- InChI
- InChI=1S/C4F8/c5-1(6)2(7,8)4(11,12)3(1,9)10
- InChI Key
- BCCOBQSFUDVTJQ-UHFFFAOYSA-N
- Formula
- C4F8
- SMILES
- FC1(F)C(F)(F)C(F)(F)C1(F)F
- Molecular Weight1
- 200.03
- CAS
- 115-25-3
- Other Names
-
- CYCLOOCTAFLUOROBUTANE
- Cyclobutane, 1,1,2,2,3,3,4,4-octafluoro-
- FC-C 318
- FREON 318
- Freon C 318
- Halocarbon C-138
- Octafluorocyclobutane
- PERFLUOROCYCLOBUTANE
- Propellant C 318
- R C318
- RC-318
- UN 1976
- freon C-318
- ω : Acentric Factor.
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- EA : Electron affinity (eV).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- ν : Kinematic viscosity (m2/s).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- γ : Surface Tension (N/m).
- ΔvapS : Entropy of vaporization at a given temperature (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.3560 | KDB | |
| EA | [0.40; 1.05] | eV |
|
| EA | 0.63 ± 0.05 | eV | NIST |
| EA | 0.63 ± 0.02 | eV | NIST |
| EA | 0.52 ± 0.05 | eV | NIST |
| EA | 1.05 ± 0.10 | eV | NIST |
| EA | 0.40 ± 0.30 | eV | NIST |
| ΔfG° | -1572.12 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -1628.19 | kJ/mol | Joback Calculated Property |
| ΔfusH° | 4.81 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 12.52 | kJ/mol | Joback Calculated Property |
| log10WS | -3.92 | Aq. Sol... | |
| logPoct/wat | 2.541 | Crippen Calculated Property | |
| McVol | 70.520 | ml/mol | McGowan Calculated Property |
| Pc | [2777.50; 2785.00] | kPa |
|
| Pc | 2784.00 | kPa | KDB |
| Pc | 2784.00 ± 5.00 | kPa | NIST |
| Pc | 2785.00 ± 3.44 | kPa | NIST |
| Pc | 2777.50 ± 8.10 | kPa | NIST |
| Inp | 310.00 | NIST | |
| S°liquid | 291.10 | J/mol×K | NIST |
| Tboil | [223.00; 267.30] | K |
|
| Tboil | 267.16 | K | KDB |
| Tboil | 267.30 | K | NIST |
| Tboil | 266.88 ± 0.20 | K | NIST |
| Tboil | 223.00 ± 10.00 | K | NIST |
| Tc | [388.37; 388.46] | K |
|
| Tc | 388.46 | K | KDB |
| Tc | 388.46 ± 0.30 | K | NIST |
| Tc | 388.44 ± 0.20 | K | NIST |
| Tc | 388.37 ± 0.10 | K | NIST |
| Tfus | [232.96; 233.05] | K |
|
| Tfus | 232.96 | K | KDB |
| Tfus | 233.05 | K | Aq. Sol... |
| Tfus | 233.00 ± 5.00 | K | NIST |
| Ttriple | [232.95; 232.96] | K |
|
| Ttriple | 232.95 | K | KDB |
| Ttriple | 232.96 ± 0.20 | K | NIST |
| Ttriple | 232.96 ± 0.02 | K | NIST |
| Vc | [0.324; 0.325] | m3/kmol |
|
| Vc | 0.324 | m3/kmol | KDB |
| Vc | 0.325 ± 0.020 | m3/kmol | NIST |
| Zc | 0.2792740 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [125.00; 186.23] | J/mol×K | [283.04; 419.47] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 120 130 140 150 160 170 180 190 300 350 400 | ||||
| Cp,gas | 125.00 | J/mol×K | 283.04 | Joback Calculated Property |
| Cp,gas | 138.29 | J/mol×K | 305.78 | Joback Calculated Property |
| Cp,gas | 150.23 | J/mol×K | 328.52 | Joback Calculated Property |
| Cp,gas | 160.91 | J/mol×K | 351.26 | Joback Calculated Property |
| Cp,gas | 170.41 | J/mol×K | 373.99 | Joback Calculated Property |
| Cp,gas | 178.82 | J/mol×K | 396.73 | Joback Calculated Property |
| Cp,gas | 186.23 | J/mol×K | 419.47 | Joback Calculated Property |
| Cp,liquid | [209.77; 222.40] | J/mol×K | [268.52; 296.41] |
|
| Cp,liquid | 209.77 | J/mol×K | 268.52 | NIST |
| Cp,liquid | 222.40 | J/mol×K | 296.41 | NIST |
| ΔvapH | [23.20; 25.00] | kJ/mol | [251.50; 365.50] |
|
|
T(K) Enthalpy of vaporization at a given temperature (kJ/mol) 23.5 24 24.5 25 250 300 350 | ||||
| ΔvapH | 25.00 | kJ/mol | 251.50 | NIST |
| ΔvapH | 24.90 | kJ/mol | 253.50 | NIST |
| ΔvapH | 23.72 | kJ/mol | 261.25 | NIST |
| ΔvapH | 23.35 | kJ/mol | 267.20 | KDB |
| ΔvapH | 25.00 | kJ/mol | 310.50 | NIST |
| ΔvapH | 23.50 | kJ/mol | 318.50 | NIST |
| ΔvapH | 23.20 | kJ/mol | 365.50 | NIST |
| Pvap | [39.00; 1329.00] | kPa | [247.90; 352.36] |
|
|
T(K) Vapor pressure (kPa) 0 200 400 600 800 1000 1200 1400 250 300 350 | ||||
| Pvap | 39.00 | kPa | 247.90 | Isother... |
| Pvap | 41.00 | kPa | 248.25 | Isother... |
| Pvap | 40.00 | kPa | 248.30 | Isother... |
| Pvap | 51.00 | kPa | 253.38 | Isother... |
| Pvap | 81.00 | kPa | 263.00 | Isother... |
| Pvap | 85.40 | kPa | 263.15 | Measure... |
| Pvap | 92.00 | kPa | 265.93 | Isother... |
| Pvap | 99.00 | kPa | 267.92 | Isother... |
| Pvap | 110.00 | kPa | 269.89 | Isother... |
| Pvap | 122.00 | kPa | 272.90 | Isother... |
| Pvap | 130.50 | kPa | 273.15 | Measure... |
| Pvap | 148.00 | kPa | 277.87 | Isother... |
| Pvap | 180.00 | kPa | 282.90 | Isother... |
| Pvap | 190.20 | kPa | 283.15 | Measure... |
| Pvap | 216.00 | kPa | 287.89 | Isother... |
| Pvap | 257.00 | kPa | 292.89 | Isother... |
| Pvap | 266.10 | kPa | 293.15 | Measure... |
| Pvap | 371.10 | kPa | 303.15 | Measure... |
| Pvap | 362.00 | kPa | 303.37 | Isother... |
| Pvap | 486.00 | kPa | 313.09 | Isother... |
| Pvap | 635.00 | kPa | 322.53 | Isother... |
| Pvap | 889.00 | kPa | 335.34 | Isother... |
| Pvap | 1055.00 | kPa | 342.37 | Isother... |
| Pvap | 1329.00 | kPa | 352.36 | Isother... |
| ρl | 1654.00 | kg/m3 | 253.00 | KDB |
| γ | 0.01 | N/m | 294.30 | KDB |
| ΔvapS | 90.80 | J/mol×K | 261.25 | NIST |
Datasets
Kinematic viscosity, m2/s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Pressure, kPa - Gas | Kinematic viscosity, m2/s - Gas |
| 300.00 | 160.13 | 8.5370e-07 |
| 300.00 | 180.38 | 7.6210e-07 |
| 300.00 | 209.45 | 6.4740e-07 |
| 300.00 | 239.58 | 5.5450e-07 |
| 310.00 | 167.11 | 1.0400e-06 |
| 310.00 | 212.21 | 6.6500e-07 |
| 310.00 | 259.63 | 5.4500e-07 |
| 310.00 | 319.54 | 4.4000e-07 |
| 310.00 | 359.99 | 4.2100e-07 |
| 315.00 | 195.64 | 7.5700e-07 |
| 315.00 | 234.75 | 6.3900e-07 |
| 315.00 | 272.93 | 5.3800e-07 |
| 315.00 | 312.27 | 4.6120e-07 |
| 315.00 | 357.70 | 3.9880e-07 |
| 315.00 | 410.27 | 3.4170e-07 |
| 320.00 | 122.60 | 1.1210e-06 |
| 320.00 | 172.92 | 9.2000e-07 |
| 320.00 | 222.82 | 6.6000e-07 |
| 320.00 | 274.43 | 5.3800e-07 |
| 320.00 | 326.85 | 4.4800e-07 |
| 320.00 | 380.03 | 3.9190e-07 |
| 320.00 | 482.22 | 2.9500e-07 |
| 330.00 | 117.49 | 1.4330e-06 |
| 330.00 | 189.29 | 8.8100e-07 |
| 330.00 | 215.35 | 7.7700e-07 |
| 330.00 | 288.39 | 5.6300e-07 |
| 330.00 | 290.78 | 5.6700e-07 |
| 330.00 | 368.85 | 4.3010e-07 |
| 330.00 | 376.53 | 4.2040e-07 |
| 330.00 | 450.70 | 3.4510e-07 |
| 330.00 | 465.61 | 3.2960e-07 |
| 330.00 | 534.61 | 2.8270e-07 |
| 330.00 | 536.09 | 2.8030e-07 |
| 330.00 | 621.46 | 2.3650e-07 |
| 330.00 | 621.46 | 2.3690e-07 |
| 345.04 | 244.86 | 7.3000e-07 |
| 345.04 | 347.35 | 5.1400e-07 |
| 345.04 | 445.79 | 3.8600e-07 |
| 345.04 | 553.32 | 3.0450e-07 |
| 345.04 | 652.37 | 2.5240e-07 |
| 345.04 | 772.66 | 2.0560e-07 |
| 345.04 | 881.89 | 1.7620e-07 |
| 360.00 | 216.10 | 9.1500e-07 |
| 360.00 | 407.30 | 4.7400e-07 |
| 360.00 | 609.73 | 3.2020e-07 |
| 360.00 | 802.73 | 2.1900e-07 |
| 360.00 | 1012.20 | 1.6840e-07 |
| 360.00 | 1203.26 | 1.3540e-07 |
| 375.00 | 183.85 | 1.1170e-06 |
| 375.00 | 378.87 | 5.5300e-07 |
| 375.00 | 568.99 | 3.5370e-07 |
| 375.00 | 758.63 | 2.5900e-07 |
| 375.00 | 960.10 | 2.0460e-07 |
| 375.00 | 1188.17 | 1.5550e-07 |
| 375.00 | 1402.03 | 1.2780e-07 |
| 375.00 | 1620.38 | 1.0630e-07 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 2734.16] | kPa | [195.24; 388.38] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.42253e+01 | |||
| Coefficient B | -2.22800e+03 | |||
| Coefficient C | -3.53850e+01 | |||
| Temperature range, min. | 195.24 | |||
| Temperature range, max. | 388.38 | |||
|
T(K) Vapor pressure (kPa) 0 500 1000 1500 2000 2500 3000 200 250 300 350 | ||||
| Pvap | 1.33 | kPa | 195.24 | Calculated Property |
| Pvap | 6.94 | kPa | 216.70 | Calculated Property |
| Pvap | 25.48 | kPa | 238.16 | Calculated Property |
| Pvap | 72.91 | kPa | 259.62 | Calculated Property |
| Pvap | 173.67 | kPa | 281.08 | Calculated Property |
| Pvap | 359.80 | kPa | 302.54 | Calculated Property |
| Pvap | 668.92 | kPa | 324.00 | Calculated Property |
| Pvap | 1141.30 | kPa | 345.46 | Calculated Property |
| Pvap | 1817.16 | kPa | 366.92 | Calculated Property |
| Pvap | 2734.16 | kPa | 388.38 | Calculated Property |
| Pvap | [18.98; 2767.95] | kPa | [232.96; 388.37] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 8.86963e+01 | |||
| Coefficient B | -5.42536e+03 | |||
| Coefficient C | -1.16250e+01 | |||
| Coefficient D | 1.66194e-05 | |||
| Temperature range, min. | 232.96 | |||
| Temperature range, max. | 388.37 | |||
|
T(K) Vapor pressure (kPa) 0 500 1000 1500 2000 2500 3000 250 300 350 | ||||
| Pvap | 18.98 | kPa | 232.96 | Calculated Property |
| Pvap | 47.36 | kPa | 250.23 | Calculated Property |
| Pvap | 102.54 | kPa | 267.50 | Calculated Property |
| Pvap | 198.63 | kPa | 284.76 | Calculated Property |
| Pvap | 352.38 | kPa | 302.03 | Calculated Property |
| Pvap | 582.97 | kPa | 319.30 | Calculated Property |
| Pvap | 912.18 | kPa | 336.57 | Calculated Property |
| Pvap | 1365.14 | kPa | 353.83 | Calculated Property |
| Pvap | 1971.61 | kPa | 371.10 | Calculated Property |
| Pvap | 2767.95 | kPa | 388.37 | Calculated Property |
Similar Compounds
Find more compounds similar to Cyclobutane, octafluoro-.
Mixtures
- Ethene, tetrafluoro- + Cyclobutane, octafluoro-
- Perfluoropropane + Cyclobutane, octafluoro-
- Cyclobutane, octafluoro- + Hexafluoropropylene oxide
- Propene, hexafluoro- + Cyclobutane, octafluoro-
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Kinematic viscosity and speed of sound in gaseous CO, CO2, SiF4, SF6, C4F8, and NH3 from 220 K to 375 K and pressures up to 3.4 MPa
- Isothermal Vapor Liquid Equilibrium Data for the 1,1,2,2-Tetrafluoroethene + 1,1,2,2,3,3,4,4-Octafluorocyclobutane Binary System: Measurement and Modeling from (248 to 283) K
- Measurement of Vapor Liquid Equilibria for the Binary Mixture of Octafluoropropane and Hexafluoropropylene Oxide Containing Octafluorocyclobutane
- Isothermal Vapor Liquid Equilibrium Data for the 1,1,2,3,3,3-Hexafluoroprop-1-ene +1,1,2,2,3,3,4,4-Octafluorocyclobutane Binary System: Measurement and Modeling from (292 to 352) K and Pressures up to 2.6 MPa
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.