- InChI
- InChI=1S/C6H4O4S/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2H,(H,7,8)(H,9,10)
- InChI Key
- YCGAZNXXGKTASZ-UHFFFAOYSA-N
- Formula
- C6H4O4S
- SMILES
- O=C(O)c1ccc(C(=O)O)s1
- Molecular Weight1
- 172.16
- CAS
- 4282-31-9
- Other Names
-
- 2,5-Dicarboxythiophene
- thiophene-2,5-dicarboxylic acid
- Cp,solid : Solid phase heat capacity (J/mol×K).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| log10WS | -1.35 | Crippen Calculated Property | |
| logPoct/wat | 1.145 | Crippen Calculated Property | |
| McVol | 107.170 | ml/mol | McGowan Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,solid | [161.40; 229.80] | J/mol×K | [277.15; 445.15] | 
|
|
T(K) Solid phase heat capacity (J/mol×K) 160 170 180 190 200 210 220 230 300 350 400 | ||||
| Cp,solid | 161.40 | J/mol×K | 277.15 | Thermop... |
| Cp,solid | 162.70 | J/mol×K | 280.15 | Thermop... |
| Cp,solid | 163.70 | J/mol×K | 285.15 | Thermop... |
| Cp,solid | 164.70 | J/mol×K | 290.15 | Thermop... |
| Cp,solid | 166.40 | J/mol×K | 295.15 | Thermop... |
| Cp,solid | 167.10 | J/mol×K | 298.15 | Thermop... |
| Cp,solid | 167.70 | J/mol×K | 300.15 | Thermop... |
| Cp,solid | 169.50 | J/mol×K | 305.15 | Thermop... |
| Cp,solid | 171.00 | J/mol×K | 310.15 | Thermop... |
| Cp,solid | 173.10 | J/mol×K | 315.15 | Thermop... |
| Cp,solid | 175.10 | J/mol×K | 320.15 | Thermop... |
| Cp,solid | 177.00 | J/mol×K | 325.15 | Thermop... |
| Cp,solid | 178.10 | J/mol×K | 330.15 | Thermop... |
| Cp,solid | 179.70 | J/mol×K | 335.15 | Thermop... |
| Cp,solid | 180.80 | J/mol×K | 340.15 | Thermop... |
| Cp,solid | 182.30 | J/mol×K | 345.15 | Thermop... |
| Cp,solid | 184.00 | J/mol×K | 350.15 | Thermop... |
| Cp,solid | 186.10 | J/mol×K | 355.15 | Thermop... |
| Cp,solid | 186.40 | J/mol×K | 360.15 | Thermop... |
| Cp,solid | 190.10 | J/mol×K | 365.15 | Thermop... |
| Cp,solid | 192.40 | J/mol×K | 370.15 | Thermop... |
| Cp,solid | 194.20 | J/mol×K | 375.15 | Thermop... |
| Cp,solid | 196.70 | J/mol×K | 380.15 | Thermop... |
| Cp,solid | 198.70 | J/mol×K | 385.15 | Thermop... |
| Cp,solid | 200.90 | J/mol×K | 390.15 | Thermop... |
| Cp,solid | 203.30 | J/mol×K | 395.15 | Thermop... |
| Cp,solid | 206.10 | J/mol×K | 400.15 | Thermop... |
| Cp,solid | 209.60 | J/mol×K | 405.15 | Thermop... |
| Cp,solid | 210.90 | J/mol×K | 410.15 | Thermop... |
| Cp,solid | 213.70 | J/mol×K | 415.15 | Thermop... |
| Cp,solid | 216.30 | J/mol×K | 420.15 | Thermop... |
| Cp,solid | 219.40 | J/mol×K | 425.15 | Thermop... |
| Cp,solid | 223.10 | J/mol×K | 430.15 | Thermop... |
| Cp,solid | 225.50 | J/mol×K | 435.15 | Thermop... |
| Cp,solid | 228.10 | J/mol×K | 440.15 | Thermop... |
| Cp,solid | 229.80 | J/mol×K | 445.15 | Thermop... |
Similar Compounds
Find more compounds similar to 2,5-Thiophenedicarboxylic acid.
Mixtures
- Methyl Alcohol + 2,5-Thiophenedicarboxylic acid
- Ethanol + 2,5-Thiophenedicarboxylic acid
- Isopropyl Alcohol + 2,5-Thiophenedicarboxylic acid
- 1-Butanol + 2,5-Thiophenedicarboxylic acid
- Acetic acid + 2,5-Thiophenedicarboxylic acid
- n-Hexane + 2,5-Thiophenedicarboxylic acid
- Acetonitrile + 2,5-Thiophenedicarboxylic acid
- Acetone + 2,5-Thiophenedicarboxylic acid
- Ethanol + Acetic acid + 2,5-Thiophenedicarboxylic acid
- Ethanol + Water + 2,5-Thiophenedicarboxylic acid
- Water + 2,5-Thiophenedicarboxylic acid
Sources
- Crippen Method
- Crippen Method
- Solid-liquid equilibrium and thermodynamic of 2,5-thiophenedicarboxylic acid in different organic solvents
- Thermodynamic models for determination of the solid-liquid equilibrium of 2,5-thiophenedicarboxylic acid in (acetic acid + ethanol) binary solvent mixtures
- Thermophysical properties of sulfur heterocycles: Thiane and thiophene derivatives
- Solubility and solution thermodynamics of 2,5-thiophenedicarboxylic acid in (water + ethanol) binary solvent mixtures
- McGowan Method
- NIST Webbook
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.