- InChI
- InChI=1S/C4F10/c5-1(6,3(9,10)11)2(7,8)4(12,13)14
- InChI Key
- KAVGMUDTWQVPDF-UHFFFAOYSA-N
- Formula
- C4F10
- SMILES
- FC(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Molecular Weight1
- 238.03
- CAS
- 355-25-9
- Other Names
-
- DECAFLUOROBUTANE
- PERFLUOROBUTANE
- Perfluoro-n-butane
- ω : Acentric Factor.
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- csound,fluid : Speed of sound in fluid (m/s).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.3740 | KDB | |
| ΔfG° | -1953.94 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -2121.99 | kJ/mol | Joback Calculated Property |
| ΔfusH° | 7.26 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 11.14 | kJ/mol | Joback Calculated Property |
| log10WS | -3.45 | Crippen Calculated Property | |
| logPoct/wat | 3.382 | Crippen Calculated Property | |
| McVol | 84.920 | ml/mol | McGowan Calculated Property |
| Pc | [2323.00; 2323.38] | kPa |
|
| Pc | 2323.00 | kPa | KDB |
| Pc | 2323.38 ± 10.13 | kPa | NIST |
| ρc | 599.83 ± 10.00 | kg/m3 | NIST |
| Tboil | [271.00; 277.20] | K |
|
| Tboil | 271.20 | K | KDB |
| Tboil | 271.00 | K | NIST |
| Tboil | 277.20 | K | NIST |
| Tboil | 271.20 ± 0.50 | K | NIST |
| Tboil | 271.15 ± 0.10 | K | NIST |
| Tc | [386.35; 386.40] | K |
|
| Tc | 386.40 | K | KDB |
| Tc | 386.35 ± 0.20 | K | NIST |
| Tfus | [144.00; 144.90] | K |
|
| Tfus | 144.90 | K | KDB |
| Tfus | 144.00 ± 1.00 | K | NIST |
| Vc | 0.378 | m3/kmol | KDB |
| Zc | 0.2733170 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [165.29; 217.03] | J/mol×K | [270.70; 387.83] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 170 180 190 200 210 220 300 350 | ||||
| Cp,gas | 165.29 | J/mol×K | 270.70 | Joback Calculated Property |
| Cp,gas | 175.21 | J/mol×K | 290.22 | Joback Calculated Property |
| Cp,gas | 184.60 | J/mol×K | 309.74 | Joback Calculated Property |
| Cp,gas | 193.45 | J/mol×K | 329.26 | Joback Calculated Property |
| Cp,gas | 201.80 | J/mol×K | 348.79 | Joback Calculated Property |
| Cp,gas | 209.65 | J/mol×K | 368.31 | Joback Calculated Property |
| Cp,gas | 217.03 | J/mol×K | 387.83 | Joback Calculated Property |
| Cp,liquid | 127.20 | J/mol×K | 293.00 | NIST |
| ΔvapH | [17.10; 25.80] | kJ/mol | [246.50; 354.50] |
|
|
T(K) Enthalpy of vaporization at a given temperature (kJ/mol) 18 20 22 24 26 250 300 350 | ||||
| ΔvapH | 25.80 | kJ/mol | 246.50 | NIST |
| ΔvapH | 24.20 | kJ/mol | 253.00 | NIST |
| ΔvapH | 24.20 | kJ/mol | 299.50 | NIST |
| ΔvapH | 21.00 | kJ/mol | 308.00 | NIST |
| ΔvapH | 17.10 | kJ/mol | 308.00 | NIST |
| ΔvapH | 23.10 | kJ/mol | 354.50 | NIST |
| Pvap | [72.70; 1997.70] | kPa | [263.15; 379.05] |
|
|
T(K) Vapor pressure (kPa) 0 500 1000 1500 2000 300 350 | ||||
| Pvap | 72.70 | kPa | 263.15 | Isother... |
| Pvap | 72.70 | kPa | 263.15 | Isother... |
| Pvap | 72.70 | kPa | 263.15 | Vapor-l... |
| Pvap | 89.60 | kPa | 268.12 | Vapor-l... |
| Pvap | 89.60 | kPa | 268.12 | Isother... |
| Pvap | 89.60 | kPa | 268.12 | Isother... |
| Pvap | 89.60 | kPa | 268.13 | Isother... |
| Pvap | 89.60 | kPa | 268.13 | Isother... |
| Pvap | 91.00 | kPa | 268.13 | Vapor-l... |
| Pvap | 109.40 | kPa | 273.09 | Vapor-l... |
| Pvap | 109.40 | kPa | 273.09 | Isother... |
| Pvap | 109.40 | kPa | 273.09 | Isother... |
| Pvap | 132.40 | kPa | 278.00 | Isother... |
| Pvap | 132.40 | kPa | 278.00 | Isother... |
| Pvap | 132.40 | kPa | 278.00 | Vapor-l... |
| Pvap | 132.30 | kPa | 278.03 | Isother... |
| Pvap | 132.30 | kPa | 278.03 | Isother... |
| Pvap | 132.40 | kPa | 278.03 | Isother... |
| Pvap | 132.30 | kPa | 278.03 | Isother... |
| Pvap | 132.30 | kPa | 278.03 | Isother... |
| Pvap | 132.30 | kPa | 278.03 | Isother... |
| Pvap | 132.40 | kPa | 278.03 | Isother... |
| Pvap | 132.30 | kPa | 278.03 | Isother... |
| Pvap | 132.60 | kPa | 278.06 | Isother... |
| Pvap | 132.60 | kPa | 278.06 | Isother... |
| Pvap | 134.60 | kPa | 278.36 | Vapor-l... |
| Pvap | 159.00 | kPa | 282.99 | Isother... |
| Pvap | 159.00 | kPa | 282.99 | Isother... |
| Pvap | 159.00 | kPa | 282.99 | Vapor-l... |
| Pvap | 189.30 | kPa | 287.91 | Isother... |
| Pvap | 189.30 | kPa | 287.91 | Vapor-l... |
| Pvap | 189.30 | kPa | 287.91 | Isother... |
| Pvap | 192.90 | kPa | 288.16 | Vapor-l... |
| Pvap | 225.40 | kPa | 292.97 | Isother... |
| Pvap | 225.40 | kPa | 292.97 | Isother... |
| Pvap | 225.40 | kPa | 292.97 | Vapor-l... |
| Pvap | 265.30 | kPa | 297.95 | Vapor-l... |
| Pvap | 265.30 | kPa | 297.95 | Isother... |
| Pvap | 265.30 | kPa | 297.95 | Isother... |
| Pvap | 268.80 | kPa | 298.13 | Vapor-l... |
| Pvap | 310.20 | kPa | 302.90 | Isother... |
| Pvap | 310.20 | kPa | 302.90 | Vapor-l... |
| Pvap | 310.20 | kPa | 302.90 | Isother... |
| Pvap | 316.00 | kPa | 302.92 | Experim... |
| Pvap | 311.70 | kPa | 303.13 | Isother... |
| Pvap | 311.70 | kPa | 303.13 | Isother... |
| Pvap | 339.00 | kPa | 305.45 | Experim... |
| Pvap | 361.00 | kPa | 307.90 | Isother... |
| Pvap | 366.00 | kPa | 307.90 | Experim... |
| Pvap | 361.00 | kPa | 307.90 | Isother... |
| Pvap | 364.30 | kPa | 308.21 | Isother... |
| Pvap | 364.30 | kPa | 308.21 | Vapor-l... |
| Pvap | 364.30 | kPa | 308.21 | Isother... |
| Pvap | 393.00 | kPa | 310.50 | Experim... |
| Pvap | 417.80 | kPa | 312.88 | Isother... |
| Pvap | 417.80 | kPa | 312.88 | Vapor-l... |
| Pvap | 417.80 | kPa | 312.88 | Isother... |
| Pvap | 419.00 | kPa | 312.93 | Experim... |
| Pvap | 455.00 | kPa | 315.48 | Experim... |
| Pvap | 481.20 | kPa | 317.88 | Isother... |
| Pvap | 481.20 | kPa | 317.88 | Isother... |
| Pvap | 481.20 | kPa | 317.88 | Vapor-l... |
| Pvap | 487.00 | kPa | 317.90 | Experim... |
| Pvap | 522.00 | kPa | 320.40 | Experim... |
| Pvap | 551.70 | kPa | 322.89 | Isother... |
| Pvap | 551.70 | kPa | 322.89 | Isother... |
| Pvap | 560.00 | kPa | 322.91 | Experim... |
| Pvap | 556.40 | kPa | 323.22 | Isother... |
| Pvap | 556.40 | kPa | 323.22 | Isother... |
| Pvap | 556.40 | kPa | 323.22 | Vapor-l... |
| Pvap | 595.00 | kPa | 325.44 | Experim... |
| Pvap | 629.50 | kPa | 327.88 | Isother... |
| Pvap | 629.50 | kPa | 327.88 | Isother... |
| Pvap | 633.00 | kPa | 327.92 | Experim... |
| Pvap | 633.70 | kPa | 328.15 | Vapor-l... |
| Pvap | 675.00 | kPa | 330.40 | Experim... |
| Pvap | 718.00 | kPa | 332.87 | Experim... |
| Pvap | 716.10 | kPa | 332.91 | Vapor-l... |
| Pvap | 716.10 | kPa | 332.91 | Isother... |
| Pvap | 716.10 | kPa | 332.91 | Isother... |
| Pvap | 762.00 | kPa | 335.39 | Experim... |
| Pvap | 811.00 | kPa | 337.93 | Isother... |
| Pvap | 811.00 | kPa | 337.93 | Isother... |
| Pvap | 811.00 | kPa | 337.93 | Vapor-l... |
| Pvap | 819.00 | kPa | 337.94 | Experim... |
| Pvap | 816.70 | kPa | 338.22 | Isother... |
| Pvap | 816.70 | kPa | 338.22 | Isother... |
| Pvap | 860.00 | kPa | 340.39 | Experim... |
| Pvap | 913.00 | kPa | 342.91 | Isother... |
| Pvap | 913.00 | kPa | 342.91 | Isother... |
| Pvap | 913.00 | kPa | 342.91 | Vapor-l... |
| Pvap | 919.00 | kPa | 342.93 | Experim... |
| Pvap | 1025.80 | kPa | 347.93 | Vapor-l... |
| Pvap | 1025.80 | kPa | 347.93 | Isother... |
| Pvap | 1025.80 | kPa | 347.93 | Isother... |
| Pvap | 1149.20 | kPa | 352.92 | Vapor-l... |
| Pvap | 1149.20 | kPa | 352.92 | Isother... |
| Pvap | 1149.20 | kPa | 352.92 | Isother... |
| Pvap | 1151.60 | kPa | 353.01 | Isother... |
| Pvap | 1151.60 | kPa | 353.01 | Isother... |
| Pvap | 1261.30 | kPa | 357.10 | Vapor-l... |
| Pvap | 1437.80 | kPa | 363.13 | Vapor-l... |
| Pvap | 1594.10 | kPa | 368.03 | Vapor-l... |
| Pvap | 1775.90 | kPa | 373.25 | Vapor-l... |
| Pvap | 1912.10 | kPa | 376.88 | Vapor-l... |
| Pvap | 1997.70 | kPa | 379.05 | Vapor-l... |
| ρl | 1517.00 | kg/m3 | 293.00 | KDB |
Datasets
Speed of sound, m/s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Pressure, kPa - Gas | Speed of sound, m/s - Gas |
| 248.70 | 10.00 | 95.1 |
| 248.70 | 20.00 | 94.56 |
| 248.70 | 30.00 | 93.98 |
| 257.70 | 10.00 | 96.57 |
| 257.70 | 20.00 | 96.22 |
| 257.70 | 30.00 | 95.7 |
| 257.70 | 50.00 | 94.78 |
| 271.30 | 10.00 | 99.26 |
| 271.30 | 20.00 | 98.71 |
| 271.30 | 30.00 | 98.33 |
| 271.30 | 50.00 | 97.39 |
| 271.30 | 70.00 | 96.39 |
| 271.30 | 100.00 | 94.79 |
| 281.50 | 10.00 | 101.05 |
| 281.50 | 20.00 | 100.64 |
| 281.50 | 30.00 | 100.23 |
| 281.50 | 50.00 | 99.38 |
| 281.50 | 70.00 | 98.4 |
| 281.50 | 100.00 | 97.04 |
| 281.50 | 150.00 | 95.08 |
| 293.10 | 10.00 | 103.02 |
| 293.10 | 20.00 | 102.7 |
| 293.10 | 30.00 | 102.37 |
| 293.10 | 50.00 | 101.71 |
| 293.10 | 70.00 | 100.86 |
| 293.10 | 100.00 | 99.66 |
| 293.10 | 150.00 | 97.68 |
| 293.10 | 200.00 | 95.63 |
| 303.10 | 10.00 | 104.78 |
| 303.10 | 20.00 | 104.57 |
| 303.10 | 30.00 | 104.25 |
| 303.10 | 50.00 | 103.35 |
| 303.10 | 70.00 | 103.06 |
| 303.10 | 100.00 | 103.05 |
| 303.10 | 150.00 | 99.91 |
| 303.10 | 200.00 | 98.41 |
| 303.10 | 250.00 | 96.5 |
| 303.10 | 300.00 | 94.89 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 2340.36] | kPa | [196.90; 386.33] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.42719e+01 | |||
| Coefficient B | -2.30981e+03 | |||
| Coefficient C | -3.17290e+01 | |||
| Temperature range, min. | 196.90 | |||
| Temperature range, max. | 386.33 | |||
|
T(K) Vapor pressure (kPa) 0 500 1000 1500 2000 2500 200 250 300 350 | ||||
| Pvap | 1.33 | kPa | 196.90 | Calculated Property |
| Pvap | 6.48 | kPa | 217.95 | Calculated Property |
| Pvap | 22.82 | kPa | 239.00 | Calculated Property |
| Pvap | 63.76 | kPa | 260.04 | Calculated Property |
| Pvap | 149.76 | kPa | 281.09 | Calculated Property |
| Pvap | 307.97 | kPa | 302.14 | Calculated Property |
| Pvap | 570.70 | kPa | 323.19 | Calculated Property |
| Pvap | 973.23 | kPa | 344.23 | Calculated Property |
| Pvap | 1551.58 | kPa | 365.28 | Calculated Property |
| Pvap | 2340.36 | kPa | 386.33 | Calculated Property |
| Pvap | [2.12e-03; 2284.39] | kPa | [144.95; 386.35] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 7.19638e+01 | |||
| Coefficient B | -4.91335e+03 | |||
| Coefficient C | -8.93526e+00 | |||
| Coefficient D | 1.14729e-05 | |||
| Temperature range, min. | 144.95 | |||
| Temperature range, max. | 386.35 | |||
|
T(K) Vapor pressure (kPa) 0 500 1000 1500 2000 2500 200 300 | ||||
| Pvap | 2.12e-03 | kPa | 144.95 | Calculated Property |
| Pvap | 0.10 | kPa | 171.77 | Calculated Property |
| Pvap | 1.49 | kPa | 198.59 | Calculated Property |
| Pvap | 10.37 | kPa | 225.42 | Calculated Property |
| Pvap | 44.67 | kPa | 252.24 | Calculated Property |
| Pvap | 138.68 | kPa | 279.06 | Calculated Property |
| Pvap | 342.43 | kPa | 305.88 | Calculated Property |
| Pvap | 718.02 | kPa | 332.71 | Calculated Property |
| Pvap | 1337.39 | kPa | 359.53 | Calculated Property |
| Pvap | 2284.39 | kPa | 386.35 | Calculated Property |
Similar Compounds
Find more compounds similar to Butane, decafluoro-.
Mixtures
- Butane, decafluoro- + Perfluoropropane
- Carbon dioxide + Butane, decafluoro-
- Butane, decafluoro- + Dimethyl ether
- Butane, decafluoro- + Ethylene
- Propane + Butane, decafluoro-
- 1-Butene + Butane, decafluoro-
- Butane, decafluoro- + Ethane
- Carbon monoxide + Butane, decafluoro-
- Nitric oxide + Butane, decafluoro-
- Methane + Butane, decafluoro-
- Butane, decafluoro- + Hydrogen sulfide
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Crippen Method
- Properties of saturated fluorocarbons: Experimental data and modeling using perturbed-chain-SAFT
- Isothermal vapor-liquid equilibrium data for the carbon dioxide (R744) + decafluorobutane (R610) system at temperatures from 263 to 353K
- Vapor-liquid equilibrium data for the dimethyl ether (RE170) + decafluorobutane (R3-1-10) system at temperatures from 313.28 to 392.83 K and pressures up to 4.9 MPa
- Vapor-liquid equilibria of ethylene (C2H4) + decafluorobutane (C4F10) at 268 to 298 K from experiment, molecular simulation and the Peng-Robinson equation of state
- Isothermal vapor liquid equilibrium data for the decafluorobutane(R3110) + 1,1,1,3,3-pentafluorobutane (R365mfc) system attemperatures from 333 K to 441 K
- Experimental (vapour + liquid) equilibrium data and modelling for binary mixtures of decafluorobutane with propane and 1-butene
- Isothermal Vapor-Liquid Equilibrium Data for the Perfluorobutane (R610) + Ethane System at Temperatures from (263 to 353) K
- Vapor Liquid Equilibrium (VLE) Data and Thermodynamic Modeling for Binary Systems Containing Perfluorobutane (R610) with Carbon Monoxide or Nitric Oxide at (293, 313, and 333) K
- Isothermal Vapor Liquid Equilibrium Data and Thermodynamic Modeling for Binary Systems of Perfluorobutane (R610) + (Methane or Hydrogen Sulfide) at (293, 313, and 333) K
- Joback Method
- KDB
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.