- Name
- methyl 2-hydroxypropanoate
- InChI
- InChI=1S/C4H8O3/c1-3(5)4(6)7-2/h3,5H,1-2H3
- InChI Key
- LPEKGGXMPWTOCB-UHFFFAOYSA-N
- Formula
- C4H8O3
- SMILES
- COC(=O)C(C)O
- Mol. Weight (g/mol)
- 104.10
- CAS
- 547-64-8
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- Pvap - Vapor or sublimation pressure, kPa (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 14100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 303.15 | 0.0632 | 0.0167 |
| 303.15 | 0.1202 | 0.0149 |
| 303.15 | 0.2190 | -0.0018 |
| 303.15 | 0.3016 | -0.0193 |
| 303.15 | 0.3718 | -0.0362 |
| 303.15 | 0.4321 | -0.0560 |
| 303.15 | 0.5083 | -0.0926 |
| 303.15 | 0.5711 | -0.1235 |
| 303.15 | 0.6397 | -0.1607 |
| 303.15 | 0.7195 | -0.2061 |
| 303.15 | 0.7803 | -0.2395 |
| 303.15 | 0.8419 | -0.2686 |
| 303.15 | 0.8988 | -0.2709 |
| 303.15 | 0.9411 | -0.2309 |
| 303.15 | 0.9796 | -0.1205 |
| 333.15 | 0.0632 | -0.0165 |
| 333.15 | 0.1202 | -0.0388 |
| 333.15 | 0.2190 | -0.0884 |
| 333.15 | 0.3016 | -0.1204 |
| 333.15 | 0.3718 | -0.1442 |
| 333.15 | 0.4321 | -0.1666 |
| 333.15 | 0.5083 | -0.2006 |
| 333.15 | 0.5711 | -0.2308 |
| 333.15 | 0.6397 | -0.2691 |
| 333.15 | 0.7195 | -0.3164 |
| 333.15 | 0.7803 | -0.3512 |
| 333.15 | 0.8419 | -0.3770 |
| 333.15 | 0.8988 | -0.3728 |
| 333.15 | 0.9411 | -0.3210 |
| 333.15 | 0.9796 | -0.1647 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 14100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 303.15 | 0.0632 | 0.0167 |
| 303.15 | 0.1202 | 0.0149 |
| 303.15 | 0.2190 | -0.0018 |
| 303.15 | 0.3016 | -0.0193 |
| 303.15 | 0.3718 | -0.0362 |
| 303.15 | 0.4321 | -0.0560 |
| 303.15 | 0.5083 | -0.0926 |
| 303.15 | 0.5711 | -0.1235 |
| 303.15 | 0.6397 | -0.1607 |
| 303.15 | 0.7195 | -0.2061 |
| 303.15 | 0.7803 | -0.2395 |
| 303.15 | 0.8419 | -0.2686 |
| 303.15 | 0.8988 | -0.2709 |
| 303.15 | 0.9411 | -0.2309 |
| 303.15 | 0.9796 | -0.1205 |
| 333.15 | 0.0632 | -0.0165 |
| 333.15 | 0.1202 | -0.0388 |
| 333.15 | 0.2190 | -0.0884 |
| 333.15 | 0.3016 | -0.1204 |
| 333.15 | 0.3718 | -0.1442 |
| 333.15 | 0.4321 | -0.1666 |
| 333.15 | 0.5083 | -0.2006 |
| 333.15 | 0.5711 | -0.2308 |
| 333.15 | 0.6397 | -0.2691 |
| 333.15 | 0.7195 | -0.3164 |
| 333.15 | 0.7803 | -0.3512 |
| 333.15 | 0.8419 | -0.3770 |
| 333.15 | 0.8988 | -0.3728 |
| 333.15 | 0.9411 | -0.3210 |
| 333.15 | 0.9796 | -0.1647 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 283.15 | 0.0000 | 0.17 |
| 283.15 | 0.0673 | 0.34 |
| 283.15 | 0.0753 | 0.36 |
| 283.15 | 0.2320 | 0.66 |
| 283.15 | 0.2701 | 0.71 |
| 283.15 | 0.3687 | 0.84 |
| 283.15 | 0.4400 | 0.91 |
| 283.15 | 0.4941 | 0.96 |
| 283.15 | 0.5570 | 1.01 |
| 283.15 | 0.6007 | 1.06 |
| 283.15 | 0.6523 | 1.08 |
| 283.15 | 0.6912 | 1.10 |
| 283.15 | 0.7292 | 1.12 |
| 283.15 | 0.7607 | 1.13 |
| 283.15 | 0.7883 | 1.15 |
| 283.15 | 0.8323 | 1.17 |
| 283.15 | 0.8648 | 1.19 |
| 283.15 | 0.8895 | 1.20 |
| 283.15 | 0.9083 | 1.21 |
| 283.15 | 0.9228 | 1.22 |
| 283.15 | 0.9341 | 1.23 |
| 293.15 | 0.0000 | 0.43 |
| 293.15 | 0.0394 | 0.63 |
| 293.15 | 0.1051 | 0.91 |
| 293.15 | 0.2561 | 1.41 |
| 293.15 | 0.3944 | 1.74 |
| 293.15 | 0.5194 | 1.97 |
| 293.15 | 0.6218 | 2.11 |
| 293.15 | 0.7066 | 2.19 |
| 293.15 | 0.7935 | 2.25 |
| 293.15 | 0.8559 | 2.29 |
| 293.15 | 0.8969 | 2.33 |
| 293.15 | 0.9257 | 2.35 |
| 293.15 | 0.9461 | 2.37 |
| 293.15 | 0.9582 | 2.38 |
| 303.15 | 0.0000 | 0.87 |
| 303.15 | 0.0399 | 1.22 |
| 303.15 | 0.1149 | 1.80 |
| 303.15 | 0.2264 | 2.49 |
| 303.15 | 0.3409 | 3.04 |
| 303.15 | 0.4659 | 3.50 |
| 303.15 | 0.5759 | 3.80 |
| 303.15 | 0.6707 | 3.99 |
| 303.15 | 0.7723 | 4.14 |
| 303.15 | 0.8438 | 4.22 |
| 303.15 | 0.8899 | 4.26 |
| 303.15 | 0.9216 | 4.29 |
| 303.15 | 0.9436 | 4.32 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 283.15 | 0.0000 | 0.17 |
| 283.15 | 0.0673 | 0.34 |
| 283.15 | 0.0753 | 0.36 |
| 283.15 | 0.2320 | 0.66 |
| 283.15 | 0.2701 | 0.71 |
| 283.15 | 0.3687 | 0.84 |
| 283.15 | 0.4400 | 0.91 |
| 283.15 | 0.4941 | 0.96 |
| 283.15 | 0.5570 | 1.01 |
| 283.15 | 0.6007 | 1.06 |
| 283.15 | 0.6523 | 1.08 |
| 283.15 | 0.6912 | 1.10 |
| 283.15 | 0.7292 | 1.12 |
| 283.15 | 0.7607 | 1.13 |
| 283.15 | 0.7883 | 1.15 |
| 283.15 | 0.8323 | 1.17 |
| 283.15 | 0.8648 | 1.19 |
| 283.15 | 0.8895 | 1.20 |
| 283.15 | 0.9083 | 1.21 |
| 283.15 | 0.9228 | 1.22 |
| 283.15 | 0.9341 | 1.23 |
| 293.15 | 0.0000 | 0.43 |
| 293.15 | 0.0394 | 0.63 |
| 293.15 | 0.1051 | 0.91 |
| 293.15 | 0.2561 | 1.41 |
| 293.15 | 0.3944 | 1.74 |
| 293.15 | 0.5194 | 1.97 |
| 293.15 | 0.6218 | 2.11 |
| 293.15 | 0.7066 | 2.19 |
| 293.15 | 0.7935 | 2.25 |
| 293.15 | 0.8559 | 2.29 |
| 293.15 | 0.8969 | 2.33 |
| 293.15 | 0.9257 | 2.35 |
| 293.15 | 0.9461 | 2.37 |
| 293.15 | 0.9582 | 2.38 |
| 303.15 | 0.0000 | 0.87 |
| 303.15 | 0.0399 | 1.22 |
| 303.15 | 0.1149 | 1.80 |
| 303.15 | 0.2264 | 2.49 |
| 303.15 | 0.3409 | 3.04 |
| 303.15 | 0.4659 | 3.50 |
| 303.15 | 0.5759 | 3.80 |
| 303.15 | 0.6707 | 3.99 |
| 303.15 | 0.7723 | 4.14 |
| 303.15 | 0.8438 | 4.22 |
| 303.15 | 0.8899 | 4.26 |
| 303.15 | 0.9216 | 4.29 |
| 303.15 | 0.9436 | 4.32 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of methyl 2-hydroxypropanoate (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0487 | 997.862 |
| 0.0568 | 997.968 |
| 0.0707 | 998.157 |
| 0.0956 | 998.501 |
| 0.1039 | 998.614 |
| 0.1117 | 998.722 |
| 0.1338 | 999.035 |
| 0.1539 | 999.294 |
| 0.2230 | 1000.237 |
| 0.3212 | 1001.553 |
| 0.4840 | 1003.64 |
| 0.7855 | 1007.523 |
| 0.9699 | 1009.784 |
| 1.1682 | 1012.118 |
| 1.3774 | 1014.504 |
| 1.5601 | 1016.483 |
| 1.7762 | 1018.699 |
| 1.938 | 1020.397 |
| 2.2371 | 1023.266 |
| 2.6316 | 1026.816 |
| 2.9412 | 1029.455 |
| 3.3223 | 1032.465 |
| 3.9063 | 1036.616 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of methyl 2-hydroxypropanoate (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0487 | 997.862 |
| 0.0568 | 997.968 |
| 0.0707 | 998.157 |
| 0.0956 | 998.501 |
| 0.1039 | 998.614 |
| 0.1117 | 998.722 |
| 0.1338 | 999.035 |
| 0.1539 | 999.294 |
| 0.2230 | 1000.237 |
| 0.3212 | 1001.553 |
| 0.4840 | 1003.64 |
| 0.7855 | 1007.523 |
| 0.9699 | 1009.784 |
| 1.1682 | 1012.118 |
| 1.3774 | 1014.504 |
| 1.5601 | 1016.483 |
| 1.7762 | 1018.699 |
| 1.938 | 1020.397 |
| 2.2371 | 1023.266 |
| 2.6316 | 1026.816 |
| 2.9412 | 1029.455 |
| 3.3223 | 1032.465 |
| 3.9063 | 1036.616 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of methyl 2-hydroxypropanoate (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0487 | 1499.0 |
| 0.0568 | 1499.54 |
| 0.0707 | 1500.43 |
| 0.0956 | 1501.24 |
| 0.1039 | 1501.63 |
| 0.1117 | 1501.97 |
| 0.1338 | 1503.12 |
| 0.1539 | 1503.95 |
| 0.2230 | 1507.78 |
| 0.3212 | 1511.7 |
| 0.4840 | 1518.16 |
| 0.7855 | 1529.04 |
| 0.9699 | 1535.26 |
| 1.1682 | 1542.09 |
| 1.3774 | 1548.69 |
| 1.5601 | 1554.22 |
| 1.7762 | 1561.86 |
| 1.938 | 1566.9 |
| 2.2371 | 1575.77 |
| 2.6316 | 1588.16 |
| 2.9412 | 1597.05 |
| 3.3223 | 1606.55 |
| 3.9063 | 1617.15 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of methyl 2-hydroxypropanoate (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0487 | 1499.0 |
| 0.0568 | 1499.54 |
| 0.0707 | 1500.43 |
| 0.0956 | 1501.24 |
| 0.1039 | 1501.63 |
| 0.1117 | 1501.97 |
| 0.1338 | 1503.12 |
| 0.1539 | 1503.95 |
| 0.2230 | 1507.78 |
| 0.3212 | 1511.7 |
| 0.4840 | 1518.16 |
| 0.7855 | 1529.04 |
| 0.9699 | 1535.26 |
| 1.1682 | 1542.09 |
| 1.3774 | 1548.69 |
| 1.5601 | 1554.22 |
| 1.7762 | 1561.86 |
| 1.938 | 1566.9 |
| 2.2371 | 1575.77 |
| 2.6316 | 1588.16 |
| 2.9412 | 1597.05 |
| 3.3223 | 1606.55 |
| 3.9063 | 1617.15 |