Chemical Properties of 11«alpha»,15«alpha»-dihydroxy-9-ketoprost-13-enoic acid, 19-hydroxy, EO-TMS # 2

11«alpha»,15«alpha»-dihydroxy-9-ketoprost-13-enoic acid, 19-hydroxy, EO-TMS # 2

PDF Excel Molecule Calculator
InChI
InChI=1S/C35H73NO6Si4/c1-16-38-36-32-28-33(40-44(7,8)9)31(30(32)23-19-17-18-20-24-34(37)41-45(10,11)12)25-27-35(3,42-46(13,14)15)26-21-22-29(2)39-43(4,5)6/h25,27,29-31,33H,16-24,26,28H2,1-15H3/b27-25+,36-32?/t29?,30-,31-,33-,35+/m0/s1
InChI Key
PCJNNCUCXDURPT-MYDRTQKRSA-N
Formula
C35H73NO6Si4
SMILES
CCON=C1CC(O[Si](C)(C)C)C(C=CC(C)(CCCC(C)O[Si](C)(C)C)O[Si](C)(C)C)C1CCCCCCC(=O)O[Si](C)(C)C
Molecular Weight1
716.30
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry. Do not hesitate to contact us for your projects.

Physical Properties

Property Value Unit Source
log10WS -1.64 Crippen Calculated Property
logPoct/wat 10.530 Crippen Calculated Property
Inp [3130.00; 3130.00]   Show
Inp 3130.00 NIST
Inp 3130.00 NIST

Similar Compounds

PGE1, EO-TMS, isomer # 1. PGE1, EO-TMS, isomer # 2. PGE1, MO-TMS, isomer # 1. PGE1, MO-TMS, isomer # 2. PGE2, EO-TMS, isomer # 1. PGE2, EO-TMS, isomer # 2. PGE1, BO-TMS, isomer # 2. PGE1, BO-TMS, isomer # 1. PGE2, MO-TMS, isomer # 2. PGE2, MO-TMS, isomer # 1. PGE2, BO-TMS, isomer # 1. PGE2, BO-TMS, isomer # 2. 15-Keto-PGE2, EO-TMS, isomer # 1. 15-Keto-PGE2, EO-TMS, isomer # 3. 15-Keto-PGE2, MO-TMS, isomer # 3.

Find more compounds similar to 11«alpha»,15«alpha»-dihydroxy-9-ketoprost-13-enoic acid, 19-hydroxy, EO-TMS # 2.

Sources

Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.