- InChI
- InChI=1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3
- InChI Key
- RLSSMJSEOOYNOY-UHFFFAOYSA-N
- Formula
- C7H8O
- SMILES
- Cc1cccc(O)c1
- Molecular Weight1
- 108.14
- CAS
- 108-39-4
- Other Names
-
- 1-Hydroxy-3-methylbenzene
- 3-Cresol
- 3-Hydroxytoluene
- 3-METHYLPHENOL
- Cresol, meta
- Cresol,m-
- M-CRESYLIC ACID
- M-HYDROXYTOLUENE
- NSC 8768
- Rcra waste number U052
- m-Cresol
- m-Cresole
- m-Kresol
- m-Methylphenol
- m-Oxytoluene
- m-Toluol
- meta-Cresol
- meta-hydroxytoluene
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔsubH : Enthalpy of sublimation at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tboil : Boiling point at given pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.4540 | KDB | |
| PAff | 841.00 ± 8.00 | kJ/mol | NIST |
| BasG | 809.00 ± 8.00 | kJ/mol | NIST |
| ΔcH°liquid | [-3721.00; -3694.00] | kJ/mol |
|
| ΔcH°liquid | -3704.70 ± 0.30 | kJ/mol | NIST |
| ΔcH°liquid | -3703.90 ± 0.59 | kJ/mol | NIST |
| ΔcH°liquid | -3721.00 | kJ/mol | NIST |
| ΔcH°liquid | -3704.40 | kJ/mol | NIST |
| ΔcH°liquid | -3694.00 | kJ/mol | NIST |
| μ | 1.80 | debye | KDB |
| ΔfG° | -40.57 | kJ/mol | KDB |
| ΔfH°gas | [-133.80; -117.30] | kJ/mol |
|
| ΔfH°gas | -132.40 | kJ/mol | KDB |
| ΔfH°gas | -133.60 ± 1.10 | kJ/mol | NIST |
| ΔfH°gas | -132.30 ± 1.10 | kJ/mol | NIST |
| ΔfH°gas | -117.30 | kJ/mol | NIST |
| ΔfH°gas | -133.80 | kJ/mol | NIST |
| ΔfH°liquid | [-194.10; -177.00] | kJ/mol |
|
| ΔfH°liquid | -193.30 | kJ/mol | NIST |
| ΔfH°liquid | -194.10 ± 1.10 | kJ/mol | NIST |
| ΔfH°liquid | -177.00 | kJ/mol | NIST |
| ΔfH°liquid | -193.50 | kJ/mol | NIST |
| ΔfusH° | 13.71 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 46.47 | kJ/mol | Joback Calculated Property |
| IE | [8.23; 8.98] | eV |
|
| IE | 8.29 ± 0.02 | eV | NIST |
| IE | 8.36 ± 0.11 | eV | NIST |
| IE | 8.29 ± 0.02 | eV | NIST |
| IE | 8.23 | eV | NIST |
| IE | 8.52 ± 0.05 | eV | NIST |
| IE | Outlier 8.98 | eV | NIST |
| IE | 8.41 | eV | NIST |
| IE | 8.52 | eV | NIST |
| log10WS | [-0.68; -0.68] |
|
|
| log10WS | -0.68 | Aq. Sol... | |
| log10WS | -0.68 | Estimat... | |
| logPoct/wat | 1.701 | Crippen Calculated Property | |
| McVol | 91.600 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 1 | KDB | |
| NFPA Health | 2 | KDB | |
| Pc | [4360.00; 4564.69] | kPa |
|
| Pc | 4560.00 | kPa | KDB |
| Pc | Outlier 4360.00 ± 588.40 | kPa | NIST |
| Pc | 4559.63 ± 303.98 | kPa | NIST |
| Pc | 4560.00 ± 91.19 | kPa | NIST |
| Pc | 4554.56 ± 151.99 | kPa | NIST |
| Pc | 4564.69 ± 151.99 | kPa | NIST |
| Inp | [171.00; 1105.00] |
|
|
| Inp | 1045.00 | NIST | |
| Inp | 1059.00 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1059.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1028.90 | NIST | |
| Inp | 1034.50 | NIST | |
| Inp | 1037.00 | NIST | |
| Inp | 1037.00 | NIST | |
| Inp | 1050.00 | NIST | |
| Inp | 1050.00 | NIST | |
| Inp | 1050.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1105.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1077.00 | NIST | |
| Inp | 1084.00 | NIST | |
| Inp | 1053.10 | NIST | |
| Inp | 1051.70 | NIST | |
| Inp | 1056.00 | NIST | |
| Inp | 1054.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1051.00 | NIST | |
| Inp | 1064.00 | NIST | |
| Inp | 1077.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1073.90 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1064.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1057.00 | NIST | |
| Inp | 1057.00 | NIST | |
| Inp | 1083.00 | NIST | |
| Inp | 1074.00 | NIST | |
| Inp | 1100.00 | NIST | |
| Inp | 1093.00 | NIST | |
| Inp | 1081.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1051.00 | NIST | |
| Inp | 1055.00 | NIST | |
| Inp | 1055.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1055.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1090.00 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1047.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1091.00 | NIST | |
| Inp | 1044.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1086.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1079.00 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1057.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1077.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | Outlier 175.80 | NIST | |
| Inp | Outlier 176.00 | NIST | |
| Inp | Outlier 175.79 | NIST | |
| Inp | Outlier 178.68 | NIST | |
| Inp | Outlier 175.40 | NIST | |
| Inp | Outlier 177.63 | NIST | |
| Inp | Outlier 171.00 | NIST | |
| Inp | Outlier 175.80 | NIST | |
| Inp | Outlier 177.63 | NIST | |
| Inp | Outlier 177.95 | NIST | |
| I | [2059.00; 2140.00] |
|
|
| I | 2093.00 | NIST | |
| I | 2085.00 | NIST | |
| I | 2100.00 | NIST | |
| I | 2129.00 | NIST | |
| I | 2091.00 | NIST | |
| I | 2097.00 | NIST | |
| I | 2109.00 | NIST | |
| I | 2097.00 | NIST | |
| I | 2067.00 | NIST | |
| I | 2081.00 | NIST | |
| I | 2083.00 | NIST | |
| I | 2109.09 | NIST | |
| I | 2102.63 | NIST | |
| I | 2109.90 | NIST | |
| I | 2100.00 | NIST | |
| I | 2099.00 | NIST | |
| I | 2081.00 | NIST | |
| I | 2129.00 | NIST | |
| I | Outlier 2140.00 | NIST | |
| I | 2068.00 | NIST | |
| I | Outlier 2135.00 | NIST | |
| I | 2077.00 | NIST | |
| I | 2103.00 | NIST | |
| I | 2071.00 | NIST | |
| I | 2111.00 | NIST | |
| I | 2080.00 | NIST | |
| I | 2107.00 | NIST | |
| I | 2115.00 | NIST | |
| I | 2112.00 | NIST | |
| I | 2090.00 | NIST | |
| I | 2114.00 | NIST | |
| I | 2116.00 | NIST | |
| I | 2065.00 | NIST | |
| I | 2088.00 | NIST | |
| I | 2060.00 | NIST | |
| I | 2069.00 | NIST | |
| I | 2106.00 | NIST | |
| I | 2068.00 | NIST | |
| I | 2090.00 | NIST | |
| I | 2091.00 | NIST | |
| I | 2064.00 | NIST | |
| I | 2080.00 | NIST | |
| I | 2085.00 | NIST | |
| I | 2083.00 | NIST | |
| I | 2108.00 | NIST | |
| I | 2059.00 | NIST | |
| I | 2059.00 | NIST | |
| I | 2100.00 | NIST | |
| S°liquid | 212.59 | J/mol×K | NIST |
| Tboil | 475.42 | K | KDB |
| Tc | [705.00; 705.80] | K |
|
| Tc | 705.80 | K | KDB |
| Tc | 705.80 ± 0.40 | K | NIST |
| Tc | 705.75 ± 0.45 | K | NIST |
| Tc | 705.15 ± 2.00 | K | NIST |
| Tc | 705.00 ± 2.50 | K | NIST |
| Tc | 705.15 ± 2.00 | K | NIST |
| Tfus | [284.67; 284.90] | K |
|
| Tfus | 284.90 | K | KDB |
| Tfus | 284.67 | K | Aq. Sol... |
| Ttriple | 285.40 ± 0.02 | K | NIST |
| Vc | 0.309 | m3/kmol | KDB |
| Zc | 0.2401070 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [184.27; 237.56] | J/mol×K | [466.86; 696.68] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 180 190 200 210 220 230 240 500 600 700 | ||||
| Cp,gas | 184.27 | J/mol×K | 466.86 | Joback Calculated Property |
| Cp,gas | 195.06 | J/mol×K | 505.16 | Joback Calculated Property |
| Cp,gas | 204.98 | J/mol×K | 543.47 | Joback Calculated Property |
| Cp,gas | 214.11 | J/mol×K | 581.77 | Joback Calculated Property |
| Cp,gas | 222.53 | J/mol×K | 620.08 | Joback Calculated Property |
| Cp,gas | 230.32 | J/mol×K | 658.38 | Joback Calculated Property |
| Cp,gas | 237.56 | J/mol×K | 696.68 | Joback Calculated Property |
| Cp,liquid | [216.70; 224.93] | J/mol×K | [93.00; 298.15] |
|
| Cp,liquid | 220.90 | J/mol×K | 93.00 | NIST |
| Cp,liquid | 216.70 | J/mol×K | 283.00 | NIST |
| Cp,liquid | 218.80 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 224.93 | J/mol×K | 298.15 | NIST |
| η | [0.0017590; 0.0077010] | Pa×s | [308.15; 353.15] |
|
|
T(K) Dynamic viscosity (Pa×s) 2.00e-3 3.00e-3 4.00e-3 5.00e-3 6.00e-3 7.00e-3 8.00e-3 320 340 | ||||
| η | 0.0077010 | Pa×s | 308.15 | Densiti... |
| η | 0.0061200 | Pa×s | 313.15 | Densiti... |
| η | 0.0050220 | Pa×s | 318.15 | Densiti... |
| η | 0.0041580 | Pa×s | 323.15 | Densiti... |
| η | 0.0035180 | Pa×s | 328.15 | Densiti... |
| η | 0.0029800 | Pa×s | 333.15 | Densiti... |
| η | 0.0022310 | Pa×s | 343.15 | Densiti... |
| η | 0.0017590 | Pa×s | 353.15 | Densiti... |
| ΔfusH | [8.90; 10.71] | kJ/mol | [280.75; 285.40] |
|
|
T(K) Enthalpy of fusion at a given temperature (kJ/mol) 9 9.5 10 10.5 282 284 | ||||
| ΔfusH | 9.10 | kJ/mol | 280.75 | NIST |
| ΔfusH | 9.10 | kJ/mol | 280.80 | NIST |
| ΔfusH | 8.90 | kJ/mol | 282.30 | NIST |
| ΔfusH | 9.41 | kJ/mol | 285.00 | NIST |
| ΔfusH | 10.67 | kJ/mol | 285.30 | NIST |
| ΔfusH | 10.71 | kJ/mol | 285.40 | NIST |
| ΔfusH | 10.71 | kJ/mol | 285.40 | NIST |
| ΔfusH | 10.71 | kJ/mol | 285.40 | NIST |
| ΔsubH | [56.10; 61.70] | kJ/mol | [279.00; 298.50] |
|
| ΔsubH | 56.10 | kJ/mol | 279.00 | NIST |
| ΔsubH | 61.70 ± 1.00 | kJ/mol | 298.50 | NIST |
| ΔvapH | [43.80; 63.10] | kJ/mol | [350.50; 578.00] |
|
|
T(K) Enthalpy of vaporization at a given temperature (kJ/mol) 45 50 55 60 65 400 500 | ||||
| ΔvapH | 63.10 | kJ/mol | 350.50 | NIST |
| ΔvapH | 60.60 | kJ/mol | 408.50 | NIST |
| ΔvapH | 58.80 | kJ/mol | 416.00 | NIST |
| ΔvapH | 55.00 | kJ/mol | 428.00 | NIST |
| ΔvapH | 52.70 | kJ/mol | 443.50 | NIST |
| ΔvapH | 50.70 | kJ/mol | 448.00 | NIST |
| ΔvapH | 47.41 | kJ/mol | 475.40 | KDB |
| ΔvapH | 47.60 | kJ/mol | 501.00 | NIST |
| ΔvapH | 43.80 | kJ/mol | 578.00 | NIST |
| Pvap | 20.00 | kPa | 422.25 | Experim... |
| n0 | [1.53200; 1.54140] | [293.15; 308.15] |
|
|
|
T(K) Refractive Index 1.53 1.53 1.54 1.54 1.54 1.54 295 300 305 | ||||
| n0 | 1.54140 | 293.15 | Excess ... | |
| n0 | 1.54010 | 293.15 | Activit... | |
| n0 | 1.53950 | 298.15 | Excess ... | |
| n0 | 1.53950 | 298.15 | (Vapor ... | |
| n0 | 1.53800 | 298.15 | Densiti... | |
| n0 | 1.53500 | 303.15 | Densiti... | |
| n0 | 1.53200 | 308.15 | Densiti... | |
| ρl | [993.63; 1034.00] | kg/m3 | [293.00; 343.15] |
|
|
T(K) Liquid Density (kg/m3) 990 1000 1010 1020 1030 300 320 340 | ||||
| ρl | 1034.00 | kg/m3 | 293.00 | KDB |
| ρl | 1033.85 | kg/m3 | 293.15 | Liquid-... |
| ρl | 1033.84 | kg/m3 | 293.15 | Experim... |
| ρl | 1033.85 | kg/m3 | 293.15 | Liquid-... |
| ρl | 1029.91 | kg/m3 | 298.15 | Experim... |
| ρl | 1025.96 | kg/m3 | 303.15 | Experim... |
| ρl | 1025.95 | kg/m3 | 303.15 | Vapor-L... |
| ρl | 1025.71 | kg/m3 | 303.15 | Thermod... |
| ρl | 1021.99 | kg/m3 | 308.15 | Experim... |
| ρl | 1021.70 | kg/m3 | 308.15 | Thermod... |
| ρl | 1018.00 | kg/m3 | 313.15 | Experim... |
| ρl | 1017.69 | kg/m3 | 313.15 | Thermod... |
| ρl | 1013.99 | kg/m3 | 318.15 | Experim... |
| ρl | 1013.65 | kg/m3 | 318.15 | Thermod... |
| ρl | 1009.97 | kg/m3 | 323.15 | Experim... |
| ρl | 1009.20 | kg/m3 | 323.20 | Liquid-... |
| ρl | 1005.91 | kg/m3 | 328.15 | Experim... |
| ρl | 1001.84 | kg/m3 | 333.15 | Experim... |
| ρl | 997.74 | kg/m3 | 338.15 | Experim... |
| ρl | 993.63 | kg/m3 | 343.15 | Experim... |
| ΔfusS | [27.53; 33.03] | J/mol×K | [280.75; 285.40] |
|
| ΔfusS | 32.00 | J/mol×K | 280.75 | NIST |
| ΔfusS | 33.03 | J/mol×K | 285.00 | NIST |
| ΔfusS | 27.53 | J/mol×K | 285.40 | NIST |
| γ | 0.04 | N/m | 298.20 | KDB |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboil | [402.24; 428.56] | K | [9.29; 25.13] |
|
|
P(kPa) Boiling point at given pressure (K) 400 405 410 415 420 425 430 10 15 20 25 | ||||
| Tboil | 402.24 | K | 9.29 | Measure... |
| Tboil | 408.55 | K | 11.93 | Measure... |
| Tboil | 413.39 | K | 14.57 | Measure... |
| Tboil | 417.47 | K | 16.68 | Measure... |
| Tboil | 420.54 | K | 18.79 | Measure... |
| Tboil | 422.16 | K | 20.00 | Measure... |
| Tboil | 423.55 | K | 20.91 | Measure... |
| Tboil | 426.04 | K | 23.02 | Measure... |
| Tboil | 428.56 | K | 25.13 | Measure... |
Datasets
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 313.22 | 1001.00 | 1019.1 |
| 313.22 | 2012.00 | 1019.8 |
| 313.22 | 3024.00 | 1020.3 |
| 313.22 | 4007.00 | 1020.9 |
| 313.22 | 4992.00 | 1021.4 |
| 313.22 | 6027.00 | 1022.0 |
| 313.22 | 7013.00 | 1022.6 |
| 313.22 | 8000.00 | 1023.1 |
| 313.22 | 9008.00 | 1023.7 |
| 313.22 | 10014.00 | 1024.3 |
| 313.22 | 11015.00 | 1024.8 |
| 313.22 | 12040.00 | 1025.4 |
| 313.22 | 13022.00 | 1026.0 |
| 313.22 | 14023.00 | 1026.4 |
| 313.22 | 15002.00 | 1026.9 |
| 313.22 | 16009.00 | 1027.5 |
| 313.22 | 17020.00 | 1028.0 |
| 313.22 | 18021.00 | 1028.5 |
| 313.22 | 19016.00 | 1029.0 |
| 313.22 | 20026.00 | 1029.6 |
| 313.22 | 21024.00 | 1030.1 |
| 313.22 | 22026.00 | 1030.7 |
| 313.22 | 23030.00 | 1031.1 |
| 313.22 | 24017.00 | 1031.6 |
| 313.22 | 25019.00 | 1032.2 |
| 322.90 | 1014.00 | 1011.2 |
| 322.90 | 2041.00 | 1011.8 |
| 322.90 | 3002.00 | 1012.4 |
| 322.90 | 4014.00 | 1013.0 |
| 322.90 | 5012.00 | 1013.6 |
| 322.90 | 6022.00 | 1014.2 |
| 322.90 | 7020.00 | 1014.7 |
| 322.90 | 8018.00 | 1015.3 |
| 322.90 | 9020.00 | 1015.9 |
| 322.90 | 10005.00 | 1016.4 |
| 322.90 | 11018.00 | 1017.0 |
| 322.90 | 12019.00 | 1017.6 |
| 322.90 | 13017.00 | 1018.2 |
| 322.90 | 14010.00 | 1018.7 |
| 322.90 | 15022.00 | 1019.3 |
| 322.90 | 16000.00 | 1019.8 |
| 322.90 | 17011.00 | 1020.4 |
| 322.90 | 18018.00 | 1020.9 |
| 322.90 | 19018.00 | 1021.4 |
| 322.90 | 20009.00 | 1022.0 |
| 322.90 | 21019.00 | 1022.6 |
| 322.90 | 22019.00 | 1023.1 |
| 322.90 | 23006.00 | 1023.6 |
| 322.90 | 24012.00 | 1024.1 |
| 322.90 | 25019.00 | 1024.7 |
| 332.61 | 1018.00 | 1003.3 |
| 332.61 | 2014.00 | 1004.0 |
| 332.61 | 3003.00 | 1004.5 |
| 332.61 | 4030.00 | 1005.2 |
| 332.61 | 5000.00 | 1005.8 |
| 332.61 | 6022.00 | 1006.4 |
| 332.61 | 7020.00 | 1006.9 |
| 332.61 | 8020.00 | 1007.5 |
| 332.61 | 9003.00 | 1008.1 |
| 332.61 | 10014.00 | 1008.7 |
| 332.61 | 11012.00 | 1009.3 |
| 332.61 | 12000.00 | 1009.9 |
| 332.61 | 13000.00 | 1010.4 |
| 332.61 | 14028.00 | 1011.0 |
| 332.61 | 15028.00 | 1011.6 |
| 332.61 | 16023.00 | 1012.2 |
| 332.61 | 17000.00 | 1012.7 |
| 332.61 | 18008.00 | 1013.3 |
| 332.61 | 19000.00 | 1013.9 |
| 332.61 | 20001.00 | 1014.4 |
| 332.61 | 21013.00 | 1014.9 |
| 332.61 | 22010.00 | 1015.5 |
| 332.61 | 23007.00 | 1016.0 |
| 332.61 | 24000.00 | 1016.6 |
| 332.61 | 25008.00 | 1017.1 |
| 342.27 | 2018.00 | 995.8 |
| 342.27 | 2999.00 | 996.4 |
| 342.27 | 3998.00 | 997.0 |
| 342.27 | 4976.00 | 997.6 |
| 342.27 | 5984.00 | 998.3 |
| 342.27 | 7059.00 | 998.9 |
| 342.27 | 8070.00 | 999.7 |
| 342.27 | 8967.00 | 1000.2 |
| 342.27 | 9994.00 | 1000.8 |
| 342.27 | 10921.00 | 1001.4 |
| 342.27 | 11964.00 | 1002.1 |
| 342.27 | 12971.00 | 1002.6 |
| 342.27 | 13954.00 | 1003.2 |
| 342.27 | 14960.00 | 1004.0 |
| 342.27 | 15941.00 | 1004.3 |
| 342.27 | 16963.00 | 1005.1 |
| 342.27 | 17992.00 | 1005.8 |
| 342.27 | 18963.00 | 1006.2 |
| 342.27 | 19996.00 | 1006.7 |
| 342.27 | 21003.00 | 1007.5 |
| 342.27 | 21974.00 | 1008.0 |
| 342.27 | 22968.00 | 1008.7 |
| 342.27 | 24051.00 | 1009.2 |
| 342.27 | 24971.00 | 1009.7 |
| 352.06 | 1951.00 | 988.5 |
| 352.06 | 2979.00 | 989.1 |
| 352.06 | 4034.00 | 989.8 |
| 352.06 | 4966.00 | 990.3 |
| 352.06 | 5929.00 | 990.9 |
| 352.06 | 7014.00 | 991.6 |
| 352.06 | 8011.00 | 992.2 |
| 352.06 | 8921.00 | 992.8 |
| 352.06 | 9982.00 | 993.4 |
| 352.06 | 10938.00 | 994.0 |
| 352.06 | 11975.00 | 994.6 |
| 352.06 | 12999.00 | 995.3 |
| 352.06 | 13907.00 | 995.8 |
| 352.06 | 14981.00 | 996.5 |
| 352.06 | 15966.00 | 997.1 |
| 352.06 | 16996.00 | 997.7 |
| 352.06 | 17984.00 | 998.3 |
| 352.06 | 18991.00 | 998.9 |
| 352.06 | 20005.00 | 999.5 |
| 352.06 | 21038.00 | 1000.1 |
| 352.06 | 22019.00 | 1000.6 |
| 352.06 | 23001.00 | 1001.2 |
| 352.06 | 24029.00 | 1001.8 |
| 352.06 | 24969.00 | 1002.3 |
| 361.90 | 1990.00 | 980.5 |
| 361.90 | 3001.00 | 981.2 |
| 361.90 | 4024.00 | 981.8 |
| 361.90 | 5019.00 | 982.5 |
| 361.90 | 6014.00 | 983.1 |
| 361.90 | 7025.00 | 983.7 |
| 361.90 | 8019.00 | 984.4 |
| 361.90 | 9010.00 | 985.0 |
| 361.90 | 9978.00 | 985.6 |
| 361.90 | 11019.00 | 986.3 |
| 361.90 | 12038.00 | 986.9 |
| 361.90 | 13020.00 | 987.6 |
| 361.90 | 14021.00 | 988.2 |
| 361.90 | 15006.00 | 988.8 |
| 361.90 | 15970.00 | 989.4 |
| 361.90 | 16988.00 | 990.1 |
| 361.90 | 17991.00 | 990.7 |
| 361.90 | 19016.00 | 991.4 |
| 361.90 | 20042.00 | 992.0 |
| 361.90 | 20983.00 | 992.6 |
| 361.90 | 22034.00 | 993.3 |
| 361.90 | 23021.00 | 993.9 |
| 361.90 | 24011.00 | 994.6 |
| 361.90 | 24912.00 | 995.1 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.68] | kPa | [370.97; 501.72] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.38350e+01 | |||
| Coefficient B | -3.00508e+03 | |||
| Coefficient C | -1.49150e+02 | |||
| Temperature range, min. | 370.97 | |||
| Temperature range, max. | 501.72 | |||
|
T(K) Vapor pressure (kPa) 0 50 100 150 200 400 450 500 | ||||
| Pvap | 1.33 | kPa | 370.97 | Calculated Property |
| Pvap | 3.07 | kPa | 385.50 | Calculated Property |
| Pvap | 6.40 | kPa | 400.03 | Calculated Property |
| Pvap | 12.33 | kPa | 414.55 | Calculated Property |
| Pvap | 22.20 | kPa | 429.08 | Calculated Property |
| Pvap | 37.70 | kPa | 443.61 | Calculated Property |
| Pvap | 60.91 | kPa | 458.14 | Calculated Property |
| Pvap | 94.27 | kPa | 472.66 | Calculated Property |
| Pvap | 140.52 | kPa | 487.19 | Calculated Property |
| Pvap | 202.68 | kPa | 501.72 | Calculated Property |
| Pvap | [4.30e-03; 4580.17] | kPa | [285.39; 705.85] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 1.62599e+02 | |||
| Coefficient B | -1.39270e+04 | |||
| Coefficient C | -2.12308e+01 | |||
| Coefficient D | 9.68027e-06 | |||
| Temperature range, min. | 285.39 | |||
| Temperature range, max. | 705.85 | |||
|
T(K) Vapor pressure (kPa) 0 1000 2000 3000 4000 5000 400 600 | ||||
| Pvap | 4.30e-03 | kPa | 285.39 | Calculated Property |
| Pvap | 0.22 | kPa | 332.11 | Calculated Property |
| Pvap | 3.24 | kPa | 378.83 | Calculated Property |
| Pvap | 22.34 | kPa | 425.54 | Calculated Property |
| Pvap | 93.54 | kPa | 472.26 | Calculated Property |
| Pvap | 281.06 | kPa | 518.98 | Calculated Property |
| Pvap | 675.40 | kPa | 565.70 | Calculated Property |
| Pvap | 1396.14 | kPa | 612.41 | Calculated Property |
| Pvap | 2611.22 | kPa | 659.13 | Calculated Property |
| Pvap | 4580.17 | kPa | 705.85 | Calculated Property |
Similar Compounds
Find more compounds similar to Phenol, 3-methyl-.
Mixtures
- Benzene, nitro- + Phenol, 3-methyl-
- Phenol, 3-methyl- + Formamide, N,N-dimethyl-
- Phenol, 3-methyl- + Phenol, 2,6-dimethyl-
- Phenol, 2-methyl- + Phenol, 3-methyl-
- Phenol, 3-methyl- + Methyl Alcohol
- Phenol, 3-methyl- + Ethanol
- 1-Propanol + Phenol, 3-methyl-
- Phenol, 3-methyl- + Isopropyl Alcohol
- Phenol, 3-methyl- + 1-Butanol
- Phenol, 3-methyl- + 1-Propanol, 2-methyl-
- 2-Propanol, 2-methyl- + Phenol, 3-methyl-
- 2-Hexanone + Phenol, 3-methyl- + Water
- Phenol, 3-methyl- + Diethanolamine
- Phenol, 3-methyl- + Nonane
- Phenol, 3-methyl- + Decane
- Undecane + Phenol, 3-methyl-
- Phenol, 3-methyl- + Dodecane
- Phenol, 3-methyl- + 1,2-Ethanediol
- Toluene + Phenol, 3-methyl- + Water
- Phenol, 3-methyl- + Ethylbenzene + Water
Find more mixtures with Phenol, 3-methyl-.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Excess Gibbs energies of binary mixtures formed by nitrobenzene with selected compounds at 94.95 kPa
- Excess Gibbs' energies of the binary mixtures formed by N,N-dimethylformamide with xylenes and cresols at 95.1 kPa
- Liquid-liquid equilibria in the ternary systems water + cresols + methyl butyl ketone at 298.2 and 313.2 K: experimental data and correlation
- Liquid-liquid equilibria for the extraction of phenols from alkane using ethylene glycol
- Liquid-liquid equilibria for methyl isobutyl ketone + cresols + water at 333.15K, 343.15K and 353.15K: Experimental results and data correlation
- Determination and modeling of liquid-liquid equilibrium for ternary mixtures of methyl isopropyl ketone, cresol isomers and water
- Measurement, correlation and COSMO-SAC prediction of liquid-liquid equilibrium for the ternary systems, mesityl oxide + o-, m-, p-cresol + water, at 333.2 K and 353.2 K
- Phase equilibria of phenolic compounds in water or ethanol
- Measurement and correlation of isobaric vapour-liquid equilibrium for systems of o-cresol, m-cresol and 2, 6-dimethylphenol at 20.0 kPa
- (Vapor + liquid) equilibria of the binary mixtures of m-cresol with C1 C4 aliphatic alcohols at 95.5 kPa
- Volumetric and ultrasonic behaviour of binary mixtures of 1-nonanol with o-cresol, m-cresol, p-cresol and anisole at T = (293.15 and 313.15) K
- Excess parameters of binary mixtures of anisaldehyde with o-cresol, m-cresol and p-cresol at T = (303.15, 308.15, 313.15, and 318.15) K
- Measurement and thermodynamic modeling of ternary (liquid + liquid) equilibrium for extraction of o-cresol, m-cresol or p-cresol from aqueous solution with 2-pentanone
- Liquid-liquid equilibria for toluene/heptane + phenol/cresols + ethylene glycol system
- Extraction of o-, m- and p-cresol from aqueous solution with methyl isopropyl ketone: Equilibrium, correlations, and COSMO-RS predictions
- Liquid-liquid equilibrium for methyl butyl ketone + o-, m-, p-cresol + water ternary systems and COSMO-SAC predictions
- Experimental and predicted vapor-liquid equilibrium for binary systems with diethanolamine, m-cresol and p-cresol at 20.0 kPa
- Solvent screening and liquid-liquid measurement for extraction of phenols from aromatic hydrocarbon mixtures
- Thermodynamic and spectroscopic study of molecular interactions between ethanol and isomeric cresols
- Liquid Liquid Equilibrium for the Ternary Systems Methyl tert-Butyl Ketone + o-, m-, p-Cresol + Water at (298.2, 313.2, and 323.2) K
- Phase Equilibrium on Extraction Methylphenols from Aqueous Solution with 3,3-Dimethyl-2-butanone at 333.2 K and 353.2 K
- Activity Coefficients at Infinite Dilution and Excess Molar Volumes in Binary Mixtures Containing Normal Alkanes (Nonane, Decane, Undecane, or Dodecane) and Cresols (2-Methylphenol or 3-Methylphenol)
- Densities and Viscosities of Binary Mixtures of m-Cresol with Ethylene Glycol or Methanol over Several Temperatures
- Liquid-Liquid Equilibria in Ternary Systems of Aromatic Hydrocarbons (Toluene or Ethylbenzene) + Phenols + Water
- Densities, Speeds of Sound, and Refractive Indices of Binary Mixtures of Decan-1-ol with Anisole, o-Cresol, m-Cresol, and p-Cresol at T = (298.15, 303.15, and 308.15) K
- Henry's Law Constants and Infinite Dilution Activity Coefficients of Propane, Propene, Butane, 2-Methylpropane, 1-Butene, 2-Methylpropene, trans-2-Butene, cis-2-Butene, 1,3-Butadiene, Dimethyl Ether, Chloroethane, and 1,1-Difluoroethane in 2-Methylphenol, 3-Methylphenol, and 4-Methylphenol
- Liquid-Liquid(-Liquid) Equilibria in Ternary Systems of Aliphatic Hydrocarbons (Heptane or Octane) + Phenols + Water
- Vapor-Liquid Equilibria in Ternary Systems of Toluene or Octane + Phenols + Water
- Densities of Cresols and Linear Alkane Mixtures at High Pressure
- Experimental Densities and Speeds of Sound of Substituted Phenols and Their Modeling with the Prigogine Flory Patterson Model
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.