Chemical Properties of 15-Keto-PGE2, EO-TMS, isomer # 3

15-Keto-PGE2, EO-TMS, isomer # 3

PDF Excel Molecule Calculator
InChI
InChI=1S/C30H56N2O5Si2/c1-10-13-16-19-25(31-34-11-2)22-23-27-26(20-17-14-15-18-21-30(33)37-39(7,8)9)28(32-35-12-3)24-29(27)36-38(4,5)6/h14,17,22-23,26-27,29H,10-13,15-16,18-21,24H2,1-9H3/b17-14-,23-22+,31-25-,32-28?/t26-,27-,29-/m0/s1
InChI Key
SYKNYLRBRFILLL-QPZUBDORSA-N
Formula
C30H56N2O5Si2
SMILES
CCCCCC(C=CC1C(O[Si](C)(C)C)CC(=NOCC)C1CC=CCCCC(=O)O[Si](C)(C)C)=NOCC
Molecular Weight1
580.95
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry. Do not hesitate to contact us for your projects.

Physical Properties

Property Value Unit Source
log10WS -4.15 Crippen Calculated Property
logPoct/wat 8.259 Crippen Calculated Property
Inp [2842.00; 2842.00]   Show Hide
Inp 2842.00 NIST
Inp 2842.00 NIST

Similar Compounds

15-Keto-PGE2, EO-TMS, isomer # 2. 15-Keto-PGE2, MO-TMS, isomer # 1. 15-Keto-PGE2, MO-TMS, isomer # 3. 15-Keto-PGE2, MO-TMS, isomer # 2. 15-Keto-PGE2, EO-TMS, isomer # 4. 15-Keto-PGE2, EO-TMS, isomer # 1. 15-Keto-PGE2, BO-TMS, isomer # 4. 15-Keto-PGE2, BO-TMS, isomer # 2. 15-Keto-PGE2, BO-TMS, isomer # 1. 15-Keto-PGE2, BO-TMS, isomer # 3. PGE1, EO-TMS, isomer # 2. PGE2, EO-TMS, isomer # 1. PGE1, EO-TMS, isomer # 1. PGE2, EO-TMS, isomer # 2. PGE1, BO-TMS, isomer # 2.

Find more compounds similar to 15-Keto-PGE2, EO-TMS, isomer # 3.

Sources

Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.