- InChI
- InChI=1S/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3
- InChI Key
- XNLICIUVMPYHGG-UHFFFAOYSA-N
- Formula
- C5H10O
- SMILES
- CCCC(C)=O
- Molecular Weight1
- 86.13
- CAS
- 107-87-9
- Other Names
-
- ETHYL ACETONE
- MPK
- Methyl n-propyl ketone
- Methyl propyl ketone
- Metylopropyloketon
- NSC 5350
- Pentan-2-one
- Pentanone-2
- Propyl methyl ketone
- UN 1249
- n-C3H7COCH3
- n-Propyl methyl ketone
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°gas : Standard gas enthalpy of combustion (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- csound,fluid : Speed of sound in fluid (m/s).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.3460 | KDB | |
| PAff | 832.70 | kJ/mol | NIST |
| BasG | 800.90 | kJ/mol | NIST |
| ΔcH°gas | -3156.00 | kJ/mol | NIST |
| ΔcH°liquid | -3099.40 ± 0.80 | kJ/mol | NIST |
| μ | 2.50 | debye | KDB |
| ΔfG° | -137.20 | kJ/mol | KDB |
| ΔfH°gas | [-259.10; -258.80] | kJ/mol |
|
| ΔfH°gas | -258.80 | kJ/mol | KDB |
| ΔfH°gas | -259.10 ± 1.10 | kJ/mol | NIST |
| ΔfH°liquid | -297.30 ± 1.10 | kJ/mol | NIST |
| ΔfusH° | 10.30 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [38.30; 38.46] | kJ/mol |
|
| ΔvapH° | 38.46 | kJ/mol | NIST |
| ΔvapH° | 38.43 | kJ/mol | NIST |
| ΔvapH° | 38.40 | kJ/mol | NIST |
| ΔvapH° | 38.30 ± 0.30 | kJ/mol | NIST |
| ΔvapH° | 38.40 | kJ/mol | NIST |
| IE | [9.28; 9.47] | eV |
|
| IE | 9.38 ± 0.06 | eV | NIST |
| IE | Outlier 9.28 ± 0.02 | eV | NIST |
| IE | 9.38 ± 0.01 | eV | NIST |
| IE | 9.40 ± 0.01 | eV | NIST |
| IE | 9.37 ± 0.02 | eV | NIST |
| IE | 9.39 ± 0.02 | eV | NIST |
| IE | 9.47 ± 0.03 | eV | NIST |
| IE | 9.46 | eV | NIST |
| IE | 9.44 | eV | NIST |
| log10WS | [-0.19; -0.19] |
|
|
| log10WS | -0.19 | Aq. Sol... | |
| log10WS | -0.19 | Estimat... | |
| logPoct/wat | 1.375 | Crippen Calculated Property | |
| McVol | 82.880 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 3 | KDB | |
| NFPA Health | 2 | KDB | |
| Pc | [3694.00; 3890.00] | kPa |
|
| Pc | 3694.00 | kPa | KDB |
| Pc | 3694.00 ± 20.00 | kPa | NIST |
| Pc | 3890.00 ± 48.30 | kPa | NIST |
| ρc | 285.96 ± 7.75 | kg/m3 | NIST |
| Inp | [623.00; 716.00] |
|
|
| Inp | 663.30 | NIST | |
| Inp | 667.09 | NIST | |
| Inp | 666.82 | NIST | |
| Inp | 666.11 | NIST | |
| Inp | 665.42 | NIST | |
| Inp | 666.63 | NIST | |
| Inp | 667.23 | NIST | |
| Inp | 668.17 | NIST | |
| Inp | 668.33 | NIST | |
| Inp | 669.68 | NIST | |
| Inp | 670.44 | NIST | |
| Inp | 672.02 | NIST | |
| Inp | 674.86 | NIST | |
| Inp | 693.14 | NIST | |
| Inp | 692.22 | NIST | |
| Inp | 691.63 | NIST | |
| Inp | 691.20 | NIST | |
| Inp | 690.53 | NIST | |
| Inp | 691.40 | NIST | |
| Inp | 691.57 | NIST | |
| Inp | 691.79 | NIST | |
| Inp | 692.92 | NIST | |
| Inp | 694.09 | NIST | |
| Inp | 696.34 | NIST | |
| Inp | 697.44 | NIST | |
| Inp | 672.20 | NIST | |
| Inp | 673.99 | NIST | |
| Inp | 671.87 | NIST | |
| Inp | 652.20 | NIST | |
| Inp | 638.93 | NIST | |
| Inp | 666.90 | NIST | |
| Inp | 665.40 | NIST | |
| Inp | 665.40 | NIST | |
| Inp | 665.40 | NIST | |
| Inp | 665.40 | NIST | |
| Inp | 665.69 | NIST | |
| Inp | 666.07 | NIST | |
| Inp | Outlier 631.00 | NIST | |
| Inp | 636.00 | NIST | |
| Inp | 667.00 | NIST | |
| Inp | 665.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 674.00 | NIST | |
| Inp | 676.00 | NIST | |
| Inp | 672.00 | NIST | |
| Inp | 673.00 | NIST | |
| Inp | 649.00 | NIST | |
| Inp | 669.20 | NIST | |
| Inp | 675.30 | NIST | |
| Inp | 663.00 | NIST | |
| Inp | 682.00 | NIST | |
| Inp | Outlier 629.60 | NIST | |
| Inp | 688.50 | NIST | |
| Inp | 690.00 | NIST | |
| Inp | 691.20 | NIST | |
| Inp | 685.60 | NIST | |
| Inp | 685.00 | NIST | |
| Inp | 668.00 | NIST | |
| Inp | 668.00 | NIST | |
| Inp | 672.00 | NIST | |
| Inp | 675.00 | NIST | |
| Inp | 671.00 | NIST | |
| Inp | Outlier 630.00 | NIST | |
| Inp | 636.00 | NIST | |
| Inp | Outlier 624.00 | NIST | |
| Inp | Outlier 627.00 | NIST | |
| Inp | Outlier 626.00 | NIST | |
| Inp | Outlier 631.00 | NIST | |
| Inp | 671.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 646.00 | NIST | |
| Inp | 653.00 | NIST | |
| Inp | 644.00 | NIST | |
| Inp | 642.00 | NIST | |
| Inp | Outlier 634.80 | NIST | |
| Inp | 673.00 | NIST | |
| Inp | 674.00 | NIST | |
| Inp | Outlier 624.00 | NIST | |
| Inp | Outlier 623.00 | NIST | |
| Inp | 642.00 | NIST | |
| Inp | 654.00 | NIST | |
| Inp | 644.00 | NIST | |
| Inp | 638.00 | NIST | |
| Inp | 687.00 | NIST | |
| Inp | 703.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 692.00 | NIST | |
| Inp | 697.00 | NIST | |
| Inp | 664.80 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 651.00 | NIST | |
| Inp | 699.00 | NIST | |
| Inp | 683.00 | NIST | |
| Inp | 689.00 | NIST | |
| Inp | 685.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 673.90 | NIST | |
| Inp | 653.00 | NIST | |
| Inp | 689.00 | NIST | |
| Inp | 681.80 | NIST | |
| Inp | 692.00 | NIST | |
| Inp | 653.00 | NIST | |
| Inp | 653.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 692.00 | NIST | |
| Inp | 673.00 | NIST | |
| Inp | 653.00 | NIST | |
| Inp | 653.00 | NIST | |
| Inp | 693.00 | NIST | |
| Inp | Outlier 715.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 698.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 682.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 689.00 | NIST | |
| Inp | Outlier 715.00 | NIST | |
| Inp | Outlier 715.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 682.00 | NIST | |
| Inp | Outlier 630.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 700.00 | NIST | |
| Inp | 663.00 | NIST | |
| Inp | 664.00 | NIST | |
| Inp | 661.00 | NIST | |
| Inp | 662.00 | NIST | |
| Inp | 662.00 | NIST | |
| Inp | 662.00 | NIST | |
| Inp | 645.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | Outlier 711.00 | NIST | |
| Inp | 700.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | Outlier 716.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 677.00 | NIST | |
| Inp | 667.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 667.00 | NIST | |
| Inp | 668.00 | NIST | |
| Inp | 669.00 | NIST | |
| Inp | 669.00 | NIST | |
| Inp | 667.00 | NIST | |
| Inp | 670.00 | NIST | |
| Inp | 669.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 668.00 | NIST | |
| Inp | 668.00 | NIST | |
| Inp | 670.00 | NIST | |
| Inp | 665.00 | NIST | |
| Inp | 655.00 | NIST | |
| Inp | 640.00 | NIST | |
| Inp | 671.00 | NIST | |
| Inp | 668.00 | NIST | |
| Inp | 678.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 670.00 | NIST | |
| Inp | 661.00 | NIST | |
| Inp | 703.00 | NIST | |
| Inp | 685.00 | NIST | |
| Inp | 685.00 | NIST | |
| Inp | 662.00 | NIST | |
| Inp | 698.00 | NIST | |
| Inp | 698.00 | NIST | |
| Inp | 688.00 | NIST | |
| Inp | 689.00 | NIST | |
| Inp | 671.00 | NIST | |
| Inp | 687.00 | NIST | |
| Inp | 685.00 | NIST | |
| Inp | 659.00 | NIST | |
| Inp | 655.00 | NIST | |
| Inp | 681.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | 664.00 | NIST | |
| Inp | 674.00 | NIST | |
| Inp | 685.00 | NIST | |
| Inp | 681.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 693.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 690.00 | NIST | |
| Inp | 682.00 | NIST | |
| Inp | 652.00 | NIST | |
| Inp | 655.00 | NIST | |
| Inp | 652.00 | NIST | |
| Inp | 658.00 | NIST | |
| Inp | 688.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | 690.00 | NIST | |
| Inp | 672.00 | NIST | |
| Inp | 658.00 | NIST | |
| Inp | 672.00 | NIST | |
| Inp | 679.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 664.00 | NIST | |
| Inp | 665.00 | NIST | |
| Inp | 660.00 | NIST | |
| Inp | 677.00 | NIST | |
| Inp | 673.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 699.00 | NIST | |
| Inp | 674.00 | NIST | |
| Inp | 699.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 690.00 | NIST | |
| Inp | 673.00 | NIST | |
| Inp | 660.00 | NIST | |
| Inp | 671.00 | NIST | |
| Inp | 700.00 | NIST | |
| Inp | 654.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 682.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 689.00 | NIST | |
| Inp | 689.00 | NIST | |
| Inp | 689.00 | NIST | |
| Inp | 700.00 | NIST | |
| Inp | 649.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | 665.00 | NIST | |
| Inp | 672.00 | NIST | |
| Inp | 678.00 | NIST | |
| Inp | 653.00 | NIST | |
| Inp | 665.00 | NIST | |
| Inp | 685.00 | NIST | |
| Inp | 687.00 | NIST | |
| Inp | 679.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 644.00 | NIST | |
| Inp | Outlier 629.00 | NIST | |
| Inp | 663.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 669.00 | NIST | |
| Inp | 670.00 | NIST | |
| Inp | 676.00 | NIST | |
| Inp | 663.00 | NIST | |
| Inp | 663.00 | NIST | |
| Inp | 669.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 658.00 | NIST | |
| Inp | 672.00 | NIST | |
| Inp | 664.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 674.00 | NIST | |
| Inp | 639.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 687.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | 689.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 653.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | Outlier 715.00 | NIST | |
| Inp | 700.00 | NIST | |
| Inp | 662.00 | NIST | |
| Inp | 666.00 | NIST | |
| Inp | 663.30 | NIST | |
| Inp | 666.63 | NIST | |
| Inp | 670.44 | NIST | |
| Inp | 691.63 | NIST | |
| Inp | 691.79 | NIST | |
| Inp | 672.20 | NIST | |
| Inp | 666.90 | NIST | |
| Inp | 665.69 | NIST | |
| Inp | 665.00 | NIST | |
| Inp | 672.00 | NIST | |
| Inp | 663.00 | NIST | |
| Inp | 691.20 | NIST | |
| Inp | Outlier 624.00 | NIST | |
| Inp | Outlier 634.80 | NIST | |
| Inp | 642.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 671.00 | NIST | |
| Inp | 661.00 | NIST | |
| Inp | 698.00 | NIST | |
| Inp | 681.00 | NIST | |
| Inp | 682.00 | NIST | |
| Inp | 688.00 | NIST | |
| Inp | 660.00 | NIST | |
| Inp | 667.00 | NIST | |
| Inp | 669.00 | NIST | |
| Inp | 668.00 | NIST | |
| Inp | 640.00 | NIST | |
| I | [938.00; 1025.00] |
|
|
| I | 1003.89 | NIST | |
| I | 1005.72 | NIST | |
| I | 1007.52 | NIST | |
| I | 1009.73 | NIST | |
| I | 1011.09 | NIST | |
| I | 1012.78 | NIST | |
| I | 1014.87 | NIST | |
| I | 1016.30 | NIST | |
| I | 1018.39 | NIST | |
| I | 1020.31 | NIST | |
| I | 1022.25 | NIST | |
| I | Outlier 1023.72 | NIST | |
| I | 986.78 | NIST | |
| I | 1015.63 | NIST | |
| I | 1021.54 | NIST | |
| I | 1010.70 | NIST | |
| I | 996.20 | NIST | |
| I | 1000.70 | NIST | |
| I | 1005.60 | NIST | |
| I | 990.20 | NIST | |
| I | 979.40 | NIST | |
| I | 992.60 | NIST | |
| I | 994.60 | NIST | |
| I | 979.00 | NIST | |
| I | 996.00 | NIST | |
| I | 974.00 | NIST | |
| I | 978.00 | NIST | |
| I | 969.00 | NIST | |
| I | 990.00 | NIST | |
| I | 998.00 | NIST | |
| I | 969.00 | NIST | |
| I | 997.60 | NIST | |
| I | 983.00 | NIST | |
| I | 968.00 | NIST | |
| I | 945.00 | NIST | |
| I | 971.00 | NIST | |
| I | 978.00 | NIST | |
| I | 1005.00 | NIST | |
| I | 985.00 | NIST | |
| I | 991.10 | NIST | |
| I | 945.00 | NIST | |
| I | 944.00 | NIST | |
| I | 943.00 | NIST | |
| I | 944.00 | NIST | |
| I | 996.00 | NIST | |
| I | 988.00 | NIST | |
| I | 980.00 | NIST | |
| I | 975.00 | NIST | |
| I | 975.00 | NIST | |
| I | 993.00 | NIST | |
| I | 978.00 | NIST | |
| I | Outlier 938.00 | NIST | |
| I | 977.00 | NIST | |
| I | Outlier 938.00 | NIST | |
| I | 943.00 | NIST | |
| I | 978.00 | NIST | |
| I | 979.00 | NIST | |
| I | 983.40 | NIST | |
| I | 984.30 | NIST | |
| I | 984.40 | NIST | |
| I | 987.00 | NIST | |
| I | 971.00 | NIST | |
| I | 980.00 | NIST | |
| I | 980.00 | NIST | |
| I | 982.00 | NIST | |
| I | 979.00 | NIST | |
| I | 980.00 | NIST | |
| I | 984.00 | NIST | |
| I | 983.00 | NIST | |
| I | 968.00 | NIST | |
| I | 944.00 | NIST | |
| I | 971.00 | NIST | |
| I | 970.00 | NIST | |
| I | 974.00 | NIST | |
| I | 976.00 | NIST | |
| I | 965.00 | NIST | |
| I | 990.00 | NIST | |
| I | 1001.00 | NIST | |
| I | 981.00 | NIST | |
| I | 971.00 | NIST | |
| I | 984.00 | NIST | |
| I | 982.00 | NIST | |
| I | 972.00 | NIST | |
| I | 970.00 | NIST | |
| I | 992.00 | NIST | |
| I | 1015.00 | NIST | |
| I | 1018.00 | NIST | |
| I | 983.00 | NIST | |
| I | 990.00 | NIST | |
| I | Outlier 1025.00 | NIST | |
| I | 980.00 | NIST | |
| I | 992.00 | NIST | |
| I | 960.00 | NIST | |
| I | 975.00 | NIST | |
| I | 975.00 | NIST | |
| I | 969.00 | NIST | |
| I | 957.00 | NIST | |
| I | 969.00 | NIST | |
| I | 975.00 | NIST | |
| I | Outlier 940.00 | NIST | |
| I | 990.00 | NIST | |
| I | 1000.00 | NIST | |
| I | 989.00 | NIST | |
| I | 971.00 | NIST | |
| I | 976.00 | NIST | |
| I | 966.00 | NIST | |
| I | Outlier 940.00 | NIST | |
| I | 975.00 | NIST | |
| I | 969.00 | NIST | |
| I | 975.00 | NIST | |
| I | Outlier 1025.00 | NIST | |
| I | 971.00 | NIST | |
| I | 990.00 | NIST | |
| I | 981.00 | NIST | |
| I | 966.00 | NIST | |
| I | 1005.00 | NIST | |
| I | 982.00 | NIST | |
| I | 969.00 | NIST | |
| I | 979.00 | NIST | |
| I | 980.00 | NIST | |
| I | 944.00 | NIST | |
| I | 983.00 | NIST | |
| I | 983.00 | NIST | |
| I | Outlier 942.00 | NIST | |
| I | 975.00 | NIST | |
| I | 1009.00 | NIST | |
| I | 996.00 | NIST | |
| I | 970.00 | NIST | |
| I | 969.00 | NIST | |
| I | 966.00 | NIST | |
| I | 986.00 | NIST | |
| I | 992.00 | NIST | |
| I | 975.00 | NIST | |
| I | 983.00 | NIST | |
| I | 984.00 | NIST | |
| I | 1003.89 | NIST | |
| I | 1012.78 | NIST | |
| I | 1022.25 | NIST | |
| I | 1010.70 | NIST | |
| I | 979.40 | NIST | |
| I | 966.00 | NIST | |
| I | 980.00 | NIST | |
| I | 975.00 | NIST | |
| I | 984.00 | NIST | |
| I | 983.00 | NIST | |
| I | 1005.00 | NIST | |
| I | 943.00 | NIST | |
| I | 977.00 | NIST | |
| I | 983.40 | NIST | |
| I | 970.00 | NIST | |
| I | 965.00 | NIST | |
| I | 1015.00 | NIST | |
| I | 969.00 | NIST | |
| I | 990.00 | NIST | |
| I | Outlier 1025.00 | NIST | |
| I | 974.00 | NIST | |
| I | 998.00 | NIST | |
| S°liquid | [272.42; 274.10] | J/mol×K |
|
| S°liquid | 274.10 | J/mol×K | NIST |
| S°liquid | 272.42 | J/mol×K | NIST |
| Tboil | [362.05; 400.15] | K |
|
| Tboil | 375.41 | K | KDB |
| Tboil | 375.36 | K | Measure... |
| Tboil | 375.20 | K | NIST |
| Tboil | 375.40 | K | NIST |
| Tboil | 375.45 ± 0.30 | K | NIST |
| Tboil | 375.50 ± 0.30 | K | NIST |
| Tboil | 375.45 | K | NIST |
| Tboil | 375.41 ± 0.03 | K | NIST |
| Tboil | 375.05 ± 0.50 | K | NIST |
| Tboil | 375.00 ± 0.60 | K | NIST |
| Tboil | 375.00 ± 0.30 | K | NIST |
| Tboil | 375.10 ± 0.40 | K | NIST |
| Tboil | 375.10 ± 0.30 | K | NIST |
| Tboil | 375.95 ± 0.50 | K | NIST |
| Tboil | 375.15 ± 2.00 | K | NIST |
| Tboil | 375.45 ± 0.50 | K | NIST |
| Tboil | 375.15 ± 0.50 | K | NIST |
| Tboil | 375.55 ± 0.20 | K | NIST |
| Tboil | 373.65 ± 2.00 | K | NIST |
| Tboil | 375.42 ± 0.44 | K | NIST |
| Tboil | 375.95 ± 0.50 | K | NIST |
| Tboil | 375.25 ± 0.50 | K | NIST |
| Tboil | 375.35 ± 0.50 | K | NIST |
| Tboil | 375.50 ± 0.30 | K | NIST |
| Tboil | 375.45 ± 0.70 | K | NIST |
| Tboil | 373.90 ± 2.00 | K | NIST |
| Tboil | 375.15 ± 1.00 | K | NIST |
| Tboil | 375.50 ± 1.00 | K | NIST |
| Tboil | 375.15 ± 1.00 | K | NIST |
| Tboil | 374.65 ± 2.00 | K | NIST |
| Tboil | 375.15 ± 1.00 | K | NIST |
| Tboil | 375.40 ± 0.50 | K | NIST |
| Tboil | 373.15 ± 5.00 | K | NIST |
| Tboil | 376.15 ± 5.00 | K | NIST |
| Tboil | 375.08 ± 0.20 | K | NIST |
| Tboil | 375.15 ± 0.50 | K | NIST |
| Tboil | 374.15 ± 1.00 | K | NIST |
| Tboil | 373.15 ± 3.00 | K | NIST |
| Tboil | 376.15 ± 3.00 | K | NIST |
| Tboil | 375.65 ± 1.00 | K | NIST |
| Tboil | 375.30 ± 0.50 | K | NIST |
| Tboil | 374.65 ± 1.00 | K | NIST |
| Tboil | 375.25 ± 0.50 | K | NIST |
| Tboil | 375.55 ± 0.50 | K | NIST |
| Tboil | 375.15 ± 1.00 | K | NIST |
| Tboil | 375.40 ± 0.20 | K | NIST |
| Tboil | 374.15 ± 1.00 | K | NIST |
| Tboil | 375.15 ± 0.20 | K | NIST |
| Tboil | 375.45 ± 1.00 | K | NIST |
| Tboil | 375.15 ± 0.30 | K | NIST |
| Tboil | 375.65 ± 3.00 | K | NIST |
| Tboil | 376.15 ± 2.00 | K | NIST |
| Tboil | 374.95 ± 0.50 | K | NIST |
| Tboil | 375.15 ± 1.00 | K | NIST |
| Tboil | Outlier 362.05 ± 1.00 | K | NIST |
| Tboil | 375.15 ± 1.00 | K | NIST |
| Tboil | 374.15 ± 2.00 | K | NIST |
| Tboil | Outlier 400.15 ± 10.00 | K | NIST |
| Tboil | 374.15 ± 4.00 | K | NIST |
| Tboil | 374.15 ± 1.00 | K | NIST |
| Tc | [561.08; 564.00] | K |
|
| Tc | 561.08 | K | KDB |
| Tc | 561.10 | K | NIST |
| Tc | 561.08 ± 0.20 | K | NIST |
| Tc | 564.00 ± 0.56 | K | NIST |
| Tfus | [195.43; 196.20] | K |
|
| Tfus | 196.20 | K | KDB |
| Tfus | 195.43 | K | Aq. Sol... |
| Ttriple | [196.29; 196.35] | K |
|
| Ttriple | 196.31 ± 0.04 | K | NIST |
| Ttriple | 196.29 ± 0.07 | K | NIST |
| Ttriple | 196.35 ± 0.06 | K | NIST |
| Vc | 0.301 | m3/kmol | KDB |
| Zc | 0.2383430 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [142.97; 167.15] | J/mol×K | [369.00; 454.00] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 145 150 155 160 165 380 400 420 440 | ||||
| Cp,gas | 142.97 ± 0.43 | J/mol×K | 369.00 | NIST |
| Cp,gas | 150.62 ± 0.45 | J/mol×K | 394.00 | NIST |
| Cp,gas | 156.40 ± 0.47 | J/mol×K | 414.00 | NIST |
| Cp,gas | 162.00 ± 0.49 | J/mol×K | 434.00 | NIST |
| Cp,gas | 167.15 ± 0.50 | J/mol×K | 454.00 | NIST |
| Cp,liquid | [184.20; 185.40] | J/mol×K | [298.15; 298.15] |
|
|
T(K) Liquid phase heat capacity (J/mol×K) 184.2 184.4 184.6 184.8 185 185.2 185.4 | ||||
| Cp,liquid | 185.40 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 185.10 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 184.30 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 184.20 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 184.35 | J/mol×K | 298.15 | NIST |
| η | [0.0004440; 0.0004960] | Pa×s | [293.15; 303.15] |
|
|
T(K) Dynamic viscosity (Pa×s) 4.40e-4 4.50e-4 4.60e-4 4.70e-4 4.80e-4 4.90e-4 5.00e-4 295 300 | ||||
| η | 0.0004960 | Pa×s | 293.15 | Physica... |
| η | 0.0004960 | Pa×s | 293.15 | Dynamic... |
| η | 0.0004690 | Pa×s | 298.15 | Physica... |
| η | 0.0004690 | Pa×s | 298.15 | Dynamic... |
| η | 0.0004440 | Pa×s | 303.15 | Physica... |
| η | 0.0004440 | Pa×s | 303.15 | Dynamic... |
| ΔfusH | [2.09; 10.63] | kJ/mol | [110.00; 196.35] |
|
| ΔfusH | 2.09 | kJ/mol | 110.00 | NIST |
| ΔfusH | 10.63 | kJ/mol | 196.30 | NIST |
| ΔfusH | 10.62 | kJ/mol | 196.35 | NIST |
| ΔvapH | [32.20; 39.50] | kJ/mol | [320.50; 524.00] |
|
|
T(K) Enthalpy of vaporization at a given temperature (kJ/mol) 32 34 36 38 40 350 400 450 500 | ||||
| ΔvapH | 39.50 | kJ/mol | 320.50 | NIST |
| ΔvapH | 36.10 ± 0.10 | kJ/mol | 335.00 | NIST |
| ΔvapH | 36.50 | kJ/mol | 357.00 | NIST |
| ΔvapH | 34.40 ± 0.10 | kJ/mol | 360.00 | NIST |
| ΔvapH | 33.40 ± 0.10 | kJ/mol | 375.00 | NIST |
| ΔvapH | 33.47 | kJ/mol | 375.40 | KDB |
| ΔvapH | 33.44 | kJ/mol | 375.40 | NIST |
| ΔvapH | 36.10 | kJ/mol | 379.00 | NIST |
| ΔvapH | 32.80 ± 0.10 | kJ/mol | 386.00 | NIST |
| ΔvapH | 32.20 ± 0.10 | kJ/mol | 394.00 | NIST |
| ΔvapH | 33.70 | kJ/mol | 458.50 | NIST |
| ΔvapH | 33.30 | kJ/mol | 524.00 | NIST |
| n0 | [1.38810; 1.39060] | [293.15; 298.15] |
|
|
|
T(K) Refractive Index 1.39 1.39 1.39 1.39 1.39 1.39 294 296 298 | ||||
| n0 | 1.39060 | 293.15 | Isother... | |
| n0 | 1.38930 | 293.15 | Isother... | |
| n0 | 1.38920 | 293.15 | Solid-L... | |
| n0 | 1.38930 | 293.15 | Solubil... | |
| n0 | 1.38823 | 298.15 | Propert... | |
| n0 | 1.38830 | 298.15 | Excess ... | |
| n0 | 1.38810 | 298.15 | Phase E... | |
| ρl | [762.27; 811.49] | kg/m3 | [288.15; 338.15] |
|
|
T(K) Liquid Density (kg/m3) 760 770 780 790 800 810 300 320 | ||||
| ρl | 811.49 | kg/m3 | 288.15 | Excess ... |
| ρl | 811.06 | kg/m3 | 288.15 | Thermal... |
| ρl | 806.00 | kg/m3 | 293.00 | KDB |
| ρl | 807.47 | kg/m3 | 293.15 | Volumet... |
| ρl | 806.83 | kg/m3 | 293.15 | Thermod... |
| ρl | 801.41 | kg/m3 | 298.15 | Thermal... |
| ρl | 801.99 | kg/m3 | 298.15 | Thermod... |
| ρl | 802.09 | kg/m3 | 298.15 | Density... |
| ρl | 801.52 | kg/m3 | 298.15 | Thermod... |
| ρl | 801.52 | kg/m3 | 298.15 | Thermod... |
| ρl | 802.46 | kg/m3 | 298.15 | Volumet... |
| ρl | 801.52 | kg/m3 | 298.15 | Thermod... |
| ρl | 796.96 | kg/m3 | 303.15 | Excess ... |
| ρl | 797.53 | kg/m3 | 303.15 | Volumet... |
| ρl | 796.73 | kg/m3 | 303.15 | Thermod... |
| ρl | 796.58 | kg/m3 | 303.15 | Excess ... |
| ρl | 792.32 | kg/m3 | 308.15 | Density... |
| ρl | 792.52 | kg/m3 | 308.15 | Volumet... |
| ρl | 791.66 | kg/m3 | 308.15 | Thermal... |
| ρl | 787.16 | kg/m3 | 313.15 | Excess ... |
| ρl | 787.44 | kg/m3 | 313.15 | Volumet... |
| ρl | 782.44 | kg/m3 | 318.15 | Density... |
| ρl | 781.83 | kg/m3 | 318.15 | Thermal... |
| ρl | 772.43 | kg/m3 | 328.15 | Density... |
| ρl | 762.27 | kg/m3 | 338.15 | Density... |
| ΔfusS | [2.18; 54.14] | J/mol×K | [110.00; 196.35] |
|
| ΔfusS | 2.18 | J/mol×K | 110.00 | NIST |
| ΔfusS | 54.14 | J/mol×K | 196.30 | NIST |
| ΔfusS | 54.10 | J/mol×K | 196.35 | NIST |
| csound,fluid | [1151.00; 1212.00] | m/s | [298.15; 313.15] |
|
| csound,fluid | 1212.00 | m/s | 298.15 | Vapor l... |
| csound,fluid | 1192.00 | m/s | 303.15 | Densiti... |
| csound,fluid | 1176.00 | m/s | 308.15 | Densiti... |
| csound,fluid | 1151.00 | m/s | 313.15 | Densiti... |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 308.15 | 101.30 | 0.0004 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.63] | kPa | [273.03; 399.81] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.49654e+01 | |||
| Coefficient B | -3.57595e+03 | |||
| Coefficient C | -2.93990e+01 | |||
| Temperature range, min. | 273.03 | |||
| Temperature range, max. | 399.81 | |||
|
T(K) Vapor pressure (kPa) 0 50 100 150 200 300 350 400 | ||||
| Pvap | 1.33 | kPa | 273.03 | Calculated Property |
| Pvap | 2.97 | kPa | 287.12 | Calculated Property |
| Pvap | 6.10 | kPa | 301.20 | Calculated Property |
| Pvap | 11.67 | kPa | 315.29 | Calculated Property |
| Pvap | 21.00 | kPa | 329.38 | Calculated Property |
| Pvap | 35.85 | kPa | 343.46 | Calculated Property |
| Pvap | 58.45 | kPa | 357.55 | Calculated Property |
| Pvap | 91.53 | kPa | 371.64 | Calculated Property |
| Pvap | 138.34 | kPa | 385.72 | Calculated Property |
| Pvap | 202.63 | kPa | 399.81 | Calculated Property |
| Pvap | [1.22; 257.19] | kPa | [275.00; 410.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 1.05592e+02 | |||
| Coefficient B | -8.16731e+03 | |||
| Coefficient C | -1.36252e+01 | |||
| Coefficient D | 1.10014e-05 | |||
| Temperature range, min. | 275.00 | |||
| Temperature range, max. | 410.00 | |||
|
T(K) Vapor pressure (kPa) 0 50 100 150 200 250 300 350 400 | ||||
| Pvap | 1.22 | kPa | 275.00 | Calculated Property |
| Pvap | 3.01 | kPa | 290.00 | Calculated Property |
| Pvap | 6.67 | kPa | 305.00 | Calculated Property |
| Pvap | 13.48 | kPa | 320.00 | Calculated Property |
| Pvap | 25.23 | kPa | 335.00 | Calculated Property |
| Pvap | 44.22 | kPa | 350.00 | Calculated Property |
| Pvap | 73.28 | kPa | 365.00 | Calculated Property |
| Pvap | 115.79 | kPa | 380.00 | Calculated Property |
| Pvap | 175.63 | kPa | 395.00 | Calculated Property |
| Pvap | 257.19 | kPa | 410.00 | Calculated Property |
Similar Compounds
Find more compounds similar to 2-Pentanone.
Mixtures
- Diethyl carbonate + 2-Pentanone
- 2-Pentanone + 1-Propanamine, N-propyl-
- 2-Pentanone + 1-Butanamine, N-butyl-
- 2-Pentanone + Triethylamine
- 2-Pentanone + 2-Pyrrolidinone, 1-methyl-
- Cyclopentane, methyl- + 2-Pentanone
- 2-Pentanone + Dimethyl Sulfoxide
- 2-Pentanone + Formamide, N,N-dimethyl-
- 2-Pentanone + Butane, 1-chloro-
- 2-Pentanone + Heptane
- 2-Pentanone + Butane, 1-chloro- + Heptane
- 2-Pentanone + Water
- 2-Pentanone + 1-Propanol, 2-methyl-
- Isopropyl Alcohol + 2-Pentanone
- 1-Propanol + 2-Pentanone
- 2-Pentanone + 1-Butanol
- 2-Pentanone + 3-Pentanone
- 2-Pentanone + 3-Pentanol
- 2-Pentanone + 3-Pentanone + 3-Pentanol
- 2-Pentanone + Carbonic acid, dimethyl ester
Find more mixtures with 2-Pentanone.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- A relative headspace method for Henry s constants of volatile organic compounds
- Vapor liquid equilibria for systems of diethyl carbonate and ketones and determination of group interaction parameters for the UNIFAC and ASOG methods
- Liquid liquid equilibria of 1,3-dimethylimidazolium methyl sulfate with ketones, dialkyl carbonates and acetates
- Thermodynamics of ketone + amine mixtures. Part IX. Excess molar enthalpies at 298.15K for dipropylamine, or dibutylamine + 2-alkanone systems and modeling of linear or aromatic amine + 2-alkanone mixtures in terms of DISQUAC and ERAS
- Thermodynamics of ketone + amine mixtures. Part X. Excess molarenthalpies at 298.15 K for N,N,N-triethylamine + 2-alkanone systems.Characterization of tertiary amine + 2-alkanone, and ofamino-ketone + n-alkane mixtures in terms of DISQUAC
- Experimental and theoretical study of interaction between organic compounds and 1- (4-sulfobutyl)-3-methylimidazolium based ionic liquids
- Study of interaction between organic compounds and mono or dicationic oxygenated ionic liquids using gas chromatography
- Activity coefficients at infinite dilution for different alcohols and ketones in [EMpy][ESO4]: Experimental data and modeling with PC-SAFT
- Activity coefficients at infinite dilution of organic solvents and water in 1-butyl-3-methylimidazolium dicyanamide. A literature review of hexane/hex-1-ene separation
- High selective water/butan-1-ol separation on investigation of limiting activity coefficients with [P8,8,8,8][[NTf2] ionic liquid
- Separation of binary mixtures based on limiting activity coefficients data using specific ammonium-based ionic liquid and modelling of thermodynamic functions
- Thermodynamics and activity coefficients at infinite dilution for organic solutes in the ionic liquid 1-butyl-1-methylpyrrolidinium dicyanamide
- New ionic liquid [P4,4,4,4][NTf2] in bio-butanol extraction on investigation of limiting activity coefficients
- Ammonium ionic liquids in extraction of bio-butan-1-ol from water phase using activity coefficients at infinite dilution
- A thermodynamic study of the ketoreductase-catalyzed reduction of 2-alkanones in non-aqueous solvents
- Thermodynamics of binary mixtures of N-methyl-2-pyrrolidinone and ketone. Experimental results and modelling of the solid-liquid equilibrium and vapou-liquid equilibrium. The Modified UNIFAC (Do) model characterization
- Systems with ionic liquids: Measurement of VLE and c1 data and prediction of their thermodynamic behavior using original UNIFAC, mod. UNIFAC(Do) and COSMO-RS(Ol)
- Properties of ionic liquid HMIMPF6 with carbonates, ketones and alkyl acetates
- (Liquid + liquid) phase equilibria of 1-alkyl-3-methylimidazolium methylsulfate with alcohols, or ethers, or ketones
- Physical properties of the binary systems methylcyclopentane with ketones (acetone, butanone and 2-pentanone) at T = (293.15, 298.15, and 303.15) K. New UNIFAC-VISCO interaction parameters
- Measurement of activity coefficients at infinite dilution in 1-hexadecyl-3-methylimidazolium tetrafluoroborate ionic liquid
- Excess molar volumes and ultrasonic studies of dimethylsulphoxide with ketones at T = 303.15 K
- Excess molar volumes and ultrasonic studies of N-methyl-2-pyrrolidone with ketones at T = 303.15 K
- Measurements of activity coefficients at infinite dilution of organic solutes and water in 1-propyl-1-methylpiperidinium bis{(trifluoromethyl)sulfonyl}imide ionic liquid using g.l.c.
- Measurements of activity coefficients at infinite dilution of organic compounds and water in isoquinolinium-based ionic liquid [C8iQuin][NTf2] using GLC
- Activity coefficients at infinite dilution measurements for organic solutes and water in the ionic liquid 1-ethyl-3-methylimidazolium tetracyanoborate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(3-hydroxypropyl)pyridinium bis(trifluoromethylsulfonyl)-amide
- Thermodynamics and activity coefficients at infinite dilution measurements for organic solutes and water in the ionic liquid 1-butyl-1-methylpyrrolidinium tetracyanoborate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 4-(2-methoxyethyl)-4-methylmorpholinium bis(trifluoromethylsulfonyl)-amide
- Measurements of activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-hexyl-3-methylimidazolium tetracyanoborate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)-1-methylpiperidinium bis(trifluoromethylsulfonyl)-amide
- Measurements of activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-ethyl-3-methylimidazolium methanesulfonate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)-1-methylpyrrolidinium bis(trifluoromethylsulfonyl)-amide
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 4-(2-methoxyethyl)-4-methylmorpholinium trifluorotris(perfluoroethyl)phosphate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)- 1-methylpiperidinium trifluorotris(perfluoroethyl)phosphate
- Physicochemical properties and activity coefficients at infinite dilution for organic solutes and water in a novel bicyclic guanidinium superbase-derived protic ionic liquid
- Experimental and theoretical study on infinite dilution activity coefficients of various solutes in piperidinium ionic liquids
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)- 1-methylpyrrolidinium trifluorotris(perfluoroethyl)phosphate
- Measurements of activity coefficients at infinite dilution for organic solutes and water in N-hexylisoquinolinium thiocyanate, [HiQuin][SCN] using GLC
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-hydroxyethyl)- 3-methylimidazolium trifluorotris(perfluoroethyl)phosphate
- Measurements of activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-butyl-1-methylpyrrolidinium tricyanomethanide
- Thermodynamics and activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-butyl-1-methylmorpholinium tricyanomethanide
- The study of activity coefficients at infinite dilution for organic solutes and water in 1-butyl-4-methylpyridinium dicyanamide, [B4MPy][DCA] using GLC
- Measurement of activity coefficients at infinite dilution of organic solutes in the ionic liquid 1-hexyl-1,4-diaza[2.2.2]bicyclooctanium bis(trifluoromethylsulfonyl)imide using gas-liquid chromatography
- Thermodynamics and activity coefficients at infinite dilution for organic solutes, water and diols in the ionic liquid choline bis(trifluoromethylsulfonyl)imide
- Solvation parameter model and thermodynamic parameters in a dicationic ionic liquid based on pyrrolidinium
- Experimental and theoretically study of interaction between organic compounds and tricyanomethanide based ionic liquids
- Activity coefficients at infinite dilution of organic solutes in methylphosphonate based ionic liquids using gas-liquid chromatography
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 4-(3-hydroxypropyl)-4-methylmorpholinium bis(trifluoromethylsulfonyl)-amide
- Activity coefficients at infinite dilution for organic solutes and water in 1-ethyl-1-methylpyrrolidinium lactate
- Activity coefficients at infinite dilution, physicochemical and thermodynamic properties for organic solutes and water in the ionic liquid ethyl-dimethyl-(2-methoxyethyl)ammonium trifluorotris-(perfluoroethyl)phosphate
- Screening of environmental friendly ionic liquid as a solvent for the different types of separations problem: Insight from activity coefficients at infinite dilution measurement using (gas + liquid) chromatography technique
- A 1-alkylcyanopyridinium-based ionic liquid in the separation processes
- Thermodynamics of amide + ketone mixtures. 1. Volumetric, speed of sound and refractive index data for N,N-dimethylformamide + 2-alkanone systems at several temperatures
- Thermodynamics and selectivity of separation based on activity coefficients at infinite dilution of various solutes in 1-allyl-3-methylimidazolium bis{(trifluoromethyl)sulfonyl}imide ionic liquid
- Separation of aliphatic from aromatic hydrocarbons and sulphur compounds from fuel based on measurements of activity coefficients at infinite dilution for organic solutes and water in the ionic liquid N,N-diethyl-N-methyl-N-(2-methoxy-ethyl)ammonium bis(trifluoromethylsulfonyl)imide
- Thermodynamics and limiting activity coefficients measurements for organic solutes and water in the ionic liquid 1-dodecyl-3-methylimidzolium bis(trifluoromethylsulfonyl) imide
- Measurement and thermodynamic modeling of ternary (liquid + liquid) equilibrium for extraction of o-cresol, m-cresol or p-cresol from aqueous solution with 2-pentanone
- Separation of binary mixtures hexane/hex-1-ene, cyclohexane/cyclohexene and ethylbenzene/styrene based on limiting activity coefficients
- Separation of water/butan-1-ol based on activity coefficients at infinite dilution in 1,3-didecyl-2-methylimidazolium dicyanamide ionic liquid
- Separation of binary mixtures hexane/hex-1-ene, cyclohexane/cyclohexene and ethylbenzene/styrene based on gamma infinity data measurements
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid trihexyl-tetradecyl-phosphonium tricyanomethanide
- Thermodynamic study of molecular interaction-selectivity in separation processes based on limiting activity coefficients
- The use of ionic liquids for separation of binary hydrocarbons mixtures based on gamma infinity data measurements
- Excess molar volumes of (1-chlorobutane +heptane + 2-butanone or 2-pentanone) at 288.15 , 303.15 and 313.15 K . Measurements and correlations.
- Activity Coefficients at Infinite Dilution of Organic Solutes and Water in Tributylethylphosphonium Diethylphosphate Using Gas Liquid Chromatography: Thermodynamic Properties of Mixtures Containing Ionic Liquids
- Thermal and Volumetric Properties of Some C5 and C6 Alkanones at Infinite Dilution in Water
- Liquid-Liquid Equilibria for Ternary (Methyl Propyl Ketone + Hydroquinone or Resorcinol + Water) Systems at 298.15, 318.15, and 333.15 K
- Solubility Measurement and Thermodynamic Modeling of Benzoic Acid in Monosolvents and Binary Mixtures
- Liquid-Liquid Equilibrium for Ternary Systems of 2-Pentanone/Mesityl Oxide + Catechol + Water at 298.2, 318.2, and 333.2 K
- Isothermal Vapor-Liquid Equilibrium for the 2-Pentanone (MPK) + 2-Methyl Propan-1-ol Binary Mixture
- Density, Speed of Sound, and Refractive Index Measurements for Binary Mixtures of Pentan-2-one with Propan-2-ol and Butan-2-ol
- Thermodynamic Parameters of a New Synthesized Tricationic Ionic Liquid Stationary Phase by Inverse Gas Chromatography
- Isothermal Vapor-Liquid Equilibrium Measurements for the Pentan-2-one + Propan-1-ol/Butan-1-ol System within 342-363 K
- Solid-Liquid Equilibrium Measurements for Posaconazole and Voriconazole in Several Solvents between T = 278.2 and 323.2 K Using Differential Thermal Analysis/Thermal Gravimetric Analysis
- Measurements and Thermodynamic Modeling of Liquid-Liquid Equilibria Data for the Ternary (Methyl Propyl Ketone + Catechol/Resorcinol/Hydroquinone + Water) Systems
- Solubility Data for Roflumilast and Maraviroc in Various Solvents between T = (278.2-323.2) K
- Air-Water Partitioning of C5 and C6 Alkanones: Measurement, Critical Compilation, Correlation, and Recommended Data
- Phase Equilibria in the Binary and Ternary Systems Composed of Diethyl ketone, 2-Pentanone and 3-Pentanol at 101.3 kPa
- Determination of Henry s Law Constants and Activity Coefficients at Infinite Dilution of Flavor Compounds in Water at 298 K with a Gas-Chromatographic Method
- Measurement of Isobaric Vapor - Liquid Equilibria of Dimethyl Carbonate with Acetone, 2-Butanone and 2-Pentanone at 101.3 kPa and Density and Speed of Sound at 298.15 K
- Measurement of Activity Coefficients at Infinite Dilution of Benzene, Toluene, Ethanol, Esters, Ketones, and Ethers at Various Temperatures in Water Using the Dilutor Technique
- Dynamic Viscosities of the Binary Systems Cyclohexane and Cyclopentane with Acetone, Butanone, or 2-Pentanone at Three Temperatures T ) (293.15, 298.15, and 303.15) K
- Thermodynamic Properties of Mixtures Containing Ionic Liquids: Activity Coefficients at Infinite Dilution of Organic Compounds in 1-Propyl Boronic Acid-3-Alkylimidazolium Bromide and 1-Propenyl-3-alkylimidazolium Bromide Using Inverse Gas Chromatography
- Henry s Constants of 1-Alkanols and 2-Ketones in Salt Solutions
- Activity Coefficients at Infinite Dilution Measurements for Organic Solutes and Water in the Ionic Liquid 1-Butyl-3-methyl-pyridinium Trifluoromethanesulfonate
- Determination of Activity Coefficients at Infinite Dilution of 35 Solutes in the Ionic Liquid, 1-Butyl-3-methylimidazolium Tosylate, Using Gas-Liquid Chromatography
- Measurements of Activity Coefficients at Infinite Dilution for Organic Solutes and Water in the Ionic Liquid 1-Butyl-1-methylpiperydinium Thiocyanate
- Activity Coefficients at Infinite Dilution of Organic Compounds in Four New Imidazolium-Based Ionic Liquids
- Thermodynamics of Ketone + Amine Mixtures. Part VIII. Molar Excess Enthalpies at 298.15 K for n-Alkanone + Aniline or + N-Methylaniline Systems
- Partition Coefficients of Organic Compounds in Four New Tetraalkylammonium Bis(trifluoromethylsulfonyl)imide Ionic Liquids Using Inverse Gas Chromatography
- Evaluation of the Performance of Trigeminal Tricationic Ionic Liquids for Separation Problems
- Activity Coefficients at Infinite Dilution for Organic Compounds Dissolved in 1-Alkyl-1-methylpyrrolidinium Bis(trifluoromethylsulfonyl)imide Ionic Liquids Having Six-, Eight-, and Ten-Carbon Alkyl Chains
- Volumetric Properties of Binary Mixtures of N-Ethylformamide with Tetrahydropyran, 2-Pentanone, and Propylacetate from (293.15 to 313.15) K
- Activity Coefficients at Infinite Dilution for Organic Solutes Dissolved in Three 1-Alkyl-1-methylpyrrolidinium Bis(trifluoromethylsulfonyl)imide Ionic Liquids Bearing Short Linear Alkyl Side Chains of Three to Five Carbons
- Infinite Dilution Activity Coefficients of Solutes Dissolved in Two Trihexyl(tetradecyl)phosphonium Ionic Liquids
- Phase Equilibria of (1-Ethyl-3-methylimidazolium Ethylsulfate + Hydrocarbon, + Ketone, and + Ether) Binary Systems
- Volumetric and Transport Properties of Binary Liquid Mixtures of Aliphatic Ketones with Phenylacetonitrile at T = 308.15 K
- Activity Coefficients at Infinite Dilution of Organic Compounds in 1-Butyl-3-methylimidazolium Tetrafluoroborate Using Inverse Gas Chromatography
- Activity Coefficients at Infinite Dilution of Organic Compounds in Trihexyl(tetradecyl)phosphonium Bis(trifluoromethylsulfonyl)imide Using Inverse Gas Chromatography
- Densities and Speeds of Sound for Binary Liquid Mixtures of Thiolane-l,l-dioxide with Butanone, Pentan-2-one, Pentan-3-one, and 4-Methyl-pentan-2-one at T = (303.15 or 308.15 or 313.15) K
- Partition Coefficients of Organic Compounds in New Imidazolium and Tetralkylammonium Based Ionic Liquids Using Inverse Gas Chromatography
- Study of Ether-, Alcohol-, or Cyano-Functionalized Ionic Liquids Using Inverse Gas Chromatography
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.