- Name
- Methyl Isobutyl Ketone
- InChI
- InChI=1S/C6H12O/c1-5(2)4-6(3)7/h5H,4H2,1-3H3
- InChI Key
- NTIZESTWPVYFNL-UHFFFAOYSA-N
- Formula
- C6H12O
- SMILES
- CC(=O)CC(C)C
- Mol. Weight (g/mol)
- 100.16
- CAS
- 108-10-1
- Name
- Benzene, (1-methylethyl)-
- InChI
- InChI=1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3
- InChI Key
- RWGFKTVRMDUZSP-UHFFFAOYSA-N
- Formula
- C9H12
- SMILES
- CC(C)c1ccccc1
- Mol. Weight (g/mol)
- 120.19
- CAS
- 98-82-8
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Benzene, (1-methylethyl)- (2) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0000 | 0.0006 |
| 0.0518 | 0.0006 |
| 0.1305 | 0.0006 |
| 0.2631 | 0.0006 |
| 0.4022 | 0.0006 |
| 0.5439 | 0.0006 |
| 0.6917 | 0.0007 |
| 0.8420 | 0.0007 |
| 0.9355 | 0.0007 |
| 1.0000 | 0.0007 |
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Benzene, (1-methylethyl)- (2) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0000 | 0.0006 |
| 0.0518 | 0.0006 |
| 0.1305 | 0.0006 |
| 0.2631 | 0.0006 |
| 0.4022 | 0.0006 |
| 0.5439 | 0.0006 |
| 0.6917 | 0.0007 |
| 0.8420 | 0.0007 |
| 0.9355 | 0.0007 |
| 1.0000 | 0.0007 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Benzene, (1-methylethyl)- (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 796.0 |
| 0.0518 | 799.4 |
| 0.1305 | 804.6 |
| 0.2631 | 813.4 |
| 0.4022 | 822.6 |
| 0.5439 | 831.5 |
| 0.6917 | 840.3 |
| 0.8420 | 848.7 |
| 0.9355 | 853.7 |
| 1.0000 | 857.1 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Benzene, (1-methylethyl)- (2) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 796.0 |
| 0.0518 | 799.4 |
| 0.1305 | 804.6 |
| 0.2631 | 813.4 |
| 0.4022 | 822.6 |
| 0.5439 | 831.5 |
| 0.6917 | 840.3 |
| 0.8420 | 848.7 |
| 0.9355 | 853.7 |
| 1.0000 | 857.1 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Benzene, (1-methylethyl)- (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1215.0 |
| 0.0518 | 1227.0 |
| 0.1305 | 1231.0 |
| 0.2631 | 1234.0 |
| 0.4022 | 1246.0 |
| 0.5439 | 1262.0 |
| 0.6917 | 1282.0 |
| 0.8420 | 1309.0 |
| 0.9355 | 1325.0 |
| 1.0000 | 1338.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Benzene, (1-methylethyl)- (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1215.0 |
| 0.0518 | 1227.0 |
| 0.1305 | 1231.0 |
| 0.2631 | 1234.0 |
| 0.4022 | 1246.0 |
| 0.5439 | 1262.0 |
| 0.6917 | 1282.0 |
| 0.8420 | 1309.0 |
| 0.9355 | 1325.0 |
| 1.0000 | 1338.0 |