- InChI
- InChI=1S/C4H8O3/c1-3(5)4(6)7-2/h3,5H,1-2H3
- InChI Key
- LPEKGGXMPWTOCB-UHFFFAOYSA-N
- Formula
- C4H8O3
- SMILES
- COC(=O)C(C)O
- Molecular Weight1
- 104.10
- CAS
- 547-64-8
- Other Names
-
- (.+-.)-methyl 2-hydroxypropanoate
- (.+-.)-methyl 2-hydroxypropionate
- (.+-.)-methyl lactate
- 2-hydroxypropanoic acid methyl ester
- Propanoic acid, 2-hydroxy, methyl ester
- lactic acid methyl ester
- lactic acid, methyl ester
- methyl .alpha.-hydroxypropionate
- methyl 2-hydroxypropionate
- methyl lactate
- propanoic acid, 2-hydroxy-, methyl ester
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρl : Liquid Density (kg/m3).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔfG° | -390.38 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -528.20 | kJ/mol | Joback Calculated Property |
| ΔfusH° | 9.47 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 49.94 | kJ/mol | Joback Calculated Property |
| log10WS | 0.27 | Crippen Calculated Property | |
| logPoct/wat | -0.460 | Crippen Calculated Property | |
| McVol | 80.530 | ml/mol | McGowan Calculated Property |
| Pc | 4717.12 | kPa | Joback Calculated Property |
| Tboil | [417.00; 417.00] | K |
|
| Tboil | 417.00 ± 0.50 | K | NIST |
| Tboil | 417.00 ± 0.50 | K | NIST |
| Tboil | 417.00 ± 0.50 | K | NIST |
| Tc | 636.26 | K | Joback Calculated Property |
| Tfus | 252.82 | K | Joback Calculated Property |
| Vc | 0.296 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [166.01; 203.08] | J/mol×K | [458.95; 636.26] |
|
| Cp,gas | 166.01 | J/mol×K | 458.95 | Joback Calculated Property |
| Cp,gas | 172.74 | J/mol×K | 488.50 | Joback Calculated Property |
| Cp,gas | 179.25 | J/mol×K | 518.05 | Joback Calculated Property |
| Cp,gas | 185.54 | J/mol×K | 547.60 | Joback Calculated Property |
| Cp,gas | 191.62 | J/mol×K | 577.16 | Joback Calculated Property |
| Cp,gas | 197.46 | J/mol×K | 606.71 | Joback Calculated Property |
| Cp,gas | 203.08 | J/mol×K | 636.26 | Joback Calculated Property |
| η | [0.0002093; 0.0309613] | Pa×s | [252.82; 458.95] |
|
| η | 0.0309613 | Pa×s | 252.82 | Joback Calculated Property |
| η | 0.0081807 | Pa×s | 287.18 | Joback Calculated Property |
| η | 0.0028726 | Pa×s | 321.53 | Joback Calculated Property |
| η | 0.0012346 | Pa×s | 355.88 | Joback Calculated Property |
| η | 0.0006157 | Pa×s | 390.24 | Joback Calculated Property |
| η | 0.0003436 | Pa×s | 424.59 | Joback Calculated Property |
| η | 0.0002093 | Pa×s | 458.95 | Joback Calculated Property |
| ΔvapH | 44.70 | kJ/mol | 365.50 | NIST |
| Pvap | [0.17; 0.87] | kPa | [283.15; 303.15] |
|
| Pvap | 0.17 | kPa | 283.15 | Isother... |
| Pvap | 0.43 | kPa | 293.15 | Isother... |
| Pvap | 0.87 | kPa | 303.15 | Isother... |
| ρl | [1041.83; 1109.61] | kg/m3 | [278.15; 338.15] |
|
| ρl | 1109.61 | kg/m3 | 278.15 | Thermop... |
| ρl | 1106.86 | kg/m3 | 280.65 | Thermop... |
| ρl | 1104.11 | kg/m3 | 283.15 | Thermop... |
| ρl | 1101.34 | kg/m3 | 285.65 | Thermop... |
| ρl | 1098.57 | kg/m3 | 288.15 | Thermop... |
| ρl | 1095.79 | kg/m3 | 290.65 | Thermop... |
| ρl | 1093.01 | kg/m3 | 293.15 | Thermop... |
| ρl | 1090.23 | kg/m3 | 295.65 | Thermop... |
| ρl | 1087.43 | kg/m3 | 298.15 | Self-ag... |
| ρl | 1087.43 | kg/m3 | 298.15 | Thermop... |
| ρl | 1084.64 | kg/m3 | 300.65 | Thermop... |
| ρl | 1081.83 | kg/m3 | 303.15 | Thermop... |
| ρl | 1079.02 | kg/m3 | 305.65 | Thermop... |
| ρl | 1076.20 | kg/m3 | 308.15 | Thermop... |
| ρl | 1073.38 | kg/m3 | 310.65 | Thermop... |
| ρl | 1070.55 | kg/m3 | 313.15 | Thermop... |
| ρl | 1067.71 | kg/m3 | 315.65 | Thermop... |
| ρl | 1064.86 | kg/m3 | 318.15 | Thermop... |
| ρl | 1062.01 | kg/m3 | 320.65 | Thermop... |
| ρl | 1059.15 | kg/m3 | 323.15 | Thermop... |
| ρl | 1056.28 | kg/m3 | 325.65 | Thermop... |
| ρl | 1053.40 | kg/m3 | 328.15 | Thermop... |
| ρl | 1050.52 | kg/m3 | 330.65 | Thermop... |
| ρl | 1047.63 | kg/m3 | 333.15 | Thermop... |
| ρl | 1044.73 | kg/m3 | 335.65 | Thermop... |
| ρl | 1041.83 | kg/m3 | 338.15 | Thermop... |
Datasets
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 100.00 | 1104.41 |
| 288.15 | 100.00 | 1098.86 |
| 293.15 | 100.00 | 1093.31 |
| 298.15 | 100.00 | 1087.76 |
| 303.15 | 100.00 | 1082.13 |
| 308.15 | 100.00 | 1076.53 |
| 313.15 | 100.00 | 1070.85 |
| 318.15 | 100.00 | 1065.11 |
| 323.15 | 100.00 | 1059.39 |
| 328.15 | 100.00 | 1053.63 |
| 333.15 | 100.00 | 1047.83 |
| 338.15 | 100.00 | 1042.0 |
| 283.15 | 2500.00 | 1106.0 |
| 288.15 | 2500.00 | 1100.48 |
| 293.15 | 2500.00 | 1094.99 |
| 298.15 | 2500.00 | 1089.42 |
| 303.15 | 2500.00 | 1083.92 |
| 308.15 | 2500.00 | 1078.32 |
| 313.15 | 2500.00 | 1072.76 |
| 318.15 | 2500.00 | 1067.04 |
| 323.15 | 2500.00 | 1061.4 |
| 328.15 | 2500.00 | 1055.7 |
| 333.15 | 2500.00 | 1049.97 |
| 338.15 | 2500.00 | 1044.15 |
| 283.15 | 5000.00 | 1107.57 |
| 288.15 | 5000.00 | 1102.13 |
| 293.15 | 5000.00 | 1096.72 |
| 298.15 | 5000.00 | 1091.21 |
| 303.15 | 5000.00 | 1085.75 |
| 308.15 | 5000.00 | 1080.19 |
| 313.15 | 5000.00 | 1074.65 |
| 318.15 | 5000.00 | 1068.97 |
| 323.15 | 5000.00 | 1063.43 |
| 328.15 | 5000.00 | 1057.77 |
| 333.15 | 5000.00 | 1052.16 |
| 338.15 | 5000.00 | 1046.35 |
| 283.15 | 7500.00 | 1109.14 |
| 288.15 | 7500.00 | 1103.77 |
| 293.15 | 7500.00 | 1098.35 |
| 298.15 | 7500.00 | 1092.88 |
| 303.15 | 7500.00 | 1087.5 |
| 308.15 | 7500.00 | 1082.0 |
| 313.15 | 7500.00 | 1076.52 |
| 318.15 | 7500.00 | 1070.94 |
| 323.15 | 7500.00 | 1065.44 |
| 328.15 | 7500.00 | 1059.74 |
| 333.15 | 7500.00 | 1054.23 |
| 338.15 | 7500.00 | 1048.52 |
| 283.15 | 10000.00 | 1110.68 |
| 288.15 | 10000.00 | 1105.31 |
| 293.15 | 10000.00 | 1099.92 |
| 298.15 | 10000.00 | 1094.57 |
| 303.15 | 10000.00 | 1089.23 |
| 308.15 | 10000.00 | 1083.79 |
| 313.15 | 10000.00 | 1078.39 |
| 318.15 | 10000.00 | 1072.77 |
| 323.15 | 10000.00 | 1067.34 |
| 328.15 | 10000.00 | 1061.8 |
| 333.15 | 10000.00 | 1056.23 |
| 338.15 | 10000.00 | 1050.63 |
| 283.15 | 20000.00 | 1116.59 |
| 288.15 | 20000.00 | 1111.55 |
| 293.15 | 20000.00 | 1106.2 |
| 298.15 | 20000.00 | 1101.03 |
| 303.15 | 20000.00 | 1095.82 |
| 308.15 | 20000.00 | 1090.68 |
| 313.15 | 20000.00 | 1085.28 |
| 318.15 | 20000.00 | 1080.09 |
| 323.15 | 20000.00 | 1074.67 |
| 328.15 | 20000.00 | 1069.41 |
| 333.15 | 20000.00 | 1064.05 |
| 338.15 | 20000.00 | 1058.63 |
| 283.15 | 30000.00 | 1122.23 |
| 288.15 | 30000.00 | 1117.27 |
| 293.15 | 30000.00 | 1112.08 |
| 298.15 | 30000.00 | 1107.23 |
| 303.15 | 30000.00 | 1101.97 |
| 308.15 | 30000.00 | 1097.03 |
| 313.15 | 30000.00 | 1091.84 |
| 318.15 | 30000.00 | 1086.77 |
| 323.15 | 30000.00 | 1081.41 |
| 328.15 | 30000.00 | 1076.5 |
| 333.15 | 30000.00 | 1071.33 |
| 338.15 | 30000.00 | 1066.13 |
| 283.15 | 40000.00 | 1127.45 |
| 288.15 | 40000.00 | 1122.78 |
| 293.15 | 40000.00 | 1117.65 |
| 298.15 | 40000.00 | 1112.83 |
| 303.15 | 40000.00 | 1107.9 |
| 308.15 | 40000.00 | 1102.99 |
| 313.15 | 40000.00 | 1097.99 |
| 318.15 | 40000.00 | 1093.08 |
| 323.15 | 40000.00 | 1088.0 |
| 328.15 | 40000.00 | 1083.15 |
| 333.15 | 40000.00 | 1078.01 |
| 338.15 | 40000.00 | 1073.12 |
| 283.15 | 50000.00 | 1132.48 |
| 288.15 | 50000.00 | 1127.98 |
| 293.15 | 50000.00 | 1122.93 |
| 298.15 | 50000.00 | 1118.24 |
| 303.15 | 50000.00 | 1113.44 |
| 308.15 | 50000.00 | 1108.63 |
| 313.15 | 50000.00 | 1103.74 |
| 318.15 | 50000.00 | 1098.93 |
| 323.15 | 50000.00 | 1094.04 |
| 328.15 | 50000.00 | 1089.4 |
| 333.15 | 50000.00 | 1084.39 |
| 338.15 | 50000.00 | 1079.74 |
| 283.15 | 60000.00 | 1137.4 |
| 288.15 | 60000.00 | 1132.78 |
| 293.15 | 60000.00 | 1128.01 |
| 298.15 | 60000.00 | 1123.43 |
| 303.15 | 60000.00 | 1118.66 |
| 308.15 | 60000.00 | 1114.02 |
| 313.15 | 60000.00 | 1109.24 |
| 318.15 | 60000.00 | 1104.49 |
| 323.15 | 60000.00 | 1099.76 |
| 328.15 | 60000.00 | 1095.07 |
| 333.15 | 60000.00 | 1090.37 |
| 338.15 | 60000.00 | 1085.76 |
| Reference | ||
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 100.00 | 1087.35 |
| Reference | ||
Similar Compounds
Find more compounds similar to methyl 2-hydroxypropanoate.
Mixtures
- methyl 2-hydroxypropanoate + Water
- methyl 2-hydroxypropanoate + Methyl Alcohol
- methyl 2-hydroxypropanoate + Ethanol
- 1-Propanol + methyl 2-hydroxypropanoate
- methyl 2-hydroxypropanoate + 1-Butanol
- Carbon dioxide + methyl 2-hydroxypropanoate
Sources
- Crippen Method
- Crippen Method
- The pqT behaviour of the lactate family
- Self-aggregation of liquids from biomass in aqueous solution
- Thermodynamic behaviour of alkyl lactate-alkanol systems
- Thermophysical Properties of Lactates
- Isothermal Vapor-Liquid Equilibrium, Excess Enthalpy Data and Activity Coefficients at Infinite Dilution for the Binary System Water + Methyl Lactate
- High-Pressure Phase Behavior of Methyl Lactate and Ethyl Lactate in Supercritical Carbon Dioxide
- Joback Method
- McGowan Method
- NIST Webbook
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.