- InChI
- InChI=1S/C10H12/c1-2-6-10-8-4-3-7-9(10)5-1/h1-2,5-6H,3-4,7-8H2
- InChI Key
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N
- Formula
- C10H12
- SMILES
- c1ccc2c(c1)CCCC2
- Molecular Weight1
- 132.20
- CAS
- 119-64-2
- Other Names
-
- 1,2,3,4-TETRAHYDRONAPHTHALENE
- BACTICIN
- BENZOCYCLOHEXANE
- NSC 77451
- Naphthalene-1,2,3,4-tetrahydride
- TETRALINE
- Tetrahydronaphthalene
- Tetralin
- Tetralina
- Tetranap
- tetralene
- «delta»(5,7,9)-Naphthantriene
- «delta»(5,7,9)-Naphthantriene
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.3030 | KDB | |
| PAff | [800.80; 809.70] | kJ/mol |
|
| PAff | 809.70 | kJ/mol | NIST |
| PAff | 800.80 | kJ/mol | NIST |
| BasG | [774.00; 782.10] | kJ/mol |
|
| BasG | 782.10 | kJ/mol | NIST |
| BasG | 774.00 | kJ/mol | NIST |
| ΔcH°liquid | [-5621.54; -5581.90] | kJ/mol |
|
| ΔcH°liquid | -5621.54 ± 0.88 | kJ/mol | NIST |
| ΔcH°liquid | -5617.50 ± 2.10 | kJ/mol | NIST |
| ΔcH°liquid | -5598.60 | kJ/mol | NIST |
| ΔcH°liquid | -5581.90 | kJ/mol | NIST |
| ΔfG° | 167.10 | kJ/mol | KDB |
| ΔfH°gas | [2.76; 30.00] | kJ/mol |
|
| ΔfH°gas | 2.76 | kJ/mol | KDB |
| ΔfH°gas | 30.00 | kJ/mol | NIST |
| ΔfH°gas | 26.00 ± 2.00 | kJ/mol | NIST |
| ΔfH°liquid | [-32.60; -28.60] | kJ/mol |
|
| ΔfH°liquid | -28.60 ± 1.00 | kJ/mol | NIST |
| ΔfH°liquid | -32.60 ± 2.20 | kJ/mol | NIST |
| ΔfusH° | 10.27 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [55.00; 58.60] | kJ/mol |
|
| ΔvapH° | 55.00 ± 1.00 | kJ/mol | NIST |
| ΔvapH° | 58.60 | kJ/mol | NIST |
| IE | [8.44; 9.14] | eV |
|
| IE | 8.46 ± 0.02 | eV | NIST |
| IE | 8.44 | eV | NIST |
| IE | 8.48 ± 0.05 | eV | NIST |
| IE | 8.47 | eV | NIST |
| IE | 8.73 | eV | NIST |
| IE | Outlier 9.14 ± 0.05 | eV | NIST |
| IE | 8.45 ± 0.02 | eV | NIST |
| IE | 8.44 | eV | NIST |
| log10WS | -4.37 | Aq. Sol... | |
| logPoct/wat | 2.565 | Crippen Calculated Property | |
| McVol | 117.140 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 2 | KDB | |
| NFPA Health | 1 | KDB | |
| Pc | [3630.00; 3750.00] | kPa |
|
| Pc | 3650.00 | kPa | KDB |
| Pc | 3700.00 ± 100.00 | kPa | NIST |
| Pc | 3630.00 ± 25.00 | kPa | NIST |
| Pc | 3750.00 ± 80.00 | kPa | NIST |
| ρc | [300.10; 330.51] | kg/m3 |
|
| ρc | 330.51 ± 13.22 | kg/m3 | NIST |
| ρc | 323.90 ± 6.61 | kg/m3 | NIST |
| ρc | 300.10 ± 14.54 | kg/m3 | NIST |
| Inp | [195.21; 1180.00] |
|
|
| Inp | 1143.00 | NIST | |
| Inp | 1143.00 | NIST | |
| Inp | 1168.50 | NIST | |
| Inp | 1142.80 | NIST | |
| Inp | 1154.00 | NIST | |
| Inp | 1180.00 | NIST | |
| Inp | 1179.00 | NIST | |
| Inp | 1170.00 | NIST | |
| Inp | 1142.00 | NIST | |
| Inp | 1142.00 | NIST | |
| Inp | 1147.00 | NIST | |
| Inp | 1136.00 | NIST | |
| Inp | 1129.80 | NIST | |
| Inp | 1164.00 | NIST | |
| Inp | 1178.00 | NIST | |
| Inp | 1137.00 | NIST | |
| Inp | 1133.20 | NIST | |
| Inp | 1137.60 | NIST | |
| Inp | 1168.70 | NIST | |
| Inp | 1179.80 | NIST | |
| Inp | 1140.00 | NIST | |
| Inp | 1142.00 | NIST | |
| Inp | 1150.00 | NIST | |
| Inp | 1155.00 | NIST | |
| Inp | 1133.00 | NIST | |
| Inp | 1137.00 | NIST | |
| Inp | 1133.20 | NIST | |
| Inp | 1137.60 | NIST | |
| Inp | 1165.00 | NIST | |
| Inp | 1168.00 | NIST | |
| Inp | 1173.00 | NIST | |
| Inp | 1140.00 | NIST | |
| Inp | 1125.60 | NIST | |
| Inp | 1150.00 | NIST | |
| Inp | 1136.00 | NIST | |
| Inp | 1163.35 | NIST | |
| Inp | 1153.90 | NIST | |
| Inp | 1151.70 | NIST | |
| Inp | 1158.50 | NIST | |
| Inp | 1162.50 | NIST | |
| Inp | 1179.40 | NIST | |
| Inp | 1142.90 | NIST | |
| Inp | 1151.70 | NIST | |
| Inp | 1158.50 | NIST | |
| Inp | 1162.50 | NIST | |
| Inp | 1140.47 | NIST | |
| Inp | 1140.85 | NIST | |
| Inp | 1141.00 | NIST | |
| Inp | 1163.00 | NIST | |
| Inp | 1130.46 | NIST | |
| Inp | 1138.09 | NIST | |
| Inp | 1142.95 | NIST | |
| Inp | 1157.79 | NIST | |
| Inp | 1166.27 | NIST | |
| Inp | 1171.51 | NIST | |
| Inp | 1136.00 | NIST | |
| Inp | 1169.00 | NIST | |
| Inp | 1133.00 | NIST | |
| Inp | 1137.00 | NIST | |
| Inp | 1142.00 | NIST | |
| Inp | 1155.00 | NIST | |
| Inp | 1147.00 | NIST | |
| Inp | 1166.00 | NIST | |
| Inp | 1169.00 | NIST | |
| Inp | 1155.00 | NIST | |
| Inp | 1148.00 | NIST | |
| Inp | 1152.00 | NIST | |
| Inp | 1162.00 | NIST | |
| Inp | 1164.00 | NIST | |
| Inp | 1174.00 | NIST | |
| Inp | 1136.00 | NIST | |
| Inp | 1147.00 | NIST | |
| Inp | 1167.00 | NIST | |
| Inp | 1137.00 | NIST | |
| Inp | 1158.00 | NIST | |
| Inp | 1171.00 | NIST | |
| Inp | 1179.00 | NIST | |
| Inp | 1137.00 | NIST | |
| Inp | 1162.00 | NIST | |
| Inp | 1163.00 | NIST | |
| Inp | 1130.00 | NIST | |
| Inp | 1144.00 | NIST | |
| Inp | 1169.00 | NIST | |
| Inp | 1142.10 | NIST | |
| Inp | 1152.90 | NIST | |
| Inp | 1149.70 | NIST | |
| Inp | 1152.40 | NIST | |
| Inp | 1141.00 | NIST | |
| Inp | 1136.00 | NIST | |
| Inp | 1153.00 | NIST | |
| Inp | Outlier 195.21 | NIST | |
| Inp | Outlier 195.47 | NIST | |
| Inp | Outlier 197.04 | NIST | |
| Inp | 1169.00 | NIST | |
| Inp | 1164.00 | NIST | |
| Inp | 1137.00 | NIST | |
| Inp | Outlier 195.21 | NIST | |
| I | [1476.00; 1565.00] |
|
|
| I | 1490.40 | NIST | |
| I | 1476.00 | NIST | |
| I | 1523.00 | NIST | |
| I | 1517.00 | NIST | |
| I | 1565.00 | NIST | |
| I | 1565.00 | NIST | |
| I | 1490.00 | NIST | |
| I | 1525.00 | NIST | |
| I | 1525.00 | NIST | |
| I | 1525.00 | NIST | |
| I | 1523.00 | NIST | |
| S°liquid | 251.46 | J/mol×K | NIST |
| Tboil | [480.77; 481.45] | K |
|
| Tboil | 480.77 | K | KDB |
| Tboil | 481.45 | K | Excess ... |
| Tc | [719.90; 721.70] | K |
|
| Tc | 720.00 | K | KDB |
| Tc | 720.00 ± 1.00 | K | NIST |
| Tc | 721.70 ± 0.50 | K | NIST |
| Tc | 719.90 ± 1.00 | K | NIST |
| Tc | 721.00 ± 1.50 | K | NIST |
| Tfus | [236.45; 242.55] | K |
|
| Tfus | 237.40 | K | KDB |
| Tfus | 238.73 | K | Aq. Sol... |
| Tfus | Outlier 242.55 | K | NIST |
| Tfus | 237.17 ± 0.20 | K | NIST |
| Tfus | 237.31 ± 0.06 | K | NIST |
| Tfus | 237.33 ± 0.04 | K | NIST |
| Tfus | 237.36 ± 0.03 | K | NIST |
| Tfus | 237.33 ± 0.20 | K | NIST |
| Tfus | 236.45 ± 0.50 | K | NIST |
| Tfus | 238.20 ± 0.60 | K | NIST |
| Ttriple | [237.34; 237.35] | K |
|
| Ttriple | 237.34 ± 0.07 | K | NIST |
| Ttriple | 237.35 ± 0.05 | K | NIST |
| Vc | [0.408; 0.408] | m3/kmol |
|
| Vc | 0.408 | m3/kmol | KDB |
| Vc | 0.408 | m3/kmol | NIST |
| Zc | 0.2487620 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [241.23; 324.45] | J/mol×K | [475.54; 708.10] |
|
| Cp,gas | 241.23 | J/mol×K | 475.54 | Joback Calculated Property |
| Cp,gas | 257.83 | J/mol×K | 514.30 | Joback Calculated Property |
| Cp,gas | 273.25 | J/mol×K | 553.06 | Joback Calculated Property |
| Cp,gas | 287.54 | J/mol×K | 591.82 | Joback Calculated Property |
| Cp,gas | 300.80 | J/mol×K | 630.58 | Joback Calculated Property |
| Cp,gas | 313.07 | J/mol×K | 669.34 | Joback Calculated Property |
| Cp,gas | 324.45 | J/mol×K | 708.10 | Joback Calculated Property |
| Cp,liquid | 217.44 | J/mol×K | 298.15 | NIST |
| η | [0.0003310; 0.0025839] | Pa×s | [260.06; 475.54] |
|
| η | 0.0025839 | Pa×s | 260.06 | Joback Calculated Property |
| η | 0.0014903 | Pa×s | 295.97 | Joback Calculated Property |
| η | 0.0009683 | Pa×s | 331.89 | Joback Calculated Property |
| η | 0.0006844 | Pa×s | 367.80 | Joback Calculated Property |
| η | 0.0005146 | Pa×s | 403.71 | Joback Calculated Property |
| η | 0.0004053 | Pa×s | 439.63 | Joback Calculated Property |
| η | 0.0003310 | Pa×s | 475.54 | Joback Calculated Property |
| ΔfusH | [12.45; 12.45] | kJ/mol | [237.36; 237.40] |
|
| ΔfusH | 12.45 | kJ/mol | 237.36 | NIST |
| ΔfusH | 12.45 | kJ/mol | 237.40 | NIST |
| ΔfusH | 12.45 | kJ/mol | 237.40 | NIST |
| ΔvapH | [32.00; 52.10] | kJ/mol | [384.00; 604.00] |
|
| ΔvapH | 52.10 | kJ/mol | 384.00 | NIST |
| ΔvapH | 51.10 | kJ/mol | 396.00 | NIST |
| ΔvapH | 48.60 | kJ/mol | 423.00 | NIST |
| ΔvapH | 41.30 ± 0.10 | kJ/mol | 498.00 | NIST |
| ΔvapH | 44.10 | kJ/mol | 522.50 | NIST |
| ΔvapH | 37.60 ± 0.10 | kJ/mol | 552.00 | NIST |
| ΔvapH | 35.70 ± 0.10 | kJ/mol | 567.00 | NIST |
| ΔvapH | 33.90 ± 0.10 | kJ/mol | 585.00 | NIST |
| ΔvapH | 32.00 ± 0.10 | kJ/mol | 604.00 | NIST |
| n0 | [1.51790; 1.54155] | [293.15; 343.15] |
|
|
| n0 | 1.54140 | 293.15 | Densiti... | |
| n0 | 1.54000 | 293.15 | Densiti... | |
| n0 | 1.54150 | 293.15 | Densiti... | |
| n0 | 1.54155 | 293.15 | Thermod... | |
| n0 | 1.53919 | 298.15 | KDB | |
| n0 | 1.53670 | 303.15 | Densiti... | |
| n0 | 1.53690 | 303.15 | Densiti... | |
| n0 | 1.53687 | 303.15 | Thermod... | |
| n0 | 1.53600 | 303.15 | Densiti... | |
| n0 | 1.53216 | 313.15 | Thermod... | |
| n0 | 1.53210 | 313.15 | Densiti... | |
| n0 | 1.53220 | 313.15 | Densiti... | |
| n0 | 1.52750 | 323.15 | Densiti... | |
| n0 | 1.52740 | 323.15 | Densiti... | |
| n0 | 1.52752 | 323.15 | Thermod... | |
| n0 | 1.52274 | 333.15 | Thermod... | |
| n0 | 1.52270 | 333.15 | Densiti... | |
| n0 | 1.52280 | 333.15 | Densiti... | |
| n0 | 1.51795 | 343.15 | Thermod... | |
| n0 | 1.51800 | 343.15 | Densiti... | |
| n0 | 1.51790 | 343.15 | Densiti... | |
| ρl | [904.80; 973.00] | kg/m3 | [293.00; 373.15] |
|
| ρl | 973.00 | kg/m3 | 293.00 | KDB |
| ρl | 968.80 | kg/m3 | 293.15 | Density... |
| ρl | 968.89 | kg/m3 | 293.15 | Densiti... |
| ρl | 964.92 | kg/m3 | 298.15 | Densiti... |
| ρl | 960.96 | kg/m3 | 303.15 | Densiti... |
| ρl | 960.90 | kg/m3 | 303.15 | Density... |
| ρl | 956.99 | kg/m3 | 308.15 | Densiti... |
| ρl | 953.03 | kg/m3 | 313.15 | Densiti... |
| ρl | 952.93 | kg/m3 | 313.15 | Experim... |
| ρl | 953.00 | kg/m3 | 313.15 | Density... |
| ρl | 949.05 | kg/m3 | 318.15 | Densiti... |
| ρl | 945.00 | kg/m3 | 323.15 | Density... |
| ρl | 944.99 | kg/m3 | 323.15 | Experim... |
| ρl | 945.10 | kg/m3 | 323.15 | Densiti... |
| ρl | 941.13 | kg/m3 | 328.15 | Densiti... |
| ρl | 937.17 | kg/m3 | 333.15 | Densiti... |
| ρl | 937.10 | kg/m3 | 333.15 | Density... |
| ρl | 937.04 | kg/m3 | 333.15 | Experim... |
| ρl | 933.19 | kg/m3 | 338.15 | Densiti... |
| ρl | 929.20 | kg/m3 | 343.15 | Densiti... |
| ρl | 929.10 | kg/m3 | 343.15 | Density... |
| ρl | 920.90 | kg/m3 | 353.15 | Density... |
| ρl | 912.90 | kg/m3 | 363.15 | Density... |
| ρl | 904.80 | kg/m3 | 373.15 | Density... |
| ΔfusS | 52.44 | J/mol×K | 237.36 | NIST |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 100.00 | 0.0020 |
| 298.15 | 40300.00 | 0.0029 |
| 298.15 | 78600.00 | 0.0042 |
| 298.15 | 80900.00 | 0.0042 |
| 298.15 | 119800.00 | 0.0060 |
| 298.15 | 120600.00 | 0.0060 |
| 298.15 | 158900.00 | 0.0085 |
| 298.15 | 190200.00 | 0.0112 |
| 298.15 | 100.00 | 0.0020 |
| 323.15 | 100.00 | 0.0013 |
| 323.15 | 39900.00 | 0.0018 |
| 323.15 | 80300.00 | 0.0026 |
| 323.15 | 80600.00 | 0.0026 |
| 323.15 | 120900.00 | 0.0035 |
| 323.15 | 121000.00 | 0.0035 |
| 323.15 | 161200.00 | 0.0047 |
| 323.15 | 190600.00 | 0.0058 |
| 323.15 | 100.00 | 0.0013 |
| 348.15 | 100.00 | 0.0009 |
| 348.15 | 41000.00 | 0.0013 |
| 348.15 | 79700.00 | 0.0017 |
| 348.15 | 80600.00 | 0.0017 |
| 348.15 | 119500.00 | 0.0023 |
| 348.15 | 121700.00 | 0.0023 |
| 348.15 | 163000.00 | 0.0030 |
| 348.15 | 190800.00 | 0.0036 |
| 348.15 | 100.00 | 0.0009 |
| 373.15 | 100.00 | 0.0007 |
| 373.15 | 40500.00 | 0.0010 |
| 373.15 | 80300.00 | 0.0013 |
| 373.15 | 81100.00 | 0.0013 |
| 373.15 | 122500.00 | 0.0017 |
| 373.15 | 123000.00 | 0.0017 |
| 373.15 | 160200.00 | 0.0021 |
| 373.15 | 190600.00 | 0.0025 |
| 373.15 | 100.00 | 0.0007 |
| 398.15 | 100.00 | 0.0005 |
| 398.15 | 40500.00 | 0.0008 |
| 398.15 | 80600.00 | 0.0010 |
| 398.15 | 81800.00 | 0.0010 |
| 398.15 | 120800.00 | 0.0013 |
| 398.15 | 159900.00 | 0.0016 |
| 398.15 | 161000.00 | 0.0016 |
| 398.15 | 200600.00 | 0.0020 |
| 398.15 | 100.00 | 0.0005 |
| 423.15 | 100.00 | 0.0004 |
| 423.15 | 40500.00 | 0.0006 |
| 423.15 | 81000.00 | 0.0008 |
| 423.15 | 82200.00 | 0.0008 |
| 423.15 | 120800.00 | 0.0010 |
| 423.15 | 160800.00 | 0.0013 |
| 423.15 | 161300.00 | 0.0013 |
| 423.15 | 201000.00 | 0.0015 |
| 423.15 | 100.00 | 0.0004 |
| 448.15 | 100.00 | 0.0004 |
| 448.15 | 40400.00 | 0.0005 |
| 448.15 | 80400.00 | 0.0007 |
| 448.15 | 81200.00 | 0.0007 |
| 448.15 | 120200.00 | 0.0008 |
| 448.15 | 160600.00 | 0.0010 |
| 448.15 | 161200.00 | 0.0010 |
| 448.15 | 200100.00 | 0.0012 |
| 448.15 | 100.00 | 0.0004 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [352.27; 525.05] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.38270e+01 | |||
| Coefficient B | -3.96508e+03 | |||
| Coefficient C | -5.94180e+01 | |||
| Temperature range, min. | 352.27 | |||
| Temperature range, max. | 525.05 | |||
| Pvap | 1.33 | kPa | 352.27 | Calculated Property |
| Pvap | 3.07 | kPa | 371.47 | Calculated Property |
| Pvap | 6.40 | kPa | 390.67 | Calculated Property |
| Pvap | 12.34 | kPa | 409.86 | Calculated Property |
| Pvap | 22.20 | kPa | 429.06 | Calculated Property |
| Pvap | 37.71 | kPa | 448.26 | Calculated Property |
| Pvap | 60.92 | kPa | 467.46 | Calculated Property |
| Pvap | 94.27 | kPa | 486.65 | Calculated Property |
| Pvap | 140.51 | kPa | 505.85 | Calculated Property |
| Pvap | 202.65 | kPa | 525.05 | Calculated Property |
| Pvap | [1.38e-04; 3626.24] | kPa | [237.40; 720.15] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 9.13922e+01 | |||
| Coefficient B | -9.58531e+03 | |||
| Coefficient C | -1.10009e+01 | |||
| Coefficient D | 4.80933e-06 | |||
| Temperature range, min. | 237.40 | |||
| Temperature range, max. | 720.15 | |||
| Pvap | 1.38e-04 | kPa | 237.40 | Calculated Property |
| Pvap | 0.03 | kPa | 291.04 | Calculated Property |
| Pvap | 0.89 | kPa | 344.68 | Calculated Property |
| Pvap | 9.26 | kPa | 398.32 | Calculated Property |
| Pvap | 49.94 | kPa | 451.96 | Calculated Property |
| Pvap | 176.64 | kPa | 505.59 | Calculated Property |
| Pvap | 472.46 | kPa | 559.23 | Calculated Property |
| Pvap | 1046.14 | kPa | 612.87 | Calculated Property |
| Pvap | 2035.67 | kPa | 666.51 | Calculated Property |
| Pvap | 3626.24 | kPa | 720.15 | Calculated Property |
Similar Compounds
Find more compounds similar to Naphthalene, 1,2,3,4-tetrahydro-.
Mixtures
- Naphthalene, 1,2,3,4-tetrahydro- + Decane
- Dodecane + Naphthalene, 1,2,3,4-tetrahydro-
- Naphthalene, 1,2,3,4-tetrahydro- + Benzene, (2-methylpropyl)-
- Dodecane + Naphthalene, 1,2,3,4-tetrahydro- + Benzene, (2-methylpropyl)-
- Hexadecane + Naphthalene, 1,2,3,4-tetrahydro-
- Diisopropyl ether + Naphthalene, 1,2,3,4-tetrahydro-
- Naphthalene, 1,2,3,4-tetrahydro- + 1,1'-Bicyclohexyl
- Naphthalene, 1,2,3,4-tetrahydro- + Naphthalene, decahydro-, trans-
- Naphthalene, 1,2,3,4-tetrahydro- + Cyclopropyl carbinol
- Cyclohexane, (1-methylethyl)- + Naphthalene, 1,2,3,4-tetrahydro-
- Cyclohexane, (1-methylethyl)- + Naphthalene, 1,2,3,4-tetrahydro- + Cyclopropyl carbinol
- Naphthalene, 1,2,3,4-tetrahydro- + Octane
- Naphthalene, 1,2,3,4-tetrahydro- + Nonane
- Carbon dioxide + Naphthalene, 1,2,3,4-tetrahydro-
- n-Hexane + Carbon dioxide + Naphthalene, 1,2,3,4-tetrahydro-
- Carbon dioxide + Hexadecane + Naphthalene, 1,2,3,4-tetrahydro-
- Naphthalene, decahydro-, cis- + Naphthalene, 1,2,3,4-tetrahydro- + Naphthalene, decahydro-, trans-
- Cyclic octaatomic sulfur + Naphthalene, 1,2,3,4-tetrahydro-
- Furfural + Naphthalene, 1,2,3,4-tetrahydro- + Water
- Pentanoic acid, 4-oxo- + Naphthalene, 1,2,3,4-tetrahydro- + Water
Find more mixtures with Naphthalene, 1,2,3,4-tetrahydro-.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Experimental measurement and thermodynamic modeling of phase equilibria of {CO2 + tetralin + n-alkanes (with n = 6, 16)} and its binary systems
- Densities, sound velocities, and refractive indexes of (tetralin + n-decane) and thermodynamic modeling by Prigogine-Flory-Patterson model
- Thermodynamic modeling and experimental speeds of sound, densities, and refractive indexes of (tetralin + n-dodecane)
- Experimental high pressure speed of sound and density of (tetralin + n-decane) and (tetralin + n-hexadecane) systems and thermodynamic modeling
- Excess volumes, densities, speeds of sound and viscosities for the binary systems of diisopropyl ether with hydrocarbons at 303.15K
- Prediction and Experimental Measurement of Refractive Index in Ternary Hydrocarbon Mixtures
- Mass Diffusion Coefficient and Soret Coefficient of o-Dichlorobenzene Solutions of PCBM and [60]Fullerene by the Soret Forced Rayleigh Scattering Method
- Density and Viscosity from 293.15 to 373.15 K, Speed of Sound and Bulk Modulus from 293.15 to 343.15 K, Surface Tension, and Flash Point of Binary Mixtures of Bicyclohexyl and 1,2,3,4-Tetrahydronaphthalene or Trans-decahydronaphthalene at 0.1 MPa
- Density, Viscosity, Speed of Sound, Bulk Modulus, Surface Tension, and Flash Point of Binary Mixtures of 1,2,3,4-Tetrahydronaphthalene and Trans-decahydronaphthalene
- Speeds of Sound and Densities of Ternary and Quaternary Mixtures of Tetralin, Decalin, n-Decane, and n-Hexadecane: Experiments and Thermodynamic Modeling with PC-SAFT Equation of State
- Measurement and Correlation of the Solubilities of Sulfur S8 in 10 Solvents
- Liquid-Liquid Equilibria of Formic Acid and Furfural in a Biphasic Aqueous-Organic System: Optimization of Solvent and Amine Extractant
- Densities and Viscosities for the Ternary System of 1,2,3,4-Tetrahydronaphthalene + Isopropylcyclohexane + Cyclopropanemethanol and Corresponding Binaries at T = (293.15 to 343.15) K
- Densities, Sound Velocities, and Refractive Indexes of Tetralin + n-Hexadecane at (293.15, 303.15, 313.15, 323.15, 333.15, and 343.15) K
- Densities, Viscosities, and Refractive Indices of Binary Mixtures of 1,2,3,4-Tetrahydronaphthalene with Some n-Alkanes at T = (293.15 to 313.15) K
- Viscosity and Density of Five Hydrocarbon Liquids at Pressures up to 200 MPa and Temperatures up to 473 K
- Comparison between Experimental and Theoretical Estimations of the Thermal Expansion, Concentration Expansion Coefficients, and Viscosity for Binary Mixtures under Pressures up to 20 MPa
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.