- Name
- Methyl Isobutyl Ketone
- InChI
- InChI=1S/C6H12O/c1-5(2)4-6(3)7/h5H,4H2,1-3H3
- InChI Key
- NTIZESTWPVYFNL-UHFFFAOYSA-N
- Formula
- C6H12O
- SMILES
- CC(=O)CC(C)C
- Mol. Weight (g/mol)
- 100.16
- CAS
- 108-10-1
- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (8)
- n0 - Refractive index (Na D-line) (6)
- ρl - Mass density, kg/m3 (6)
- csound,fluid - Speed of Sound, m/s (6)
Mole fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.0915 | 0.0000 |
| 293.20 | 0.2122 | 0.1178 |
| 293.20 | 0.2992 | 0.1789 |
| 293.20 | 0.4324 | 0.2302 |
| 293.20 | 0.5270 | 0.2387 |
| 293.20 | 0.5911 | 0.2316 |
| 293.20 | 0.6642 | 0.2112 |
| 293.20 | 0.7532 | 0.1807 |
| 293.20 | 0.8231 | 0.1463 |
| 293.20 | 0.8789 | 0.1067 |
| 293.20 | 0.9094 | 0.0811 |
| 293.20 | 0.9378 | 0.0554 |
| 293.20 | 0.9661 | 0.0285 |
| 293.20 | 0.9953 | 0.0000 |
| 313.20 | 0.1380 | 0.0000 |
| 313.20 | 0.2532 | 0.1111 |
| 313.20 | 0.3154 | 0.1731 |
| 313.20 | 0.4462 | 0.2227 |
| 313.20 | 0.5409 | 0.2304 |
| 313.20 | 0.6053 | 0.2221 |
| 313.20 | 0.6839 | 0.2011 |
| 313.20 | 0.7505 | 0.1786 |
| 313.20 | 0.8202 | 0.1481 |
| 313.20 | 0.8812 | 0.1044 |
| 313.20 | 0.9080 | 0.0819 |
| 313.20 | 0.9385 | 0.0545 |
| 313.20 | 0.9641 | 0.0307 |
| 313.20 | 0.9966 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9788 | 0.0192 | 0.0586 | 0.1455 |
| 293.20 | 0.9580 | 0.0382 | 0.1153 | 0.2092 |
| 293.20 | 0.9344 | 0.0588 | 0.1620 | 0.2747 |
| 293.20 | 0.9083 | 0.0804 | 0.1984 | 0.3423 |
| 293.20 | 0.8829 | 0.1002 | 0.2245 | 0.4151 |
| 293.20 | 0.8528 | 0.1221 | 0.2387 | 0.5039 |
| 313.20 | 0.9763 | 0.0219 | 0.0545 | 0.1852 |
| 313.20 | 0.9566 | 0.0393 | 0.1014 | 0.2334 |
| 313.20 | 0.9289 | 0.0628 | 0.1567 | 0.3043 |
| 313.20 | 0.9034 | 0.0833 | 0.1903 | 0.3623 |
| 313.20 | 0.8764 | 0.1037 | 0.2183 | 0.4341 |
| 313.20 | 0.8414 | 0.1283 | 0.2329 | 0.5200 |
Mole fraction [ref]
Operational conditions:
- Temperature, K = 293.15 (Liquid mixture 2)
- Pressure, kPa = 101 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Methyl Isobutyl Ketone (1) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Methyl Isobutyl Ketone (1) - Liquid mixture 2 |
| 0.0000 | 0.0000 | 0.0000 | 0.9009 |
| 0.1320 | 0.0120 | 0.2238 | 0.2035 |
| 0.1650 | 0.0550 | 0.1908 | 0.1156 |
| 0.0267 | 0.0036 | 0.0758 | 0.7575 |
| 0.0330 | 0.0040 | 0.1208 | 0.6711 |
| 0.0560 | 0.0079 | 0.1622 | 0.5405 |
| 0.0777 | 0.0085 | 0.1991 | 0.4329 |
| 0.0839 | 0.0089 | 0.2075 | 0.3774 |
| 0.0950 | 0.0129 | 0.2258 | 0.3226 |
| 0.0996 | 0.0127 | 0.2305 | 0.2882 |
| 0.1200 | 0.0182 | 0.2261 | 0.2513 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Acetic acid (2) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Acetic acid (2) - Liquid mixture 1 |
| 288.20 | 0.9540 | 0.0270 | 0.0290 | 0.0270 |
| 288.20 | 0.9080 | 0.0720 | 0.0370 | 0.0670 |
| 288.20 | 0.8720 | 0.0990 | 0.0540 | 0.0900 |
| 288.20 | 0.7960 | 0.1610 | 0.0850 | 0.1440 |
| 288.20 | 0.7410 | 0.2030 | 0.0900 | 0.1790 |
| 288.20 | 0.6890 | 0.2380 | 0.1140 | 0.2080 |
| 288.20 | 0.6460 | 0.2710 | 0.1210 | 0.2290 |
| 288.20 | 0.6180 | 0.2870 | 0.1410 | 0.2380 |
| 313.20 | 0.9560 | 0.0260 | 0.0240 | 0.0280 |
| 313.20 | 0.8850 | 0.0890 | 0.0400 | 0.0860 |
| 313.20 | 0.8430 | 0.1250 | 0.0540 | 0.1190 |
| 313.20 | 0.8070 | 0.1530 | 0.0690 | 0.1420 |
| 313.20 | 0.7560 | 0.1930 | 0.0860 | 0.1770 |
| 313.20 | 0.7030 | 0.2300 | 0.1030 | 0.2060 |
| 313.20 | 0.6340 | 0.2700 | 0.1310 | 0.2330 |
| 313.20 | 0.6140 | 0.2870 | 0.1570 | 0.2400 |
| 333.20 | 0.9590 | 0.0260 | 0.0320 | 0.0310 |
| 333.20 | 0.8910 | 0.0920 | 0.0510 | 0.0930 |
| 333.20 | 0.8500 | 0.1190 | 0.0680 | 0.1170 |
| 333.20 | 0.8050 | 0.1510 | 0.0780 | 0.1450 |
| 333.20 | 0.7500 | 0.1930 | 0.0890 | 0.1810 |
| 333.20 | 0.6920 | 0.2360 | 0.1070 | 0.2140 |
| 333.20 | 0.6540 | 0.2580 | 0.1300 | 0.2300 |
| 333.20 | 0.6100 | 0.2880 | 0.1500 | 0.2440 |
Mole fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.0915 | 0.0000 |
| 293.20 | 0.2122 | 0.1178 |
| 293.20 | 0.2992 | 0.1789 |
| 293.20 | 0.4324 | 0.2302 |
| 293.20 | 0.5270 | 0.2387 |
| 293.20 | 0.5911 | 0.2316 |
| 293.20 | 0.6642 | 0.2112 |
| 293.20 | 0.7532 | 0.1807 |
| 293.20 | 0.8231 | 0.1463 |
| 293.20 | 0.8789 | 0.1067 |
| 293.20 | 0.9094 | 0.0811 |
| 293.20 | 0.9378 | 0.0554 |
| 293.20 | 0.9661 | 0.0285 |
| 293.20 | 0.9953 | 0.0000 |
| 313.20 | 0.1380 | 0.0000 |
| 313.20 | 0.2532 | 0.1111 |
| 313.20 | 0.3154 | 0.1731 |
| 313.20 | 0.4462 | 0.2227 |
| 313.20 | 0.5409 | 0.2304 |
| 313.20 | 0.6053 | 0.2221 |
| 313.20 | 0.6839 | 0.2011 |
| 313.20 | 0.7505 | 0.1786 |
| 313.20 | 0.8202 | 0.1481 |
| 313.20 | 0.8812 | 0.1044 |
| 313.20 | 0.9080 | 0.0819 |
| 313.20 | 0.9385 | 0.0545 |
| 313.20 | 0.9641 | 0.0307 |
| 313.20 | 0.9966 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9788 | 0.0192 | 0.0586 | 0.1455 |
| 293.20 | 0.9580 | 0.0382 | 0.1153 | 0.2092 |
| 293.20 | 0.9344 | 0.0588 | 0.1620 | 0.2747 |
| 293.20 | 0.9083 | 0.0804 | 0.1984 | 0.3423 |
| 293.20 | 0.8829 | 0.1002 | 0.2245 | 0.4151 |
| 293.20 | 0.8528 | 0.1221 | 0.2387 | 0.5039 |
| 313.20 | 0.9763 | 0.0219 | 0.0545 | 0.1852 |
| 313.20 | 0.9566 | 0.0393 | 0.1014 | 0.2334 |
| 313.20 | 0.9289 | 0.0628 | 0.1567 | 0.3043 |
| 313.20 | 0.9034 | 0.0833 | 0.1903 | 0.3623 |
| 313.20 | 0.8764 | 0.1037 | 0.2183 | 0.4341 |
| 313.20 | 0.8414 | 0.1283 | 0.2329 | 0.5200 |
Mole fraction [ref]
Operational conditions:
- Temperature, K = 293.15 (Liquid mixture 2)
- Pressure, kPa = 101 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Methyl Isobutyl Ketone (1) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Methyl Isobutyl Ketone (1) - Liquid mixture 2 |
| 0.0000 | 0.0000 | 0.0000 | 0.9009 |
| 0.1320 | 0.0120 | 0.2238 | 0.2035 |
| 0.1650 | 0.0550 | 0.1908 | 0.1156 |
| 0.0267 | 0.0036 | 0.0758 | 0.7575 |
| 0.0330 | 0.0040 | 0.1208 | 0.6711 |
| 0.0560 | 0.0079 | 0.1622 | 0.5405 |
| 0.0777 | 0.0085 | 0.1991 | 0.4329 |
| 0.0839 | 0.0089 | 0.2075 | 0.3774 |
| 0.0950 | 0.0129 | 0.2258 | 0.3226 |
| 0.0996 | 0.0127 | 0.2305 | 0.2882 |
| 0.1200 | 0.0182 | 0.2261 | 0.2513 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Acetic acid (2) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Acetic acid (2) - Liquid mixture 1 |
| 288.20 | 0.9540 | 0.0270 | 0.0290 | 0.0270 |
| 288.20 | 0.9080 | 0.0720 | 0.0370 | 0.0670 |
| 288.20 | 0.8720 | 0.0990 | 0.0540 | 0.0900 |
| 288.20 | 0.7960 | 0.1610 | 0.0850 | 0.1440 |
| 288.20 | 0.7410 | 0.2030 | 0.0900 | 0.1790 |
| 288.20 | 0.6890 | 0.2380 | 0.1140 | 0.2080 |
| 288.20 | 0.6460 | 0.2710 | 0.1210 | 0.2290 |
| 288.20 | 0.6180 | 0.2870 | 0.1410 | 0.2380 |
| 313.20 | 0.9560 | 0.0260 | 0.0240 | 0.0280 |
| 313.20 | 0.8850 | 0.0890 | 0.0400 | 0.0860 |
| 313.20 | 0.8430 | 0.1250 | 0.0540 | 0.1190 |
| 313.20 | 0.8070 | 0.1530 | 0.0690 | 0.1420 |
| 313.20 | 0.7560 | 0.1930 | 0.0860 | 0.1770 |
| 313.20 | 0.7030 | 0.2300 | 0.1030 | 0.2060 |
| 313.20 | 0.6340 | 0.2700 | 0.1310 | 0.2330 |
| 313.20 | 0.6140 | 0.2870 | 0.1570 | 0.2400 |
| 333.20 | 0.9590 | 0.0260 | 0.0320 | 0.0310 |
| 333.20 | 0.8910 | 0.0920 | 0.0510 | 0.0930 |
| 333.20 | 0.8500 | 0.1190 | 0.0680 | 0.1170 |
| 333.20 | 0.8050 | 0.1510 | 0.0780 | 0.1450 |
| 333.20 | 0.7500 | 0.1930 | 0.0890 | 0.1810 |
| 333.20 | 0.6920 | 0.2360 | 0.1070 | 0.2140 |
| 333.20 | 0.6540 | 0.2580 | 0.1300 | 0.2300 |
| 333.20 | 0.6100 | 0.2880 | 0.1500 | 0.2440 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.0915 | 1.3956 |
| 293.20 | 0.2122 | 1.3945 |
| 293.20 | 0.2992 | 1.3931 |
| 293.20 | 0.4324 | 1.3887 |
| 293.20 | 0.5270 | 1.3865 |
| 293.20 | 0.5911 | 1.3833 |
| 293.20 | 0.6642 | 1.3795 |
| 293.20 | 0.7532 | 1.3725 |
| 293.20 | 0.8231 | 1.3649 |
| 293.20 | 0.8789 | 1.3573 |
| 293.20 | 0.9094 | 1.3525 |
| 293.20 | 0.9378 | 1.3475 |
| 293.20 | 0.9661 | 1.3416 |
| 293.20 | 0.9953 | 1.3349 |
| 313.20 | 0.1380 | 1.386 |
| 313.20 | 0.2532 | 1.3852 |
| 313.20 | 0.3154 | 1.384 |
| 313.20 | 0.4462 | 1.3812 |
| 313.20 | 0.5409 | 1.3781 |
| 313.20 | 0.6053 | 1.3755 |
| 313.20 | 0.6839 | 1.3696 |
| 313.20 | 0.7505 | 1.365 |
| 313.20 | 0.8202 | 1.3589 |
| 313.20 | 0.8812 | 1.3514 |
| 313.20 | 0.9080 | 1.3477 |
| 313.20 | 0.9385 | 1.3425 |
| 313.20 | 0.9641 | 1.3378 |
| 313.20 | 0.9966 | 1.3312 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.1455 | 1.3952 |
| 293.20 | 0.2092 | 1.3945 |
| 293.20 | 0.2747 | 1.3936 |
| 293.20 | 0.3423 | 1.3922 |
| 293.20 | 0.4151 | 1.3905 |
| 293.20 | 0.5039 | 1.3875 |
| 313.20 | 0.1852 | 1.3857 |
| 313.20 | 0.2334 | 1.3853 |
| 313.20 | 0.3043 | 1.3843 |
| 313.20 | 0.3623 | 1.3834 |
| 313.20 | 0.4341 | 1.3818 |
| 313.20 | 0.5200 | 1.3792 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
| 293.20 | 0.9788 | 1.34 |
| 293.20 | 0.9580 | 1.3442 |
| 293.20 | 0.9344 | 1.3482 |
| 293.20 | 0.9083 | 1.3525 |
| 293.20 | 0.8829 | 1.3566 |
| 293.20 | 0.8528 | 1.3611 |
| 313.20 | 0.9763 | 1.3359 |
| 313.20 | 0.9566 | 1.3392 |
| 313.20 | 0.9289 | 1.3437 |
| 313.20 | 0.9034 | 1.3478 |
| 313.20 | 0.8764 | 1.3519 |
| 313.20 | 0.8414 | 1.3568 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.0915 | 1.3956 |
| 293.20 | 0.2122 | 1.3945 |
| 293.20 | 0.2992 | 1.3931 |
| 293.20 | 0.4324 | 1.3887 |
| 293.20 | 0.5270 | 1.3865 |
| 293.20 | 0.5911 | 1.3833 |
| 293.20 | 0.6642 | 1.3795 |
| 293.20 | 0.7532 | 1.3725 |
| 293.20 | 0.8231 | 1.3649 |
| 293.20 | 0.8789 | 1.3573 |
| 293.20 | 0.9094 | 1.3525 |
| 293.20 | 0.9378 | 1.3475 |
| 293.20 | 0.9661 | 1.3416 |
| 293.20 | 0.9953 | 1.3349 |
| 313.20 | 0.1380 | 1.386 |
| 313.20 | 0.2532 | 1.3852 |
| 313.20 | 0.3154 | 1.384 |
| 313.20 | 0.4462 | 1.3812 |
| 313.20 | 0.5409 | 1.3781 |
| 313.20 | 0.6053 | 1.3755 |
| 313.20 | 0.6839 | 1.3696 |
| 313.20 | 0.7505 | 1.365 |
| 313.20 | 0.8202 | 1.3589 |
| 313.20 | 0.8812 | 1.3514 |
| 313.20 | 0.9080 | 1.3477 |
| 313.20 | 0.9385 | 1.3425 |
| 313.20 | 0.9641 | 1.3378 |
| 313.20 | 0.9966 | 1.3312 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.1455 | 1.3952 |
| 293.20 | 0.2092 | 1.3945 |
| 293.20 | 0.2747 | 1.3936 |
| 293.20 | 0.3423 | 1.3922 |
| 293.20 | 0.4151 | 1.3905 |
| 293.20 | 0.5039 | 1.3875 |
| 313.20 | 0.1852 | 1.3857 |
| 313.20 | 0.2334 | 1.3853 |
| 313.20 | 0.3043 | 1.3843 |
| 313.20 | 0.3623 | 1.3834 |
| 313.20 | 0.4341 | 1.3818 |
| 313.20 | 0.5200 | 1.3792 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
| 293.20 | 0.9788 | 1.34 |
| 293.20 | 0.9580 | 1.3442 |
| 293.20 | 0.9344 | 1.3482 |
| 293.20 | 0.9083 | 1.3525 |
| 293.20 | 0.8829 | 1.3566 |
| 293.20 | 0.8528 | 1.3611 |
| 313.20 | 0.9763 | 1.3359 |
| 313.20 | 0.9566 | 1.3392 |
| 313.20 | 0.9289 | 1.3437 |
| 313.20 | 0.9034 | 1.3478 |
| 313.20 | 0.8764 | 1.3519 |
| 313.20 | 0.8414 | 1.3568 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.0915 | 808.399 |
| 293.20 | 0.2122 | 832.035 |
| 293.20 | 0.2992 | 853.444 |
| 293.20 | 0.4324 | 890.678 |
| 293.20 | 0.5270 | 918.929 |
| 293.20 | 0.5911 | 938.611 |
| 293.20 | 0.6642 | 958.952 |
| 293.20 | 0.7532 | 990.225 |
| 293.20 | 0.8231 | 1014.251 |
| 293.20 | 0.8789 | 1021.948 |
| 293.20 | 0.9094 | 1020.597 |
| 293.20 | 0.9378 | 1015.39 |
| 293.20 | 0.9661 | 1007.193 |
| 293.20 | 0.9953 | 995.765 |
| 313.20 | 0.1380 | 786.441 |
| 313.20 | 0.2532 | 813.319 |
| 313.20 | 0.3154 | 834.83 |
| 313.20 | 0.4462 | 871.287 |
| 313.20 | 0.5409 | 899.323 |
| 313.20 | 0.6053 | 902.002 |
| 313.20 | 0.6839 | 939.531 |
| 313.20 | 0.7505 | 968.171 |
| 313.20 | 0.8202 | 998.005 |
| 313.20 | 0.8812 | 1008.666 |
| 313.20 | 0.9080 | 1008.605 |
| 313.20 | 0.9385 | 1005.071 |
| 313.20 | 0.9641 | 999.868 |
| 313.20 | 0.9966 | 990.249 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.1455 | 819.306 |
| 293.20 | 0.2092 | 832.547 |
| 293.20 | 0.2747 | 846.568 |
| 293.20 | 0.3423 | 864.974 |
| 293.20 | 0.4151 | 884.698 |
| 293.20 | 0.5039 | 910.649 |
| 313.20 | 0.1852 | 798.814 |
| 313.20 | 0.2334 | 810.658 |
| 313.20 | 0.3043 | 828.829 |
| 313.20 | 0.3623 | 844.712 |
| 313.20 | 0.4341 | 865.308 |
| 313.20 | 0.5200 | 891.792 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.20 | 0.9788 | 1004.138 |
| 293.20 | 0.9580 | 1010.792 |
| 293.20 | 0.9344 | 1016.471 |
| 293.20 | 0.9083 | 1020.453 |
| 293.20 | 0.8829 | 1021.936 |
| 293.20 | 0.8528 | 1018.685 |
| 313.20 | 0.9763 | 996.558 |
| 313.20 | 0.9566 | 1001.128 |
| 313.20 | 0.9289 | 1006.247 |
| 313.20 | 0.9034 | 1008.114 |
| 313.20 | 0.8764 | 1008.032 |
| 313.20 | 0.8414 | 1001.432 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.0915 | 808.399 |
| 293.20 | 0.2122 | 832.035 |
| 293.20 | 0.2992 | 853.444 |
| 293.20 | 0.4324 | 890.678 |
| 293.20 | 0.5270 | 918.929 |
| 293.20 | 0.5911 | 938.611 |
| 293.20 | 0.6642 | 958.952 |
| 293.20 | 0.7532 | 990.225 |
| 293.20 | 0.8231 | 1014.251 |
| 293.20 | 0.8789 | 1021.948 |
| 293.20 | 0.9094 | 1020.597 |
| 293.20 | 0.9378 | 1015.39 |
| 293.20 | 0.9661 | 1007.193 |
| 293.20 | 0.9953 | 995.765 |
| 313.20 | 0.1380 | 786.441 |
| 313.20 | 0.2532 | 813.319 |
| 313.20 | 0.3154 | 834.83 |
| 313.20 | 0.4462 | 871.287 |
| 313.20 | 0.5409 | 899.323 |
| 313.20 | 0.6053 | 902.002 |
| 313.20 | 0.6839 | 939.531 |
| 313.20 | 0.7505 | 968.171 |
| 313.20 | 0.8202 | 998.005 |
| 313.20 | 0.8812 | 1008.666 |
| 313.20 | 0.9080 | 1008.605 |
| 313.20 | 0.9385 | 1005.071 |
| 313.20 | 0.9641 | 999.868 |
| 313.20 | 0.9966 | 990.249 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.1455 | 819.306 |
| 293.20 | 0.2092 | 832.547 |
| 293.20 | 0.2747 | 846.568 |
| 293.20 | 0.3423 | 864.974 |
| 293.20 | 0.4151 | 884.698 |
| 293.20 | 0.5039 | 910.649 |
| 313.20 | 0.1852 | 798.814 |
| 313.20 | 0.2334 | 810.658 |
| 313.20 | 0.3043 | 828.829 |
| 313.20 | 0.3623 | 844.712 |
| 313.20 | 0.4341 | 865.308 |
| 313.20 | 0.5200 | 891.792 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.20 | 0.9788 | 1004.138 |
| 293.20 | 0.9580 | 1010.792 |
| 293.20 | 0.9344 | 1016.471 |
| 293.20 | 0.9083 | 1020.453 |
| 293.20 | 0.8829 | 1021.936 |
| 293.20 | 0.8528 | 1018.685 |
| 313.20 | 0.9763 | 996.558 |
| 313.20 | 0.9566 | 1001.128 |
| 313.20 | 0.9289 | 1006.247 |
| 313.20 | 0.9034 | 1008.114 |
| 313.20 | 0.8764 | 1008.032 |
| 313.20 | 0.8414 | 1001.432 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.0915 | 1224.89 |
| 293.20 | 0.2122 | 1242.56 |
| 293.20 | 0.2992 | 1255.14 |
| 293.20 | 0.4324 | 1284.04 |
| 293.20 | 0.5270 | 1309.87 |
| 293.20 | 0.5911 | 1331.49 |
| 293.20 | 0.6642 | 1358.99 |
| 293.20 | 0.7532 | 1415.74 |
| 293.20 | 0.8231 | 1481.7 |
| 293.20 | 0.8789 | 1524.69 |
| 293.20 | 0.9094 | 1536.86 |
| 293.20 | 0.9378 | 1538.23 |
| 293.20 | 0.9661 | 1527.15 |
| 293.20 | 0.9953 | 1497.87 |
| 313.20 | 0.1380 | 1145.28 |
| 313.20 | 0.2532 | 1164.77 |
| 313.20 | 0.3154 | 1181.57 |
| 313.20 | 0.4462 | 1213.57 |
| 313.20 | 0.5409 | 1241.98 |
| 313.20 | 0.6053 | 1266.18 |
| 313.20 | 0.6839 | 1293.5 |
| 313.20 | 0.7505 | 1386.37 |
| 313.20 | 0.8202 | 1444.96 |
| 313.20 | 0.8812 | 1507.27 |
| 313.20 | 0.9080 | 1527.39 |
| 313.20 | 0.9385 | 1541.78 |
| 313.20 | 0.9641 | 1545.75 |
| 313.20 | 0.9966 | 1535.8 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.1455 | 1231.33 |
| 293.20 | 0.2092 | 1241.34 |
| 293.20 | 0.2747 | 1252.85 |
| 293.20 | 0.3423 | 1263.83 |
| 293.20 | 0.4151 | 1279.07 |
| 293.20 | 0.5039 | 1301.65 |
| 313.20 | 0.1852 | 1153.53 |
| 313.20 | 0.2334 | 1162.65 |
| 313.20 | 0.3043 | 1176.14 |
| 313.20 | 0.3623 | 1189.03 |
| 313.20 | 0.4341 | 1207.27 |
| 313.20 | 0.5200 | 1233.89 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Speed of sound, m/s - Liquid mixture 2 |
| 293.20 | 0.9788 | 1520.8 |
| 293.20 | 0.9580 | 1533.34 |
| 293.20 | 0.9344 | 1538.7 |
| 293.20 | 0.9083 | 1536.2 |
| 293.20 | 0.8829 | 1525.48 |
| 293.20 | 0.8528 | 1499.69 |
| 313.20 | 0.9763 | 1544.58 |
| 313.20 | 0.9566 | 1545.89 |
| 313.20 | 0.9289 | 1539.41 |
| 313.20 | 0.9034 | 1527.74 |
| 313.20 | 0.8764 | 1504.83 |
| 313.20 | 0.8414 | 1464.1 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.0915 | 1224.89 |
| 293.20 | 0.2122 | 1242.56 |
| 293.20 | 0.2992 | 1255.14 |
| 293.20 | 0.4324 | 1284.04 |
| 293.20 | 0.5270 | 1309.87 |
| 293.20 | 0.5911 | 1331.49 |
| 293.20 | 0.6642 | 1358.99 |
| 293.20 | 0.7532 | 1415.74 |
| 293.20 | 0.8231 | 1481.7 |
| 293.20 | 0.8789 | 1524.69 |
| 293.20 | 0.9094 | 1536.86 |
| 293.20 | 0.9378 | 1538.23 |
| 293.20 | 0.9661 | 1527.15 |
| 293.20 | 0.9953 | 1497.87 |
| 313.20 | 0.1380 | 1145.28 |
| 313.20 | 0.2532 | 1164.77 |
| 313.20 | 0.3154 | 1181.57 |
| 313.20 | 0.4462 | 1213.57 |
| 313.20 | 0.5409 | 1241.98 |
| 313.20 | 0.6053 | 1266.18 |
| 313.20 | 0.6839 | 1293.5 |
| 313.20 | 0.7505 | 1386.37 |
| 313.20 | 0.8202 | 1444.96 |
| 313.20 | 0.8812 | 1507.27 |
| 313.20 | 0.9080 | 1527.39 |
| 313.20 | 0.9385 | 1541.78 |
| 313.20 | 0.9641 | 1545.75 |
| 313.20 | 0.9966 | 1535.8 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.1455 | 1231.33 |
| 293.20 | 0.2092 | 1241.34 |
| 293.20 | 0.2747 | 1252.85 |
| 293.20 | 0.3423 | 1263.83 |
| 293.20 | 0.4151 | 1279.07 |
| 293.20 | 0.5039 | 1301.65 |
| 313.20 | 0.1852 | 1153.53 |
| 313.20 | 0.2334 | 1162.65 |
| 313.20 | 0.3043 | 1176.14 |
| 313.20 | 0.3623 | 1189.03 |
| 313.20 | 0.4341 | 1207.27 |
| 313.20 | 0.5200 | 1233.89 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Speed of sound, m/s - Liquid mixture 2 |
| 293.20 | 0.9788 | 1520.8 |
| 293.20 | 0.9580 | 1533.34 |
| 293.20 | 0.9344 | 1538.7 |
| 293.20 | 0.9083 | 1536.2 |
| 293.20 | 0.8829 | 1525.48 |
| 293.20 | 0.8528 | 1499.69 |
| 313.20 | 0.9763 | 1544.58 |
| 313.20 | 0.9566 | 1545.89 |
| 313.20 | 0.9289 | 1539.41 |
| 313.20 | 0.9034 | 1527.74 |
| 313.20 | 0.8764 | 1504.83 |
| 313.20 | 0.8414 | 1464.1 |
Sources
- Liquid-liquid equilibrium data and thermophysical properties for ternary systems composed of water, acetic acid and different solvents
- Liquid-Liquid Equilibria of Ionic Liquids-Water-Acetic Acid Mixtures
- Liquid Liquid Equilibria for the System Water + 4-Methylpentan-2-one + Acetic Acid at Several Temperatures