethane
- Measurement and correlation of ternary vapor-liquid equilibria for methanol + glycerol + fatty acid methyl ester (methyl laurate, methyl myristate, methyl palmitate) systems at elevated temperatures and pressures
- Experimental vapor pressures (from 1 Pa to 100 kPa) of six saturated Fatty Acid Methyl Esters (FAMEs): Methyl hexanoate, methyl octanoate, methyl decanoate, methyl dodecanoate, methyl tetradecanoate and methyl hexadecanoate
- High-pressure liquid densities and derived thermodynamic properties for methyl laurate and ethyl laurate
- Isobaric vapor-liquid equilibrium for binary system of methyl caprate + methyl laurate at 2, 4 and 6 kPa
- Measurement of speed of sound, density compressibility and viscosity in liquid methyl laurate and ethyl laurate up to 200 MPa by using acoustic wave sensors
- Experimental studies on the liquid thermal conductivity of three saturated fatty acid methyl esters components of biodiesel
- Heat capacities and thermal diffusivities of some n-alkanoic acid methyl esters
- Fatty acids methyl esters: Complementary measurements and comprehensive analysis of vaporization thermodynamics
- Thermophysical properties of fatty acid methyl and ethyl esters
- Liquid viscosities for methyl hexanoate, methyl heptanoate, methyl caprylate, and methyl nonanoate at high pressures
- Measurement and correlation of density and viscosity of binary mixtures of fatty acid (methyl esters + methylcyclohexane)
- Experimental studies on the thermal conductivity of methyl laurate component of biodiesel with three alcohols
- the vaporization enthaplies and vapor pressures of a series of unstaurated fatty acid methyl esters by correlation gas chromatography
- Isobaric molar heat capacities of binary mixtures containing methyl caprate and methyl laurate at pressures up to 16.2 MPa
- Measurement and correlation of viscosities and densities of methyl dodecanoate and ethyl dodecanoate at elevated pressures
- Liquid Liquid Equilibrium for the Ternary System of Methyl Laurate/Methyl Myristate + Ethanol + Glycerol at 318.15 and 333.15 K
- Isothermal Vapor Pressures of Three Binary Systems: n-Tetradecane + Methyl Dodecanoate, Methyl Tetradecanoate, or Methyl Hexadecanoate between 353.15 and 453.15 K
- Densities and Viscosities of Mixtures of Methyl Dodecanoate + Ethyl Octanoate at Pressures up to 15 MPa
- Densities and Viscosities for the Ternary Mixtures of exo-Tetrahydrodicyclopentadiene (1) + Isopropylcyclohexane (2) + Methyl Laurate (3) and Corresponding Binaries
- Heat Capacity Measurements of 13 Methyl Esters of n-Carboxylic Acids from Methyloctanoate to Methyleicosanoate between 5 K and 350 K
- Densities and Viscosities of Fatty Acid Methyl and Ethyl Esters
- Article Ternary Liquid Liquid Equilibrium of Biodiesel Compounds for Systems Consisting of a Methyl Ester + Glycerin + Water
- Group Contribution Model for Predicting Viscosity of Fatty Compounds
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.