- Name
- Propane, 2-methoxy-2-methyl-
- InChI
- InChI=1S/C5H12O/c1-5(2,3)6-4/h1-4H3
- InChI Key
- BZLVMXJERCGZMT-UHFFFAOYSA-N
- Formula
- C5H12O
- SMILES
- COC(C)(C)C
- Mol. Weight (g/mol)
- 88.15
- CAS
- 1634-04-4
- Name
- Propanoic acid
- InChI
- InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)
- InChI Key
- XBDQKXXYIPTUBI-UHFFFAOYSA-N
- Formula
- C3H6O2
- SMILES
- CCC(=O)O
- Mol. Weight (g/mol)
- 74.08
- CAS
- 79-09-4
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Propanoic acid (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Propane, 2-methoxy-2-methyl- (1) - Liquid | Mole fraction of Propanoic acid (2) - Liquid |
| 298.20 | 0.9453 | 0.0000 |
| 298.20 | 0.8713 | 0.0485 |
| 298.20 | 0.7814 | 0.0836 |
| 298.20 | 0.6897 | 0.1259 |
| 298.20 | 0.6158 | 0.1588 |
| 298.20 | 0.5332 | 0.1874 |
| 298.20 | 0.4602 | 0.2309 |
| 298.20 | 0.3752 | 0.2504 |
| 298.20 | 0.2844 | 0.2698 |
| 298.20 | 0.1996 | 0.2878 |
| 298.20 | 0.1321 | 0.2601 |
| 298.20 | 0.0922 | 0.1965 |
| 298.20 | 0.0625 | 0.1596 |
| 298.20 | 0.0413 | 0.1203 |
| 298.20 | 0.0296 | 0.0620 |
| 298.20 | 0.0078 | 0.0000 |
| 232.20 | 0.9299 | 0.0000 |
| 232.20 | 0.8375 | 0.0384 |
| 232.20 | 0.7510 | 0.0757 |
| 232.20 | 0.6742 | 0.1089 |
| 232.20 | 0.5989 | 0.1466 |
| 232.20 | 0.5062 | 0.1908 |
| 232.20 | 0.4264 | 0.2341 |
| 232.20 | 0.3357 | 0.2658 |
| 232.20 | 0.2511 | 0.2804 |
| 232.20 | 0.1940 | 0.2899 |
| 232.20 | 0.1143 | 0.2602 |
| 232.20 | 0.0847 | 0.2217 |
| 232.20 | 0.0613 | 0.1588 |
| 232.20 | 0.0344 | 0.1184 |
| 232.20 | 0.0125 | 0.0624 |
| 232.20 | 0.0050 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Propanoic acid (2) - Liquid mixture 2 | Mole fraction of Propane, 2-methoxy-2-methyl- (1) - Liquid mixture 2 | Mole fraction of Propane, 2-methoxy-2-methyl- (1) - Liquid mixture 1 | Mole fraction of Propanoic acid (2) - Liquid mixture 1 |
| 298.20 | 0.7669 | 0.0703 | 0.0079 | 0.0046 |
| 298.20 | 0.6526 | 0.1299 | 0.0083 | 0.0093 |
| 298.20 | 0.5699 | 0.1664 | 0.0088 | 0.0140 |
| 298.20 | 0.4755 | 0.1996 | 0.0095 | 0.0209 |
| 298.20 | 0.3886 | 0.2290 | 0.0102 | 0.0277 |
| 298.20 | 0.2969 | 0.2587 | 0.0114 | 0.0359 |
| 298.20 | 0.2171 | 0.2795 | 0.0122 | 0.0466 |
| 298.20 | 0.1576 | 0.2808 | 0.0140 | 0.0543 |
| 323.20 | 0.7557 | 0.0735 | 0.0041 | 0.0050 |
| 323.20 | 0.6420 | 0.1307 | 0.0044 | 0.0105 |
| 323.20 | 0.5263 | 0.1891 | 0.0048 | 0.0185 |
| 323.20 | 0.4347 | 0.2263 | 0.0052 | 0.0296 |
| 323.20 | 0.3414 | 0.2650 | 0.0054 | 0.0381 |
| 323.20 | 0.2605 | 0.2825 | 0.0072 | 0.0478 |
| 323.20 | 0.2006 | 0.2936 | 0.0099 | 0.0612 |
| 323.20 | 0.1490 | 0.3011 | 0.0125 | 0.0858 |
Mole fraction of Propanoic acid (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Propane, 2-methoxy-2-methyl- (1) - Liquid | Mole fraction of Propanoic acid (2) - Liquid |
| 298.20 | 0.9453 | 0.0000 |
| 298.20 | 0.8713 | 0.0485 |
| 298.20 | 0.7814 | 0.0836 |
| 298.20 | 0.6897 | 0.1259 |
| 298.20 | 0.6158 | 0.1588 |
| 298.20 | 0.5332 | 0.1874 |
| 298.20 | 0.4602 | 0.2309 |
| 298.20 | 0.3752 | 0.2504 |
| 298.20 | 0.2844 | 0.2698 |
| 298.20 | 0.1996 | 0.2878 |
| 298.20 | 0.1321 | 0.2601 |
| 298.20 | 0.0922 | 0.1965 |
| 298.20 | 0.0625 | 0.1596 |
| 298.20 | 0.0413 | 0.1203 |
| 298.20 | 0.0296 | 0.0620 |
| 298.20 | 0.0078 | 0.0000 |
| 232.20 | 0.9299 | 0.0000 |
| 232.20 | 0.8375 | 0.0384 |
| 232.20 | 0.7510 | 0.0757 |
| 232.20 | 0.6742 | 0.1089 |
| 232.20 | 0.5989 | 0.1466 |
| 232.20 | 0.5062 | 0.1908 |
| 232.20 | 0.4264 | 0.2341 |
| 232.20 | 0.3357 | 0.2658 |
| 232.20 | 0.2511 | 0.2804 |
| 232.20 | 0.1940 | 0.2899 |
| 232.20 | 0.1143 | 0.2602 |
| 232.20 | 0.0847 | 0.2217 |
| 232.20 | 0.0613 | 0.1588 |
| 232.20 | 0.0344 | 0.1184 |
| 232.20 | 0.0125 | 0.0624 |
| 232.20 | 0.0050 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Propanoic acid (2) - Liquid mixture 2 | Mole fraction of Propane, 2-methoxy-2-methyl- (1) - Liquid mixture 2 | Mole fraction of Propane, 2-methoxy-2-methyl- (1) - Liquid mixture 1 | Mole fraction of Propanoic acid (2) - Liquid mixture 1 |
| 298.20 | 0.7669 | 0.0703 | 0.0079 | 0.0046 |
| 298.20 | 0.6526 | 0.1299 | 0.0083 | 0.0093 |
| 298.20 | 0.5699 | 0.1664 | 0.0088 | 0.0140 |
| 298.20 | 0.4755 | 0.1996 | 0.0095 | 0.0209 |
| 298.20 | 0.3886 | 0.2290 | 0.0102 | 0.0277 |
| 298.20 | 0.2969 | 0.2587 | 0.0114 | 0.0359 |
| 298.20 | 0.2171 | 0.2795 | 0.0122 | 0.0466 |
| 298.20 | 0.1576 | 0.2808 | 0.0140 | 0.0543 |
| 323.20 | 0.7557 | 0.0735 | 0.0041 | 0.0050 |
| 323.20 | 0.6420 | 0.1307 | 0.0044 | 0.0105 |
| 323.20 | 0.5263 | 0.1891 | 0.0048 | 0.0185 |
| 323.20 | 0.4347 | 0.2263 | 0.0052 | 0.0296 |
| 323.20 | 0.3414 | 0.2650 | 0.0054 | 0.0381 |
| 323.20 | 0.2605 | 0.2825 | 0.0072 | 0.0478 |
| 323.20 | 0.2006 | 0.2936 | 0.0099 | 0.0612 |
| 323.20 | 0.1490 | 0.3011 | 0.0125 | 0.0858 |