- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Molecular Weight1
- 60.05
- CAS
- 64-19-7
- Other Names
-
- Acetasol
- Acetic acid, glacial
- Aci-jel
- Acide acetique
- Acido acetico
- Azijnzuur
- CH3COOH
- Essigsaeure
- Ethanoic acid
- Ethanoic acid monomer
- Ethylic acid
- Glacial acetic acid
- Kyselina octova
- Methanecarboxylic acid
- NSC 132953
- Octowy kwas
- Shotgun
- UN 2789
- Vinegar acid
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- Tig : Autoignition Temperature (K).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- LFL : Lower Flammability Limit (% in Air).
- UFL : Upper Flammability Limit (% in Air).
- Tflash,cc : Flash Point (Closed Cup Method) (K).
- Tflash,oc : Flash Point (Open Cup Method) (K).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Rg : Radius of Gyration.
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔsubH : Enthalpy of sublimation at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- NFPA Safety : NFPA Safety Rating.
- Pc : Critical Pressure (kPa).
- Ptriple : Triple Point Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- S°gas : Molar entropy at standard conditions (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tboil : Boiling point at given pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.4470 | KDB | |
| PAff | 783.70 | kJ/mol | NIST |
| Tig | 699.82 | K | KDB |
| BasG | 752.80 | kJ/mol | NIST |
| ΔcH°liquid | [-875.16; -872.40] | kJ/mol |
|
| ΔcH°liquid | -875.16 ± 0.34 | kJ/mol | NIST |
| ΔcH°liquid | -874.20 ± 0.20 | kJ/mol | NIST |
| ΔcH°liquid | -874.50 ± 0.40 | kJ/mol | NIST |
| ΔcH°liquid | -872.40 | kJ/mol | NIST |
| μ | 1.30 | debye | KDB |
| LFL | 5.40 | % in Air | KDB |
| UFL | 16.00 | % in Air | KDB |
| Tflash,cc | 317.59 | K | KDB |
| Tflash,oc | 313.15 | K | KDB |
| ΔfG° | -376.90 | kJ/mol | KDB |
| Rg | 2.5950 | KDB | |
| ΔfH°gas | [-435.40; -431.90] | kJ/mol |
|
| ΔfH°gas | -435.10 | kJ/mol | KDB |
| ΔfH°gas | -431.90 ± 1.50 | kJ/mol | NIST |
| ΔfH°gas | -431.90 ± 1.50 | kJ/mol | NIST |
| ΔfH°gas | -432.90 ± 1.50 | kJ/mol | NIST |
| ΔfH°gas | -432.90 ± 1.50 | kJ/mol | NIST |
| ΔfH°gas | -432.50 ± 1.60 | kJ/mol | NIST |
| ΔfH°gas | -432.50 ± 1.60 | kJ/mol | NIST |
| ΔfH°gas | -435.40 | kJ/mol | NIST |
| ΔfH°gas | -435.40 ± 4.30 | kJ/mol | NIST |
| ΔfH°liquid | [-487.00; -483.52] | kJ/mol |
|
| ΔfH°liquid | -483.52 ± 0.36 | kJ/mol | NIST |
| ΔfH°liquid | -484.50 ± 0.20 | kJ/mol | NIST |
| ΔfH°liquid | -484.10 ± 0.40 | kJ/mol | NIST |
| ΔfH°liquid | -487.00 | kJ/mol | NIST |
| ΔfusH° | 6.62 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [50.30; 51.60] | kJ/mol |
|
| ΔvapH° | 50.30 | kJ/mol | NIST |
| ΔvapH° | 51.60 | kJ/mol | NIST |
| ΔvapH° | 51.60 ± 1.50 | kJ/mol | NIST |
| ΔvapH° | 51.60 ± 1.60 | kJ/mol | NIST |
| IE | [10.35; 11.50] | eV |
|
| IE | 10.65 ± 0.02 | eV | NIST |
| IE | 10.63 | eV | NIST |
| IE | 10.66 | eV | NIST |
| IE | 10.66 ± 0.05 | eV | NIST |
| IE | 10.66 | eV | NIST |
| IE | 10.66 ± 0.05 | eV | NIST |
| IE | 10.66 ± 0.00 | eV | NIST |
| IE | 10.64 ± 0.00 | eV | NIST |
| IE | 10.65 | eV | NIST |
| IE | 10.69 ± 0.03 | eV | NIST |
| IE | 10.70 | eV | NIST |
| IE | 10.37 ± 0.03 | eV | NIST |
| IE | 10.38 ± 0.03 | eV | NIST |
| IE | 10.35 ± 0.03 | eV | NIST |
| IE | 10.90 | eV | NIST |
| IE | 10.84 | eV | NIST |
| IE | 10.63 | eV | NIST |
| IE | Outlier 11.50 | eV | NIST |
| IE | 10.87 | eV | NIST |
| IE | 10.80 | eV | NIST |
| log10WS | 1.22 | Aq. Sol... | |
| logPoct/wat | 0.091 | Crippen Calculated Property | |
| McVol | 46.480 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 2 | KDB | |
| NFPA Health | 3 | KDB | |
| NFPA Safety | 1 | KDB | |
| Pc | [5781.00; 5829.01] | kPa |
|
| Pc | 5786.00 | kPa | KDB |
| Pc | 5781.00 ± 20.00 | kPa | NIST |
| Pc | Outlier 5829.01 ± 90.00 | kPa | NIST |
| Pc | 5786.00 ± 8.00 | kPa | NIST |
| Pc | 5787.00 ± 101.32 | kPa | NIST |
| Pc | 5786.70 ± 26.66 | kPa | NIST |
| Ptriple | 1.28 | kPa | KDB |
| ρc | [350.58; 350.70] | kg/m3 |
|
| ρc | 350.70 ± 1.20 | kg/m3 | NIST |
| ρc | 350.58 ± 1.20 | kg/m3 | NIST |
| Inp | [580.00; 665.00] |
|
|
| Inp | 590.00 | NIST | |
| Inp | 602.00 | NIST | |
| Inp | 646.00 | NIST | |
| Inp | 645.00 | NIST | |
| Inp | 602.00 | NIST | |
| Inp | 661.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 625.00 | NIST | |
| Inp | 649.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 663.00 | NIST | |
| Inp | 606.00 | NIST | |
| Inp | 660.40 | NIST | |
| Inp | 625.00 | NIST | |
| Inp | 625.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 599.00 | NIST | |
| Inp | 594.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 605.00 | NIST | |
| Inp | 610.00 | NIST | |
| Inp | Outlier 665.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 610.00 | NIST | |
| Inp | 610.00 | NIST | |
| Inp | 645.00 | NIST | |
| Inp | 642.00 | NIST | |
| Inp | 642.00 | NIST | |
| Inp | 609.00 | NIST | |
| Inp | 640.00 | NIST | |
| Inp | 587.00 | NIST | |
| Inp | 588.00 | NIST | |
| Inp | 623.00 | NIST | |
| Inp | 602.00 | NIST | |
| Inp | 641.00 | NIST | |
| Inp | 622.00 | NIST | |
| Inp | 610.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 615.00 | NIST | |
| Inp | 615.00 | NIST | |
| Inp | 662.00 | NIST | |
| Inp | 658.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 660.00 | NIST | |
| Inp | 649.00 | NIST | |
| Inp | 638.00 | NIST | |
| Inp | 660.00 | NIST | |
| Inp | 641.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 617.00 | NIST | |
| Inp | 617.00 | NIST | |
| Inp | 603.00 | NIST | |
| Inp | 603.00 | NIST | |
| Inp | 606.00 | NIST | |
| Inp | 584.00 | NIST | |
| Inp | 637.00 | NIST | |
| Inp | 628.00 | NIST | |
| Inp | 628.00 | NIST | |
| Inp | 580.00 | NIST | |
| Inp | 620.77 | NIST | |
| Inp | 616.00 | NIST | |
| Inp | 650.00 | NIST | |
| Inp | 650.00 | NIST | |
| Inp | 608.00 | NIST | |
| Inp | 602.00 | NIST | |
| Inp | 611.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 622.00 | NIST | |
| Inp | 646.00 | NIST | |
| Inp | 621.00 | NIST | |
| Inp | 630.00 | NIST | |
| Inp | 662.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 606.00 | NIST | |
| Inp | 595.00 | NIST | |
| Inp | 638.00 | NIST | |
| Inp | 610.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 594.00 | NIST | |
| Inp | 601.00 | NIST | |
| Inp | 616.00 | NIST | |
| Inp | 618.00 | NIST | |
| Inp | 622.00 | NIST | |
| Inp | 606.00 | NIST | |
| Inp | 610.00 | NIST | |
| Inp | 610.00 | NIST | |
| Inp | 610.00 | NIST | |
| Inp | 610.00 | NIST | |
| Inp | 610.00 | NIST | |
| Inp | 591.00 | NIST | |
| Inp | 591.00 | NIST | |
| Inp | 630.00 | NIST | |
| Inp | 612.00 | NIST | |
| Inp | 644.00 | NIST | |
| Inp | 612.00 | NIST | |
| Inp | 614.00 | NIST | |
| Inp | 622.00 | NIST | |
| Inp | 645.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 645.00 | NIST | |
| Inp | 645.00 | NIST | |
| Inp | 634.00 | NIST | |
| Inp | 648.00 | NIST | |
| Inp | 648.00 | NIST | |
| Inp | 660.00 | NIST | |
| Inp | 660.00 | NIST | |
| Inp | 630.00 | NIST | |
| Inp | 600.00 | NIST | |
| Inp | 618.00 | NIST | |
| Inp | 610.00 | NIST | |
| Inp | 622.00 | NIST | |
| Inp | 634.00 | NIST | |
| Inp | 645.00 | NIST | |
| Inp | 590.00 | NIST | |
| Inp | 602.00 | NIST | |
| Inp | 663.00 | NIST | |
| Inp | 609.00 | NIST | |
| Inp | 615.00 | NIST | |
| Inp | 660.00 | NIST | |
| Inp | 606.00 | NIST | |
| Inp | 580.00 | NIST | |
| Inp | 608.00 | NIST | |
| Inp | 646.00 | NIST | |
| I | [1400.00; 1498.00] |
|
|
| I | 1465.00 | NIST | |
| I | 1465.00 | NIST | |
| I | 1408.00 | NIST | |
| I | Outlier 1400.00 | NIST | |
| I | Outlier 1400.00 | NIST | |
| I | 1447.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1445.00 | NIST | |
| I | 1435.00 | NIST | |
| I | Outlier 1402.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1427.00 | NIST | |
| I | 1460.00 | NIST | |
| I | 1436.00 | NIST | |
| I | 1461.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1429.00 | NIST | |
| I | 1460.00 | NIST | |
| I | 1464.00 | NIST | |
| I | 1479.00 | NIST | |
| I | 1463.00 | NIST | |
| I | 1434.00 | NIST | |
| I | 1441.00 | NIST | |
| I | 1424.00 | NIST | |
| I | 1453.00 | NIST | |
| I | 1467.00 | NIST | |
| I | 1433.00 | NIST | |
| I | 1486.00 | NIST | |
| I | 1463.00 | NIST | |
| I | 1480.00 | NIST | |
| I | 1465.00 | NIST | |
| I | 1443.00 | NIST | |
| I | 1436.00 | NIST | |
| I | 1464.00 | NIST | |
| I | 1448.00 | NIST | |
| I | 1448.00 | NIST | |
| I | 1434.00 | NIST | |
| I | 1460.00 | NIST | |
| I | 1429.00 | NIST | |
| I | 1444.00 | NIST | |
| I | 1418.00 | NIST | |
| I | 1453.00 | NIST | |
| I | 1433.00 | NIST | |
| I | 1442.00 | NIST | |
| I | 1449.00 | NIST | |
| I | Outlier 1488.00 | NIST | |
| I | 1419.00 | NIST | |
| I | 1434.00 | NIST | |
| I | 1443.00 | NIST | |
| I | 1431.00 | NIST | |
| I | 1443.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1436.00 | NIST | |
| I | 1426.00 | NIST | |
| I | 1472.00 | NIST | |
| I | 1440.00 | NIST | |
| I | 1442.00 | NIST | |
| I | 1484.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1472.00 | NIST | |
| I | 1468.00 | NIST | |
| I | 1447.00 | NIST | |
| I | 1434.00 | NIST | |
| I | 1440.00 | NIST | |
| I | 1442.00 | NIST | |
| I | 1442.00 | NIST | |
| I | Outlier 1498.00 | NIST | |
| I | 1442.00 | NIST | |
| I | 1460.00 | NIST | |
| I | 1462.00 | NIST | |
| I | 1462.00 | NIST | |
| I | 1435.00 | NIST | |
| I | 1445.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1435.00 | NIST | |
| I | 1435.00 | NIST | |
| I | 1459.00 | NIST | |
| I | 1459.00 | NIST | |
| I | Outlier 1404.00 | NIST | |
| I | 1471.00 | NIST | |
| I | 1442.00 | NIST | |
| I | 1484.00 | NIST | |
| I | 1424.00 | NIST | |
| I | 1415.00 | NIST | |
| I | 1431.00 | NIST | |
| I | 1415.00 | NIST | |
| I | 1425.00 | NIST | |
| I | 1415.00 | NIST | |
| I | 1418.00 | NIST | |
| I | 1415.00 | NIST | |
| I | 1419.00 | NIST | |
| I | 1415.00 | NIST | |
| I | 1415.00 | NIST | |
| I | 1419.00 | NIST | |
| I | Outlier 1403.00 | NIST | |
| I | 1455.00 | NIST | |
| I | 1480.00 | NIST | |
| I | 1460.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1463.00 | NIST | |
| I | 1448.00 | NIST | |
| I | 1446.00 | NIST | |
| I | 1463.00 | NIST | |
| I | 1461.00 | NIST | |
| I | 1453.00 | NIST | |
| I | 1478.00 | NIST | |
| I | 1478.00 | NIST | |
| I | 1478.00 | NIST | |
| I | 1430.00 | NIST | |
| I | 1486.00 | NIST | |
| I | 1476.00 | NIST | |
| I | 1445.00 | NIST | |
| I | 1461.00 | NIST | |
| I | 1461.00 | NIST | |
| I | 1460.00 | NIST | |
| I | 1425.00 | NIST | |
| I | 1467.00 | NIST | |
| I | 1430.00 | NIST | |
| I | 1447.00 | NIST | |
| I | 1443.00 | NIST | |
| I | 1444.00 | NIST | |
| I | 1461.00 | NIST | |
| I | 1453.00 | NIST | |
| I | 1444.00 | NIST | |
| I | 1413.00 | NIST | |
| I | 1431.00 | NIST | |
| I | 1428.00 | NIST | |
| I | 1439.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1420.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1486.60 | NIST | |
| I | 1486.60 | NIST | |
| I | 1451.00 | NIST | |
| I | 1436.00 | NIST | |
| I | 1462.00 | NIST | |
| I | 1465.00 | NIST | |
| I | 1476.00 | NIST | |
| I | 1431.00 | NIST | |
| I | 1465.00 | NIST | |
| I | 1429.00 | NIST | |
| I | 1439.00 | NIST | |
| I | 1455.00 | NIST | |
| I | 1465.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1445.00 | NIST | |
| I | 1468.00 | NIST | |
| I | 1441.00 | NIST | |
| I | 1464.00 | NIST | |
| I | 1425.00 | NIST | |
| I | 1425.00 | NIST | |
| I | 1471.00 | NIST | |
| I | 1460.00 | NIST | |
| I | 1436.00 | NIST | |
| I | 1453.00 | NIST | |
| I | 1469.00 | NIST | |
| I | 1478.00 | NIST | |
| I | 1462.00 | NIST | |
| I | 1436.00 | NIST | |
| I | 1424.00 | NIST | |
| I | 1448.00 | NIST | |
| I | 1424.00 | NIST | |
| I | 1473.00 | NIST | |
| I | 1433.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1485.00 | NIST | |
| I | 1477.00 | NIST | |
| I | 1473.00 | NIST | |
| I | 1458.00 | NIST | |
| I | 1409.00 | NIST | |
| I | 1470.00 | NIST | |
| I | 1471.00 | NIST | |
| I | 1454.00 | NIST | |
| I | 1466.00 | NIST | |
| I | 1466.00 | NIST | |
| I | 1457.00 | NIST | |
| I | 1477.00 | NIST | |
| I | 1455.00 | NIST | |
| I | 1448.00 | NIST | |
| I | 1448.00 | NIST | |
| I | 1466.00 | NIST | |
| I | 1463.00 | NIST | |
| I | 1471.00 | NIST | |
| I | 1455.00 | NIST | |
| I | 1474.00 | NIST | |
| I | 1453.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1447.00 | NIST | |
| I | 1454.00 | NIST | |
| I | 1434.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1467.00 | NIST | |
| I | 1459.00 | NIST | |
| I | 1475.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1448.00 | NIST | |
| I | 1442.00 | NIST | |
| I | 1465.00 | NIST | |
| I | 1476.00 | NIST | |
| I | 1443.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1461.00 | NIST | |
| I | 1433.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1410.00 | NIST | |
| I | 1453.00 | NIST | |
| I | 1415.00 | NIST | |
| I | 1432.00 | NIST | |
| I | 1460.00 | NIST | |
| I | 1480.00 | NIST | |
| I | 1424.00 | NIST | |
| I | 1437.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1455.00 | NIST | |
| I | 1422.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1480.00 | NIST | |
| I | 1441.00 | NIST | |
| I | 1480.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1435.00 | NIST | |
| I | 1440.00 | NIST | |
| I | 1465.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1424.00 | NIST | |
| I | 1430.00 | NIST | |
| I | 1457.00 | NIST | |
| I | 1432.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1454.00 | NIST | |
| I | 1460.00 | NIST | |
| I | 1440.00 | NIST | |
| I | 1470.00 | NIST | |
| I | 1430.00 | NIST | |
| I | 1424.00 | NIST | |
| I | 1446.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1430.00 | NIST | |
| I | 1445.00 | NIST | |
| I | 1459.00 | NIST | |
| I | 1415.00 | NIST | |
| I | 1460.00 | NIST | |
| I | Outlier 1488.00 | NIST | |
| I | 1418.00 | NIST | |
| I | 1448.00 | NIST | |
| I | Outlier 1405.00 | NIST | |
| I | 1410.00 | NIST | |
| I | 1410.00 | NIST | |
| I | Outlier 1405.00 | NIST | |
| I | 1417.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1471.00 | NIST | |
| I | Outlier 1403.00 | NIST | |
| I | 1413.00 | NIST | |
| I | Outlier 1403.00 | NIST | |
| I | 1413.00 | NIST | |
| I | 1425.00 | NIST | |
| I | 1425.00 | NIST | |
| I | Outlier 1403.00 | NIST | |
| I | 1413.00 | NIST | |
| I | Outlier 1403.00 | NIST | |
| I | 1413.00 | NIST | |
| I | 1430.00 | NIST | |
| I | 1430.00 | NIST | |
| I | 1448.00 | NIST | |
| I | 1458.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1457.00 | NIST | |
| I | 1446.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1462.00 | NIST | |
| I | 1445.00 | NIST | |
| I | 1473.00 | NIST | |
| I | Outlier 1492.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1447.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1457.00 | NIST | |
| I | 1456.00 | NIST | |
| I | 1454.00 | NIST | |
| I | 1445.00 | NIST | |
| I | 1462.00 | NIST | |
| I | 1448.00 | NIST | |
| I | 1443.00 | NIST | |
| I | Outlier 1498.00 | NIST | |
| I | 1445.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1480.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1410.00 | NIST | |
| I | 1440.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1443.00 | NIST | |
| I | 1428.00 | NIST | |
| I | 1457.00 | NIST | |
| I | 1457.00 | NIST | |
| I | 1409.00 | NIST | |
| I | 1441.00 | NIST | |
| I | 1454.00 | NIST | |
| I | 1459.00 | NIST | |
| I | 1476.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1432.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1418.00 | NIST | |
| I | Outlier 1401.00 | NIST | |
| I | 1425.00 | NIST | |
| I | 1436.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1453.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1461.00 | NIST | |
| I | 1447.00 | NIST | |
| I | 1435.00 | NIST | |
| I | 1447.00 | NIST | |
| I | 1434.00 | NIST | |
| I | 1446.00 | NIST | |
| I | 1476.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1447.00 | NIST | |
| I | 1468.00 | NIST | |
| I | 1430.00 | NIST | |
| I | 1439.00 | NIST | |
| I | 1475.00 | NIST | |
| I | 1425.00 | NIST | |
| I | 1408.00 | NIST | |
| I | 1457.00 | NIST | |
| I | 1453.00 | NIST | |
| I | 1463.00 | NIST | |
| I | 1431.00 | NIST | |
| I | 1435.00 | NIST | |
| I | 1439.00 | NIST | |
| I | 1428.00 | NIST | |
| I | 1435.00 | NIST | |
| I | 1446.00 | NIST | |
| I | 1455.00 | NIST | |
| I | 1435.00 | NIST | |
| I | 1409.00 | NIST | |
| I | 1454.00 | NIST | |
| I | 1454.00 | NIST | |
| I | 1430.00 | NIST | |
| I | 1430.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1480.00 | NIST | |
| I | 1446.00 | NIST | |
| I | 1478.00 | NIST | |
| I | 1445.00 | NIST | |
| I | 1467.00 | NIST | |
| I | 1461.00 | NIST | |
| I | 1428.00 | NIST | |
| I | 1450.00 | NIST | |
| I | 1462.00 | NIST | |
| I | 1465.00 | NIST | |
| I | 1449.00 | NIST | |
| I | 1452.00 | NIST | |
| I | 1479.00 | NIST | |
| I | 1453.00 | NIST | |
| I | 1448.00 | NIST | |
| I | 1444.00 | NIST | |
| I | 1431.00 | NIST | |
| I | 1472.00 | NIST | |
| I | 1442.00 | NIST | |
| I | 1435.00 | NIST | |
| I | 1471.00 | NIST | |
| I | 1415.00 | NIST | |
| I | Outlier 1403.00 | NIST | |
| I | Outlier 1492.00 | NIST | |
| I | 1457.00 | NIST | |
| I | 1409.00 | NIST | |
| I | 1425.00 | NIST | |
| I | 1447.00 | NIST | |
| I | 1476.00 | NIST | |
| I | 1439.00 | NIST | |
| I | 1469.00 | NIST | |
| I | 1485.00 | NIST | |
| I | 1470.00 | NIST | |
| I | 1466.00 | NIST | |
| I | 1451.00 | NIST | |
| I | 1443.00 | NIST | |
| I | 1410.00 | NIST | |
| I | 1422.00 | NIST | |
| I | 1432.00 | NIST | |
| I | 1460.00 | NIST | |
| I | Outlier 1405.00 | NIST | |
| I | 1413.00 | NIST | |
| S°gas | 282.84 | J/mol×K | NIST |
| S°liquid | [158.00; 193.70] | J/mol×K |
|
| S°liquid | 158.00 | J/mol×K | NIST |
| S°liquid | 193.70 | J/mol×K | NIST |
| Tboil | [390.85; 391.44] | K |
|
| Tboil | 391.00 | K | KDB |
| Tboil | 391.20 | K | Liquid ... |
| Tboil | 390.95 | K | Vapor l... |
| Tboil | 391.20 | K | Liquid ... |
| Tboil | 390.85 | K | Isobari... |
| Tboil | 391.05 | K | Determi... |
| Tboil | 391.00 | K | Vapor l... |
| Tboil | 391.05 | K | Quatern... |
| Tboil | 390.95 | K | Ternary... |
| Tboil | 391.03 | K | Isobari... |
| Tboil | 391.20 | K | (Liquid... |
| Tboil | 390.93 | K | Study o... |
| Tboil | 391.20 | K | Liquid-... |
| Tboil | 390.85 | K | Measure... |
| Tboil | 391.03 | K | Isobari... |
| Tboil | 390.96 | K | Investi... |
| Tboil | 391.15 | K | Liquid-... |
| Tboil | Outlier 391.44 | K | Isobari... |
| Tc | 592.71 | K | KDB |
| Tfus | [289.00; 289.95] | K |
|
| Tfus | 289.93 | K | Aq. Sol... |
| Tfus | 289.70 | K | KDB |
| Tfus | 289.84 | K | Solid l... |
| Tfus | 289.95 | K | Differe... |
| Tfus | 289.70 ± 0.03 | K | NIST |
| Tfus | 289.85 | K | NIST |
| Tfus | 289.62 ± 0.10 | K | NIST |
| Tfus | 289.49 ± 0.05 | K | NIST |
| Tfus | 289.75 ± 0.05 | K | NIST |
| Tfus | 289.80 ± 0.30 | K | NIST |
| Tfus | 289.67 ± 0.05 | K | NIST |
| Tfus | Outlier 289.00 ± 1.50 | K | NIST |
| Tfus | 289.69 ± 0.20 | K | NIST |
| Ttriple | [289.69; 289.80] | K |
|
| Ttriple | 289.69 | K | KDB |
| Ttriple | 289.80 ± 0.05 | K | NIST |
| Ttriple | 289.69 ± 0.04 | K | NIST |
| Ttriple | 289.80 ± 0.15 | K | NIST |
| Vc | 0.171 | m3/kmol | KDB |
| Zc | 0.2007690 | KDB | |
| Zra | 0.22 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [77.89; 98.37] | J/mol×K | [391.21; 567.09] |
|
| Cp,gas | 77.89 | J/mol×K | 391.21 | Joback Calculated Property |
| Cp,gas | 81.64 | J/mol×K | 420.52 | Joback Calculated Property |
| Cp,gas | 85.25 | J/mol×K | 449.84 | Joback Calculated Property |
| Cp,gas | 88.73 | J/mol×K | 479.15 | Joback Calculated Property |
| Cp,gas | 92.08 | J/mol×K | 508.46 | Joback Calculated Property |
| Cp,gas | 95.29 | J/mol×K | 537.78 | Joback Calculated Property |
| Cp,gas | 98.37 | J/mol×K | 567.09 | Joback Calculated Property |
| Cp,liquid | [120.50; 159.80] | J/mol×K | [294.70; 333.15] |
|
| Cp,liquid | 123.40 | J/mol×K | 294.70 | NIST |
| Cp,liquid | 121.30 | J/mol×K | 297.10 | NIST |
| Cp,liquid | 123.50 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 120.50 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 159.80 | J/mol×K | 298.10 | NIST |
| Cp,liquid | 123.10 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 137.00 | J/mol×K | 311.00 | NIST |
| Cp,liquid | 135.50 | J/mol×K | 313.15 | Heat Ca... |
| Cp,liquid | 139.70 | J/mol×K | 332.00 | NIST |
| Cp,liquid | 137.21 | J/mol×K | 333.15 | Heat Ca... |
| η | [0.0005700; 0.0012110] | Pa×s | [293.15; 353.15] |
|
| η | 0.0012040 | Pa×s | 293.15 | Densiti... |
| η | 0.0012040 | Pa×s | 293.15 | Densiti... |
| η | 0.0012110 | Pa×s | 293.15 | Dynamic... |
| η | 0.0011150 | Pa×s | 298.15 | Dynamic... |
| η | 0.0011140 | Pa×s | 298.15 | Densiti... |
| η | 0.0011140 | Pa×s | 298.15 | Densiti... |
| η | 0.0010590 | Pa×s | 303.15 | Densiti... |
| η | 0.0010370 | Pa×s | 303.15 | Densiti... |
| η | 0.0010340 | Pa×s | 303.15 | Dynamic... |
| η | 0.0010370 | Pa×s | 303.15 | Densiti... |
| η | 0.0009640 | Pa×s | 308.15 | Densiti... |
| η | 0.0009640 | Pa×s | 308.15 | Densiti... |
| η | 0.0009020 | Pa×s | 313.15 | Densiti... |
| η | 0.0009020 | Pa×s | 313.15 | Densiti... |
| η | 0.0009200 | Pa×s | 313.15 | Densiti... |
| η | 0.0008410 | Pa×s | 318.15 | Densiti... |
| η | 0.0008410 | Pa×s | 318.15 | Densiti... |
| η | 0.0007870 | Pa×s | 323.15 | Densiti... |
| η | 0.0007870 | Pa×s | 323.15 | Densiti... |
| η | 0.0008040 | Pa×s | 323.15 | Densiti... |
| η | 0.0007410 | Pa×s | 328.15 | Densiti... |
| η | 0.0007410 | Pa×s | 328.15 | Densiti... |
| η | 0.0007090 | Pa×s | 333.15 | Densiti... |
| η | 0.0006970 | Pa×s | 333.15 | Densiti... |
| η | 0.0006970 | Pa×s | 333.15 | Densiti... |
| η | 0.0006570 | Pa×s | 338.15 | Densiti... |
| η | 0.0006320 | Pa×s | 343.15 | Densiti... |
| η | 0.0005700 | Pa×s | 353.15 | Densiti... |
| ΔfusH | [10.83; 11.73] | kJ/mol | [283.70; 298.70] |
|
| ΔfusH | 11.52 | kJ/mol | 283.70 | NIST |
| ΔfusH | 10.83 | kJ/mol | 289.80 | NIST |
| ΔfusH | 11.73 | kJ/mol | 289.90 | NIST |
| ΔfusH | 11.13 | kJ/mol | 290.06 | NIST |
| ΔfusH | 11.72 | kJ/mol | 298.70 | NIST |
| ΔfusH | 11.72 | kJ/mol | 298.70 | NIST |
| ΔsubH | [67.00; 70.00] | kJ/mol | [221.50; 221.50] |
|
| ΔsubH | 67.00 ± 1.00 | kJ/mol | 221.50 | NIST |
| ΔsubH | 70.00 ± 1.00 | kJ/mol | 221.50 | NIST |
| ΔvapH | [23.68; 43.00] | kJ/mol | [308.00; 559.00] |
|
| ΔvapH | 43.00 | kJ/mol | 308.00 | NIST |
| ΔvapH | 41.60 | kJ/mol | 340.50 | NIST |
| ΔvapH | 42.00 | kJ/mol | 343.00 | NIST |
| ΔvapH | 41.60 | kJ/mol | 351.00 | NIST |
| ΔvapH | 40.90 | kJ/mol | 357.50 | NIST |
| ΔvapH | 40.30 | kJ/mol | 358.00 | NIST |
| ΔvapH | 39.10 | kJ/mol | 364.00 | NIST |
| ΔvapH | 23.70 | kJ/mol | 391.10 | NIST |
| ΔvapH | 23.68 | kJ/mol | 391.30 | KDB |
| ΔvapH | 38.70 | kJ/mol | 419.00 | NIST |
| ΔvapH | 37.90 | kJ/mol | 470.50 | NIST |
| ΔvapH | 38.10 | kJ/mol | 486.00 | NIST |
| ΔvapH | 38.80 | kJ/mol | 559.00 | NIST |
| Pvap | [7.57; 101.32] | kPa | [323.15; 391.03] |
|
| Pvap | 7.72 | kPa | 323.15 | Isother... |
| Pvap | 7.57 | kPa | 323.15 | Vapor-L... |
| Pvap | 12.04 | kPa | 333.15 | Vapor-L... |
| Pvap | 18.66 | kPa | 343.15 | Vapor-L... |
| Pvap | 20.00 | kPa | 345.27 | Isobari... |
| Pvap | 28.20 | kPa | 353.15 | Vapor-L... |
| Pvap | 49.34 | kPa | 368.10 | Separat... |
| Pvap | 88.98 | kPa | 386.07 | Separat... |
| Pvap | 96.15 | kPa | 388.91 | Vapor L... |
| Pvap | 101.32 | kPa | 391.03 | Isobari... |
| n0 | [1.36809; 1.37224] | [293.00; 303.15] |
|
|
| n0 | 1.37200 | 293.00 | Quatern... | |
| n0 | 1.37170 | 293.15 | Measure... | |
| n0 | 1.36870 | 293.15 | Volumet... | |
| n0 | 1.37160 | 293.15 | Solubil... | |
| n0 | 1.37130 | 293.15 | Isobari... | |
| n0 | 1.37180 | 293.15 | Solubil... | |
| n0 | 1.37224 | 293.15 | Solubil... | |
| n0 | 1.37200 | 293.15 | Isobari... | |
| n0 | 1.37190 | 293.15 | Isobari... | |
| n0 | 1.37210 | 293.15 | Liquid ... | |
| n0 | 1.37203 | 298.00 | Quatern... | |
| n0 | 1.36960 | 298.15 | Phase E... | |
| n0 | 1.37012 | 298.15 | Solubil... | |
| n0 | 1.36969 | 298.15 | Refract... | |
| n0 | 1.37160 | 298.15 | Isobari... | |
| n0 | 1.36960 | 298.15 | Study o... | |
| n0 | 1.36960 | 298.15 | Liquid-... | |
| n0 | 1.36980 | 298.15 | Densiti... | |
| n0 | 1.37160 | 298.15 | Geometr... | |
| n0 | 1.37000 | 298.15 | Solubil... | |
| n0 | 1.37160 | 303.15 | Liquid ... | |
| n0 | 1.37160 | 303.15 | Phase e... | |
| n0 | 1.36809 | 303.15 | Solubil... | |
| ρl | [993.00; 1055.01] | kg/m3 | [288.15; 343.15] |
|
| ρl | 1053.00 | kg/m3 | 288.15 | Effect ... |
| ρl | 1055.01 | kg/m3 | 288.20 | The imp... |
| ρl | 1049.00 | kg/m3 | 293.00 | KDB |
| ρl | 1044.30 | kg/m3 | 293.15 | Phase e... |
| ρl | 1052.50 | kg/m3 | 293.15 | Probe o... |
| ρl | 1048.93 | kg/m3 | 293.15 | Liquid-... |
| ρl | 1052.00 | kg/m3 | 293.15 | Effect ... |
| ρl | 1049.80 | kg/m3 | 293.20 | Liquid-... |
| ρl | 1049.80 | kg/m3 | 293.20 | Liquid-... |
| ρl | 1043.50 | kg/m3 | 298.15 | Isobari... |
| ρl | 1044.12 | kg/m3 | 298.15 | Liquid ... |
| ρl | 1042.00 | kg/m3 | 298.15 | Effect ... |
| ρl | 1046.90 | kg/m3 | 298.15 | Probe o... |
| ρl | 1044.60 | kg/m3 | 298.15 | Liquid ... |
| ρl | 1049.42 | kg/m3 | 298.15 | Liquid-... |
| ρl | 1043.67 | kg/m3 | 298.20 | The imp... |
| ρl | 1049.42 | kg/m3 | 298.20 | (Liquid... |
| ρl | 1049.42 | kg/m3 | 298.20 | Liquid ... |
| ρl | 1041.40 | kg/m3 | 303.15 | Probe o... |
| ρl | 1037.00 | kg/m3 | 303.15 | Effect ... |
| ρl | 1035.80 | kg/m3 | 308.15 | Probe o... |
| ρl | 1025.00 | kg/m3 | 313.15 | Effect ... |
| ρl | 1030.00 | kg/m3 | 313.15 | Probe o... |
| ρl | 1028.13 | kg/m3 | 313.20 | Liquid-... |
| ρl | 1026.72 | kg/m3 | 313.20 | The imp... |
| ρl | 1028.13 | kg/m3 | 313.20 | Liquid-... |
| ρl | 1015.00 | kg/m3 | 323.15 | Effect ... |
| ρl | 1004.00 | kg/m3 | 333.15 | Effect ... |
| ρl | 993.00 | kg/m3 | 343.15 | Effect ... |
| ΔfusS | [38.36; 40.47] | J/mol×K | [289.90; 290.06] |
|
| ΔfusS | 40.47 | J/mol×K | 289.90 | NIST |
| ΔfusS | 38.36 | J/mol×K | 290.06 | NIST |
| γ | [0.02; 0.03] | N/m | [303.15; 343.15] |
|
| γ | 0.03 | N/m | 303.15 | Surface... |
| γ | 0.03 | N/m | 303.20 | KDB |
| γ | 0.03 | N/m | 308.15 | Surface... |
| γ | 0.03 | N/m | 313.15 | Surface... |
| γ | 0.02 | N/m | 318.15 | Surface... |
| γ | 0.02 | N/m | 323.15 | Surface... |
| γ | 0.02 | N/m | 333.15 | Surface... |
| γ | 0.02 | N/m | 343.15 | Surface... |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboil | [341.30; 389.58] | K | [17.00; 97.08] |
|
| Tboil | 341.30 | K | 17.00 | Study o... |
| Tboil | 342.87 | K | 18.47 | Study o... |
| Tboil | 345.03 | K | 20.01 | Study o... |
| Tboil | 346.41 | K | 21.29 | Study o... |
| Tboil | 348.49 | K | 23.18 | Study o... |
| Tboil | 350.35 | K | 24.92 | Study o... |
| Tboil | 352.88 | K | 27.44 | Study o... |
| Tboil | 355.01 | K | 29.78 | Study o... |
| Tboil | 357.54 | K | 32.78 | Study o... |
| Tboil | 359.26 | K | 34.97 | Study o... |
| Tboil | 363.04 | K | 39.99 | Study o... |
| Tboil | 368.56 | K | 48.99 | Study o... |
| Tboil | 372.27 | K | 55.76 | Study o... |
| Tboil | 374.54 | K | 60.04 | Study o... |
| Tboil | 376.66 | K | 64.44 | Study o... |
| Tboil | 379.05 | K | 69.39 | Study o... |
| Tboil | 381.60 | K | 75.23 | Study o... |
| Tboil | 383.32 | K | 79.98 | Study o... |
| Tboil | 384.82 | K | 83.66 | Study o... |
| Tboil | 386.07 | K | 87.18 | Study o... |
| Tboil | 389.58 | K | 97.08 | Study o... |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 313.15 | 100.00 | 0.0009 |
| 313.15 | 800.00 | 0.0009 |
| 313.15 | 1600.00 | 0.0009 |
| 313.15 | 2400.00 | 0.0009 |
| 313.15 | 3200.00 | 0.0009 |
| 333.15 | 100.00 | 0.0007 |
| 333.15 | 800.00 | 0.0007 |
| 333.15 | 1600.00 | 0.0007 |
| 333.15 | 2400.00 | 0.0007 |
| 333.15 | 3200.00 | 0.0007 |
| 353.15 | 100.00 | 0.0006 |
| 353.15 | 800.00 | 0.0006 |
| 353.15 | 1600.00 | 0.0006 |
| 353.15 | 2400.00 | 0.0006 |
| 353.15 | 3200.00 | 0.0006 |
| 373.15 | 100.00 | 0.0005 |
| 373.15 | 800.00 | 0.0005 |
| 373.15 | 1600.00 | 0.0005 |
| 373.15 | 2400.00 | 0.0005 |
| 373.15 | 3200.00 | 0.0005 |
| 393.15 | 800.00 | 0.0004 |
| 393.15 | 1600.00 | 0.0004 |
| 393.15 | 2400.00 | 0.0004 |
| 393.15 | 3200.00 | 0.0004 |
| 413.15 | 800.00 | 0.0003 |
| 413.15 | 1600.00 | 0.0003 |
| 413.15 | 2400.00 | 0.0003 |
| 413.15 | 3200.00 | 0.0004 |
| 433.15 | 800.00 | 0.0003 |
| 433.15 | 1600.00 | 0.0003 |
| 433.15 | 2400.00 | 0.0003 |
| 433.15 | 3200.00 | 0.0003 |
| 453.15 | 800.00 | 0.0002 |
| 453.15 | 1600.00 | 0.0003 |
| 453.15 | 2400.00 | 0.0003 |
| 453.15 | 3200.00 | 0.0003 |
| 473.15 | 1600.00 | 0.0002 |
| 473.15 | 2400.00 | 0.0002 |
| 473.15 | 3200.00 | 0.0002 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [0.61; 5765.55] | kPa | [289.81; 591.95] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.47385e+01 | |||
| Coefficient B | -3.05591e+03 | |||
| Coefficient C | -8.92370e+01 | |||
| Temperature range, min. | 289.81 | |||
| Temperature range, max. | 591.95 | |||
| Pvap | 0.61 | kPa | 289.81 | Calculated Property |
| Pvap | 5.40 | kPa | 323.38 | Calculated Property |
| Pvap | 27.76 | kPa | 356.95 | Calculated Property |
| Pvap | 99.05 | kPa | 390.52 | Calculated Property |
| Pvap | 273.83 | kPa | 424.09 | Calculated Property |
| Pvap | 628.95 | kPa | 457.67 | Calculated Property |
| Pvap | 1257.30 | kPa | 491.24 | Calculated Property |
| Pvap | 2258.87 | kPa | 524.81 | Calculated Property |
| Pvap | 3731.87 | kPa | 558.38 | Calculated Property |
| Pvap | 5765.55 | kPa | 591.95 | Calculated Property |
| Pvap | [1.30; 5775.35] | kPa | [289.81; 592.71] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 6.82294e+01 | |||
| Coefficient B | -7.02972e+03 | |||
| Coefficient C | -7.79853e+00 | |||
| Coefficient D | 5.93100e-06 | |||
| Temperature range, min. | 289.81 | |||
| Temperature range, max. | 592.71 | |||
| Pvap | 1.30 | kPa | 289.81 | Calculated Property |
| Pvap | 7.76 | kPa | 323.47 | Calculated Property |
| Pvap | 31.85 | kPa | 357.12 | Calculated Property |
| Pvap | 99.81 | kPa | 390.78 | Calculated Property |
| Pvap | 256.77 | kPa | 424.43 | Calculated Property |
| Pvap | 570.27 | kPa | 458.09 | Calculated Property |
| Pvap | 1133.54 | kPa | 491.74 | Calculated Property |
| Pvap | 2070.61 | kPa | 525.40 | Calculated Property |
| Pvap | 3545.16 | kPa | 559.05 | Calculated Property |
| Pvap | 5775.35 | kPa | 592.71 | Calculated Property |
Similar Compounds
Find more compounds similar to Acetic acid.
Mixtures
- Acetic acid + Hexanedioic acid, dimethyl ester + Water
- Acetic acid + Ethyl Acetate
- Acetic acid + Water
- Acetic acid + Butanedioic acid, dimethyl ester + Water
- 2-Pyrrolidinone, 1-methyl- + Acetic acid
- Acetic acid + Acetamide, N-methyl-
- 2-Pyrrolidinone, 1-methyl- + Acetic acid + Water
- Acetic acid + Acetamide, N-methyl- + Water
- Acetic acid + Acetic acid, methyl ester
- Benzene, (1-methylethyl)- + Acetic acid + Water
- 1,2-Ethanediol, diacetate + Acetic acid
- Acetic acid + 1,2-Ethanediol, monoacetate
- 1,2-Ethanediol + Acetic acid
- Acetic acid + Propanoic acid + Formamide
- 2-Butenedioic acid (Z)-, dimethyl ester + Acetic acid + Water
- Isobutyl acetate + Acetic acid + Water
- 1-Propanol, 2-methyl- + Acetic acid + Water
- Acetic acid + Methyl propionate
- Acetic acid + Dimethyl Sulfoxide
- Formamide, N,N-dimethyl- + Acetic acid
Find more mixtures with Acetic acid.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Liquid liquid equilibria of the ternary system water + acetic acid + dimethyl adipate
- Solubility of terephthalic acid in aqueous acetic acid from 423.15 to 513.15K
- Vapor liquid equilibria for the quaternary reactive system ethyl acetate + ethanol +water + acetic acid and some of the constituent binary systems at 101.3 kPa
- Liquid liquid equilibria of the ternary system water + acetic acid + dimethyl succinate
- Isobaric vapor liquid equilibria for water + acetic acid + (N-methyl pyrrolidone or N-methyl acetamide)
- Liquid liquid equilibria for the system (water + carboxylic acid + chloroform): Thermodynamic modeling
- High pressure vapour liquid equilibria of the binary and some of the ternary and multicomponent mixtures of the carbon dioxide + acetic anhydride + alpha-methylbenzyl alcohol + acetic acid + alpha-methylbenzyl acetate system: Experimental and modelling results
- Isothermal vapour liquid equilibrium with chemical reaction in the quaternary water + methanol + acetic acid + methyl acetate system, and in five binary subsystems
- Liquid liquid equilibria of ternary systems (water + carboxylic acid + cumene) at 298.15K
- Measurement of the thermodynamic properties for the reactive system ethylene glycol acetic acid
- Solid liquid equilibrium in the ternary system acetic acid propanoic acid formamide
- Determination and correlation of liquid liquid equilibria for the (water + carboxylic acid + dimethyl maleate) ternary systems at T = 298.2K
- Study of liquid liquid equilibrium of the systems isobutyl acetate + acetic acid +water and isobutyl alcohol + acetic acid +water at different temperatures
- Multiphase equilibria for mixtures containing water, acetic acid, propionic acid, methyl acetate and methyl propionate
- Vapor liquid equilibria for water + acetic acid + (N,N-dimethylformamide or dimethyl sulfoxide) at 13.33 kPa
- Investigation on isobaric vapor liquid equilibrium for acetic acid +water +methyl ethyl ketone + isopropyl acetate
- Experimental measurements of vapor liquid equilibria at low pressure: Systems containing alcohols, esters and organic acids
- Phase equilibria for reactive distillation of diethyl succinate. Part II: Systems diethyl succinate + ethyl acetate + water and diethyl succinate + acetic acid + water
- Liquid liquid equilibrium of the ternary system water + acetic acid + sec-butyl acetate
- Solubility of benzoic acid in acetone, 2-propanol, acetic acid and cyclohexane: Experimental measurement and thermodynamic modeling
- Phase equilibria of (water + carboxylic acid + diethyl maleate) ternary liquid systems at 298.15 K
- Investigation on isobaric vapor-liquid equilibrium for acetic acid + water + (n-propyl acetate or iso-butyl acetate)
- Phase equilibria in binary mixtures with monoethyl succinate
- Liquid-liquid equilibrium for the ternary system isopropenyl acetate + water + acetic acid at 298.2 K, 313.2 K, 323.2 K and 333.2 K
- Quaternary phase equilibrium of water-carboxylic acid mixture (formic-propionic acid or acetic-propionic acid)-solvent liquid systems at 298.15 K
- Isobaric vapor-liquid liquid equilibrium for isopropenyl acetate + water + acetic acid at 101 kPa
- Experiment and correlation of osmotic coefficient for aqueous solution of carboxylic acids using NRTL nonrandom factor model
- Measurement and correlation for solubility of levofloxacin in six solvents at temperatures from 288.15 to 328.15 K
- Solubility of chlocyphos in different solvents
- Ternary liquid-liquid phase equilibria of (water-carboxylic acid-1-undecanol) systems at 298.15 K
- Solubilities of D-xylose in water + (acetic acid or propionic acid ) mixtures at atmospheric pressure and different temperatures
- Solid liquid equilibrium of 1-hydroxyethane-1,1-diphosphonic acid in different solvents
- Solubility of puerarin in the binary system of methanol and acetic acid solvent mixtures
- Solubility of propanoic acid 3-(hydroxyphenylphosphinyl)-sodium salts in different solvent
- Isobaric vapor-liquid-liquid equilibrium for water + cyclohexane + acetic acid at 101.3 kPa
- Solubilities of crotonic acid in different organic solvents at severaltemperatures from (278.15 to 333.15) K
- Phase equilibrium of (water + formic or acetic acid + ethyl heptanoate) ternary liquid systems at different temperatures
- Liquid-liquid equilibria for ternary systems acetic acid + n-butylacetate + hydrocarbons at 293.15 K
- Measurement on the solubility of adipic acid in various solvents at high temperature and its thermodynamics parameters.
- Isobaric vapor-liquid equilibrium for water + acetic acid + 1-butyl-3-methylimidazolium dibutylphosphate at 101.32 kPa
- Solubility and solution thermodynamics of myo-inositol in (water + acetic acid) binary solvent mixtures
- Measurement and correlation of the solubility of maleic anhydride in different organic solvents
- (Liquid + liquid) equilibria of the (water + carboxylic acid + dibasic esters mixture (DBE-2)) ternary systems
- Solubility, liquid-liquid equilibrium and critical states for the quaternary system acetic acid-ethanol-ethyl acetate-water at 303.15 K and 313.15 K
- Solubility, liquid-liquid equilibrium and critical states for the system acetic acid + n-propanol + n-propyl acetate + water at 293.15 K and 303.15 K
- Solid-liquid equilibrium and thermodynamic of 2,5-thiophenedicarboxylic acid in different organic solvents
- Phase equilibria and excess properties for binary systems in reactive distillation processes Part II. Ethyl acetate synthesis
- Liquid-liquid equilibria of water + acetic acid + 2-ethyl hexyl acetate ternary system
- Excess molar enthalpies for binary mixtures of n-propanol, acetic acid, and n-propyl acetate at 313.15 K and atmospheric pressure
- Liquid-liquid equilibria for ternary system water + acetic acid+ cyclohexanone at (293.2 to 323.2) K
- Liquid-liquid equilibrium and critical states for the system acetic acid + n-butanol + n-butyl acetate + water at 308.15 K
- Liquid liquid equilibria measurements of ternary systems (acetonitrile + a carboxylic acid + dodecane) at 303.15 K
- Temperature dependent solubility of sodium cyclamate in selected pure solvents and binary methanol + water mixed solvents
- Measurement and correlation of solubility of D-camphor-10-sulfonic acid in pure solvents
- Enhancement of bio-oil derived chemicals in aqueous phase using ionic liquids: Experimental and COSMO-SAC predictions using a modified hydrogen bonding expression
- Isobaric vapor-liquid equilibrium of the binary system sec-butyl acetate + para-xylene and the quaternary system methyl acetate + para-xylene + sec-butyl acetate + acetic acid at 101.3 kPa
- Thermodynamic models for determination of the solid-liquid equilibrium of 2,5-thiophenedicarboxylic acid in (acetic acid + ethanol) binary solvent mixtures
- Liquid-liquid equilibrium of water + acetic acid + butyl butyrate at 298 K and 1 atmosphere
- Phase equilibria measurements of ternary mixtures (sulfolane + a carboxylic acid + pentane) at 303.15 K
- Excess molar enthalpies of the ternary mixture n-propanol + acetic acid + water at 313.15 K and atmospheric pressure
- Experimental determination of solubility and metastable zone width of 3,4-bis(3-nitrofurazan-4-yl)furoxan (DNTF) in (acetic acid + water) systems from (298.15 K - 338.15 K)
- Isobaric vapor-liquid equilibrium of acetic acid + N,N-dimethylacetamide + 1-butyl-3-methylimidazolium Bis [(trifluoromethyl)sulfonyl]-imide
- Liquid-liquid equilibria for ternary systems water + acetic acid + 1,2,4-trimethylbenzene and water + acetic acid + 1,3,5- trimethylbenzene at (303.2 - 343.2) K
- Liquid - liquid equilibrium for the quaternary reaction system water p sec-butyl alcohol p sec-butyl acetate p acetic acid
- Liquid-liquid equilibrium data for ternary systems of water + acetic acid + acetate esters at 293.2 K and 303.2 K and ~ 95 kPa
- Solubility, liquid-liquid equilibrium and critical states for quaternary system acetic acid - n-amyl alcohol - n-amyl acetate - water at 303.15 K and atmospheric pressure
- Solubility of 1-methyl-4-nitropyrazole in seventeen pure solvents at temperatures from 283.15 K to 323.15 K
- Vapor-liquid equilibrium in the ternary systems acetic acid + water + (xylose or glucose)
- Solubility determination and correlation of cyromazine in sixteen pure solvents and mixing properties of solutions
- Liquid-liquid equilibrium data and thermophysical properties for ternary systems composed of water, acetic acid and different solvents
- Thermodynamic equilibrium of hexamethylenediammonium glutarate in mono-solvents and binary solvent systems
- Differential scanning calorimetry determination of Solid-Liquid equilibria phase diagrams for binary monocarboxylic acids solutions
- Quaternary liquid-liquid equilibrium, solubility and critical states: Acetic acid - n-butanol - n-butyl acetate - water at 318.15 K and atmospheric pressure
- Phase equilibria for ternary liquid systems of (water + carboxylic acid or alcohol + 1-hexanol) at T = 293.15 K: modelling considerations
- (Liquid + liquid) equilibria for (water + acetic acid + 2-ethyl- 1-hexanol): experimental data and prediction
- (Liquid + liquid) equilibria of the (water + acetic acid + dibutyl phthalate) system
- Isobaric (vapour + liquid) equilibria data for the binary systems {1,2-dichloroethane (1) + toluene (2)} and {1,2-dichloroethane (1) + acetic acid (2)} at atmospheric pressure
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(3-hydroxypropyl)pyridinium bis(trifluoromethylsulfonyl)-amide
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 4-(2-methoxyethyl)-4-methylmorpholinium bis(trifluoromethylsulfonyl)-amide
- Measurements of activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-hexyl-3-methylimidazolium tetracyanoborate
- (Liquid + liquid) equilibria for the ternary (water + acetic acid + toluene) system at different temperatures: Experimental data and correlation
- Solubilities of {a-D-glucose in water + (acetic acid or propionic acid)} mixtures at atmospheric pressure and different temperatures
- Phase behaviour of aqueous mixtures of acetic acid with isomers of xylene
- Measurement and correlation of solubility of dodecanedioic acid in different pure solvents from T = (288.15 to 323.15) K
- The impact of uni-univalent electrolytes on (water + acetic acid + toluene) equilibria: Representation with electrolyte-NRTL model
- An odd-even effect on solubility of dicarboxylic acids in organic solvents
- (Solid + liquid) phase equilibria of tetraphenyl piperazine-1,4-diyldiphosphonate in pure solvents
- Solvation parameter model and thermodynamic parameters in a dicationic ionic liquid based on pyrrolidinium
- Influence of the alkyl group on thermophysical properties of carboxylic acids in 1-butyl-3-methylimidazolium thiocyanate ionic liquid at various temperatures
- Solubility of tridecanedioic acid in pure solvent systems: An experimental and computational study
- Measurement and correlation of the solubility of 3,4-bis(3-nitrofurazan-4-yl)furoxan (DNTF) in different solvents
- (Liquid + liquid) equilibria measurements for ternary systems (sulfolane + a carboxylic acid + n-heptane) at T = 303.15 K and at 0.1 MPa
- Solubility of 3-chloro-N-phenylphthalimide in ten organic solvents from T = (288.15 to 323.15) K: Determination and modelling
- Influence of alkyl group on interactions between carboxylic acid and acetonitrile at different temperatures
- Solubility determination and thermodynamic modeling of 5-nitro-8- hydroxyquinoline in ten organic solvents from T = (278.15 to 313.15) K and mixing properties of solutions
- Solubility measurement and thermodynamic functions of 3-nitrobenzaldehyde in different solvents at elevated temperatures
- Cibulka correlation for ternary excess/deviation properties of {[C2mim] [EtSO4] (x1) + acetic or propionic acid (x2) + acetonitrile (x3)} systems at different temperatures
- Effect of temperature on intermolecular interactions between the organic solvents: Insights from density and excess volume
- Quaternary and ternary LLE measurements for solvent (2-methyltetrahydrofuran and cyclopentyl methyl ether) + furfural + acetic acid + water between 298 and 343 K
- Solubility of succinic acid, glutaric acid and adipic acid in propionic acid + epsilon-caprolactone + water mixtures: Experimental measurement and thermodynamic modeling
- Thermodynamic properties of ternary mixture {[C4mim][SCN] + acetic or propionic acid + acetonitrile} over the temperature range of (293.15-313.15) K
- Enthalpies of formation and lattice enthalpies of alkaline metal acetates
- Low-temperature heat capacities and standard molar enthalpy of formation of the solid-state coordination compound trans-Cu(Ala)2(s) (Ala = l- -alanine)
- Low temperature heat capacities and standard molar enthalpy of formation of sodium benzoate C6H5COONa (s)
- Synthesis, Characterization, and Thermodynamic Study of Ammonium Benzoate C7H5O2NH4(s)
- Thermochemistry on K2[M(DPA)2]*7H2O(s) (M= Cu and Ni, H2DPA= pyridine-2,6-dicarboxylic acid)
- Synthesis, Structural Characterization and Thermochemistry of Copper Pyridine 2,6-dicarboxylate
- Synthesis, crystal structure and thermochemistry of nickel hydrogen pyridine-2,6-dicarboxylate
- Solid-liquid equilibrium and thermodynamic research of 3-Thiophenecarboxylic acid in (water + acetic acid) binary solvent mixtures
- Differential scanning calorimetry determination of phase diagrams and water activities of aqueous carboxylic acid solutions
- Liquid-Liquid Equilibrium for Ternary Systems Water + Acetic Acid + m-Xylene and Water + Acetic Acid + o-Xylene at (303.2 to 343.2) K
- Solubility, Thermodynamic Properties, and Derived Excess Properties of Benzoic Acid in (Acetic Acid + Water) and (Acetic Acid + Toluene) Binary Mixtures
- Liquid Liquid Phase Equilibria for the Ternary Water + Acetic Acid + 3,3-Dimethyl-2-butanone System at (298.15, 313.15 and 323.15) K
- Solubility Modeling of 4-(Methylsulfonyl)benzaldehyde in Nine Organic Solvents at Elevated Temperatures
- p x Data of (Acetic Acid + Water) at T = (412.6, 443.2, 483.2) K
- Liquid Phase Equilibria of Aqueous Mixtures of Carboxylic Acids (C1-C4) with Ethylbenzene: Thermodynamic and Mathematical Modeling
- Quaternary, Ternary, and Binary LLE Measurements for 2-Methoxy-2-methylpropane + Furfural + Acetic Acid + Water at Temperatures between 298 and 307 K
- Quaternary, Ternary and Binary LLE Measurements for 2-Methoxy-2-methylbutane + Furfural + Acetic Acid + Water at Temperatures between 298 and 341 K
- Measurement and Correlation for Solubilities of Adipic Acid in Acetic Acid + e-Caprolactone Mixtures and Cyclohexanone + e-Caprolactone Mixtures
- Solubilities of Phthalic Acid and o-Toluic Acid in Binary Acetic Acid + Water and Acetic Acid + o-Xylene Solvent Mixtures
- Measurement and Modeling of Solid Liquid Equilibrium of para-tert-Butylbenzoic Acid in Acetic Acid/Methanol + Water and Acetic Acid + para-tert-Butyltoluene Binary Systems at Various Temperatures
- Liquid-Liquid Equilibria of Ionic Liquids-Water-Acetic Acid Mixtures
- Vapor Liquid Equilibrium Data for Binary Mixtures of Acetic Acid + Anisole, Acetone + Anisole, and Isopropanol + Anisole at Pressure 96.15 kPa
- Measurement and Modeling of Liquid Liquid Equilibrium for the Systems Vinyl Acetate + Acetic Acid/Ethanol + Water at 298.15 and 308.15 K
- Measurement and Correlation for Solubilities of Adipic Acid, Glutaric Acid and Succinic Acid in Acetic Acid + Cyclohexanone Mixtures
- Measurement and Modeling of Solubility of para-tert-Butylbenzoic Acid in Pure and Mixed Organic Solvents at Different Temperatures
- Thermophysical Properties and Solubility of Different Sugar-Derived Molecules in Deep Eutectic Solvents
- Study on the Solubilities of Mononitro-Substituted Products of Nitration of m-Toluic Acid in Several Solvents at Temperatures between 297.65 and 351.75 K
- Measurement and Correlation for the Solubility of Adipic Acid and Succinic Acid in Glutaric Acid + Cyclohexanone and Glutaric Acid + Acetic Acid Mixtures
- Liquid-Liquid Equilibrium Data, Density, Viscosity, and Interfacial Tension of Ternary System (Toluene-Acetic Acid-Water) at 298.15 K: Experiment and Correlation
- Thermodynamic Functions for the Solubility of 3-Nitrobenzonitrile in 12 Organic Solvents from T/K = (278.15 to 318.15)
- Measurement and Correlation for Solubilities of Succinic Acid and Glutaric Acid in e-Caprolactone + Acetic Acid Mixtures and e-Caprolactone + Cyclohexanone Mixtures
- Determination and Correlation of Solubility and Thermodynamic Properties of trans-Cinnamyl Alcohol in Pure and Binary Solvents from 253.15 K to 293.15 K
- Solubility of 2,5-Furandicarboxylic Acid in Eight Pure Solvents and Two Binary Solvent Systems at 313.15-363.15 K
- Solubilities of Isophthalic Acid in Ternary Mixtures of Acetic Acid + Water + Benzoic Acid from 292.55 to 372.10 K
- Solubilities of 2,5-Furandicarboxylic Acid in Binary Acetic Acid + Water, Methanol + Water, and Ethanol + Water Solvent Mixtures
- Liquid-Liquid Phase Equilibria for Quinary, Quaternary, and Ternary Systems {Water + Furfural + Acetic Acid + Cyclopentyl Methyl Ether + CaCl2}: Measurement, Effect of Salt ,and Comparative Study
- Solubility Determination and Thermodynamic Modeling of Glutaric Anhydride in Diverse Solvent Systems Consisting of Acetic Acid, Ethanoic Anhydride, and Tetrachloromethane from T = (278.45 to 324.45) K
- Measurement and Correlation of Solubility of 3-Hydroxy-2-naphthoic Acid in Ten Pure and Binary Mixed Organic Solvents from T = (293.15 to 333.15 K)
- Determination and Thermodynamic Modeling of Solid-Liquid Phase Equilibrium for Succinic Acid in the Glutaric Acid + Adipic Acid + Ethyl Acetate Mixture and Adipic Acid in the Succinic Acid + Glutaric Acid + Ethyl Acetate Mixture
- Liquid Viscosity and Interfacial Tension of Binary and Ternary Mixtures Containing n-Octacosane by Surface Light Scattering
- Probe of Interactions of Acetic and Propionic Acids with 2',3'-N-Epoxypropyl-N-methyl-2-oxopyrrolidinium Salicylate Ionic Liquid
- Solubilities of 2,6-Dimethylnaphthalene in Six Pure Solvents and Two Binary Solvent Systems
- Measurement and Modeling of Phase Equilibria in Systems Containing Water, Xylose, Furfural, and Acetic Acid
- Study of Vapor-Liquid Equilibria for Acetic Acid + n-Propyl Acetate + Isopropyl Acetate Systems
- o-Nitrophenylacetonitrile Solubility in Several Pure Solvents: Measurement, Correlation, and Solvent Effect Analysis
- Solubility and Liquid-Liquid Equilibria for the Isopropyl Acetate + Isopropanol + Acetic Acid + Water Quaternary System at 313.15 K and 101.3 kPa
- Thermodynamic Modeling and Solubility Measurement of Cetirizine Hydrochloride and Deferiprone in Pure Solvents of Acetonitrile, Ethanol, Acetic Acid, Sulfolane, and Ethyl Acetate and Their Mixtures
- Separation of Furfural from Ternary Mixtures
- Isobaric Vapor-Liquid Equilibria for Water + Acetic Acid + Sodium Acetate
- Solid-Liquid Equilibria of Several Systems Containing Acetic Acid
- Isobaric Vapor-Liquid Equilibria for Water + Acetic Acid + Potassium Acetate
- Dynamic Viscosities, Densities, and Speed of Sound and Derived Properties of the Binary Systems Acetic Acid with Water, Methanol, Ethanol, Ethyl Acetate and Methyl Acetate at T = (293.15, 298.15, and 303.15) K at Atmospheric Pressure
- Solubility of 11r-Hydroxy-16r,17r-Epoxyprogesterone in Different Solvents between 283 K and 323 K
- Liquid-Liquid Equilibria of Water + Acetic Acid + Dimethyl Glutarate Ternary System
- Solid-liquid Equilibria of 1,4-Benzenedicarboxylic Acid in Binary Acetic Acid + Water Solvent Mixtures at Elevated Temperatures
- Isobaric Vapor-Liquid Equilibria for Water + Acetic Acid + (n-Pentyl Acetate or Isopropyl Acetate)
- Critical Properties of the Reacting Mixture in the Esterification of Acetic Acid with Ethanol
- Solubilities of 1,3-benzenedicarboxylic acid in Water+ Acetic Acid Solutions
- Solid-Liquid Equilibria for Benzoic Acid + p-Toluic Acid + Chloroform, Benzoic Acid + p-Toluic Acid + Acetic Acid, and Terephthalic Acid + Isophthalic Acid + N,N-Dimethylformamide
- Thermodynamics of Phase and Chemical Equilibrium in a Strongly Nonideal Esterification System.
- Quaternary Liquid-Liquid Equilibrium of Water + Acetic Acid + Propionic Acid + Solvent (Amyl Alcohol, Cyclohexyl Acetate, or Toluene) Systems
- Phase Equlibria for Hexyl Acetate Reactive Distillation
- Solubility of 16.alpha.,17.alpha.-Epoxyprogesterone in Six Different Solvents
- Solubility of Hydroquinone in Different Solvents from 276.65 K to 345.10 K
- Liquid-Liquid Equilibria for the Ternary System Water + Acetic Acid + Propyl Acetate
- Measurements of Quaternary Liquid-Liquid Equilibrium for Water + Acetic Acid + Propionic Acid + Solvent (Butyronitrile, Benzyl Acetate, or Methyl Isobutyl Ketone) at 298.15 K
- Refractive Index, Surface Tension, and Density of Aqueous Mixtures of Carboxylic Acids at 298.15 K
- Solubility and Melting Properties of Salicylic Acid
- Solubilities of Some Phosphaspirocyclic Compounds in Selected Solvents
- Solubility and Melting Properties of Salicylamide
- Surface Tension of o-Xylene + Acetic Acid and m-Xylene + Acetic Acid Binary Mixtures from 303.15 K to 343.15 K
- Liquid-Liquid Equilibria of the Ternary System Water + Acetic Acid + Methyl tert-Butyl Ether
- Isobaric Vapor-Liquid Equilibria for Binary and Ternary Mixtures of Methanol, Ethanoic Acid, and Propanoic Acid
- Isobaric Vapor-Liquid Equilibria for Binary Systems of Acetic Acid + Benzene, Chloroacetic Acid + Benzene, and Dichloroacetic Acid + Benzene at 101.33 kPa
- Solubilities of Phosphorus-Containing Compounds in Selected Solvents
- Solubilities of 4-Formylbenzoic Acid in Ethanoic Acid, Water, and Ethanoic Acid/Water Mixtures with Different Compositions from (303.2 to 473.2) K
- Liquid-Liquid Equilibria for the Ternary System Water (1) + Acetic acid (2) + Diisopropyl Ether (3) at (293.15, 303.15, and 313.15) K
- Vapor-Liquid Equilibria in the Propyl Acetate + Ethanoic Acid Binary System from (323.15 to 353.15) K: Measurement with a Static Method and Modeling with the NRTL, Wilson, UNIQUAC, and COSMO-SAC Approaches
- Solubility of 2-Chloro-4,6-dinitroresorcinol in Ethanol, Methanol, Acetic Acid, Ethyl Acetate, and Water
- Solubilities of Pioglitazone Hydrochloride in Different Solvents
- Evaluation of Excess Molar Enthalpies for a Quaternary Mixture System of Acetic Anhydride, Ethanol, Acetic Acid, and Ethyl Acetate
- Isobaric Vapor Liquid Equilibrium for Binary Systems of Toluene + Acrylic Acid, Toluene + Acetic Acid, and Cyclohexane + Acrylic Acid at 20 kPa
- Volumetric Properties of Highly Nonideal Binary Mixtures Containing Ethanoic Acid and Propanoic Acid with Butan-2-ol, Methyl-2-propanol, and 2-Methyl-2-butanol at Different Temperatures
- Densities, Excess Molar Volumes, Viscosity, and Refractive Indices of Binary Mixtures of Ethanoic Acid and Trichloroethylene with Dimethylbenzenes at Different Temperatures
- Liquid Liquid Equilibria for the System Water + 4-Methylpentan-2-one + Acetic Acid at Several Temperatures
- Liquid Liquid Equilibria of Water + Acetic Acid + Cyclopentyl Methyl Ether (CPME) System at Different Temperatures
- Geometric Structures of Associating Component Optimized toward Correlation and Prediction of Isobaric Vapor Liquid Equilibria for Binary and Ternary Mixtures of Ethanal, Ethanol, and Ethanoic Acid
- Solubilities of Adipic Acid in Acetic Acid + Water Mixtures and Acetic Acid + Cyclohexane Mixtures
- Solubilities of 4-Bromo-1,8-naphthalic Anhydride in Different Pure Solvents and Binary Solvent Mixtures with the Temperature Range from (278.15 to 333.15) K
- Isobaric Vapor-Liquid Equilibria for Water + Acetic Acid + 1- Ethyl-3-methylimidazolium Diethylphosphate at 101.32 kPa
- Liquid Liquid Equilibrium for Ternary System Water + Cyclohexane + Acetic Acid at (303.2 to 333.2) K
- Investigation on Isobaric Vapor Liquid Equilibrium for Water + Acetic Acid + sec-Butyl Acetate
- Solubilities of Succinic Acid in Acetic Acid + Water Mixtures and Acetic Acid + Cyclohexane Mixtures
- Liquid Phase Equilibria of the Water + Acetic Acid + Dimethyl Carbonate Ternary System at Several Temperatures
- Experimental Measurement and Modeling of the Solubility of Biotin in Six Pure Solvents at Temperatures from 298.15 K to 333.85 K
- Thermodynamic Models for Determination of the Solubility of Sulfanilic Acid in Different Solvents at Temperatures from (278.15 to 328.15) K
- Solubilities of Benzoic Acid and Phthalic Acid in Acetic Acid + Water Solvent Mixtures
- Liquid-Liquid Equilibria for the Ternary Systems Acetic Acid + Water + Butyl Acetate and Acetic Acid + Water + 2-Methyl Propyl Acetate at 304.15 K, 332.15 K, and 366.15 K
- Solubility of N-Hydroxyphthalimide in Binary Acetic Acid + Water Solvent Mixtures at (293.2 to 363.2) K
- Solubilities of 2,4,8,10-Tetraoxa-3,9-diphosphaspiro[5.5]undecane-3,9-dimethanol, r,r,rcents,rcents-tetramethyl-3,9-dioxide in Selected Solvents
- Liquid-Liquid Equilibria of (Water + Acetic Acid + Diethyl Succinate or Diethyl Glutarate or Diethyl Adipate) Ternary Systems
- Liquid-Liquid Equilibria for the Acetic Acid + Water + Amyl Acetate and Acetic Acid + Water + 2-Methyl Ethyl Acetate Ternary Systems
- Ternary Liquid-Liquid Equilibria for Six Systems Containing Ethylacetate + Ethanol or Acetic Acid + an Imidazolium-Based Ionic Liquid with a Hydrogen Sulfate Anion at 313.2 K
- Phase Equilibrium for the Esterification Reaction of Acetic Acid + Butan-1-ol at 101.3 kPa
- Solubility of 1,2,4-Benzenetricarboxylic Acid in Acetic Acid + Water Solvent Mixtures
- Solubility of Dioxopromethazine Hydrochloride in Different Solvents
- Densities and Viscosities of N,N-Dimethylformamide + Formic Acid, and + Acetic Acid in the Temperature Range from (303.15 to 353.15) K
- Solubilities of Diphenylphosphinic Acid in Selected Solvents
- Solubility of 1-Hydroxyethane-1,1-diphosphonic Acid Monohydrate in Aqueous Acetic Acid Mixtures
- Solubility of Rifapentine in the Binary System of Acetic Acid and n-Octanol Solvent Mixtures
- Isobaric Vapor-Liquid Equilibria for the Binary Systems of Acetic Acid + Isopropenyl Acetate, Acetic Acid + Acetylacetone, and Water + Acetylacetone
- Solubilities of 1,3,5-Benzenetricarboxylic Acid and 1,3-Benzenedicarboxylic Acid in Acetic Acid + Water Solvent Mixtures
- Densities and Viscosities of Binary Mixtures of Acetic Acid with Acetic Anhydride and Methenamine at Different Temperatures
- Solubilities of 1,1-Di(2-carboxyethyl)-2,2'-biimidazole in Water + Acetic Acid from (292.3 to 355.1) K
- Ternary Liquid-Liquid Equilibria for Systems Containing Alcohol or Acetic Acid + Ester + 1-Ethyl-3-methylimidazolium Hydrogen Sulfate at 313.2 K Using Headspace Gas Chromatography
- Cosolvent Effect of Methanol and Acetic Acid on Dibenzofuran Solubility in Supercritical Carbon Dioxide
- Viscosities of p-Xylene, Acetic Acid, and p-Xylene + Acetic Acid at (313.15 to 473.15) K and (0.10 to 3.20) MPa: Determined by the Rolling-Ball Method
- Solubility of Hexamethylenetetramine in a Pure Water, Methanol, Acetic Acid, and Ethanol + Water Mixture from (299.38 to 340.35) K
- Measurement and Correlation of Liquid-Liquid Equilibrium Data for Water + Acetic Acid + Methyl tert-Butyl Ether + NaCl
- Solubility of Butanedioic Acid in Different Solvents at Temperatures between 283 K and 333 K
- Liquid-Liquid Equilibria for the System 1-Methyl Propyl Ethanoate (1) + Acetic Acid (2) + Water (3) at (283.15 and 323.15) K
- Solubility of Adenosine 5'-Monophosphate in Different Solvents from (288.15 to 330.15) K
- Heat Capacities of Binary Mixtures of Acetic Acid with Acetic Anhydride and Methenamine at Different Temperatures
- Isobaric Vapor-Liquid Equilibria for (Acetic Acid + Cyclohexane) and (Cyclohexane + Acetylacetone) at a Pressure of 101.3 kPa and for (Acetic Acid + Acetylacetone) at a Pressure of 60.0 kPa
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.