- InChI
- InChI=1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3
- InChI Key
- RWGFKTVRMDUZSP-UHFFFAOYSA-N
- Formula
- C9H12
- SMILES
- CC(C)c1ccccc1
- Molecular Weight1
- 120.19
- CAS
- 98-82-8
- Other Names
-
- (1-METHYLETHYL)BENZENE
- (1-methylethyl)benzene (cumene)
- (Methylethyl)benzene
- 1-methylethylbenzene
- 2-Fenilpropano
- 2-Fenyl-propaan
- 2-PHENYLPROPANE
- Benzene, i-propyl-
- Benzene, isopropyl-
- Cumeen
- Cumene
- Cumol
- ISOPROPYLBENZENE
- Isopropilbenzene
- Isopropylbenzeen
- Isopropylbenzol
- NSC 8776
- Propane, 2-phenyl-
- Rcra waste number U055
- UN 1918
- i-Propylbenzene
- iso-propylbenzene
- iso-propylbenzene (cumene)
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- Tig : Autoignition Temperature (K).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- LFL : Lower Flammability Limit (% in Air).
- UFL : Upper Flammability Limit (% in Air).
- Tflash,oc : Flash Point (Open Cup Method) (K).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Δc,grossH : Heat of Combustion, Gross form (kJ/mol).
- Δc,netH : Heat of Combustion, Net Form (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- S°gas : Molar entropy at standard conditions (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- csound,fluid : Speed of sound in fluid (m/s).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.3260 | KDB | |
| PAff | 791.60 | kJ/mol | NIST |
| Tig | 698.15 | K | KDB |
| BasG | 763.90 | kJ/mol | NIST |
| ΔcH°liquid | [-5218.60; -5215.44] | kJ/mol |
|
| ΔcH°liquid | -5215.44 ± 0.96 | kJ/mol | NIST |
| ΔcH°liquid | -5218.60 | kJ/mol | NIST |
| Cp,liquid | 214.75 | J/mol×K | Thermod... |
| η | [0.0007390; 0.0007390] | Pa×s |
|
| η | 0.0007390 | Pa×s | Viscosi... |
| η | 0.0007390 | Pa×s | Viscosi... |
| LFL | 0.90 | % in Air | KDB |
| UFL | 6.50 | % in Air | KDB |
| Tflash,oc | 317.04 | K | KDB |
| ΔfG° | 137.10 | kJ/mol | KDB |
| Δc,grossH | 5215.44 | kJ/mol | KDB |
| Δc,netH | 4951.346 | kJ/mol | KDB |
| ΔfH°gas | [3.90; 3.94] | kJ/mol |
|
| ΔfH°gas | 3.94 | kJ/mol | KDB |
| ΔfH°gas | 3.90 ± 1.10 | kJ/mol | NIST |
| ΔfH°liquid | -41.20 ± 1.10 | kJ/mol | NIST |
| ΔfusH° | 9.58 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [37.00; 45.15] | kJ/mol |
|
| ΔvapH° | 45.15 | kJ/mol | NIST |
| ΔvapH° | 45.10 | kJ/mol | NIST |
| ΔvapH° | 45.10 ± 0.10 | kJ/mol | NIST |
| ΔvapH° | 44.00 | kJ/mol | NIST |
| ΔvapH° | 45.10 | kJ/mol | NIST |
| ΔvapH° | Outlier 37.00 | kJ/mol | NIST |
| ΔvapH° | 45.10 | kJ/mol | NIST |
| ΔvapH° | 45.14 | kJ/mol | NIST |
| ΔvapH° | 45.10 | kJ/mol | NIST |
| IE | [8.69; 8.98] | eV |
|
| IE | 8.73 ± 0.02 | eV | NIST |
| IE | 8.72 | eV | NIST |
| IE | 8.72 ± 0.01 | eV | NIST |
| IE | 8.69 ± 0.01 | eV | NIST |
| IE | 8.76 | eV | NIST |
| IE | 8.71 | eV | NIST |
| IE | 8.75 | eV | NIST |
| IE | Outlier 8.98 | eV | NIST |
| log10WS | [-3.27; -3.27] |
|
|
| log10WS | -3.27 | Aq. Sol... | |
| log10WS | -3.27 | Estimat... | |
| logPoct/wat | 2.810 | Crippen Calculated Property | |
| McVol | 113.910 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 2 | KDB | |
| Pc | [2786.44; 3210.00] | kPa |
|
| Pc | 3209.00 | kPa | KDB |
| Pc | 3210.00 ± 40.00 | kPa | NIST |
| Pc | 3209.00 ± 6.00 | kPa | NIST |
| Pc | 2786.44 ± 151.99 | kPa | NIST |
| Pc | 3160.00 ± 5.88 | kPa | NIST |
| ρc | 278.84 ± 0.96 | kg/m3 | NIST |
| Inp | [134.00; 961.00] |
|
|
| Inp | 909.10 | NIST | |
| Inp | 909.82 | NIST | |
| Inp | 930.00 | NIST | |
| Inp | 930.00 | NIST | |
| Inp | 935.10 | NIST | |
| Inp | 942.50 | NIST | |
| Inp | 908.00 | NIST | |
| Inp | 909.00 | NIST | |
| Inp | 909.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 919.50 | NIST | |
| Inp | 919.20 | NIST | |
| Inp | 920.10 | NIST | |
| Inp | 920.70 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 892.90 | NIST | |
| Inp | 898.20 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 922.00 | NIST | |
| Inp | 916.00 | NIST | |
| Inp | 907.00 | NIST | |
| Inp | 905.00 | NIST | |
| Inp | 909.30 | NIST | |
| Inp | 909.80 | NIST | |
| Inp | 911.30 | NIST | |
| Inp | 921.00 | NIST | |
| Inp | 929.00 | NIST | |
| Inp | 915.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 926.00 | NIST | |
| Inp | 932.00 | NIST | |
| Inp | 904.10 | NIST | |
| Inp | 906.70 | NIST | |
| Inp | 920.40 | NIST | |
| Inp | 925.60 | NIST | |
| Inp | 931.80 | NIST | |
| Inp | 915.50 | NIST | |
| Inp | 900.30 | NIST | |
| Inp | 907.00 | NIST | |
| Inp | 903.40 | NIST | |
| Inp | 903.90 | NIST | |
| Inp | 904.10 | NIST | |
| Inp | 904.10 | NIST | |
| Inp | 906.70 | NIST | |
| Inp | 908.00 | NIST | |
| Inp | 939.00 | NIST | |
| Inp | 939.00 | NIST | |
| Inp | 939.00 | NIST | |
| Inp | 902.00 | NIST | |
| Inp | 902.00 | NIST | |
| Inp | 901.00 | NIST | |
| Inp | 922.00 | NIST | |
| Inp | 927.00 | NIST | |
| Inp | 930.00 | NIST | |
| Inp | 932.00 | NIST | |
| Inp | 929.00 | NIST | |
| Inp | 932.00 | NIST | |
| Inp | 935.00 | NIST | |
| Inp | 937.00 | NIST | |
| Inp | 940.00 | NIST | |
| Inp | 910.10 | NIST | |
| Inp | 910.10 | NIST | |
| Inp | 910.10 | NIST | |
| Inp | 910.10 | NIST | |
| Inp | 910.10 | NIST | |
| Inp | 910.10 | NIST | |
| Inp | 908.00 | NIST | |
| Inp | 905.00 | NIST | |
| Inp | 908.00 | NIST | |
| Inp | 911.00 | NIST | |
| Inp | 913.00 | NIST | |
| Inp | 916.00 | NIST | |
| Inp | 915.00 | NIST | |
| Inp | 903.10 | NIST | |
| Inp | 910.80 | NIST | |
| Inp | 903.50 | NIST | |
| Inp | 932.00 | NIST | |
| Inp | 940.00 | NIST | |
| Inp | 947.00 | NIST | |
| Inp | 924.00 | NIST | |
| Inp | 909.00 | NIST | |
| Inp | 915.00 | NIST | |
| Inp | 932.00 | NIST | |
| Inp | 925.10 | NIST | |
| Inp | 917.00 | NIST | |
| Inp | 909.00 | NIST | |
| Inp | 927.00 | NIST | |
| Inp | 911.00 | NIST | |
| Inp | 912.20 | NIST | |
| Inp | 912.00 | NIST | |
| Inp | 910.00 | NIST | |
| Inp | 927.00 | NIST | |
| Inp | 914.30 | NIST | |
| Inp | 919.40 | NIST | |
| Inp | 922.20 | NIST | |
| Inp | 923.60 | NIST | |
| Inp | 906.90 | NIST | |
| Inp | 930.30 | NIST | |
| Inp | 929.00 | NIST | |
| Inp | 926.00 | NIST | |
| Inp | 910.80 | NIST | |
| Inp | 928.70 | NIST | |
| Inp | 907.20 | NIST | |
| Inp | 907.90 | NIST | |
| Inp | 919.40 | NIST | |
| Inp | 922.20 | NIST | |
| Inp | 923.60 | NIST | |
| Inp | 913.00 | NIST | |
| Inp | 909.43 | NIST | |
| Inp | 909.62 | NIST | |
| Inp | 910.00 | NIST | |
| Inp | 934.30 | NIST | |
| Inp | 929.20 | NIST | |
| Inp | 931.60 | NIST | |
| Inp | 946.50 | NIST | |
| Inp | 941.60 | NIST | |
| Inp | 944.90 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 914.90 | NIST | |
| Inp | 909.07 | NIST | |
| Inp | 910.70 | NIST | |
| Inp | 906.00 | NIST | |
| Inp | 905.10 | NIST | |
| Inp | 911.30 | NIST | |
| Inp | 909.00 | NIST | |
| Inp | 925.00 | NIST | |
| Inp | 936.10 | NIST | |
| Inp | 910.00 | NIST | |
| Inp | 923.00 | NIST | |
| Inp | 932.00 | NIST | |
| Inp | 918.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 925.00 | NIST | |
| Inp | 926.00 | NIST | |
| Inp | 903.00 | NIST | |
| Inp | 917.00 | NIST | |
| Inp | 903.00 | NIST | |
| Inp | 910.00 | NIST | |
| Inp | 950.00 | NIST | |
| Inp | 925.00 | NIST | |
| Inp | 916.00 | NIST | |
| Inp | 922.00 | NIST | |
| Inp | 912.00 | NIST | |
| Inp | 923.00 | NIST | |
| Inp | 926.00 | NIST | |
| Inp | 915.00 | NIST | |
| Inp | 929.00 | NIST | |
| Inp | 932.00 | NIST | |
| Inp | 915.00 | NIST | |
| Inp | 923.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 925.00 | NIST | |
| Inp | 927.00 | NIST | |
| Inp | 926.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 912.00 | NIST | |
| Inp | 908.00 | NIST | |
| Inp | 930.70 | NIST | |
| Inp | 926.00 | NIST | |
| Inp | 916.00 | NIST | |
| Inp | 906.00 | NIST | |
| Inp | 938.00 | NIST | |
| Inp | 961.00 | NIST | |
| Inp | 910.00 | NIST | |
| Inp | 915.00 | NIST | |
| Inp | 916.00 | NIST | |
| Inp | 914.00 | NIST | |
| Inp | 924.00 | NIST | |
| Inp | 927.00 | NIST | |
| Inp | 931.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 922.00 | NIST | |
| Inp | 922.00 | NIST | |
| Inp | 923.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 909.00 | NIST | |
| Inp | 914.00 | NIST | |
| Inp | 925.00 | NIST | |
| Inp | 914.00 | NIST | |
| Inp | 923.00 | NIST | |
| Inp | 911.00 | NIST | |
| Inp | 920.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 914.00 | NIST | |
| Inp | 908.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 908.00 | NIST | |
| Inp | 912.00 | NIST | |
| Inp | 925.00 | NIST | |
| Inp | 905.00 | NIST | |
| Inp | 907.50 | NIST | |
| Inp | 933.00 | NIST | |
| Inp | 906.00 | NIST | |
| Inp | 913.00 | NIST | |
| Inp | 915.00 | NIST | |
| Inp | 921.00 | NIST | |
| Inp | 905.00 | NIST | |
| Inp | 919.00 | NIST | |
| Inp | 929.00 | NIST | |
| Inp | 904.00 | NIST | |
| Inp | 929.00 | NIST | |
| Inp | Outlier 134.00 | NIST | |
| I | [1150.00; 1236.00] |
|
|
| I | 1158.00 | NIST | |
| I | 1176.90 | NIST | |
| I | 1202.10 | NIST | |
| I | 1203.60 | NIST | |
| I | 1169.80 | NIST | |
| I | 1154.90 | NIST | |
| I | Outlier 1232.00 | NIST | |
| I | Outlier 1236.00 | NIST | |
| I | 1198.00 | NIST | |
| I | 1205.00 | NIST | |
| I | 1213.00 | NIST | |
| I | 1191.00 | NIST | |
| I | 1161.00 | NIST | |
| I | 1182.00 | NIST | |
| I | 1192.30 | NIST | |
| I | 1177.00 | NIST | |
| I | 1181.00 | NIST | |
| I | 1166.00 | NIST | |
| I | 1186.00 | NIST | |
| I | 1189.00 | NIST | |
| I | 1200.00 | NIST | |
| I | 1211.00 | NIST | |
| I | Outlier 1225.00 | NIST | |
| I | 1169.00 | NIST | |
| I | 1179.00 | NIST | |
| I | 1155.00 | NIST | |
| I | 1168.00 | NIST | |
| I | 1185.00 | NIST | |
| I | 1168.00 | NIST | |
| I | 1172.00 | NIST | |
| I | 1150.00 | NIST | |
| I | 1171.00 | NIST | |
| I | 1183.00 | NIST | |
| I | 1155.00 | NIST | |
| I | 1182.00 | NIST | |
| I | 1177.00 | NIST | |
| I | 1182.00 | NIST | |
| I | 1164.00 | NIST | |
| I | 1161.00 | NIST | |
| I | 1162.00 | NIST | |
| I | 1186.00 | NIST | |
| I | 1169.00 | NIST | |
| S°gas | 386.53 | J/mol×K | NIST |
| S°liquid | 277.57 | J/mol×K | NIST |
| Tboil | [425.44; 425.63] | K |
|
| Tboil | 425.56 | K | KDB |
| Tboil | 425.55 | K | Isobari... |
| Tboil | 425.55 | K | Isobari... |
| Tboil | 425.44 | K | Isobari... |
| Tboil | 425.63 | K | Experim... |
| Tboil | 425.44 | K | Vapor-L... |
| Tc | [624.55; 635.90] | K |
|
| Tc | 631.00 | K | KDB |
| Tc | 631.00 ± 0.50 | K | NIST |
| Tc | 631.10 ± 0.15 | K | NIST |
| Tc | 624.55 ± 2.00 | K | NIST |
| Tc | 635.90 ± 4.00 | K | NIST |
| Tfus | 177.14 | K | KDB |
| Ttriple | 177.13 ± 0.01 | K | NIST |
| Vc | 0.435 | m3/kmol | KDB |
| Zc | 0.2658850 | KDB | |
| Zra | 0.26 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [214.82; 289.96] | J/mol×K | [431.56; 643.71] |
|
| Cp,gas | 214.82 | J/mol×K | 431.56 | Joback Calculated Property |
| Cp,gas | 229.30 | J/mol×K | 466.92 | Joback Calculated Property |
| Cp,gas | 242.96 | J/mol×K | 502.28 | Joback Calculated Property |
| Cp,gas | 255.82 | J/mol×K | 537.64 | Joback Calculated Property |
| Cp,gas | 267.92 | J/mol×K | 573.00 | Joback Calculated Property |
| Cp,gas | 279.29 | J/mol×K | 608.35 | Joback Calculated Property |
| Cp,gas | 289.96 | J/mol×K | 643.71 | Joback Calculated Property |
| Cp,liquid | [198.70; 215.40] | J/mol×K | [295.96; 302.00] |
|
| Cp,liquid | 214.40 | J/mol×K | 295.96 | NIST |
| Cp,liquid | 213.00 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 215.40 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 209.41 | J/mol×K | 299.80 | NIST |
| Cp,liquid | 198.70 | J/mol×K | 302.00 | NIST |
| Cp,liquid | 198.70 | J/mol×K | 302.00 | NIST |
| η | [0.0006110; 0.0006900] | Pa×s | [303.15; 313.15] |
|
| η | 0.0006900 | Pa×s | 303.15 | Physica... |
| η | 0.0006900 | Pa×s | 303.15 | Density... |
| η | 0.0006510 | Pa×s | 308.15 | Physica... |
| η | 0.0006510 | Pa×s | 308.15 | Density... |
| η | 0.0006110 | Pa×s | 313.15 | Physica... |
| η | 0.0006110 | Pa×s | 313.15 | Density... |
| ΔfusH | [7.32; 7.33] | kJ/mol | [177.10; 177.13] |
|
| ΔfusH | 7.32 | kJ/mol | 177.10 | NIST |
| ΔfusH | 7.32 | kJ/mol | 177.10 | NIST |
| ΔfusH | 7.33 | kJ/mol | 177.13 | NIST |
| ΔvapH | [41.20; 42.10] | kJ/mol | [384.50; 387.50] |
|
| ΔvapH | 41.90 | kJ/mol | 384.50 | NIST |
| ΔvapH | 42.10 | kJ/mol | 386.00 | NIST |
| ΔvapH | 41.20 | kJ/mol | 387.50 | NIST |
| n0 | [1.48869; 1.49130] | [293.15; 298.20] |
|
|
| n0 | 1.49130 | 293.15 | Liquid ... | |
| n0 | 1.49120 | 293.15 | Experim... | |
| n0 | 1.48890 | 298.15 | KDB | |
| n0 | 1.48869 | 298.15 | Effect ... | |
| n0 | 1.49005 | 298.20 | Salt Ef... | |
| ρl | [857.51; 864.12] | kg/m3 | [293.00; 298.20] |
|
| ρl | 862.00 | kg/m3 | 293.00 | KDB |
| ρl | 857.51 | kg/m3 | 298.15 | Thermod... |
| ρl | 864.12 | kg/m3 | 298.15 | Liquid-... |
| ρl | 857.54 | kg/m3 | 298.20 | Liquid-... |
| ΔfusS | [41.36; 41.37] | J/mol×K | [177.10; 177.13] |
|
| ΔfusS | 41.37 | J/mol×K | 177.10 | NIST |
| ΔfusS | 41.36 | J/mol×K | 177.13 | NIST |
| γ | 0.03 | N/m | 293.20 | KDB |
| λ | [0.11; 0.13] | W/m×K | [261.13; 329.83] |
|
| λ | 0.13 | W/m×K | 261.13 | Thermal... |
| λ | 0.13 | W/m×K | 261.33 | Thermal... |
| λ | 0.13 | W/m×K | 261.48 | Thermal... |
| λ | 0.12 | W/m×K | 275.03 | Thermal... |
| λ | 0.12 | W/m×K | 275.24 | Thermal... |
| λ | 0.12 | W/m×K | 275.40 | Thermal... |
| λ | 0.12 | W/m×K | 294.11 | Thermal... |
| λ | 0.12 | W/m×K | 294.32 | Thermal... |
| λ | 0.12 | W/m×K | 294.47 | Thermal... |
| λ | 0.12 | W/m×K | 312.46 | Thermal... |
| λ | 0.12 | W/m×K | 312.68 | Thermal... |
| λ | 0.12 | W/m×K | 312.84 | Thermal... |
| λ | 0.11 | W/m×K | 329.45 | Thermal... |
| λ | 0.11 | W/m×K | 329.68 | Thermal... |
| λ | 0.11 | W/m×K | 329.83 | Thermal... |
Datasets
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 100.00 | 857.94 |
| 313.15 | 100.00 | 845.05 |
| 333.15 | 100.00 | 827.73 |
| 353.15 | 100.00 | 810.17 |
| 373.15 | 100.00 | 792.31 |
| 393.15 | 100.00 | 773.98 |
| 413.15 | 100.00 | 755.04 |
| 433.15 | 10100.00 | 752.29 |
| 298.15 | 20100.00 | 871.79 |
| 313.15 | 20100.00 | 859.97 |
| 333.15 | 20100.00 | 844.44 |
| 353.15 | 20100.00 | 828.86 |
| 373.15 | 20100.00 | 813.36 |
| 393.15 | 20100.00 | 797.74 |
| 413.15 | 20100.00 | 781.98 |
| 433.15 | 20100.00 | 766.12 |
| 298.15 | 40100.00 | 883.81 |
| 313.15 | 40100.00 | 872.84 |
| 333.15 | 40100.00 | 858.51 |
| 353.15 | 40100.00 | 844.27 |
| 373.15 | 40100.00 | 830.23 |
| 393.15 | 40100.00 | 816.2 |
| 413.15 | 40100.00 | 802.25 |
| 433.15 | 40100.00 | 788.34 |
| 298.15 | 60100.00 | 894.47 |
| 313.15 | 60100.00 | 884.19 |
| 333.15 | 60100.00 | 870.78 |
| 353.15 | 60100.00 | 857.52 |
| 373.15 | 60100.00 | 844.51 |
| 393.15 | 60100.00 | 831.6 |
| 413.15 | 60100.00 | 818.85 |
| 433.15 | 60100.00 | 806.14 |
| 298.15 | 80100.00 | 904.16 |
| 313.15 | 80100.00 | 894.38 |
| 333.15 | 80100.00 | 881.68 |
| 353.15 | 80100.00 | 869.22 |
| 373.15 | 80100.00 | 857.0 |
| 393.15 | 80100.00 | 844.92 |
| 413.15 | 80100.00 | 833.04 |
| 433.15 | 80100.00 | 821.27 |
| 298.15 | 100100.00 | 913.02 |
| 313.15 | 100100.00 | 903.69 |
| 333.15 | 100100.00 | 891.56 |
| 353.15 | 100100.00 | 879.74 |
| 373.15 | 100100.00 | 868.11 |
| 393.15 | 100100.00 | 856.72 |
| 413.15 | 100100.00 | 845.53 |
| 433.15 | 100100.00 | 834.45 |
| Reference | ||
Speed of sound, m/s
Operational condition: Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 100.00 | 1309.1 |
| 313.15 | 100.00 | 1247.6 |
| 333.15 | 100.00 | 1168.5 |
| 353.15 | 100.00 | 1091.8 |
| 373.15 | 100.00 | 1017.8 |
| 393.15 | 100.00 | 945.6 |
| 413.15 | 100.00 | 875.0 |
| 433.15 | 10100.00 | 897.7 |
| 298.15 | 20100.00 | 1406.9 |
| 313.15 | 20100.00 | 1351.3 |
| 333.15 | 20100.00 | 1280.5 |
| 353.15 | 20100.00 | 1213.2 |
| 373.15 | 20100.00 | 1149.2 |
| 393.15 | 20100.00 | 1088.1 |
| 413.15 | 20100.00 | 1029.6 |
| 433.15 | 20100.00 | 974.0 |
| 298.15 | 40100.00 | 1491.7 |
| 313.15 | 40100.00 | 1440.0 |
| 333.15 | 40100.00 | 1374.7 |
| 353.15 | 40100.00 | 1313.2 |
| 373.15 | 40100.00 | 1255.1 |
| 393.15 | 40100.00 | 1200.1 |
| 413.15 | 40100.00 | 1147.8 |
| 433.15 | 40100.00 | 1098.9 |
| 298.15 | 60100.00 | 1566.8 |
| 313.15 | 60100.00 | 1518.3 |
| 333.15 | 60100.00 | 1457.2 |
| 353.15 | 60100.00 | 1399.6 |
| 373.15 | 60100.00 | 1345.6 |
| 393.15 | 60100.00 | 1294.7 |
| 413.15 | 60100.00 | 1246.5 |
| 433.15 | 60100.00 | 1201.3 |
| 298.15 | 80100.00 | 1634.8 |
| 313.15 | 80100.00 | 1588.9 |
| 333.15 | 80100.00 | 1530.9 |
| 353.15 | 80100.00 | 1476.5 |
| 373.15 | 80100.00 | 1425.6 |
| 393.15 | 80100.00 | 1377.6 |
| 413.15 | 80100.00 | 1332.1 |
| 433.15 | 80100.00 | 1289.9 |
| 298.15 | 100100.00 | 1697.4 |
| 313.15 | 100100.00 | 1653.3 |
| 333.15 | 100100.00 | 1598.0 |
| 353.15 | 100100.00 | 1546.0 |
| 373.15 | 100100.00 | 1497.4 |
| 393.15 | 100100.00 | 1451.6 |
| 413.15 | 100100.00 | 1408.6 |
| 433.15 | 100100.00 | 1368.6 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.66] | kPa | [310.56; 454.20] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.43493e+01 | |||
| Coefficient B | -3.63341e+03 | |||
| Coefficient C | -5.21730e+01 | |||
| Temperature range, min. | 310.56 | |||
| Temperature range, max. | 454.20 | |||
| Pvap | 1.33 | kPa | 310.56 | Calculated Property |
| Pvap | 3.02 | kPa | 326.52 | Calculated Property |
| Pvap | 6.26 | kPa | 342.48 | Calculated Property |
| Pvap | 12.01 | kPa | 358.44 | Calculated Property |
| Pvap | 21.61 | kPa | 374.40 | Calculated Property |
| Pvap | 36.80 | kPa | 390.36 | Calculated Property |
| Pvap | 59.72 | kPa | 406.32 | Calculated Property |
| Pvap | 92.95 | kPa | 422.28 | Calculated Property |
| Pvap | 139.48 | kPa | 438.24 | Calculated Property |
| Pvap | 202.66 | kPa | 454.20 | Calculated Property |
| Pvap | [3.82e-07; 3143.15] | kPa | [177.14; 631.15] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 1.02480e+02 | |||
| Coefficient B | -8.96989e+03 | |||
| Coefficient C | -1.29151e+01 | |||
| Coefficient D | 7.67090e-06 | |||
| Temperature range, min. | 177.14 | |||
| Temperature range, max. | 631.15 | |||
| Pvap | 3.82e-07 | kPa | 177.14 | Calculated Property |
| Pvap | 1.32e-03 | kPa | 227.59 | Calculated Property |
| Pvap | 0.15 | kPa | 278.03 | Calculated Property |
| Pvap | 3.20 | kPa | 328.48 | Calculated Property |
| Pvap | 25.23 | kPa | 378.92 | Calculated Property |
| Pvap | 110.81 | kPa | 429.37 | Calculated Property |
| Pvap | 337.42 | kPa | 479.81 | Calculated Property |
| Pvap | 812.07 | kPa | 530.26 | Calculated Property |
| Pvap | 1677.90 | kPa | 580.70 | Calculated Property |
| Pvap | 3143.15 | kPa | 631.15 | Calculated Property |
Similar Compounds
Find more compounds similar to Benzene, (1-methylethyl)-.
Mixtures
- Benzene, (1-methylethyl)- + Acetic acid, butyl ester
- Benzene, (1-methylethyl)- + Formic acid + Water
- Benzene, (1-methylethyl)- + Acetic acid + Water
- Benzene, (1-methylethyl)- + Propanoic acid + Water
- Benzene, (1-methylethyl)- + Ethane, 1,1,2,2-tetrachloro-
- Benzene, (1-methylethyl)- + Benzonitrile
- Benzene, (1-methylethyl)- + Thiophene, tetrahydro-, 1,1-dioxide
- Benzene, (1-methylethyl)- + N-Formylmorpholine
- Benzene, (1-methylethyl)- + Water
- Benzene, (1-methylethyl)- + Phenol + Water
- Benzene, (1-methylethyl)- + sodium chloride + Water
- Benzene, (1-methylethyl)- + Sodium sulfate + Water
- 2-Butanone + Benzene, (1-methylethyl)-
- Methyl Isobutyl Ketone + Benzene, (1-methylethyl)-
- Benzene, (1-methylethyl)- + Benzaldehyde
- Ethyl formate + Benzene, (1-methylethyl)-
- Benzene, (1-methylethyl)- + Acetic acid ethenyl ester
- Benzene, (1-methylethyl)- + Tetrahydrofuran
- Benzene, (1-methylethyl)- + Tetrahydropyran
- Benzene, (1-methylethyl)- + Acetamide, N-methyl-
Find more mixtures with Benzene, (1-methylethyl)-.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Effect of Temperature on the Change of Refractive Index on Mixing for Butyl Acetate + Aromatic Hydrocarbons
- Liquid liquid equilibria of ternary systems (water + carboxylic acid + cumene) at 298.15K
- Thermodynamic study of 1,1,2,2-tetrachloroethane + hydrocarbon mixtures I. Excess and solvation enthalpies
- Thermodynamics of risperidone and solubility in pure organic solvents
- Study of critical and maximum temperatures of coexistence of liquid and gas phase in hydrocarbons binary mixtures of aromatic hydrocarbons with alkanes and cycloalkanes
- Activity coefficients at infinite dilution of organic solvents and water in 1-butyl-3-methylimidazolium dicyanamide. A literature review of hexane/hex-1-ene separation
- High selective water/butan-1-ol separation on investigation of limiting activity coefficients with [P8,8,8,8][[NTf2] ionic liquid
- Separation of binary mixtures based on limiting activity coefficients data using specific ammonium-based ionic liquid and modelling of thermodynamic functions
- Liquid density measurements of cumene, tert-butylbenzene, and hexadecane over wide ranges of temperature and pressure
- New ionic liquid [P4,4,4,4][NTf2] in bio-butanol extraction on investigation of limiting activity coefficients
- Ammonium ionic liquids in extraction of bio-butan-1-ol from water phase using activity coefficients at infinite dilution
- Thermodynamics of mixtures involving some (benzene derivatives + benzonitrile)
- LLE data for the ionic liquid 3-methyl-N-butyl pyridinium dicyanamide with several aromatic and aliphatic hydrocarbons
- Isobaric (vapour + liquid) equilibria for sulfolane with toluene, ethylbenzene, and isopropylbenzene at 101.33 kPa
- Isobaric (vapour + liquid) equilibria for N-formylmorpholine with ethylbenzene, n-butylbenzene, iso-propylbenzene and 1,2,4-trimethylbenzene at 101.33 kPa
- Measurement of activity coefficients at infinite dilution of organic solutes in the ionic liquid 1-hexyl-1,4-diaza[2.2.2]bicyclooctanium bis(trifluoromethylsulfonyl)imide using gas-liquid chromatography
- Experimental and correlational study of phase equilibria in aqueous mixtures of phosphoric acid with aromatic hydrocarbons at various temperatures
- A 1-alkylcyanopyridinium-based ionic liquid in the separation processes
- Thermodynamics and selectivity of separation based on activity coefficients at infinite dilution of various solutes in 1-allyl-3-methylimidazolium bis{(trifluoromethyl)sulfonyl}imide ionic liquid
- Thermodynamics and limiting activity coefficients measurements for organic solutes and water in the ionic liquid 1-dodecyl-3-methylimidzolium bis(trifluoromethylsulfonyl) imide
- Separation of binary mixtures hexane/hex-1-ene, cyclohexane/cyclohexene and ethylbenzene/styrene based on limiting activity coefficients
- Separation of water/butan-1-ol based on activity coefficients at infinite dilution in 1,3-didecyl-2-methylimidazolium dicyanamide ionic liquid
- Separation of binary mixtures hexane/hex-1-ene, cyclohexane/cyclohexene and ethylbenzene/styrene based on gamma infinity data measurements
- Thermodynamic study of molecular interaction-selectivity in separation processes based on limiting activity coefficients
- The use of ionic liquids for separation of binary hydrocarbons mixtures based on gamma infinity data measurements
- Thermodynamic properties of cumene, tert-butylbenzene, and n-hexadecane under elevated pressures
- Liquid-Liquid Equilibrium of the Ternary System of Water + Phenol + (Propan-2-yl) Benzene at Several Temperatures
- Liquid-Liquid Equilibrium for Ternary Systems, Water + 5-Hydroxymethylfurfural + (1-Butanol, Isobutanol, Methyl Isobutyl Ketone), at 313.15, 323.15, and 333.15 K
- Salt Effects on Liquid-Liquid Equilibria of Water + Phenol + (Propan-2-yl) Benzene + Salts Systems
- Thermal Conductivity and Thermal Diffusivity of Twenty-Nine Liquids: Alkenes, Cyclic (Alkanes, Alkenes, Alkadienes, Aromatics), and Deuterated Hydrocarbons
- Viscosities, Densities, and Speeds of Sound of Binary Mixtures of o-Xylene, m-Xylene, p-Xylene, and Isopropylbenzene with 2-Butanone at 298.15 K
- Viscosities, Densities, and Speeds of Sound of Binary Mixtures of o-Xylene, m-Xylene, p-Xylene, and Isopropylbenzene with 4-Methylpentan-2-one at 298.15 K
- Saturated Heat Capacities of Some Linear and Branched Alkylbenzenes between (332 and 401) K
- Liquid-Liquid Equilibrium of (Water + Acetone) with Cumene or r-Methylstyrene or Phenol at Temperatures of (323.15 and 333.15) K
- Liquid-Liquid Equilibria of Ternary and Six-Component Systems Including Cyclohexane, Benzene, Toluene, Ethylbenzene, Cumene, and Sulfolane at 303.15 K
- Vapor-Liquid Equilibrium for Benzaldehyde with 1-Methylethylbenzene and for 2-Methyl-propan-2-ol with 2,4,4-Trimethyl-1-pentene
- Salting-Out Effect of NaCl and KCl on the Liquid Liquid Equilibrium of Water + 2-Methylpropanoic Acid + (1-Methylethyl)-benzene System at Several Temperatures
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Isobaric Vapor Liquid Equilibrium of Binary Mixtures of Vinyl Acetate and Ethyl Formate with Cumene at 97.3 kPa
- Experimental Isobaric Vapor-Liquid Equilibrium Data for Binary Mixtures of Cyclic Ethers with (1-Methylethyl)benzene
- Vapor-Liquid Equilibrium Data for N-Methylacetamide and N,N-Dimethylacetamide with Cumene at 97.3 kPa
- Physical Properties of Binary Mixtures of Ethyl Formate with Benzene, Isopropyl Benzene, Isobutyl Benzene, and Butylbenzene at (303.15, 308.15, and 313.15) K
- Density and Viscosity of Propyl Formate + Aromatic Hydrocarbons at T = (303.15, 308.15, and 313.15) K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.