Chemical Properties of PGE2, MO-TMS, isomer # 2

PGE2, MO-TMS, isomer # 2

PDF Excel Molecule Calculator
InChI
InChI=1S/C30H59NO5Si3/c1-12-13-16-19-25(34-37(3,4)5)22-23-27-26(28(31-33-2)24-29(27)35-38(6,7)8)20-17-14-15-18-21-30(32)36-39(9,10)11/h14,17,22-23,25-27,29H,12-13,15-16,18-21,24H2,1-11H3/b17-14-,23-22+,31-28?/t25-,26+,27+,29+/m1/s1
InChI Key
CAGDKDNXQZFLSL-DKBWDJRYSA-N
Formula
C30H59NO5Si3
SMILES
CCCCCC(C=CC1C(O[Si](C)(C)C)CC(=NOC)C1CC=CCCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C
Molecular Weight1
598.05
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry. Do not hesitate to contact us for your projects.

Physical Properties

Property Value Unit Source
log10WS -2.15 Crippen Calculated Property
logPoct/wat 8.696 Crippen Calculated Property
Inp [2748.00; 2748.00]   Show Hide
Inp 2748.00 NIST
Inp 2748.00 NIST

Similar Compounds

PGE2, MO-TMS, isomer # 1. PGE2, EO-TMS, isomer # 2. PGE2, EO-TMS, isomer # 1. PGE1, MO-TMS, isomer # 1. PGE1, MO-TMS, isomer # 2. PGE1, EO-TMS, isomer # 1. PGE1, EO-TMS, isomer # 2. PGE2, BO-TMS, isomer # 1. PGE2, BO-TMS, isomer # 2. PGE1, BO-TMS, isomer # 2. PGE1, BO-TMS, isomer # 1. 11«alpha»,15«alpha»-dihydroxy-9-ketoprost-13-enoic acid, 19-hydroxy, EO-TMS # 2. 15-Keto-PGE2, EO-TMS, isomer # 2. 15-Keto-PGE2, MO-TMS, isomer # 2. 15-Keto-PGE2, MO-TMS, isomer # 3.

Find more compounds similar to PGE2, MO-TMS, isomer # 2.

Sources

Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.