- InChI
- InChI=1S/C7H8O/c1-6-4-2-3-5-7(6)8/h2-5,8H,1H3
- InChI Key
- QWVGKYWNOKOFNN-UHFFFAOYSA-N
- Formula
- C7H8O
- SMILES
- Cc1ccccc1O
- Molecular Weight1
- 108.14
- CAS
- 95-48-7
- Other Names
-
- 1-Hydroxy-2-methylbenzene
- 1-Methyl-2-hydroxybenzene
- 2-Cresol
- 2-Hydroxytoluene
- 2-METHYLPHENOL
- NSC 23076
- O-CRESYLIC ACID
- O-HYDROXYTOLUENE
- Orthocresol
- Rcra waste number U052
- o-Cresol
- o-Kresol
- o-Methylphenol
- o-Methylphenylol
- o-Oxytoluene
- o-Toluol
- ortho-cresol
- ortho-hydroxytoluene
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- ΔcH°solid : Standard solid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- Cp,solid : Solid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°solid : Solid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔsubH° : Enthalpy of sublimation at standard conditions (kJ/mol).
- ΔsubH : Enthalpy of sublimation at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- γ : Surface Tension (N/m).
- S°solid,1 bar : Solid phase molar entropy at standard conditions (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tboil : Boiling point at given pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.4330 | KDB | |
| PAff | 832.00 ± 8.00 | kJ/mol | NIST |
| BasG | 800.00 ± 8.00 | kJ/mol | NIST |
| ΔcH°liquid | -3696.00 | kJ/mol | NIST |
| ΔcH°solid | [-3697.00; -3693.30] | kJ/mol |
|
| ΔcH°solid | -3693.60 ± 0.42 | kJ/mol | NIST |
| ΔcH°solid | -3693.30 ± 1.00 | kJ/mol | NIST |
| ΔcH°solid | -3697.00 | kJ/mol | NIST |
| μ | 1.60 | debye | KDB |
| ΔfG° | -33.00 | kJ/mol | KDB |
| ΔfH°gas | [-128.70; -128.30] | kJ/mol |
|
| ΔfH°gas | -128.70 | kJ/mol | KDB |
| ΔfH°gas | -128.30 ± 0.88 | kJ/mol | NIST |
| ΔfH°gas | -128.60 ± 0.92 | kJ/mol | NIST |
| ΔfH°liquid | -202.00 | kJ/mol | NIST |
| ΔfH°solid | [-204.60; -204.30] | kJ/mol |
|
| ΔfH°solid | -204.30 | kJ/mol | NIST |
| ΔfH°solid | -204.60 ± 0.92 | kJ/mol | NIST |
| ΔfusH° | 13.71 | kJ/mol | Joback Calculated Property |
| ΔsubH° | [73.70; 76.02] | kJ/mol |
|
| ΔsubH° | 73.70 ± 0.50 | kJ/mol | NIST |
| ΔsubH° | 76.00 | kJ/mol | NIST |
| ΔsubH° | 76.02 ± 0.75 | kJ/mol | NIST |
| ΔsubH° | 76.00 | kJ/mol | NIST |
| ΔvapH° | 44.89 | kJ/mol | NIST |
| IE | [8.14; 8.93] | eV |
|
| IE | 8.14 | eV | NIST |
| IE | 8.24 ± 0.02 | eV | NIST |
| IE | 8.93 | eV | NIST |
| IE | 8.46 ± 0.06 | eV | NIST |
| IE | 8.50 | eV | NIST |
| IE | 8.48 | eV | NIST |
| log10WS | [-0.62; -0.62] |
|
|
| log10WS | -0.62 | Aq. Sol... | |
| log10WS | -0.62 | Estimat... | |
| logPoct/wat | 1.701 | Crippen Calculated Property | |
| McVol | 91.600 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 2 | KDB | |
| NFPA Health | 2 | KDB | |
| Pc | [4170.00; 5010.00] | kPa |
|
| Pc | 5010.00 | kPa | KDB |
| Pc | 4170.00 ± 39.22 | kPa | NIST |
| Pc | 4863.60 ± 303.98 | kPa | NIST |
| Pc | 5005.46 ± 70.92 | kPa | NIST |
| Inp | [170.20; 1080.00] |
|
|
| Inp | 1027.00 | NIST | |
| Inp | 1032.00 | NIST | |
| Inp | 1032.00 | NIST | |
| Inp | 1032.00 | NIST | |
| Inp | 1014.30 | NIST | |
| Inp | 1017.60 | NIST | |
| Inp | 1007.00 | NIST | |
| Inp | 1008.00 | NIST | |
| Inp | 1029.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1040.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1078.00 | NIST | |
| Inp | 1039.00 | NIST | |
| Inp | 1035.00 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1042.70 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1031.10 | NIST | |
| Inp | 1054.00 | NIST | |
| Inp | 1080.00 | NIST | |
| Inp | 1042.00 | NIST | |
| Inp | 1029.70 | NIST | |
| Inp | 1032.00 | NIST | |
| Inp | 1042.00 | NIST | |
| Inp | 1044.00 | NIST | |
| Inp | 1029.00 | NIST | |
| Inp | 1055.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1051.80 | NIST | |
| Inp | 1052.90 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1034.00 | NIST | |
| Inp | 1034.00 | NIST | |
| Inp | 1054.00 | NIST | |
| Inp | 1077.00 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1053.00 | NIST | |
| Inp | 1054.00 | NIST | |
| Inp | 1058.00 | NIST | |
| Inp | 1060.00 | NIST | |
| Inp | 1054.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1053.00 | NIST | |
| Inp | 1027.00 | NIST | |
| Inp | 1038.00 | NIST | |
| Inp | 1015.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1024.00 | NIST | |
| Inp | 1024.00 | NIST | |
| Inp | 1058.00 | NIST | |
| Inp | 1051.00 | NIST | |
| Inp | 1057.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1077.00 | NIST | |
| Inp | 1053.00 | NIST | |
| Inp | 1044.00 | NIST | |
| Inp | 1044.00 | NIST | |
| Inp | 1059.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1044.00 | NIST | |
| Inp | 1050.00 | NIST | |
| Inp | 1037.00 | NIST | |
| Inp | 1040.00 | NIST | |
| Inp | 1053.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1079.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1035.00 | NIST | |
| Inp | 1050.00 | NIST | |
| Inp | 1055.00 | NIST | |
| Inp | 1035.00 | NIST | |
| Inp | Outlier 170.20 | NIST | |
| Inp | Outlier 170.30 | NIST | |
| Inp | Outlier 172.54 | NIST | |
| Inp | Outlier 170.90 | NIST | |
| Inp | Outlier 171.30 | NIST | |
| Inp | Outlier 172.86 | NIST | |
| Inp | Outlier 172.86 | NIST | |
| Inp | Outlier 173.57 | NIST | |
| Inp | Outlier 172.86 | NIST | |
| Inp | 1035.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | Outlier 170.20 | NIST | |
| I | [1959.00; 2053.00] |
|
|
| I | 2004.00 | NIST | |
| I | 1980.00 | NIST | |
| I | 2014.00 | NIST | |
| I | 1995.00 | NIST | |
| I | 2022.00 | NIST | |
| I | 2019.00 | NIST | |
| I | Outlier 1959.00 | NIST | |
| I | 2011.00 | NIST | |
| I | 2011.00 | NIST | |
| I | 2000.00 | NIST | |
| I | 2000.00 | NIST | |
| I | Outlier 1969.00 | NIST | |
| I | 2000.00 | NIST | |
| I | 2000.00 | NIST | |
| I | 2019.80 | NIST | |
| I | 2017.19 | NIST | |
| I | 2020.19 | NIST | |
| I | 2014.43 | NIST | |
| I | 2033.00 | NIST | |
| I | 2011.00 | NIST | |
| I | 2012.00 | NIST | |
| I | 2002.00 | NIST | |
| I | 2000.00 | NIST | |
| I | 2021.00 | NIST | |
| I | 1992.00 | NIST | |
| I | 1993.00 | NIST | |
| I | 1992.00 | NIST | |
| I | 2011.00 | NIST | |
| I | 2030.00 | NIST | |
| I | 2008.00 | NIST | |
| I | 1995.00 | NIST | |
| I | Outlier 2050.00 | NIST | |
| I | 2007.00 | NIST | |
| I | 2025.00 | NIST | |
| I | 2025.00 | NIST | |
| I | 2010.00 | NIST | |
| I | 2010.00 | NIST | |
| I | 1980.00 | NIST | |
| I | 2030.00 | NIST | |
| I | Outlier 2053.00 | NIST | |
| I | 2012.00 | NIST | |
| I | 1996.00 | NIST | |
| I | 2000.00 | NIST | |
| I | 1970.00 | NIST | |
| I | 1979.00 | NIST | |
| I | 1979.00 | NIST | |
| I | 2004.00 | NIST | |
| I | 2000.00 | NIST | |
| I | 2011.00 | NIST | |
| I | 2007.00 | NIST | |
| I | 2010.00 | NIST | |
| I | 2012.00 | NIST | |
| I | 1979.00 | NIST | |
| I | 2014.00 | NIST | |
| S°solid,1 bar | 165.44 | J/mol×K | NIST |
| Tboil | [460.90; 464.95] | K |
|
| Tboil | 464.19 | K | KDB |
| Tboil | 464.20 | K | NIST |
| Tboil | 463.75 ± 2.00 | K | NIST |
| Tboil | 464.10 ± 0.30 | K | NIST |
| Tboil | 464.25 ± 1.00 | K | NIST |
| Tboil | 464.30 ± 0.60 | K | NIST |
| Tboil | 463.95 ± 1.00 | K | NIST |
| Tboil | 464.25 ± 0.30 | K | NIST |
| Tboil | 464.25 ± 0.35 | K | NIST |
| Tboil | Outlier 460.90 ± 0.70 | K | NIST |
| Tboil | 464.95 ± 1.50 | K | NIST |
| Tboil | 464.65 ± 1.50 | K | NIST |
| Tboil | 464.15 ± 0.50 | K | NIST |
| Tc | [695.15; 697.60] | K |
|
| Tc | 697.60 | K | KDB |
| Tc | 697.60 ± 0.40 | K | NIST |
| Tc | 697.55 ± 0.23 | K | NIST |
| Tc | 695.15 ± 2.00 | K | NIST |
| Tc | 695.50 ± 3.00 | K | NIST |
| Tfus | [302.55; 304.60] | K |
|
| Tfus | 302.90 | K | KDB |
| Tfus | 304.60 | K | Aq. Sol... |
| Tfus | 304.15 | K | Liquid ... |
| Tfus | 304.00 ± 0.30 | K | NIST |
| Tfus | 304.14 ± 0.05 | K | NIST |
| Tfus | 304.05 ± 0.30 | K | NIST |
| Tfus | 304.09 ± 0.05 | K | NIST |
| Tfus | 304.09 ± 0.10 | K | NIST |
| Tfus | 303.55 ± 0.25 | K | NIST |
| Tfus | 303.50 ± 0.20 | K | NIST |
| Tfus | 303.55 ± 0.50 | K | NIST |
| Tfus | 303.70 ± 0.50 | K | NIST |
| Tfus | 302.65 ± 0.40 | K | NIST |
| Tfus | 303.45 ± 0.40 | K | NIST |
| Tfus | 303.75 ± 0.20 | K | NIST |
| Tfus | 303.60 ± 0.30 | K | NIST |
| Tfus | 302.55 ± 0.50 | K | NIST |
| Tfus | 302.90 ± 0.15 | K | NIST |
| Ttriple | 304.20 ± 0.02 | K | NIST |
| Vc | 0.282 | m3/kmol | KDB |
| Zc | 0.2435810 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [184.27; 237.56] | J/mol×K | [466.86; 696.68] |
|
| Cp,gas | 184.27 | J/mol×K | 466.86 | Joback Calculated Property |
| Cp,gas | 195.06 | J/mol×K | 505.16 | Joback Calculated Property |
| Cp,gas | 204.98 | J/mol×K | 543.47 | Joback Calculated Property |
| Cp,gas | 214.11 | J/mol×K | 581.77 | Joback Calculated Property |
| Cp,gas | 222.53 | J/mol×K | 620.08 | Joback Calculated Property |
| Cp,gas | 230.32 | J/mol×K | 658.38 | Joback Calculated Property |
| Cp,gas | 237.56 | J/mol×K | 696.68 | Joback Calculated Property |
| Cp,liquid | [225.90; 233.60] | J/mol×K | [283.00; 313.00] |
|
| Cp,liquid | 225.90 | J/mol×K | 283.00 | NIST |
| Cp,liquid | 233.60 | J/mol×K | 313.00 | NIST |
| Cp,solid | 154.56 | J/mol×K | 298.15 | NIST |
| η | [0.0055660; 0.0132800] | Pa×s | [288.15; 308.15] |
|
| η | 0.0132800 | Pa×s | 288.15 | Viscosi... |
| η | 0.0096800 | Pa×s | 293.15 | Viscosi... |
| η | 0.0077600 | Pa×s | 298.15 | Viscosi... |
| η | 0.0065750 | Pa×s | 303.15 | Viscosi... |
| η | 0.0055660 | Pa×s | 308.15 | Viscosi... |
| ΔfusH | [13.94; 15.90] | kJ/mol | [303.00; 305.40] |
|
| ΔfusH | 13.94 | kJ/mol | 303.00 | NIST |
| ΔfusH | 14.80 | kJ/mol | 304.05 | NIST |
| ΔfusH | 15.90 | kJ/mol | 304.10 | NIST |
| ΔfusH | 14.80 | kJ/mol | 304.10 | NIST |
| ΔfusH | 15.82 | kJ/mol | 304.20 | NIST |
| ΔfusH | 15.82 | kJ/mol | 304.20 | NIST |
| ΔfusH | 15.82 | kJ/mol | 304.20 | NIST |
| ΔfusH | 14.80 | kJ/mol | 305.40 | NIST |
| ΔsubH | [74.80; 76.00] | kJ/mol | [288.00; 288.00] |
|
| ΔsubH | 74.80 | kJ/mol | 288.00 | NIST |
| ΔsubH | 76.00 ± 0.80 | kJ/mol | 288.00 | NIST |
| ΔvapH | [44.00; 58.50] | kJ/mol | [356.50; 573.50] |
|
| ΔvapH | 58.50 | kJ/mol | 356.50 | NIST |
| ΔvapH | 51.30 | kJ/mol | 428.00 | NIST |
| ΔvapH | 50.10 | kJ/mol | 434.50 | NIST |
| ΔvapH | 48.20 | kJ/mol | 438.50 | NIST |
| ΔvapH | 45.19 | kJ/mol | 464.10 | KDB |
| ΔvapH | 46.20 | kJ/mol | 494.50 | NIST |
| ΔvapH | 44.00 | kJ/mol | 573.50 | NIST |
| n0 | [1.53699; 1.54680] | [293.15; 308.15] |
|
|
| n0 | 1.54670 | 293.15 | Bubble ... | |
| n0 | 1.54680 | 293.15 | Excess ... | |
| n0 | 1.54680 | 298.15 | Activit... | |
| n0 | 1.54670 | 298.15 | Excess ... | |
| n0 | 1.54400 | 298.15 | Densiti... | |
| n0 | 1.54099 | 303.15 | Densiti... | |
| n0 | 1.53860 | 308.15 | Activit... | |
| n0 | 1.53699 | 308.15 | Densiti... | |
| ρl | [1001.46; 1046.00] | kg/m3 | [293.15; 343.15] |
|
| ρl | 1045.77 | kg/m3 | 293.15 | Experim... |
| ρl | 1046.00 | kg/m3 | 293.15 | Bubble ... |
| ρl | 1041.41 | kg/m3 | 298.15 | Experim... |
| ρl | 1037.02 | kg/m3 | 303.15 | Thermod... |
| ρl | 1037.05 | kg/m3 | 303.15 | Experim... |
| ρl | 1036.94 | kg/m3 | 303.15 | Vapor-L... |
| ρl | 1032.64 | kg/m3 | 308.15 | Experim... |
| ρl | 1032.58 | kg/m3 | 308.15 | Thermod... |
| ρl | 1032.73 | kg/m3 | 308.15 | Liquid-... |
| ρl | 1032.73 | kg/m3 | 308.15 | Liquid-... |
| ρl | 1028.00 | kg/m3 | 313.00 | KDB |
| ρl | 1028.19 | kg/m3 | 313.15 | Thermod... |
| ρl | 1028.25 | kg/m3 | 313.15 | Experim... |
| ρl | 1023.82 | kg/m3 | 318.15 | Thermod... |
| ρl | 1023.83 | kg/m3 | 318.15 | Experim... |
| ρl | 1019.39 | kg/m3 | 323.15 | Experim... |
| ρl | 1018.80 | kg/m3 | 323.20 | Liquid-... |
| ρl | 1014.93 | kg/m3 | 328.15 | Experim... |
| ρl | 1010.46 | kg/m3 | 333.15 | Experim... |
| ρl | 1005.97 | kg/m3 | 338.15 | Experim... |
| ρl | 1001.46 | kg/m3 | 343.15 | Experim... |
| ΔfusS | [46.00; 52.00] | J/mol×K | [303.00; 304.20] |
|
| ΔfusS | 46.00 | J/mol×K | 303.00 | NIST |
| ΔfusS | 49.00 | J/mol×K | 304.05 | NIST |
| ΔfusS | 52.00 | J/mol×K | 304.20 | NIST |
| γ | 0.03 | N/m | 333.20 | KDB |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboil | 411.26 | K | 20.00 | Measure... |
Datasets
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 313.20 | 1022.00 | 1027.5 |
| 313.20 | 2031.00 | 1028.1 |
| 313.20 | 3017.00 | 1028.7 |
| 313.20 | 4012.00 | 1029.2 |
| 313.20 | 5018.00 | 1029.8 |
| 313.20 | 6010.00 | 1030.4 |
| 313.20 | 7005.00 | 1030.9 |
| 313.20 | 8006.00 | 1031.5 |
| 313.20 | 9004.00 | 1032.0 |
| 313.20 | 10005.00 | 1032.6 |
| 323.16 | 1013.00 | 1018.7 |
| 323.16 | 2039.00 | 1019.3 |
| 323.16 | 3007.00 | 1019.9 |
| 323.16 | 4009.00 | 1020.5 |
| 323.16 | 5005.00 | 1021.1 |
| 323.16 | 6004.00 | 1021.7 |
| 323.16 | 6999.00 | 1022.2 |
| 323.16 | 8008.00 | 1022.8 |
| 323.16 | 9002.00 | 1023.4 |
| 323.16 | 10005.00 | 1024.0 |
| 333.10 | 1010.00 | 1009.9 |
| 333.10 | 2033.00 | 1010.5 |
| 333.10 | 3009.00 | 1011.1 |
| 333.10 | 4014.00 | 1011.8 |
| 333.10 | 5004.00 | 1012.4 |
| 333.10 | 5998.00 | 1013.0 |
| 333.10 | 7000.00 | 1013.6 |
| 333.10 | 8009.00 | 1014.2 |
| 333.10 | 9004.00 | 1014.8 |
| 333.10 | 10010.00 | 1015.4 |
| 343.06 | 1023.00 | 1000.8 |
| 343.06 | 2024.00 | 1001.6 |
| 343.06 | 3015.00 | 1002.2 |
| 343.06 | 4003.00 | 1002.9 |
| 343.06 | 5009.00 | 1003.6 |
| 343.06 | 6005.00 | 1004.2 |
| 343.06 | 7008.00 | 1004.8 |
| 343.06 | 8003.00 | 1005.5 |
| 343.06 | 8999.00 | 1006.1 |
| 343.06 | 10004.00 | 1006.7 |
| 352.99 | 1043.00 | 991.9 |
| 352.99 | 2000.00 | 992.6 |
| 352.99 | 3034.00 | 993.3 |
| 352.99 | 4015.00 | 994.0 |
| 352.99 | 5033.00 | 994.6 |
| 352.99 | 6007.00 | 995.3 |
| 352.99 | 7016.00 | 996.0 |
| 352.99 | 8006.00 | 996.7 |
| 352.99 | 9015.00 | 997.3 |
| 352.99 | 10014.00 | 998.0 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [352.96; 491.67] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.46886e+01 | |||
| Coefficient B | -3.72850e+03 | |||
| Coefficient C | -9.40520e+01 | |||
| Temperature range, min. | 352.96 | |||
| Temperature range, max. | 491.67 | |||
| Pvap | 1.33 | kPa | 352.96 | Calculated Property |
| Pvap | 2.99 | kPa | 368.37 | Calculated Property |
| Pvap | 6.17 | kPa | 383.78 | Calculated Property |
| Pvap | 11.82 | kPa | 399.20 | Calculated Property |
| Pvap | 21.27 | kPa | 414.61 | Calculated Property |
| Pvap | 36.26 | kPa | 430.02 | Calculated Property |
| Pvap | 59.00 | kPa | 445.43 | Calculated Property |
| Pvap | 92.16 | kPa | 460.85 | Calculated Property |
| Pvap | 138.85 | kPa | 476.26 | Calculated Property |
| Pvap | 202.65 | kPa | 491.67 | Calculated Property |
| Pvap | [0.06; 5016.43] | kPa | [304.19; 697.55] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 1.36184e+02 | |||
| Coefficient B | -1.20881e+04 | |||
| Coefficient C | -1.74841e+01 | |||
| Coefficient D | 8.51800e-06 | |||
| Temperature range, min. | 304.19 | |||
| Temperature range, max. | 697.55 | |||
| Pvap | 0.06 | kPa | 304.19 | Calculated Property |
| Pvap | 1.17 | kPa | 347.90 | Calculated Property |
| Pvap | 9.37 | kPa | 391.60 | Calculated Property |
| Pvap | 44.45 | kPa | 435.31 | Calculated Property |
| Pvap | 147.77 | kPa | 479.02 | Calculated Property |
| Pvap | 384.51 | kPa | 522.72 | Calculated Property |
| Pvap | 843.73 | kPa | 566.43 | Calculated Property |
| Pvap | 1644.20 | kPa | 610.14 | Calculated Property |
| Pvap | 2952.18 | kPa | 653.84 | Calculated Property |
| Pvap | 5016.43 | kPa | 697.55 | Calculated Property |
Similar Compounds
Find more compounds similar to Phenol, 2-methyl-.
Mixtures
- Phenol, 2-methyl- + Ethane, 1,2-dichloro-
- Trichloroethylene + Phenol, 2-methyl-
- Phenol, 2-methyl- + o-Xylene
- Phenol, 2-methyl- + p-Xylene
- Phenol, 2-methyl- + Ethane, 1,1,2,2-tetrachloro-
- Phenol, 2-methyl- + Tetrachloroethylene
- Phenol, 2-methyl- + Benzene, 1,3-dimethyl-
- Phenol, 2-methyl- + Heptane
- Phenol, 2-methyl- + Methyl Alcohol
- 1-Propanol + Phenol, 2-methyl-
- Phenol, 2-methyl- + 1-Butanol
- Phenol, 2-methyl- + Ethanol
- Phenol, 2-methyl- + Isopropyl Alcohol
- Phenol, 2-methyl- + 1-Propanol, 2-methyl-
- 2-Propanol, 2-methyl- + Phenol, 2-methyl-
- Benzene, nitro- + Phenol, 2-methyl-
- Phenol, 2-methyl- + Formamide, N,N-dimethyl-
- Phenol, 2-methyl- + Choline chloride
- Phenol, 2-methyl- + Phenol, 3-methyl-
- Phenol, 2-methyl- + Phenol, 2,6-dimethyl-
Find more mixtures with Phenol, 2-methyl-.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Bubble points of some binary mixtures formed by o-cresol at 95.75 kPa
- Activity coefficients of the binary mixtures of a-cresol or p-cresol with C l-C4 aliphatic alcohols near ambient pressure
- Excess Gibbs energies of binary mixtures formed by nitrobenzene with selected compounds at 94.95 kPa
- Excess Gibbs' energies of the binary mixtures formed by N,N-dimethylformamide with xylenes and cresols at 95.1 kPa
- Liquid-liquid equilibria in the ternary systems water + cresols + methyl butyl ketone at 298.2 and 313.2 K: experimental data and correlation
- Liquid-liquid equilibria for the extraction of phenols from alkane using ethylene glycol
- Liquid-liquid equilibria for methyl isobutyl ketone + cresols + water at 333.15K, 343.15K and 353.15K: Experimental results and data correlation
- Determination and modeling of liquid-liquid equilibrium for ternary mixtures of methyl isopropyl ketone, cresol isomers and water
- Measurement, correlation and COSMO-SAC prediction of liquid-liquid equilibrium for the ternary systems, mesityl oxide + o-, m-, p-cresol + water, at 333.2 K and 353.2 K
- Liquid pharmaceuticals formulation by eutectic formation
- Phase equilibria of phenolic compounds in water or ethanol
- Measurement and correlation of isobaric vapour-liquid equilibrium for systems of o-cresol, m-cresol and 2, 6-dimethylphenol at 20.0 kPa
- Bubble point measurements of binary mixtures formed by ethyl benzene with selected compounds at 95.35 kPa
- Volumetric and ultrasonic behaviour of binary mixtures of 1-nonanol with o-cresol, m-cresol, p-cresol and anisole at T = (293.15 and 313.15) K
- Excess parameters of binary mixtures of anisaldehyde with o-cresol, m-cresol and p-cresol at T = (303.15, 308.15, 313.15, and 318.15) K
- Measurement and thermodynamic modeling of ternary (liquid + liquid) equilibrium for extraction of o-cresol, m-cresol or p-cresol from aqueous solution with 2-pentanone
- Liquid-liquid equilibria for toluene/heptane + phenol/cresols + ethylene glycol system
- Extraction of o-, m- and p-cresol from aqueous solution with methyl isopropyl ketone: Equilibrium, correlations, and COSMO-RS predictions
- Liquid-liquid equilibrium for methyl butyl ketone + o-, m-, p-cresol + water ternary systems and COSMO-SAC predictions
- Thermodynamic and spectroscopic study of molecular interactions between ethanol and isomeric cresols
- Thermochemistry of Li, Na, K, Rb and Cs alkylated phenoxides
- Liquid Liquid Equilibrium for the Ternary Systems Methyl tert-Butyl Ketone + o-, m-, p-Cresol + Water at (298.2, 313.2, and 323.2) K
- Phase Equilibrium on Extraction Methylphenols from Aqueous Solution with 3,3-Dimethyl-2-butanone at 333.2 K and 353.2 K
- Viscosity, Gibbs Free Energy, and Refractive Indices for Binary Mixtures of o-Cresol + Poly(ethylene glycols) at T = 288.15-308.15 K and 96.5 kPa
- Activity Coefficients at Infinite Dilution and Excess Molar Volumes in Binary Mixtures Containing Normal Alkanes (Nonane, Decane, Undecane, or Dodecane) and Cresols (2-Methylphenol or 3-Methylphenol)
- Liquid-Liquid Equilibria in Ternary Systems of Aromatic Hydrocarbons (Toluene or Ethylbenzene) + Phenols + Water
- Densities, Speeds of Sound, and Refractive Indices of Binary Mixtures of Decan-1-ol with Anisole, o-Cresol, m-Cresol, and p-Cresol at T = (298.15, 303.15, and 308.15) K
- Henry's Law Constants and Infinite Dilution Activity Coefficients of Propane, Propene, Butane, 2-Methylpropane, 1-Butene, 2-Methylpropene, trans-2-Butene, cis-2-Butene, 1,3-Butadiene, Dimethyl Ether, Chloroethane, and 1,1-Difluoroethane in 2-Methylphenol, 3-Methylphenol, and 4-Methylphenol
- Liquid-Liquid(-Liquid) Equilibria in Ternary Systems of Aliphatic Hydrocarbons (Heptane or Octane) + Phenols + Water
- Vapor-Liquid Equilibria in Ternary Systems of Toluene or Octane + Phenols + Water
- Formation of Deep Eutectic Solvents by Phenols and Choline Chloride and Their Physical Properties
- Densities of Cresols and Linear Alkane Mixtures at High Pressure
- Experimental Densities and Speeds of Sound of Substituted Phenols and Their Modeling with the Prigogine Flory Patterson Model
- Experimental Determination and Correlation of Liquid Liquid Equilibria for the Ternary System 2-Methoxy-2-methylpropane + o-Cresol + Water at 298.15 K and 313.15 K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.