- InChI
- InChI=1S/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3
- InChI Key
- LZCLXQDLBQLTDK-UHFFFAOYSA-N
- Formula
- C5H10O3
- SMILES
- CCOC(=O)C(C)O
- Molecular Weight1
- 118.13
- CAS
- 97-64-3
- Other Names
-
- (+-)-ethyl 2-hydroxypropionate
- (+-)-ethyl lactate
- (.+/-.)-Ethyl lactate
- (S)-(-)-ethyl lactate
- (dl) ethyl lactate
- 2-Hydroxypropanoic acid ethyl ester
- Actylol
- Acytol
- DL-ethyl 2-hydroxypropionate
- DL-ethyl lactate
- Ethyl 2-hydroxypropionate
- Ethyl ester of lactic acid
- Ethyl lactate
- Ethyl racemic-lactate
- Ethyl «alpha»-hydroxypropionate
- Ethyl «alpha»-hydroxypropionate
- Ethylester kyseliny mlecne
- Eusolvan
- L-ethyl 2-hydroxypropanoate
- L-ethyl lactate
- L-lactic acid, ethyl ester
- Lactate d'ethyle
- Lactic acid, ethyl ester
- NSC 8850
- Solactol
- UN 1192
- ethyl 2-hydroxypropanoate
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- csound,fluid : Speed of sound in fluid (m/s).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔfG° | -381.96 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -548.84 | kJ/mol | Joback Calculated Property |
| ΔfusH° | 12.06 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 52.17 | kJ/mol | Joback Calculated Property |
| log10WS | -0.15 | Crippen Calculated Property | |
| logPoct/wat | -0.070 | Crippen Calculated Property | |
| McVol | 94.620 | ml/mol | McGowan Calculated Property |
| Pc | 4151.61 | kPa | Joback Calculated Property |
| Inp | [764.00; 836.00] |
|
|
| Inp | 803.00 | NIST | |
| Inp | 806.00 | NIST | |
| Inp | 787.00 | NIST | |
| Inp | 787.00 | NIST | |
| Inp | 787.00 | NIST | |
| Inp | 797.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 799.00 | NIST | |
| Inp | 801.00 | NIST | |
| Inp | 813.00 | NIST | |
| Inp | 815.00 | NIST | |
| Inp | 815.00 | NIST | |
| Inp | 826.00 | NIST | |
| Inp | 815.00 | NIST | |
| Inp | 789.00 | NIST | |
| Inp | 836.00 | NIST | |
| Inp | Outlier 764.00 | NIST | |
| Inp | 821.00 | NIST | |
| Inp | 832.00 | NIST | |
| Inp | 815.00 | NIST | |
| Inp | 797.00 | NIST | |
| Inp | 821.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 788.00 | NIST | |
| Inp | 798.00 | NIST | |
| Inp | 813.00 | NIST | |
| Inp | 801.00 | NIST | |
| Inp | 803.00 | NIST | |
| Inp | Outlier 764.00 | NIST | |
| Inp | 821.00 | NIST | |
| Inp | 801.00 | NIST | |
| Inp | 803.00 | NIST | |
| I | [1309.00; 1372.00] |
|
|
| I | Outlier 1309.00 | NIST | |
| I | Outlier 1312.00 | NIST | |
| I | 1340.00 | NIST | |
| I | 1352.00 | NIST | |
| I | 1353.00 | NIST | |
| I | 1342.00 | NIST | |
| I | 1329.00 | NIST | |
| I | 1333.00 | NIST | |
| I | 1333.00 | NIST | |
| I | 1345.00 | NIST | |
| I | 1347.00 | NIST | |
| I | 1347.00 | NIST | |
| I | 1325.00 | NIST | |
| I | 1341.00 | NIST | |
| I | 1339.00 | NIST | |
| I | 1316.00 | NIST | |
| I | 1317.00 | NIST | |
| I | 1353.00 | NIST | |
| I | 1353.00 | NIST | |
| I | 1347.00 | NIST | |
| I | 1331.00 | NIST | |
| I | 1353.00 | NIST | |
| I | 1353.00 | NIST | |
| I | 1339.00 | NIST | |
| I | 1353.00 | NIST | |
| I | 1372.00 | NIST | |
| I | 1356.00 | NIST | |
| I | 1362.00 | NIST | |
| I | 1338.00 | NIST | |
| I | 1334.00 | NIST | |
| I | 1334.00 | NIST | |
| I | 1334.00 | NIST | |
| I | 1349.00 | NIST | |
| I | 1371.00 | NIST | |
| I | 1349.00 | NIST | |
| I | 1349.00 | NIST | |
| I | 1356.00 | NIST | |
| I | 1362.00 | NIST | |
| I | 1331.00 | NIST | |
| I | 1337.00 | NIST | |
| I | Outlier 1312.00 | NIST | |
| I | 1367.00 | NIST | |
| I | 1355.00 | NIST | |
| I | 1341.00 | NIST | |
| I | 1334.00 | NIST | |
| I | 1339.00 | NIST | |
| I | 1353.00 | NIST | |
| I | 1354.00 | NIST | |
| I | 1353.00 | NIST | |
| I | 1356.00 | NIST | |
| I | 1348.00 | NIST | |
| I | 1363.00 | NIST | |
| I | 1353.00 | NIST | |
| I | 1363.00 | NIST | |
| I | 1348.00 | NIST | |
| I | 1348.00 | NIST | |
| I | 1321.00 | NIST | |
| I | 1363.00 | NIST | |
| I | 1341.00 | NIST | |
| I | 1349.00 | NIST | |
| I | 1364.00 | NIST | |
| I | 1348.00 | NIST | |
| I | 1334.00 | NIST | |
| I | 1338.00 | NIST | |
| I | 1353.00 | NIST | |
| I | 1338.00 | NIST | |
| I | 1371.00 | NIST | |
| I | 1339.00 | NIST | |
| I | 1330.00 | NIST | |
| I | 1356.00 | NIST | |
| I | 1358.00 | NIST | |
| I | Outlier 1312.00 | NIST | |
| I | 1342.00 | NIST | |
| I | 1347.00 | NIST | |
| I | 1316.00 | NIST | |
| I | 1353.00 | NIST | |
| I | 1340.00 | NIST | |
| I | Outlier 1309.00 | NIST | |
| Tboil | 481.83 | K | Joback Calculated Property |
| Tc | 657.66 | K | Joback Calculated Property |
| Tfus | 264.09 | K | Joback Calculated Property |
| Vc | 0.352 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [204.80; 248.43] | J/mol×K | [481.83; 657.66] |
|
| Cp,gas | 204.80 | J/mol×K | 481.83 | Joback Calculated Property |
| Cp,gas | 212.77 | J/mol×K | 511.13 | Joback Calculated Property |
| Cp,gas | 220.46 | J/mol×K | 540.44 | Joback Calculated Property |
| Cp,gas | 227.87 | J/mol×K | 569.74 | Joback Calculated Property |
| Cp,gas | 235.00 | J/mol×K | 599.05 | Joback Calculated Property |
| Cp,gas | 241.86 | J/mol×K | 628.35 | Joback Calculated Property |
| Cp,gas | 248.43 | J/mol×K | 657.66 | Joback Calculated Property |
| η | [0.0014940; 0.0023980] | Pa×s | [298.15; 318.15] |
|
| η | 0.0023980 | Pa×s | 298.15 | Densiti... |
| η | 0.0018630 | Pa×s | 308.15 | Densiti... |
| η | 0.0014940 | Pa×s | 318.15 | Densiti... |
| ΔvapH | [49.20; 51.30] | kJ/mol | [367.00; 375.50] |
|
| ΔvapH | 49.20 | kJ/mol | 367.00 | NIST |
| ΔvapH | 51.30 | kJ/mol | 375.50 | NIST |
| Pvap | [0.04; 0.69] | kPa | [274.60; 311.30] |
|
| Pvap | 0.04 | kPa | 274.60 | Renewab... |
| Pvap | 0.05 | kPa | 276.60 | Renewab... |
| Pvap | 0.07 | kPa | 279.60 | Renewab... |
| Pvap | 0.07 | kPa | 281.40 | Renewab... |
| Pvap | 0.09 | kPa | 283.60 | Renewab... |
| Pvap | 0.10 | kPa | 284.60 | Renewab... |
| Pvap | 0.10 | kPa | 285.80 | Renewab... |
| Pvap | 0.13 | kPa | 287.60 | Renewab... |
| Pvap | 0.13 | kPa | 287.60 | Renewab... |
| Pvap | 0.13 | kPa | 288.40 | Renewab... |
| Pvap | 0.15 | kPa | 290.20 | Renewab... |
| Pvap | 0.15 | kPa | 290.30 | Renewab... |
| Pvap | 0.16 | kPa | 291.10 | Renewab... |
| Pvap | 0.19 | kPa | 293.50 | Renewab... |
| Pvap | 0.24 | kPa | 296.40 | Renewab... |
| Pvap | 0.28 | kPa | 298.50 | Renewab... |
| Pvap | 0.37 | kPa | 301.50 | Renewab... |
| Pvap | 0.38 | kPa | 302.50 | Renewab... |
| Pvap | 0.45 | kPa | 304.50 | Renewab... |
| Pvap | 0.48 | kPa | 305.30 | Renewab... |
| Pvap | 0.53 | kPa | 307.20 | Renewab... |
| Pvap | 0.58 | kPa | 308.20 | Renewab... |
| Pvap | 0.63 | kPa | 310.10 | Renewab... |
| Pvap | 0.63 | kPa | 310.10 | Renewab... |
| Pvap | 0.69 | kPa | 311.30 | Renewab... |
| n0 | [1.41050; 1.41290] | [293.15; 298.15] |
|
|
| n0 | 1.41290 | 293.15 | Vapor l... | |
| n0 | 1.41050 | 298.15 | Density... | |
| n0 | 1.41057 | 298.15 | Isobari... | |
| ρl | [983.94; 1050.05] | kg/m3 | [278.15; 338.15] |
|
| ρl | 1050.05 | kg/m3 | 278.15 | Thermop... |
| ρl | 1047.37 | kg/m3 | 280.65 | Thermop... |
| ρl | 1044.68 | kg/m3 | 283.15 | Thermop... |
| ρl | 1041.96 | kg/m3 | 285.65 | Thermop... |
| ρl | 1039.26 | kg/m3 | 288.15 | Thermop... |
| ρl | 1039.28 | kg/m3 | 288.15 | Volumet... |
| ρl | 1036.54 | kg/m3 | 290.65 | Thermop... |
| ρl | 1033.82 | kg/m3 | 293.15 | Thermop... |
| ρl | 1033.84 | kg/m3 | 293.15 | Volumet... |
| ρl | 1031.09 | kg/m3 | 295.65 | Thermop... |
| ρl | 1028.39 | kg/m3 | 298.15 | Volumet... |
| ρl | 1028.08 | kg/m3 | 298.15 | Vapor-l... |
| ρl | 1028.39 | kg/m3 | 298.15 | Experim... |
| ρl | 1028.37 | kg/m3 | 298.15 | Self-ag... |
| ρl | 1028.37 | kg/m3 | 298.15 | Thermop... |
| ρl | 1028.08 | kg/m3 | 298.15 | Separat... |
| ρl | 1025.63 | kg/m3 | 300.65 | Thermop... |
| ρl | 1022.89 | kg/m3 | 303.15 | Thermop... |
| ρl | 1022.92 | kg/m3 | 303.15 | Volumet... |
| ρl | 1020.15 | kg/m3 | 305.65 | Thermop... |
| ρl | 1017.42 | kg/m3 | 308.15 | Volumet... |
| ρl | 1017.40 | kg/m3 | 308.15 | Thermop... |
| ρl | 1014.64 | kg/m3 | 310.65 | Thermop... |
| ρl | 1011.88 | kg/m3 | 313.15 | Thermop... |
| ρl | 1011.90 | kg/m3 | 313.15 | Volumet... |
| ρl | 1009.12 | kg/m3 | 315.65 | Thermop... |
| ρl | 1006.34 | kg/m3 | 318.15 | Thermop... |
| ρl | 1006.36 | kg/m3 | 318.15 | Volumet... |
| ρl | 1003.57 | kg/m3 | 320.65 | Thermop... |
| ρl | 1000.79 | kg/m3 | 323.15 | Volumet... |
| ρl | 1000.78 | kg/m3 | 323.15 | Thermop... |
| ρl | 997.99 | kg/m3 | 325.65 | Thermop... |
| ρl | 995.19 | kg/m3 | 328.15 | Thermop... |
| ρl | 992.39 | kg/m3 | 330.65 | Thermop... |
| ρl | 989.58 | kg/m3 | 333.15 | Thermop... |
| ρl | 986.76 | kg/m3 | 335.65 | Thermop... |
| ρl | 983.94 | kg/m3 | 338.15 | Thermop... |
| csound,fluid | [1206.90; 1261.10] | m/s | [303.15; 318.15] |
|
| csound,fluid | 1261.10 | m/s | 303.15 | Densiti... |
| csound,fluid | 1243.80 | m/s | 308.15 | Densiti... |
| csound,fluid | 1224.80 | m/s | 313.15 | Densiti... |
| csound,fluid | 1206.90 | m/s | 318.15 | Densiti... |
Datasets
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 100.00 | 1045.06 |
| 288.15 | 100.00 | 1039.64 |
| 293.15 | 100.00 | 1034.25 |
| 298.15 | 100.00 | 1028.78 |
| 303.15 | 100.00 | 1023.32 |
| 308.15 | 100.00 | 1017.84 |
| 313.15 | 100.00 | 1012.33 |
| 318.15 | 100.00 | 1006.72 |
| 323.15 | 100.00 | 1001.23 |
| 328.15 | 100.00 | 995.54 |
| 333.15 | 100.00 | 989.91 |
| 338.15 | 100.00 | 984.3 |
| 283.15 | 2500.00 | 1046.77 |
| 288.15 | 2500.00 | 1041.39 |
| 293.15 | 2500.00 | 1036.05 |
| 298.15 | 2500.00 | 1030.66 |
| 303.15 | 2500.00 | 1025.21 |
| 308.15 | 2500.00 | 1019.82 |
| 313.15 | 2500.00 | 1014.31 |
| 318.15 | 2500.00 | 1008.86 |
| 323.15 | 2500.00 | 1003.36 |
| 328.15 | 2500.00 | 997.8 |
| 333.15 | 2500.00 | 992.19 |
| 338.15 | 2500.00 | 986.71 |
| 283.15 | 5000.00 | 1048.51 |
| 288.15 | 5000.00 | 1043.21 |
| 293.15 | 5000.00 | 1037.86 |
| 298.15 | 5000.00 | 1032.56 |
| 303.15 | 5000.00 | 1027.24 |
| 308.15 | 5000.00 | 1021.87 |
| 313.15 | 5000.00 | 1016.42 |
| 318.15 | 5000.00 | 1011.01 |
| 323.15 | 5000.00 | 1005.56 |
| 328.15 | 5000.00 | 1000.11 |
| 333.15 | 5000.00 | 994.55 |
| 338.15 | 5000.00 | 989.18 |
| 283.15 | 7500.00 | 1050.24 |
| 288.15 | 7500.00 | 1044.99 |
| 293.15 | 7500.00 | 1039.7 |
| 298.15 | 7500.00 | 1034.43 |
| 303.15 | 7500.00 | 1029.11 |
| 308.15 | 7500.00 | 1023.84 |
| 313.15 | 7500.00 | 1018.41 |
| 318.15 | 7500.00 | 1013.1 |
| 323.15 | 7500.00 | 1007.68 |
| 328.15 | 7500.00 | 1002.34 |
| 333.15 | 7500.00 | 996.87 |
| 338.15 | 7500.00 | 991.49 |
| 283.15 | 10000.00 | 1051.88 |
| 288.15 | 10000.00 | 1046.74 |
| 293.15 | 10000.00 | 1041.5 |
| 298.15 | 10000.00 | 1036.23 |
| 303.15 | 10000.00 | 1031.0 |
| 308.15 | 10000.00 | 1025.7 |
| 313.15 | 10000.00 | 1020.39 |
| 318.15 | 10000.00 | 1015.13 |
| 323.15 | 10000.00 | 1009.78 |
| 328.15 | 10000.00 | 1004.46 |
| 333.15 | 10000.00 | 999.06 |
| 338.15 | 10000.00 | 993.65 |
| 283.15 | 20000.00 | 1058.39 |
| 288.15 | 20000.00 | 1053.28 |
| 293.15 | 20000.00 | 1048.3 |
| 298.15 | 20000.00 | 1043.21 |
| 303.15 | 20000.00 | 1038.26 |
| 308.15 | 20000.00 | 1033.08 |
| 313.15 | 20000.00 | 1027.93 |
| 318.15 | 20000.00 | 1022.87 |
| 323.15 | 20000.00 | 1017.76 |
| 328.15 | 20000.00 | 1012.65 |
| 333.15 | 20000.00 | 1007.62 |
| 338.15 | 20000.00 | 1002.34 |
| 283.15 | 30000.00 | 1064.45 |
| 288.15 | 30000.00 | 1059.46 |
| 293.15 | 30000.00 | 1054.58 |
| 298.15 | 30000.00 | 1049.76 |
| 303.15 | 30000.00 | 1044.91 |
| 308.15 | 30000.00 | 1039.92 |
| 313.15 | 30000.00 | 1034.97 |
| 318.15 | 30000.00 | 1030.04 |
| 323.15 | 30000.00 | 1025.13 |
| 328.15 | 30000.00 | 1020.17 |
| 333.15 | 30000.00 | 1015.4 |
| 338.15 | 30000.00 | 1010.27 |
| 283.15 | 40000.00 | 1070.13 |
| 288.15 | 40000.00 | 1065.24 |
| 293.15 | 40000.00 | 1060.54 |
| 298.15 | 40000.00 | 1055.69 |
| 303.15 | 40000.00 | 1051.19 |
| 308.15 | 40000.00 | 1046.28 |
| 313.15 | 40000.00 | 1041.52 |
| 318.15 | 40000.00 | 1036.74 |
| 323.15 | 40000.00 | 1031.99 |
| 328.15 | 40000.00 | 1027.16 |
| 333.15 | 40000.00 | 1022.5 |
| 338.15 | 40000.00 | 1017.75 |
| 283.15 | 50000.00 | 1075.5 |
| 288.15 | 50000.00 | 1070.74 |
| 293.15 | 50000.00 | 1066.26 |
| 298.15 | 50000.00 | 1061.53 |
| 303.15 | 50000.00 | 1056.95 |
| 308.15 | 50000.00 | 1052.19 |
| 313.15 | 50000.00 | 1047.69 |
| 318.15 | 50000.00 | 1042.96 |
| 323.15 | 50000.00 | 1038.42 |
| 328.15 | 50000.00 | 1033.75 |
| 333.15 | 50000.00 | 1029.24 |
| 338.15 | 50000.00 | 1024.55 |
| 283.15 | 60000.00 | 1080.55 |
| 288.15 | 60000.00 | 1076.04 |
| 293.15 | 60000.00 | 1071.55 |
| 298.15 | 60000.00 | 1066.96 |
| 303.15 | 60000.00 | 1062.52 |
| 308.15 | 60000.00 | 1057.98 |
| 313.15 | 60000.00 | 1053.46 |
| 318.15 | 60000.00 | 1048.96 |
| 323.15 | 60000.00 | 1044.49 |
| 328.15 | 60000.00 | 1039.99 |
| 333.15 | 60000.00 | 1035.71 |
| 338.15 | 60000.00 | 1031.04 |
| Reference | ||
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 100.00 | 1028.45 |
| Reference | ||
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 308.00 | 10000.00 | 1029.1 |
| 308.00 | 20000.00 | 1034.4 |
| 308.00 | 30000.00 | 1042.6 |
| 323.00 | 10000.00 | 1009.5 |
| 323.00 | 20000.00 | 1016.8 |
| 323.00 | 30000.00 | 1023.2 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [318.50; 450.93] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.89834e+01 | |||
| Coefficient B | -6.73793e+03 | |||
| Coefficient C | 4.18990e+01 | |||
| Temperature range, min. | 318.50 | |||
| Temperature range, max. | 450.93 | |||
| Pvap | 1.33 | kPa | 318.50 | Calculated Property |
| Pvap | 2.78 | kPa | 333.21 | Calculated Property |
| Pvap | 5.47 | kPa | 347.93 | Calculated Property |
| Pvap | 10.25 | kPa | 362.64 | Calculated Property |
| Pvap | 18.40 | kPa | 377.36 | Calculated Property |
| Pvap | 31.73 | kPa | 392.07 | Calculated Property |
| Pvap | 52.79 | kPa | 406.79 | Calculated Property |
| Pvap | 85.05 | kPa | 421.50 | Calculated Property |
| Pvap | 133.05 | kPa | 436.22 | Calculated Property |
| Pvap | 202.65 | kPa | 450.93 | Calculated Property |
Similar Compounds
Find more compounds similar to Propanoic acid, 2-hydroxy-, ethyl ester.
Mixtures
- Ethanol + Propanoic acid, 2-hydroxy-, ethyl ester
- Propylene Glycol + Propanoic acid, 2-hydroxy-, ethyl ester
- 1,3-Propanediol + Propanoic acid, 2-hydroxy-, ethyl ester
- Propanoic acid, 2-hydroxy-, ethyl ester + Tetrahydrofuran
- Tetraglyme + Propanoic acid, 2-hydroxy-, ethyl ester
- 2-Butanone + Propanoic acid, 2-hydroxy-, ethyl ester
- Toluene + Propanoic acid, 2-hydroxy-, ethyl ester
- 2-Pyrrolidinone, 1-methyl- + Propanoic acid, 2-hydroxy-, ethyl ester
- Acetic acid, methyl ester + Propanoic acid, 2-hydroxy-, ethyl ester
- Propanoic acid, 2-hydroxy-, ethyl ester + Methyl Alcohol
- Acetic acid, methyl ester + Propanoic acid, 2-hydroxy-, ethyl ester + Methyl Alcohol
- Thymol + Propanoic acid, 2-hydroxy-, ethyl ester + Water
- caffeine + Propanoic acid, 2-hydroxy-, ethyl ester + Water
- Propanoic acid, 2-hydroxy-, ethyl ester + Vanillic acid + Water
- 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)- + Propanoic acid, 2-hydroxy-, ethyl ester + Water
- Propanoic acid, 2-hydroxy-, ethyl ester + Water
- Aniline + Propanoic acid, 2-hydroxy-, ethyl ester
- Aniline, N-methyl- + Propanoic acid, 2-hydroxy-, ethyl ester
- Benzenamine, N-ethyl- + Propanoic acid, 2-hydroxy-, ethyl ester
- 1-Propanol + Propanoic acid, 2-hydroxy-, ethyl ester
Find more mixtures with Propanoic acid, 2-hydroxy-, ethyl ester.
Sources
- Crippen Method
- Crippen Method
- Vapor liquid equilibria and excess volumes of the binary systems ethanol + ethyl lactate, isopropanol + isopropyl lactate and n-butanol + n-butyl lactate at 101.325 kPa
- Liquid-liquid equilibria of mixtures with ethyl lactate and various hydrocarbons
- High pressure phase behavior of the binary system (ethyl lactate + carbon dioxide)
- Volumetric and viscometric behavior of the binary systems ethyl lactate + 1,2- propanediol, + 1,3-propanediol, + tetrahydrofuran and + tetraethylene glycol dimethyl ether. New UNIFAC-VISCO and ASOG-VISCO parameters determination
- Experimental measurements and modelling of volumetric properties, refractive index and viscosity of binary systems of ethyl lactate with methyl ethyl ketone, toluene and n-methyl-2-pirrolidone at 288.15 323.15 K and atmospheric pressure. New UNIFAC VISCO and ASOG VISCO interaction parameters
- Vapor-liquid equilibria of binary and ternary mixtures containing ethyl lactate and effect of ethyl lactate as entrainer
- Partitioning of amino acids in the novel biphasic systems based on environmentally friendly ethyl lactate
- Solubility of high-value compounds in ethyl lactate: Measurements and modelling
- The pqT behaviour of the lactate family
- Self-aggregation of liquids from biomass in aqueous solution
- Comparative studies of intermolecular interaction of aromatic amines with ethyl lactate at different temperatures
- Thermodynamic behaviour of alkyl lactate-alkanol systems
- Renewable platform chemicals: Evaluation of thermochemical data of alkyl lactates with complementary experimental and computational methods
- Thermophysical Properties of Lactates
- Densities, speed of sound, and IR studies of Ethyl lactate with 2-alkoxyethanols at different temperatures
- Separation Effects of Renewable Solvent Ethyl Lactate on the Vapor Liquid Equilibria of the Methanol + Dimethyl Carbonate Azeotropic System
- Density Measurements of CO2-Expanded Liquids
- Vapor-Liquid Equilibrium of Ethyl Lactate Highly Diluted in Ethanol-Water Mixtures at 101.3 kPa. Experimental Measurements and Thermodynamic Modeling Using Semiempirical Models
- Vapor-Liquid Equilibria in the Systems Ethyl Lactate + Ethanol and Ethyl Lactate + Water
- Density, Refractive Index, Speed of Sound at 298.15 K, and Vapor-Liquid Equilibria at 101.3 kPa for Binary Mixtures of Ethyl Acetate + Ethyl Lactate and Methyl Acetate + Ethyl Lactate
- Isobaric Vapor Liquid Equilibrium of 3-Methyl-1-butanol + Ethyl Lactate and 1-Pentanol + Ethyl Lactate at (13.0 and 101.3) kPa
- High-Pressure Phase Behavior of Methyl Lactate and Ethyl Lactate in Supercritical Carbon Dioxide
- Solubility of CO2 in Ethyl Lactate and Modeling of the Phase Behavior of the CO2 + Ethyl Lactate Mixture
- Densities and Viscosities for Binary Mixtures of Ethyl Lactate with Methacrylic Acid, Benzyl Methacrylate, and 2-Hydroxyethyl Methacrylate at (298.15, 308.15, and 318.15) K
- Joback Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.