- InChI
- InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)
- InChI Key
- XBDQKXXYIPTUBI-UHFFFAOYSA-N
- Formula
- C3H6O2
- SMILES
- CCC(=O)O
- Molecular Weight1
- 74.08
- CAS
- 79-09-4
- Other Names
-
- Acide propionique
- Antischim B
- C2H5COOH
- CARBOXYETHANE
- ETHYLFORMIC ACID
- Ethanecarboxylic acid
- Kyselina propionova
- LUPRISOL
- Luprosil
- Metacetonic acid
- Methylacetic acid
- MonoProp
- PROPIONIC ACID
- Propcorn
- Propionic acid grain preserver
- Propkorn
- Prozoin
- Pseudoacetic acid
- Sentry grain preserver
- Tenox P grain preservative
- UN 1848
- n-Propionic acid
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- Tig : Autoignition Temperature (K).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- LFL : Lower Flammability Limit (% in Air).
- UFL : Upper Flammability Limit (% in Air).
- Tflash,cc : Flash Point (Closed Cup Method) (K).
- Tflash,oc : Flash Point (Open Cup Method) (K).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Rg : Radius of Gyration.
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔsubH : Enthalpy of sublimation at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tboil : Boiling point at given pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.5200 | KDB | |
| PAff | 797.20 | kJ/mol | NIST |
| Tig | 869.26 | K | KDB |
| BasG | 766.20 | kJ/mol | NIST |
| ΔcH°liquid | [-1528.00; -1527.30] | kJ/mol |
|
| ΔcH°liquid | -1527.30 ± 0.10 | kJ/mol | NIST |
| ΔcH°liquid | -1528.00 | kJ/mol | NIST |
| μ | 1.50 | debye | KDB |
| LFL | 2.90 | % in Air | KDB |
| UFL | 14.80 | % in Air | KDB |
| Tflash,cc | 329.82 | K | KDB |
| Tflash,oc | 327.59 | K | KDB |
| ΔfG° | -369.60 | kJ/mol | KDB |
| Rg | 3.0500 | KDB | |
| ΔfH°gas | [-455.80; -455.00] | kJ/mol |
|
| ΔfH°gas | -455.40 | kJ/mol | KDB |
| ΔfH°gas | -455.80 ± 2.00 | kJ/mol | NIST |
| ΔfH°gas | -455.80 ± 2.00 | kJ/mol | NIST |
| ΔfH°gas | -455.00 ± 3.20 | kJ/mol | NIST |
| ΔfH°liquid | [-510.80; -510.00] | kJ/mol |
|
| ΔfH°liquid | -510.80 ± 0.10 | kJ/mol | NIST |
| ΔfH°liquid | -510.00 ± 2.50 | kJ/mol | NIST |
| ΔfusH° | 9.21 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [30.60; 55.00] | kJ/mol |
|
| ΔvapH° | 54.40 | kJ/mol | NIST |
| ΔvapH° | 54.90 | kJ/mol | NIST |
| ΔvapH° | 55.00 | kJ/mol | NIST |
| ΔvapH° | 55.00 ± 2.00 | kJ/mol | NIST |
| ΔvapH° | 55.00 ± 2.00 | kJ/mol | NIST |
| ΔvapH° | Outlier 30.60 ± 0.02 | kJ/mol | NIST |
| IE | [10.24; 10.72] | eV |
|
| IE | 10.44 ± 0.06 | eV | NIST |
| IE | 10.40 | eV | NIST |
| IE | 10.51 | eV | NIST |
| IE | 10.41 | eV | NIST |
| IE | 10.41 | eV | NIST |
| IE | 10.53 ± 0.00 | eV | NIST |
| IE | 10.54 | eV | NIST |
| IE | 10.44 ± 0.03 | eV | NIST |
| IE | Outlier 10.24 ± 0.03 | eV | NIST |
| IE | 10.51 | eV | NIST |
| IE | Outlier 10.72 | eV | NIST |
| log10WS | -0.18 | Crippen Calculated Property | |
| logPoct/wat | 0.481 | Crippen Calculated Property | |
| McVol | 60.570 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 2 | KDB | |
| NFPA Health | 2 | KDB | |
| Pc | [4060.00; 5360.00] | kPa |
|
| Pc | 4530.00 | kPa | KDB |
| Pc | 4668.00 ± 50.00 | kPa | NIST |
| Pc | 4530.00 ± 50.00 | kPa | NIST |
| Pc | 4810.14 ± 90.00 | kPa | NIST |
| Pc | 4060.00 ± 405.30 | kPa | NIST |
| Pc | 5360.00 ± 506.63 | kPa | NIST |
| ρc | [314.83; 334.09] | kg/m3 |
|
| ρc | 334.09 ± 3.33 | kg/m3 | NIST |
| ρc | 314.83 ± 5.93 | kg/m3 | NIST |
| Inp | [668.00; 748.00] |
|
|
| Inp | 683.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 700.00 | NIST | |
| Inp | 741.00 | NIST | |
| Inp | 745.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 721.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 711.00 | NIST | |
| Inp | 748.00 | NIST | |
| Inp | 743.00 | NIST | |
| Inp | 743.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 721.00 | NIST | |
| Inp | 690.00 | NIST | |
| Inp | 729.00 | NIST | |
| Inp | 681.00 | NIST | |
| Inp | 668.00 | NIST | |
| Inp | 679.00 | NIST | |
| Inp | 732.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 715.00 | NIST | |
| Inp | 712.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 739.00 | NIST | |
| Inp | 668.00 | NIST | |
| Inp | 740.00 | NIST | |
| Inp | 693.00 | NIST | |
| Inp | 693.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 681.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 700.00 | NIST | |
| Inp | 718.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 700.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 668.00 | NIST | |
| Inp | 712.00 | NIST | |
| Inp | 702.00 | NIST | |
| I | [1486.00; 1574.00] |
|
|
| I | Outlier 1486.00 | NIST | |
| I | Outlier 1492.00 | NIST | |
| I | 1534.00 | NIST | |
| I | 1549.00 | NIST | |
| I | 1526.00 | NIST | |
| I | 1523.00 | NIST | |
| I | 1536.00 | NIST | |
| I | 1508.00 | NIST | |
| I | Outlier 1487.00 | NIST | |
| I | 1548.00 | NIST | |
| I | 1540.00 | NIST | |
| I | 1556.00 | NIST | |
| I | 1498.00 | NIST | |
| I | 1498.00 | NIST | |
| I | 1527.00 | NIST | |
| I | 1550.00 | NIST | |
| I | 1564.00 | NIST | |
| I | 1528.00 | NIST | |
| I | 1530.00 | NIST | |
| I | 1498.00 | NIST | |
| I | 1520.00 | NIST | |
| I | 1555.00 | NIST | |
| I | 1547.00 | NIST | |
| I | 1533.00 | NIST | |
| I | 1535.00 | NIST | |
| I | Outlier 1574.00 | NIST | |
| I | 1554.00 | NIST | |
| I | 1533.00 | NIST | |
| I | 1535.00 | NIST | |
| I | 1536.00 | NIST | |
| I | 1535.00 | NIST | |
| I | 1531.00 | NIST | |
| I | 1535.00 | NIST | |
| I | 1554.00 | NIST | |
| I | 1547.00 | NIST | |
| I | 1565.00 | NIST | |
| I | 1528.00 | NIST | |
| I | 1548.00 | NIST | |
| I | 1525.00 | NIST | |
| I | 1534.00 | NIST | |
| I | 1524.00 | NIST | |
| I | 1544.00 | NIST | |
| I | 1533.00 | NIST | |
| I | 1528.00 | NIST | |
| I | 1551.00 | NIST | |
| I | 1552.00 | NIST | |
| I | 1557.00 | NIST | |
| I | Outlier 1493.00 | NIST | |
| I | 1556.00 | NIST | |
| I | 1540.00 | NIST | |
| I | 1564.00 | NIST | |
| I | 1523.00 | NIST | |
| I | 1525.00 | NIST | |
| I | 1525.00 | NIST | |
| I | 1561.00 | NIST | |
| I | 1542.00 | NIST | |
| I | 1565.00 | NIST | |
| I | 1543.00 | NIST | |
| I | 1552.00 | NIST | |
| I | 1556.00 | NIST | |
| I | 1558.00 | NIST | |
| I | 1523.00 | NIST | |
| I | 1537.00 | NIST | |
| I | 1540.00 | NIST | |
| I | 1528.00 | NIST | |
| I | 1528.00 | NIST | |
| I | 1531.00 | NIST | |
| I | 1525.00 | NIST | |
| I | 1525.00 | NIST | |
| I | 1525.00 | NIST | |
| I | 1521.00 | NIST | |
| I | 1520.00 | NIST | |
| I | 1520.00 | NIST | |
| I | 1521.00 | NIST | |
| I | 1535.00 | NIST | |
| I | 1550.00 | NIST | |
| I | 1532.00 | NIST | |
| I | 1547.00 | NIST | |
| I | 1517.00 | NIST | |
| I | 1541.00 | NIST | |
| I | Outlier 1491.00 | NIST | |
| I | Outlier 1490.00 | NIST | |
| I | 1510.00 | NIST | |
| I | Outlier 1491.00 | NIST | |
| I | 1547.00 | NIST | |
| I | 1525.00 | NIST | |
| I | 1510.00 | NIST | |
| I | 1544.00 | NIST | |
| I | 1535.00 | NIST | |
| I | 1536.00 | NIST | |
| I | 1543.00 | NIST | |
| I | 1543.00 | NIST | |
| I | 1534.00 | NIST | |
| I | 1560.00 | NIST | |
| I | 1564.00 | NIST | |
| I | 1547.00 | NIST | |
| I | 1534.00 | NIST | |
| I | 1534.00 | NIST | |
| I | 1541.00 | NIST | |
| I | 1526.00 | NIST | |
| I | 1523.00 | NIST | |
| I | 1518.00 | NIST | |
| I | 1554.00 | NIST | |
| I | 1539.00 | NIST | |
| I | 1525.00 | NIST | |
| I | 1555.00 | NIST | |
| I | 1531.00 | NIST | |
| I | 1570.00 | NIST | |
| I | 1538.00 | NIST | |
| I | 1538.00 | NIST | |
| I | 1540.00 | NIST | |
| I | Outlier 1573.00 | NIST | |
| I | 1553.00 | NIST | |
| I | 1544.00 | NIST | |
| I | 1540.00 | NIST | |
| I | Outlier 1492.00 | NIST | |
| I | 1523.00 | NIST | |
| I | 1528.00 | NIST | |
| I | 1534.00 | NIST | |
| I | 1508.00 | NIST | |
| I | 1498.00 | NIST | |
| I | 1528.00 | NIST | |
| I | 1547.00 | NIST | |
| I | 1533.00 | NIST | |
| I | 1535.00 | NIST | |
| I | Outlier 1486.00 | NIST | |
| S°liquid | 191.00 | J/mol×K | NIST |
| Tboil | [404.15; 415.55] | K |
|
| Tboil | 414.30 | K | KDB |
| Tboil | 414.35 | K | Determi... |
| Tboil | 413.58 | K | Multiph... |
| Tboil | 414.25 | K | Quatern... |
| Tboil | 414.20 | K | Ternary... |
| Tboil | 414.01 | K | Vapor-l... |
| Tboil | 414.10 | K | (Liquid... |
| Tboil | 414.10 | K | (Liquid... |
| Tboil | 414.10 | K | (Liquid... |
| Tboil | 414.50 | K | (Liquid... |
| Tboil | 414.30 | K | (Liquid... |
| Tboil | 414.50 | K | (Liquid... |
| Tboil | 414.10 | K | (Liquid... |
| Tboil | 414.32 | K | Isobari... |
| Tboil | 414.35 | K | Solubil... |
| Tboil | 414.05 | K | Measure... |
| Tboil | 414.01 ± 0.50 | K | NIST |
| Tboil | 414.20 | K | NIST |
| Tboil | 413.85 ± 0.60 | K | NIST |
| Tboil | 414.50 ± 0.15 | K | NIST |
| Tboil | 414.50 ± 0.15 | K | NIST |
| Tboil | 414.15 ± 0.50 | K | NIST |
| Tboil | 414.00 ± 0.20 | K | NIST |
| Tboil | 414.10 ± 0.30 | K | NIST |
| Tboil | 413.90 ± 0.30 | K | NIST |
| Tboil | 414.20 ± 1.50 | K | NIST |
| Tboil | 414.00 ± 2.00 | K | NIST |
| Tboil | 413.95 | K | NIST |
| Tboil | 414.05 ± 0.50 | K | NIST |
| Tboil | 414.20 ± 0.20 | K | NIST |
| Tboil | 413.70 ± 0.40 | K | NIST |
| Tboil | 413.85 ± 0.40 | K | NIST |
| Tboil | 414.05 ± 0.20 | K | NIST |
| Tboil | 414.40 ± 0.30 | K | NIST |
| Tboil | 412.65 ± 1.00 | K | NIST |
| Tboil | 414.67 ± 0.40 | K | NIST |
| Tboil | 414.45 ± 0.50 | K | NIST |
| Tboil | 412.90 ± 0.60 | K | NIST |
| Tboil | 414.25 ± 0.50 | K | NIST |
| Tboil | 414.25 ± 0.60 | K | NIST |
| Tboil | 414.15 ± 0.50 | K | NIST |
| Tboil | 413.60 ± 0.40 | K | NIST |
| Tboil | 414.15 ± 1.50 | K | NIST |
| Tboil | 413.95 ± 0.30 | K | NIST |
| Tboil | 414.45 ± 0.50 | K | NIST |
| Tboil | Outlier 410.65 ± 2.00 | K | NIST |
| Tboil | 413.85 ± 0.30 | K | NIST |
| Tboil | 414.15 ± 1.00 | K | NIST |
| Tboil | 414.50 ± 0.50 | K | NIST |
| Tboil | 414.45 ± 0.50 | K | NIST |
| Tboil | 412.65 ± 2.00 | K | NIST |
| Tboil | 414.45 ± 0.30 | K | NIST |
| Tboil | 414.60 ± 0.60 | K | NIST |
| Tboil | 413.85 ± 0.30 | K | NIST |
| Tboil | 414.65 ± 0.30 | K | NIST |
| Tboil | Outlier 404.15 ± 5.00 | K | NIST |
| Tboil | 414.15 ± 2.00 | K | NIST |
| Tboil | 414.40 ± 0.20 | K | NIST |
| Tboil | 413.95 ± 0.60 | K | NIST |
| Tboil | 414.50 ± 0.20 | K | NIST |
| Tboil | 413.25 ± 1.00 | K | NIST |
| Tboil | 413.10 ± 0.30 | K | NIST |
| Tboil | 413.85 ± 0.60 | K | NIST |
| Tboil | 413.65 ± 0.50 | K | NIST |
| Tboil | 413.85 ± 0.50 | K | NIST |
| Tboil | 413.65 ± 1.00 | K | NIST |
| Tboil | 412.75 ± 1.00 | K | NIST |
| Tboil | 414.15 ± 1.00 | K | NIST |
| Tboil | 414.20 ± 0.30 | K | NIST |
| Tboil | 412.15 ± 2.00 | K | NIST |
| Tboil | 413.45 ± 0.40 | K | NIST |
| Tboil | 413.15 ± 1.00 | K | NIST |
| Tboil | 413.45 ± 0.40 | K | NIST |
| Tboil | 412.55 ± 1.00 | K | NIST |
| Tboil | 415.55 ± 2.00 | K | NIST |
| Tboil | 414.45 ± 1.00 | K | NIST |
| Tboil | 413.85 ± 0.60 | K | NIST |
| Tboil | 414.05 ± 0.60 | K | NIST |
| Tboil | 414.95 ± 0.60 | K | NIST |
| Tboil | 414.00 ± 0.60 | K | NIST |
| Tboil | 413.86 ± 0.50 | K | NIST |
| Tboil | 413.86 ± 0.60 | K | NIST |
| Tc | [598.50; 613.10] | K |
|
| Tc | 604.00 | K | KDB |
| Tc | 598.50 ± 1.00 | K | NIST |
| Tc | 604.00 ± 0.50 | K | NIST |
| Tc | 611.49 ± 2.50 | K | NIST |
| Tc | 602.20 ± 2.00 | K | NIST |
| Tc | 613.10 ± 6.00 | K | NIST |
| Tc | 612.70 ± 6.00 | K | NIST |
| Tc | 599.95 ± 1.00 | K | NIST |
| Tc | 610.80 ± 6.00 | K | NIST |
| Tfus | [250.89; 252.54] | K |
|
| Tfus | 252.40 | K | KDB |
| Tfus | 252.54 | K | Solid l... |
| Tfus | 252.32 | K | The pha... |
| Tfus | 251.95 | K | Differe... |
| Tfus | 250.89 | K | Determi... |
| Ttriple | [252.65; 252.65] | K |
|
| Ttriple | 252.65 | K | KDB |
| Ttriple | 252.65 ± 0.06 | K | NIST |
| Vc | 0.222 | m3/kmol | KDB |
| Zc | 0.2002520 | KDB | |
| Zra | 0.25 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [110.78; 139.21] | J/mol×K | [414.09; 589.06] |
|
| Cp,gas | 110.78 | J/mol×K | 414.09 | Joback Calculated Property |
| Cp,gas | 116.00 | J/mol×K | 443.25 | Joback Calculated Property |
| Cp,gas | 121.03 | J/mol×K | 472.41 | Joback Calculated Property |
| Cp,gas | 125.86 | J/mol×K | 501.57 | Joback Calculated Property |
| Cp,gas | 130.50 | J/mol×K | 530.74 | Joback Calculated Property |
| Cp,gas | 134.95 | J/mol×K | 559.90 | Joback Calculated Property |
| Cp,gas | 139.21 | J/mol×K | 589.06 | Joback Calculated Property |
| Cp,liquid | [151.00; 159.40] | J/mol×K | [289.00; 333.15] |
|
| Cp,liquid | 159.40 | J/mol×K | 289.00 | NIST |
| Cp,liquid | 158.60 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 152.80 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 151.00 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 154.60 | J/mol×K | 333.15 | NIST |
| η | [0.0007062; 0.0009496] | Pa×s | [303.15; 323.15] |
|
| η | 0.0009496 | Pa×s | 303.15 | Densiti... |
| η | 0.0008476 | Pa×s | 313.15 | Densiti... |
| η | 0.0007062 | Pa×s | 323.15 | Densiti... |
| ΔfusH | [10.66; 10.66] | kJ/mol | [252.70; 252.70] |
|
| ΔfusH | 10.66 | kJ/mol | 252.70 | NIST |
| ΔfusH | 10.66 | kJ/mol | 252.70 | NIST |
| ΔsubH | [73.00; 74.00] | kJ/mol | [231.50; 233.00] |
|
| ΔsubH | 74.00 ± 1.00 | kJ/mol | 231.50 | NIST |
| ΔsubH | 73.00 ± 1.00 | kJ/mol | 233.00 | NIST |
| ΔvapH | [46.40; 60.60] | kJ/mol | [303.00; 462.50] |
|
| ΔvapH | 56.00 | kJ/mol | 303.00 | NIST |
| ΔvapH | 46.40 | kJ/mol | 373.00 | NIST |
| ΔvapH | 47.00 | kJ/mol | 381.00 | NIST |
| ΔvapH | 48.30 | kJ/mol | 382.50 | NIST |
| ΔvapH | 60.60 | kJ/mol | 462.50 | NIST |
| Pvap | [14.56; 112.70] | kPa | [361.52; 417.65] |
|
| Pvap | 14.56 | kPa | 361.52 | Subatmo... |
| Pvap | 19.58 | kPa | 368.37 | Subatmo... |
| Pvap | 23.38 | kPa | 373.10 | Vapor-L... |
| Pvap | 29.65 | kPa | 378.95 | Subatmo... |
| Pvap | 30.80 | kPa | 379.65 | Isobari... |
| Pvap | 34.50 | kPa | 382.45 | Isobari... |
| Pvap | 38.30 | kPa | 385.60 | Isobari... |
| Pvap | 39.73 | kPa | 386.74 | Subatmo... |
| Pvap | 43.50 | kPa | 389.10 | Isobari... |
| Pvap | 51.40 | kPa | 391.90 | Isobari... |
| Pvap | 49.79 | kPa | 392.93 | Subatmo... |
| Pvap | 61.80 | kPa | 393.75 | Isobari... |
| Pvap | 59.86 | kPa | 398.09 | Subatmo... |
| Pvap | 72.90 | kPa | 399.05 | Isobari... |
| Pvap | 69.92 | kPa | 402.65 | Subatmo... |
| Pvap | 71.20 | kPa | 403.95 | Isobari... |
| Pvap | 79.99 | kPa | 406.80 | Subatmo... |
| Pvap | 82.50 | kPa | 407.75 | Isobari... |
| Pvap | 90.07 | kPa | 410.33 | Subatmo... |
| Pvap | 93.50 | kPa | 411.65 | Isobari... |
| Pvap | 95.10 | kPa | 411.97 | Subatmo... |
| Pvap | 96.29 | kPa | 413.15 | Vapor-L... |
| Pvap | 101.30 | kPa | 413.58 | Multiph... |
| Pvap | 101.21 | kPa | 413.74 | Subatmo... |
| Pvap | 101.30 | kPa | 414.32 | Isobari... |
| Pvap | 105.30 | kPa | 415.45 | Isobari... |
| Pvap | 112.70 | kPa | 417.65 | Isobari... |
| n0 | [1.38080; 1.38610] | [293.00; 303.15] |
|
|
| n0 | 1.38110 | 293.00 | Quatern... | |
| n0 | 1.38090 | 293.15 | Isother... | |
| n0 | 1.38110 | 293.15 | Liquid ... | |
| n0 | 1.38110 | 293.15 | (Liquid... | |
| n0 | 1.38080 | 293.15 | Liquid ... | |
| n0 | 1.38120 | 293.15 | Vapour-... | |
| n0 | 1.38080 | 293.15 | (Liquid... | |
| n0 | 1.38100 | 293.15 | Vapour ... | |
| n0 | 1.38350 | 293.15 | Volumet... | |
| n0 | 1.38484 | 298.15 | Refract... | |
| n0 | 1.38610 | 298.15 | Isobari... | |
| n0 | 1.38580 | 298.15 | Isobari... | |
| n0 | 1.38200 | 298.20 | Ternary... | |
| n0 | 1.38290 | 303.15 | Liquid ... | |
| n0 | 1.38290 | 303.15 | Phase e... | |
| ρl | [960.84; 1004.11] | kg/m3 | [283.15; 323.15] |
|
| ρl | 1004.11 | kg/m3 | 283.15 | Experim... |
| ρl | 998.69 | kg/m3 | 288.15 | Experim... |
| ρl | 993.00 | kg/m3 | 293.00 | KDB |
| ρl | 993.26 | kg/m3 | 293.15 | Experim... |
| ρl | 993.88 | kg/m3 | 293.15 | Density... |
| ρl | 993.80 | kg/m3 | 293.15 | Probe o... |
| ρl | 993.90 | kg/m3 | 293.15 | Effect ... |
| ρl | 988.00 | kg/m3 | 293.15 | Correla... |
| ρl | 987.85 | kg/m3 | 298.15 | Experim... |
| ρl | 988.50 | kg/m3 | 298.15 | Effect ... |
| ρl | 988.48 | kg/m3 | 298.15 | Density... |
| ρl | 993.72 | kg/m3 | 298.15 | Phase E... |
| ρl | 987.90 | kg/m3 | 298.15 | Speed o... |
| ρl | 998.04 | kg/m3 | 298.15 | Liquid ... |
| ρl | 988.40 | kg/m3 | 298.15 | Probe o... |
| ρl | 988.10 | kg/m3 | 298.20 | Phase e... |
| ρl | 988.04 | kg/m3 | 298.20 | (Liquid... |
| ρl | 982.44 | kg/m3 | 303.14 | Experim... |
| ρl | 983.07 | kg/m3 | 303.15 | Density... |
| ρl | 983.00 | kg/m3 | 303.15 | Probe o... |
| ρl | 983.10 | kg/m3 | 303.15 | Effect ... |
| ρl | 977.04 | kg/m3 | 308.15 | Experim... |
| ρl | 977.70 | kg/m3 | 308.15 | Effect ... |
| ρl | 977.67 | kg/m3 | 308.15 | Density... |
| ρl | 977.60 | kg/m3 | 308.15 | Probe o... |
| ρl | 971.63 | kg/m3 | 313.14 | Experim... |
| ρl | 972.20 | kg/m3 | 313.15 | Probe o... |
| ρl | 972.30 | kg/m3 | 313.15 | Effect ... |
| ρl | 972.27 | kg/m3 | 313.15 | Density... |
| ρl | 966.24 | kg/m3 | 318.14 | Experim... |
| ρl | 960.84 | kg/m3 | 323.15 | Experim... |
| γ | [0.03; 0.03] | N/m | [293.15; 308.15] |
|
| γ | 0.03 | N/m | 293.15 | Apparen... |
| γ | 0.03 | N/m | 298.15 | Apparen... |
| γ | 0.03 | N/m | 303.15 | Apparen... |
| γ | 0.03 | N/m | 308.15 | Apparen... |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboil | [368.83; 437.16] | K | [20.00; 200.00] |
|
| Tboil | 368.83 | K | 20.00 | Vapor-l... |
| Tboil | 378.94 | K | 30.00 | Vapor-l... |
| Tboil | 386.59 | K | 40.00 | Vapor-l... |
| Tboil | 392.77 | K | 50.00 | Vapor-l... |
| Tboil | 397.99 | K | 60.00 | Vapor-l... |
| Tboil | 402.56 | K | 70.00 | Vapor-l... |
| Tboil | 406.60 | K | 80.00 | Vapor-l... |
| Tboil | 410.26 | K | 90.00 | Vapor-l... |
| Tboil | 416.68 | K | 110.00 | Vapor-l... |
| Tboil | 419.53 | K | 120.00 | Vapor-l... |
| Tboil | 422.18 | K | 130.00 | Vapor-l... |
| Tboil | 424.67 | K | 140.00 | Vapor-l... |
| Tboil | 427.01 | K | 150.00 | Vapor-l... |
| Tboil | 429.23 | K | 160.00 | Vapor-l... |
| Tboil | 431.36 | K | 170.00 | Vapor-l... |
| Tboil | 433.37 | K | 180.00 | Vapor-l... |
| Tboil | 435.31 | K | 190.00 | Vapor-l... |
| Tboil | 437.16 | K | 200.00 | Vapor-l... |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 4415.16] | kPa | [312.57; 600.81] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.56739e+01 | |||
| Coefficient B | -3.98399e+03 | |||
| Coefficient C | -5.36380e+01 | |||
| Temperature range, min. | 312.57 | |||
| Temperature range, max. | 600.81 | |||
| Pvap | 1.33 | kPa | 312.57 | Calculated Property |
| Pvap | 7.25 | kPa | 344.60 | Calculated Property |
| Pvap | 28.19 | kPa | 376.62 | Calculated Property |
| Pvap | 85.77 | kPa | 408.65 | Calculated Property |
| Pvap | 217.09 | kPa | 440.68 | Calculated Property |
| Pvap | 476.76 | kPa | 472.70 | Calculated Property |
| Pvap | 936.34 | kPa | 504.73 | Calculated Property |
| Pvap | 1681.52 | kPa | 536.76 | Calculated Property |
| Pvap | 2807.74 | kPa | 568.78 | Calculated Property |
| Pvap | 4415.16 | kPa | 600.81 | Calculated Property |
| Pvap | [0.01; 4514.74] | kPa | [252.45; 604.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 7.77767e+01 | |||
| Coefficient B | -8.37511e+03 | |||
| Coefficient C | -8.90331e+00 | |||
| Coefficient D | 4.15966e-06 | |||
| Temperature range, min. | 252.45 | |||
| Temperature range, max. | 604.00 | |||
| Pvap | 0.01 | kPa | 252.45 | Calculated Property |
| Pvap | 0.32 | kPa | 291.51 | Calculated Property |
| Pvap | 3.49 | kPa | 330.57 | Calculated Property |
| Pvap | 21.04 | kPa | 369.63 | Calculated Property |
| Pvap | 85.10 | kPa | 408.69 | Calculated Property |
| Pvap | 259.30 | kPa | 447.76 | Calculated Property |
| Pvap | 642.88 | kPa | 486.82 | Calculated Property |
| Pvap | 1368.14 | kPa | 525.88 | Calculated Property |
| Pvap | 2595.90 | kPa | 564.94 | Calculated Property |
| Pvap | 4514.74 | kPa | 604.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Propanoic acid.
Mixtures
- Pentanoic acid + Propanoic acid
- Benzene, (1-methylethyl)- + Propanoic acid + Water
- 2-Hexanone, 5-methyl- + Propanoic acid + Water
- 4-Heptanone, 2,6-dimethyl- + Propanoic acid + Water
- 3-Heptanone, 6-methyl- + Propanoic acid + Water
- 9-Octadecen-1-ol, (Z)- + Propanoic acid + Water
- Acetic acid + Propanoic acid + Formamide
- 2-Butenedioic acid (Z)-, dimethyl ester + Propanoic acid + Water
- Acetic acid, methyl ester + Propanoic acid
- Methyl propionate + Propanoic acid
- Propanoic acid, 1-methylethyl ester + Propanoic acid
- 1-Undecanol + Propanoic acid + Water
- 1-Butanol, 3-methyl-, propanoate + Propanoic acid
- Hexanoic acid + Propanoic acid
- Acetonitrile + Dodecane + Propanoic acid
- Propane, 2-methoxy-2-methyl- + Propanoic acid + Water
- Pentane + Propanoic acid + Thiophene, tetrahydro-, 1,1-dioxide
- Acetone + Propanoic acid
- Dimethyl phthalate + Propanoic acid + Water
- Diethyl Phthalate + Propanoic acid + Water
Find more mixtures with Propanoic acid.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Crippen Method
- Vapor liquid equilibrium in systems (water + organic solvent + salt) at low water concentrations but high ratios of salt to water: experimental results and modeling
- Liquid-liquid equilibria for ternary systems of (water + carboxylic acid + 1-octanol) at 293.15 K: modeling phase equilibria using a solvatochromic approach
- Vapour liquid equilibrium of carboxylic acid systems: Propionic acid + valeric acid and isobutyric acid + valeric acid
- Liquid liquid equilibria of ternary systems (water + carboxylic acid + cumene) at 298.15K
- (Liquid + liquid) equilibria of (water + propionic acid + methyl isoamyl ketone or diisobutyl ketone or ethyl isoamyl keton) at T = 298.2 K
- Liquid phase equilibria of (water + propionic acid + oleyl alcohol) ternary system at several temperatures
- Solid liquid equilibrium in the ternary system acetic acid propanoic acid formamide
- Ternary liquid liquid equilibria for mixtures of an ionic liquid + n-hexane + an organic compound involved in the kinetic resolution of rac-1-phenyl ethanol (rac-1-phenyl ethanol, vinyl propionate, rac-1-phenylethyl propionate or propionic acid) at 298.2K and atmospheric pressure
- Determination and correlation of liquid liquid equilibria for the (water + carboxylic acid + dimethyl maleate) ternary systems at T = 298.2K
- Multiphase equilibria for mixtures containing water, acetic acid, propionic acid, methyl acetate and methyl propionate
- Separation of propionic acid by diethyl carbonate or diethyl malonate or diethyl fumarate and the synergistic effect of phosphorus compounds and amines
- The phase envelopes of alternative solvents (ionic liquid, CO2) and building blocks of biomass origin (lactic acid, propionic acid)
- Phase equilibria of (water + carboxylic acid + diethyl maleate) ternary liquid systems at 298.15 K
- Multiphase equilibria for mixtures containing water, isopropanol, propionic acid, and isopropyl propionate
- Quaternary phase equilibrium of water-carboxylic acid mixture (formic-propionic acid or acetic-propionic acid)-solvent liquid systems at 298.15 K
- Experiment and correlation of osmotic coefficient for aqueous solution of carboxylic acids using NRTL nonrandom factor model
- Ternary liquid-liquid phase equilibria of (water-carboxylic acid-1-undecanol) systems at 298.15 K
- Solubilities of D-xylose in water + (acetic acid or propionic acid ) mixtures at atmospheric pressure and different temperatures
- Vapor-liquid equilibrium of isoamyl alcohol + isoamyl propionate andpropionic acid + isoamyl propionate systems at 50.00, 101.33 and 150.00 kPa
- (Liquid + liquid) equilibria of the (water + carboxylic acid + dibasic esters mixture (DBE-2)) ternary systems
- Vapour-liquid equilibrium of propionic acid + caproic acid, isobutyric acid + caproic acid, valeric acid + caproic acid and caproic acid + enanthoic acid binary mixtures
- Liquid liquid equilibria measurements of ternary systems (acetonitrile + a carboxylic acid + dodecane) at 303.15 K
- Vapour-liquid equilibrium of propanoic acid + water at 423.2, 453.2 and 483.2 K from 1.87 to 19.38 bar. Experimental and modelling with PR, CPA, PC-SAFT and PCP-SAFT
- Solubilities and thermodynamics of TPP in propionic acid + water and TPPMnCl in N,Ndimethylformamide + water solvent mixtures at (303.2 to 343.2) K
- Measurement and correlation of solubility of D-camphor-10-sulfonic acid in pure solvents
- Phase equilibria of (water + propionic acid or butyric acid + 2-methoxy- 2-methylpropane) ternary systems at 298.2 K and 323.2 K
- Phase equilibria measurements of ternary mixtures (sulfolane + a carboxylic acid + pentane) at 303.15 K
- Liquid-liquid equilibrium for the quaternary system propionic acid + n-propanol + n-propyl propionate + water at 293.15, 313.15 and 333.15 K
- Isothermal vapour-liquid equilibrium data for the binary systems 2-propanone + (2-butanol or propanoic acid)
- Understanding ion-ion and ion-solvent interactions in aqueous solutions of NMP based protic ionic liquids through partial molar properties and DFT calculations
- Liquid-liquid equilibrium and critical states for the quaternary system propionic acid-n-butanol-n-butyl propionate-water at 303.15 K
- Solubility determination and correlation of cyromazine in sixteen pure solvents and mixing properties of solutions
- Differential scanning calorimetry determination of Solid-Liquid equilibria phase diagrams for binary monocarboxylic acids solutions
- Salting-out effect of NaCl and KCl on the ternary LLE data for the systems of (water + propionic acid + isopropyl methyl ketone) and of (water + propionic acid + isobutyl methyl ketone)
- (Liquid + liquid) equilibria of (water + propionic acid + dimethyl phthalate) at several temperatures
- (Liquid + liquid) equilibria of (water + propionic acid + diethyl phthalate) at several temperatures
- (Liquid + liquid) equilibria of (water + propionic acid + cyclohexanone) at several temperatures
- (Liquid + liquid) equilibria of (water + propionic acid + alcohol) ternary systems
- (Liquid + liquid) equilibria of (water + propionic acid + dipropyl ether or diisopropyl ether) at T = 298.2 K
- (Liquid + liquid) equilibria of (water + propionic acid + dibasic esters) ternary systems
- (Liquid + liquid) equilibria of (water + propionic acid + diethyl succinate or diethyl glutarate or diethyl adipate) ternary systems
- (Liquid + liquid) equilibria of (water + propionic acid + 2-ethyl-1-hexanol): Experimental data and correlation
- Binodal curve measurements for (water + propionic acid + dichloromethane) ternary system by cloud point method
- (Liquid + liquid) equilibria for ternary mixtures of (water + propionic acid + organic solvent) at T = 303.2 K
- Isobaric (vapour + liquid) equilibria for the (1-pentanol + propionic acid) binary mixture at (53.3 and 91.3) kPa
- Density, speed of sound, and refractive index measurements for the binary systems (butanoic acid + propanoic acid, or 2-methyl-propanoic acid) at T = (293.15 to 313.15) K
- Solubilities of {a-D-glucose in water + (acetic acid or propionic acid)} mixtures at atmospheric pressure and different temperatures
- Effect of temperature on density, sound velocity, refractive index and their derived properties for the binary systems (heptanoic acid + propanoic or butanoic acids)
- Influence of the alkyl group on thermophysical properties of carboxylic acids in 1-butyl-3-methylimidazolium thiocyanate ionic liquid at various temperatures
- (Liquid + liquid) equilibria measurements for ternary systems (sulfolane + a carboxylic acid + n-heptane) at T = 303.15 K and at 0.1 MPa
- Influence of alkyl group on interactions between carboxylic acid and acetonitrile at different temperatures
- Cibulka correlation for ternary excess/deviation properties of {[C2mim] [EtSO4] (x1) + acetic or propionic acid (x2) + acetonitrile (x3)} systems at different temperatures
- Speed of sound as a function of temperature and pressure for propane derivatives
- Liquid phase equilibrium of the ternary systems, water + propionic or butyric acid + mesityl oxide, at (298.2 and 323.2) K
- Isobaric vapour-liquid equilibrium for binary systems of ethyl iodide with ethanol, propionic acid and ethyl propionate at 101.3 kPa
- Solubility and critical surface in the system propionic acid-ethanol-ethyl propionate-water at 293.15, 303.15 and 313.15 K
- Solubility of succinic acid, glutaric acid and adipic acid in propionic acid + epsilon-caprolactone + water mixtures: Experimental measurement and thermodynamic modeling
- Thermodynamic properties of ternary mixture {[C4mim][SCN] + acetic or propionic acid + acetonitrile} over the temperature range of (293.15-313.15) K
- Effect of temperature on the dilution enthalpies of carboxylic acids in aqueous solutions
- Binodal Curves and Tie Line Data of the Water - Propionic Acid - Isobutyl Acetate at T = (298.2, 308.2, 318.2, and 328.2) K
- Differential scanning calorimetry determination of phase diagrams and water activities of aqueous carboxylic acid solutions
- Liquid Phase Equilibria of the Water + Propionic or Butyric Acid + Methyl tert-Butyl Ketone Ternary Systems at (298.15 and 323.15) K
- Determination of the solid liquid phase diagram of the binary system propionic acid / water
- Liquid Phase Equilibria of Aqueous Mixtures of Carboxylic Acids (C1-C4) with Ethylbenzene: Thermodynamic and Mathematical Modeling
- Correlation of Experimental Liquid Liquid Equilibrium Data for Ternary Systems Using NRTL and GMDH-Type Neural Network
- Study on the Solubilities of Mononitro-Substituted Products of Nitration of m-Toluic Acid in Several Solvents at Temperatures between 297.65 and 351.75 K
- Measurement and Correlation of the Solubility of Florfenicol Form A in Several Pure and Binary Solvents
- Probe of Interactions of Acetic and Propionic Acids with 2',3'-N-Epoxypropyl-N-methyl-2-oxopyrrolidinium Salicylate Ionic Liquid
- Experimental Densities and Excess Volumes for Binary Mixtures Containing Propionic Acid, Acetone and Water from 283.15 K to 323.15 K at Atmospheric Pressure
- Subatmospheric Vapor Pressure Curves for Propionic Acid, Butyric Acid, Isobutyric Acid, Valeric Acid, Isovaleric Acid, Hexanoic Acid, and Heptanoic Acid
- Densities and Excess Molar Volumes for Acetone + Propionic Acid + Water from (283.15 to 323.15) K at Atmospheric Pressure
- Liquid-Liquid Equilibrium for the Quaternary System Toluene + Water + Propionic Acid + Ethyl Acetate at 25 deg C and Atmospheric Pressure
- Quaternary Liquid-Liquid Equilibrium of Water + Acetic Acid + Propionic Acid + Solvent (Amyl Alcohol, Cyclohexyl Acetate, or Toluene) Systems
- Vapor-Liquid Equilibria on Four Binary Systems: 2-Phenylpropionaldehyde + Phenol, Propylene Glycol Monomethyl Ether + Nitroethane, Dimethyl Ether + Propylene, and N-Butyric Acid + Propionic Acid
- Measurements of Quaternary Liquid-Liquid Equilibrium for Water + Acetic Acid + Propionic Acid + Solvent (Butyronitrile, Benzyl Acetate, or Methyl Isobutyl Ketone) at 298.15 K
- Refractive Index, Surface Tension, and Density of Aqueous Mixtures of Carboxylic Acids at 298.15 K
- Viscosities and Interfacial Properties of I-Methyl-3-butylimidazolium Hexafluorophosphate and 1-Isobutenyl-3-methylimidazolium Tetrafluoroborate Ionic Liquids
- Isobaric Vapor-Liquid Equilibria for Binary and Ternary Mixtures of Methanol, Ethanoic Acid, and Propanoic Acid
- Apparent Molar Volume and Surface Tension of Dilute Aqueous Solutions of Carboxylic Acids
- Isobaric Vapor-Liquid Equilibria for Binary and Ternary Mixtures of Propanal, Propanol, and Propanoic Acid
- Phase Equilibria for Reactive Distillation of Propyl Propanoate. Pure Component Property Data, Vapor-Liquid Equilibria, and Liquid-Liquid Equilibria
- Densities and Viscosities of Binary Mixtures of Propanoic Acid with N,N-Dimethylaniline and N,N-Diethylaniline at T = (303.15, 313.15, and 323.15) K
- Volumetric Properties of Highly Nonideal Binary Mixtures Containing Ethanoic Acid and Propanoic Acid with Butan-2-ol, Methyl-2-propanol, and 2-Methyl-2-butanol at Different Temperatures
- Experiments and Correlations of the Vapor Liquid Equilibria for Carbon Monoxide + Propionic Acid and Carbon Monoxide + Methyl Formate Systems
- Solubilities of 5,10,15,20-Tetrakis(pchlorophenyl) porphyrin in Binary Propionic Acid + Water Solvent Mixtures at (293.2 to 353.2) K
- Measurement and Correlation for Solubility of 2-Bromopropane and Thiourea in Water
- Joback Method
- KDB
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.