- InChI
- InChI=1S/C9H12/c1-7-4-8(2)6-9(3)5-7/h4-6H,1-3H3
- InChI Key
- AUHZEENZYGFFBQ-UHFFFAOYSA-N
- Formula
- C9H12
- SMILES
- Cc1cc(C)cc(C)c1
- Molecular Weight1
- 120.19
- CAS
- 108-67-8
- Other Names
-
- 1,3,5-Trimethylbenzene
- 1,3,5-trimethylbenzene (mesitylene)
- 2,4,6-Trimethylbenzene
- 3,5-Dimethyltoluene
- Benzene, 1,3,5-trimethyl-
- FLEET-X
- NSC 9273
- S-TRIMETHYLBENEZENE
- TMB
- UN 2325
- s-Trimethylbenzene
- sym-Trimethylbenzene
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Δc,grossH : Heat of Combustion, Gross form (kJ/mol).
- Δc,netH : Heat of Combustion, Net Form (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- S°gas : Molar entropy at standard conditions (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- csound,fluid : Speed of sound in fluid (m/s).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.3990 | KDB | |
| PAff | [835.10; 836.20] | kJ/mol |
|
| PAff | 836.20 | kJ/mol | NIST |
| PAff | 835.10 | kJ/mol | NIST |
| BasG | [808.60; 808.80] | kJ/mol |
|
| BasG | 808.60 | kJ/mol | NIST |
| BasG | 808.80 | kJ/mol | NIST |
| ΔcH°liquid | [-5202.70; -5193.10] | kJ/mol |
|
| ΔcH°liquid | -5193.10 ± 1.30 | kJ/mol | NIST |
| ΔcH°liquid | -5202.70 | kJ/mol | NIST |
| Cp,liquid | 207.43 | J/mol×K | Thermod... |
| μ | 0.10 | debye | KDB |
| ΔfG° | 118.00 | kJ/mol | KDB |
| Δc,grossH | 5193.14 | kJ/mol | KDB |
| Δc,netH | 4929.045 | kJ/mol | KDB |
| ΔfH°gas | -16.08 | kJ/mol | KDB |
| ΔfusH° | 12.33 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 39.23 | kJ/mol | Joback Calculated Property |
| IE | [8.20; 8.65] | eV |
|
| IE | 8.40 ± 0.01 | eV | NIST |
| IE | 8.41 ± 0.01 | eV | NIST |
| IE | 8.46 | eV | NIST |
| IE | Outlier 8.20 ± 0.10 | eV | NIST |
| IE | 8.47 | eV | NIST |
| IE | 8.40 ± 0.01 | eV | NIST |
| IE | 8.55 | eV | NIST |
| IE | 8.39 ± 0.01 | eV | NIST |
| IE | 8.41 ± 0.02 | eV | NIST |
| IE | 8.42 | eV | NIST |
| IE | 8.42 | eV | NIST |
| IE | 8.45 | eV | NIST |
| IE | 8.45 ± 0.05 | eV | NIST |
| IE | 8.45 ± 0.05 | eV | NIST |
| IE | Outlier 8.65 ± 0.03 | eV | NIST |
| log10WS | [-3.40; -3.40] |
|
|
| log10WS | -3.40 | Aq. Sol... | |
| log10WS | -3.40 | Estimat... | |
| logPoct/wat | 2.612 | Crippen Calculated Property | |
| McVol | 113.910 | ml/mol | McGowan Calculated Property |
| Pc | [3127.00; 3260.00] | kPa |
|
| Pc | 3127.00 | kPa | KDB |
| Pc | 3130.00 ± 40.00 | kPa | NIST |
| Pc | 3161.90 ± 0.31 | kPa | NIST |
| Pc | 3255.00 ± 0.32 | kPa | NIST |
| Pc | 3127.00 ± 6.00 | kPa | NIST |
| Pc | 3260.00 ± 9.81 | kPa | NIST |
| Inp | [152.10; 1013.00] |
|
|
| Inp | 979.50 | NIST | |
| Inp | 984.80 | NIST | |
| Inp | 947.50 | NIST | |
| Inp | 952.20 | NIST | |
| Inp | 953.33 | NIST | |
| Inp | 963.80 | NIST | |
| Inp | 972.10 | NIST | |
| Inp | 976.10 | NIST | |
| Inp | 981.30 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 952.00 | NIST | |
| Inp | 952.00 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 962.40 | NIST | |
| Inp | 967.30 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 975.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 966.00 | NIST | |
| Inp | 952.70 | NIST | |
| Inp | 953.10 | NIST | |
| Inp | 956.20 | NIST | |
| Inp | 972.00 | NIST | |
| Inp | 960.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 974.00 | NIST | |
| Inp | 965.00 | NIST | |
| Inp | 967.10 | NIST | |
| Inp | 963.30 | NIST | |
| Inp | 967.90 | NIST | |
| Inp | 973.50 | NIST | |
| Inp | 957.00 | NIST | |
| Inp | 972.00 | NIST | |
| Inp | 964.70 | NIST | |
| Inp | 965.00 | NIST | |
| Inp | 965.40 | NIST | |
| Inp | 964.60 | NIST | |
| Inp | 965.00 | NIST | |
| Inp | 965.00 | NIST | |
| Inp | 967.10 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 965.50 | NIST | |
| Inp | 965.50 | NIST | |
| Inp | 962.70 | NIST | |
| Inp | 988.00 | NIST | |
| Inp | 1000.00 | NIST | |
| Inp | 990.00 | NIST | |
| Inp | 1000.00 | NIST | |
| Inp | 1000.00 | NIST | |
| Inp | 986.00 | NIST | |
| Inp | 967.00 | NIST | |
| Inp | 952.10 | NIST | |
| Inp | 967.60 | NIST | |
| Inp | 971.00 | NIST | |
| Inp | 964.00 | NIST | |
| Inp | 971.20 | NIST | |
| Inp | 965.30 | NIST | |
| Inp | 1001.00 | NIST | |
| Inp | 1001.00 | NIST | |
| Inp | 1007.00 | NIST | |
| Inp | 1013.00 | NIST | |
| Inp | 998.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 974.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 1002.00 | NIST | |
| Inp | 996.40 | NIST | |
| Inp | 955.00 | NIST | |
| Inp | 970.10 | NIST | |
| Inp | 998.00 | NIST | |
| Inp | 981.00 | NIST | |
| Inp | 953.00 | NIST | |
| Inp | 959.00 | NIST | |
| Inp | 960.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 961.80 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 970.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 1002.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 1006.00 | NIST | |
| Inp | 975.00 | NIST | |
| Inp | 959.90 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 961.50 | NIST | |
| Inp | 964.90 | NIST | |
| Inp | 967.10 | NIST | |
| Inp | 948.90 | NIST | |
| Inp | 974.20 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 954.50 | NIST | |
| Inp | 958.00 | NIST | |
| Inp | 984.30 | NIST | |
| Inp | 958.00 | NIST | |
| Inp | 964.10 | NIST | |
| Inp | 955.50 | NIST | |
| Inp | 961.50 | NIST | |
| Inp | 964.90 | NIST | |
| Inp | 967.10 | NIST | |
| Inp | 954.28 | NIST | |
| Inp | 954.69 | NIST | |
| Inp | 955.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 954.56 | NIST | |
| Inp | 956.80 | NIST | |
| Inp | 953.66 | NIST | |
| Inp | 953.27 | NIST | |
| Inp | 953.00 | NIST | |
| Inp | 953.37 | NIST | |
| Inp | 953.00 | NIST | |
| Inp | 997.20 | NIST | |
| Inp | 978.22 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 985.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 967.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 967.00 | NIST | |
| Inp | 967.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 967.00 | NIST | |
| Inp | 972.00 | NIST | |
| Inp | 958.00 | NIST | |
| Inp | 972.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 961.00 | NIST | |
| Inp | 965.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 972.00 | NIST | |
| Inp | 1001.00 | NIST | |
| Inp | 961.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 992.00 | NIST | |
| Inp | 989.00 | NIST | |
| Inp | 1001.00 | NIST | |
| Inp | 1001.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 979.00 | NIST | |
| Inp | 979.00 | NIST | |
| Inp | 960.00 | NIST | |
| Inp | 989.00 | NIST | |
| Inp | 974.00 | NIST | |
| Inp | 1003.00 | NIST | |
| Inp | 985.00 | NIST | |
| Inp | 988.00 | NIST | |
| Inp | 952.00 | NIST | |
| Inp | 971.00 | NIST | |
| Inp | 964.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 956.18 | NIST | |
| Inp | 958.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 957.00 | NIST | |
| Inp | 974.70 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 952.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 940.00 | NIST | |
| Inp | 960.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 999.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 995.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 994.00 | NIST | |
| Inp | 992.00 | NIST | |
| Inp | 996.00 | NIST | |
| Inp | 997.00 | NIST | |
| Inp | 964.00 | NIST | |
| Inp | 964.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 953.00 | NIST | |
| Inp | 1003.00 | NIST | |
| Inp | 962.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 963.00 | NIST | |
| Inp | 985.00 | NIST | |
| Inp | 956.00 | NIST | |
| Inp | 964.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 969.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 962.60 | NIST | |
| Inp | 968.90 | NIST | |
| Inp | 966.50 | NIST | |
| Inp | 967.40 | NIST | |
| Inp | 967.70 | NIST | |
| Inp | 976.00 | NIST | |
| Inp | 952.00 | NIST | |
| Inp | 953.00 | NIST | |
| Inp | 954.00 | NIST | |
| Inp | 960.00 | NIST | |
| Inp | 973.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | 973.00 | NIST | |
| Inp | 968.00 | NIST | |
| Inp | Outlier 173.80 | NIST | |
| Inp | Outlier 152.10 | NIST | |
| I | [1210.00; 1300.70] |
|
|
| I | 1275.10 | NIST | |
| I | 1287.30 | NIST | |
| I | Outlier 1300.70 | NIST | |
| I | 1217.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1242.20 | NIST | |
| I | 1236.90 | NIST | |
| I | 1220.30 | NIST | |
| I | 1251.00 | NIST | |
| I | 1297.00 | NIST | |
| I | 1210.00 | NIST | |
| I | 1263.00 | NIST | |
| I | 1271.00 | NIST | |
| I | 1279.00 | NIST | |
| I | 1255.00 | NIST | |
| I | 1237.00 | NIST | |
| I | 1254.00 | NIST | |
| I | 1268.30 | NIST | |
| I | 1237.00 | NIST | |
| I | 1252.00 | NIST | |
| I | 1248.00 | NIST | |
| I | 1283.00 | NIST | |
| I | 1250.00 | NIST | |
| I | 1241.00 | NIST | |
| I | 1246.00 | NIST | |
| I | 1249.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1221.00 | NIST | |
| I | 1251.00 | NIST | |
| I | 1253.00 | NIST | |
| I | 1248.00 | NIST | |
| I | 1249.00 | NIST | |
| I | 1254.00 | NIST | |
| I | 1257.00 | NIST | |
| I | 1270.00 | NIST | |
| I | 1281.00 | NIST | |
| I | 1297.00 | NIST | |
| I | 1233.00 | NIST | |
| I | 1245.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1246.00 | NIST | |
| I | 1287.00 | NIST | |
| I | 1290.00 | NIST | |
| I | 1288.00 | NIST | |
| I | 1242.00 | NIST | |
| I | 1291.00 | NIST | |
| I | 1251.00 | NIST | |
| I | 1254.00 | NIST | |
| I | 1240.00 | NIST | |
| I | 1251.00 | NIST | |
| I | 1229.00 | NIST | |
| I | 1242.00 | NIST | |
| I | 1220.00 | NIST | |
| I | 1271.00 | NIST | |
| I | 1242.00 | NIST | |
| I | 1271.00 | NIST | |
| I | 1228.00 | NIST | |
| S°gas | 385.30 ± 0.63 | J/mol×K | NIST |
| S°liquid | 273.55 | J/mol×K | NIST |
| Tboil | [437.83; 437.89] | K |
|
| Tboil | 437.89 | K | KDB |
| Tboil | 437.83 | K | Phase e... |
| Tc | 637.30 | K | KDB |
| Tfus | [228.23; 228.40] | K |
|
| Tfus | 228.40 | K | KDB |
| Tfus | 228.23 | K | Aq. Sol... |
| Ttriple | 228.42 ± 0.01 | K | NIST |
| Vc | 0.431 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [216.81; 285.90] | J/mol×K | [441.96; 651.95] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 220 240 260 280 500 600 | ||||
| Cp,gas | 216.81 | J/mol×K | 441.96 | Joback Calculated Property |
| Cp,gas | 229.86 | J/mol×K | 476.96 | Joback Calculated Property |
| Cp,gas | 242.27 | J/mol×K | 511.96 | Joback Calculated Property |
| Cp,gas | 254.06 | J/mol×K | 546.96 | Joback Calculated Property |
| Cp,gas | 265.25 | J/mol×K | 581.96 | Joback Calculated Property |
| Cp,gas | 275.86 | J/mol×K | 616.95 | Joback Calculated Property |
| Cp,gas | 285.90 | J/mol×K | 651.95 | Joback Calculated Property |
| Cp,liquid | [201.46; 213.00] | J/mol×K | [294.99; 299.80] |
|
|
T(K) Liquid phase heat capacity (J/mol×K) 202 204 206 208 210 212 214 296 298 | ||||
| Cp,liquid | 205.50 | J/mol×K | 294.99 | NIST |
| Cp,liquid | 211.30 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 206.50 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 213.00 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 207.85 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 207.69 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 209.33 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 207.66 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 201.46 | J/mol×K | 299.80 | NIST |
| η | [0.0003400; 0.0008500] | Pa×s | [278.15; 350.15] |
|
|
T(K) Dynamic viscosity (Pa×s) 3.00e-4 4.00e-4 5.00e-4 6.00e-4 7.00e-4 8.00e-4 9.00e-4 280 300 320 340 | ||||
| η | 0.0008500 | Pa×s | 278.15 | Shear V... |
| η | 0.0008000 | Pa×s | 284.15 | Shear V... |
| η | 0.0007540 | Pa×s | 288.15 | Viscosi... |
| η | 0.0007500 | Pa×s | 290.15 | Shear V... |
| η | 0.0007050 | Pa×s | 293.15 | Viscosi... |
| η | 0.0006300 | Pa×s | 296.15 | Shear V... |
| η | 0.0006610 | Pa×s | 298.15 | Viscosi... |
| η | 0.0006572 | Pa×s | 298.15 | Ultraso... |
| η | 0.0005700 | Pa×s | 302.15 | Shear V... |
| η | 0.0006210 | Pa×s | 303.15 | Viscosi... |
| η | 0.0005792 | Pa×s | 308.15 | Ultraso... |
| η | 0.0005300 | Pa×s | 308.15 | Shear V... |
| η | 0.0004900 | Pa×s | 314.15 | Shear V... |
| η | 0.0005066 | Pa×s | 318.15 | Ultraso... |
| η | 0.0004600 | Pa×s | 320.15 | Shear V... |
| η | 0.0004400 | Pa×s | 325.15 | Shear V... |
| η | 0.0004100 | Pa×s | 330.15 | Shear V... |
| η | 0.0004000 | Pa×s | 335.15 | Shear V... |
| η | 0.0003900 | Pa×s | 340.15 | Shear V... |
| η | 0.0003500 | Pa×s | 345.15 | Shear V... |
| η | 0.0003400 | Pa×s | 350.15 | Shear V... |
| ΔfusH | [9.51; 9.51] | kJ/mol | [228.40; 228.40] |
|
| ΔfusH | 9.51 | kJ/mol | 228.40 | NIST |
| ΔfusH | 9.51 | kJ/mol | 228.40 | NIST |
| ΔvapH | [43.50; 51.10] | kJ/mol | [261.50; 399.50] |
|
|
T(K) Enthalpy of vaporization at a given temperature (kJ/mol) 44 46 48 50 300 350 400 | ||||
| ΔvapH | 51.10 | kJ/mol | 261.50 | NIST |
| ΔvapH | 47.70 | kJ/mol | 286.00 | NIST |
| ΔvapH | 49.70 | kJ/mol | 302.50 | NIST |
| ΔvapH | 46.20 ± 1.30 | kJ/mol | 319.00 | NIST |
| ΔvapH | 43.50 | kJ/mol | 386.00 | NIST |
| ΔvapH | 43.90 | kJ/mol | 399.50 | NIST |
| Pvap | 101.33 | kPa | 437.83 | Phase e... |
| n0 | [1.48680; 1.50450] | [288.15; 318.15] |
|
|
|
T(K) Refractive Index 1.49 1.5 1.5 1.51 290 300 310 | ||||
| n0 | 1.50200 | 288.15 | Densiti... | |
| n0 | 1.50450 | 288.15 | Excess ... | |
| n0 | 1.50200 | 288.15 | Refract... | |
| n0 | 1.49920 | 293.10 | Liquid-... | |
| n0 | 1.49950 | 293.15 | Densiti... | |
| n0 | 1.49930 | 293.15 | Excess ... | |
| n0 | 1.49950 | 293.15 | Refract... | |
| n0 | 1.49682 | 298.15 | Effect ... | |
| n0 | 1.49580 | 298.15 | Thermod... | |
| n0 | 1.49600 | 298.15 | Excess ... | |
| n0 | 1.49690 | 298.15 | Densiti... | |
| n0 | 1.49760 | 298.15 | Excess ... | |
| n0 | 1.49690 | 298.15 | Refract... | |
| n0 | 1.49670 | 298.15 | Excess ... | |
| n0 | 1.49693 | 298.15 | Density... | |
| n0 | 1.48980 | 298.15 | Thermod... | |
| n0 | 1.49684 | 298.15 | KDB | |
| n0 | 1.49440 | 303.15 | Densiti... | |
| n0 | 1.49440 | 303.15 | Refract... | |
| n0 | 1.49280 | 303.15 | Thermod... | |
| n0 | 1.49360 | 303.15 | Excess ... | |
| n0 | 1.49480 | 303.15 | Excess ... | |
| n0 | 1.49180 | 308.15 | Refract... | |
| n0 | 1.49180 | 308.15 | Densiti... | |
| n0 | 1.49130 | 308.15 | Excess ... | |
| n0 | 1.48980 | 308.15 | Thermod... | |
| n0 | 1.48930 | 313.15 | Densiti... | |
| n0 | 1.48930 | 313.15 | Refract... | |
| n0 | 1.48923 | 313.15 | Density... | |
| n0 | 1.48680 | 318.15 | Refract... | |
| n0 | 1.48680 | 318.15 | Densiti... | |
| ρl | [818.50; 869.28] | kg/m3 | [288.15; 343.15] |
|
|
T(K) Liquid Density (kg/m3) 820 830 840 850 860 870 300 320 340 | ||||
| ρl | 869.28 | kg/m3 | 288.15 | Densiti... |
| ρl | 865.00 | kg/m3 | 293.00 | KDB |
| ρl | 865.37 | kg/m3 | 293.15 | Densiti... |
| ρl | 865.10 | kg/m3 | 293.15 | Densiti... |
| ρl | 861.45 | kg/m3 | 298.15 | Densiti... |
| ρl | 861.03 | kg/m3 | 298.15 | Excess ... |
| ρl | 860.86 | kg/m3 | 298.15 | Acousti... |
| ρl | 861.03 | kg/m3 | 298.15 | Excess ... |
| ρl | 859.70 | kg/m3 | 298.20 | Liquid-... |
| ρl | 856.90 | kg/m3 | 303.15 | Densiti... |
| ρl | 857.54 | kg/m3 | 303.15 | Densiti... |
| ρl | 857.40 | kg/m3 | 303.15 | Densiti... |
| ρl | 853.30 | kg/m3 | 308.15 | Densiti... |
| ρl | 853.63 | kg/m3 | 308.15 | Densiti... |
| ρl | 852.66 | kg/m3 | 308.15 | Acousti... |
| ρl | 849.71 | kg/m3 | 313.15 | Densiti... |
| ρl | 849.30 | kg/m3 | 313.15 | Densiti... |
| ρl | 842.80 | kg/m3 | 313.15 | Densiti... |
| ρl | 845.80 | kg/m3 | 318.15 | Densiti... |
| ρl | 845.10 | kg/m3 | 318.15 | Densiti... |
| ρl | 840.90 | kg/m3 | 323.15 | Densiti... |
| ρl | 834.70 | kg/m3 | 323.15 | Densiti... |
| ρl | 826.60 | kg/m3 | 333.15 | Densiti... |
| ρl | 818.50 | kg/m3 | 343.15 | Densiti... |
| csound,fluid | [1263.00; 1360.40] | m/s | [293.15; 318.15] |
|
|
T(K) Speed of sound in fluid (m/s) 1260 1280 1300 1320 1340 1360 300 310 | ||||
| csound,fluid | 1360.40 | m/s | 293.15 | Physico... |
| csound,fluid | 1339.80 | m/s | 298.15 | Physico... |
| csound,fluid | 1319.60 | m/s | 303.15 | Physico... |
| csound,fluid | 1300.20 | m/s | 308.15 | Physico... |
| csound,fluid | 1280.40 | m/s | 313.15 | Physico... |
| csound,fluid | 1263.00 | m/s | 318.15 | Physico... |
| γ | [0.03; 0.03] | N/m | [298.15; 313.15] |
|
|
T(K) Surface Tension (N/m) 0.03 0.03 0.03 0.03 0.03 0.03 0.03 0.03 300 305 310 | ||||
| γ | 0.03 | N/m | 298.15 | Densiti... |
| γ | 0.03 | N/m | 298.15 | Densiti... |
| γ | 0.03 | N/m | 298.15 | Excess ... |
| γ | 0.03 | N/m | 298.15 | Excess ... |
| γ | 0.03 | N/m | 298.15 | Excess ... |
| γ | 0.03 | N/m | 303.15 | Densiti... |
| γ | 0.03 | N/m | 308.15 | Excess ... |
| γ | 0.03 | N/m | 308.15 | Excess ... |
| γ | 0.03 | N/m | 308.15 | Densiti... |
| γ | 0.03 | N/m | 313.15 | Densiti... |
| γ | 0.03 | N/m | 313.15 | Excess ... |
| γ | 0.03 | N/m | 313.15 | Excess ... |
| γ | 0.03 | N/m | 313.15 | Densiti... |
| γ | 0.03 | N/m | 313.15 | Excess ... |
| λ | [0.13; 0.14] | W/m×K | [258.66; 332.28] |
|
|
T(K) Liquid thermal conductivity (W/m×K) 0.13 0.14 0.14 0.14 260 280 300 320 | ||||
| λ | 0.14 | W/m×K | 258.66 | Thermal... |
| λ | 0.14 | W/m×K | 258.83 | Thermal... |
| λ | 0.14 | W/m×K | 258.95 | Thermal... |
| λ | 0.14 | W/m×K | 276.88 | Thermal... |
| λ | 0.14 | W/m×K | 277.04 | Thermal... |
| λ | 0.14 | W/m×K | 277.16 | Thermal... |
| λ | 0.14 | W/m×K | 296.36 | Thermal... |
| λ | 0.14 | W/m×K | 296.53 | Thermal... |
| λ | 0.14 | W/m×K | 296.66 | Thermal... |
| λ | 0.13 | W/m×K | 313.44 | Thermal... |
| λ | 0.13 | W/m×K | 313.60 | Thermal... |
| λ | 0.13 | W/m×K | 313.73 | Thermal... |
| λ | 0.13 | W/m×K | 331.99 | Thermal... |
| λ | 0.13 | W/m×K | 332.16 | Thermal... |
| λ | 0.13 | W/m×K | 332.28 | Thermal... |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [6.96e-04; 3113.46] | kPa | [228.46; 637.38] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 8.58665e+01 | |||
| Coefficient B | -8.51220e+03 | |||
| Coefficient C | -1.03429e+01 | |||
| Coefficient D | 5.70952e-06 | |||
| Temperature range, min. | 228.46 | |||
| Temperature range, max. | 637.38 | |||
|
T(K) Vapor pressure (kPa) 0 500 1000 1500 2000 2500 3000 300 400 500 600 | ||||
| Pvap | 6.96e-04 | kPa | 228.46 | Calculated Property |
| Pvap | 0.06 | kPa | 273.90 | Calculated Property |
| Pvap | 1.17 | kPa | 319.33 | Calculated Property |
| Pvap | 9.73 | kPa | 364.77 | Calculated Property |
| Pvap | 46.84 | kPa | 410.20 | Calculated Property |
| Pvap | 156.66 | kPa | 455.64 | Calculated Property |
| Pvap | 408.78 | kPa | 501.07 | Calculated Property |
| Pvap | 897.43 | kPa | 546.51 | Calculated Property |
| Pvap | 1744.79 | kPa | 591.94 | Calculated Property |
| Pvap | 3113.46 | kPa | 637.38 | Calculated Property |
Similar Compounds
Find more compounds similar to Mesitylene.
Mixtures
- Acetic acid, butyl ester + Mesitylene
- 2-Propenoic acid, butyl ester + Mesitylene
- Tetrahydrofuran + Mesitylene
- Thiophene, 2-ethyl- + Mesitylene
- Ethanol + Mesitylene
- 1-Propanol + Mesitylene
- Isopropyl Alcohol + Mesitylene
- 1-Butanol + Mesitylene
- 1-Pentanol + Mesitylene
- 1-Butanol, 3-methyl- + Mesitylene
- Cyclohexane, methyl- + Mesitylene
- Anisole + Mesitylene
- n-Propyl acetate + Mesitylene
- Benzonitrile + Mesitylene
- Octane + Mesitylene
- Morpholine, 4-acetyl- + Mesitylene
- 1,4-Dioxane + Mesitylene
- 9,10-Anthracenedione, 2-(1,1-dimethylethyl)- + Mesitylene
- Cyclohexane + Mesitylene
- Carbon Tetrachloride + Mesitylene
Find more mixtures with Mesitylene.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Effect of Temperature on the Change of Refractive Index on Mixing for Butyl Acetate + Aromatic Hydrocarbons
- Densities and Volumetric Properties of Binary Mixtures of Butyl Acrylate with Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene at Temperatures from 288.15 K to 318.15 K
- Ultrasonic and viscometric study of molecular interactions in binary mixtures of aniline with 1-propanol, 2-propanol, 2-methyl-1-propanol, and 2-methyl-2-propanol at different temperatures
- Solubility of hydrofluorocarbons in aromatic solvents and alcohols: Experimental data and modeling with CPA EoS
- Phase equilibria of three binary systems containing 2,5-dimethylthiophene and 2-ethylthiophene in hydrocarbons
- Liquid-liquid equilibria for ternary systems water + acetic acid + 1,2,4-trimethylbenzene and water + acetic acid + 1,3,5- trimethylbenzene at (303.2 - 343.2) K
- Evaluation of 1-ethyl-3-methylimidazolium methylsulfate and 1,3-dimethylimidazolium methylsulfate as solvents for extraction of alkylbenzenes from hexadecane at 313 and 333 K
- Excess molar volumes of (acetophenone + benzene, or toluene, or 1,3-xylene, or 1,3,5-trimethylbenzene) at temperatures (298.15 and 328.15) K
- Thermodynamic properties of (tetradecane + benzene, + toluene, + chlorobenzene, + bromobenzene, + anisole) binary mixtures at T = (298.15, 303.15, and 308.15) K
- Excess and deviation properties for the binary mixtures of methylcyclohexane with benzene, toluene, p-xylene, mesitylene, and anisole at T = (298.15, 303.15, and 308.15) K
- Excess molar volumes and refractive indices of (methoxybenzene + benzene, or toluene, or o-xylene, or m-xylene, or p-xylene, or mesitylene) binary mixtures between T = (288.15 to 303.15) K
- Densities, surface tensions, and derived surface thermodynamics properties of (trimethylbenzene + propyl acetate, or butyl acetate) from T = 298.15 K to 313.15 K
- Thermodynamics of mixtures involving some (benzene derivatives + benzonitrile)
- Excess molar volumes of (octane + benzene, or toluene, or 1,3-xylene, or 1,3,5-trimethylbenzene) at temperatures between (298.15 and 328.15) K
- Densities and volumetric properties of (N-acetylmorpholine + aromatic hydrocarbon) binary mixtures from T = (293.15 to 343.15) K
- Acoustic and thermodynamic properties of binary mixtures of 1-nonanol with o-xylene, m-xylene, p-xylene, ethylbenzene and mesitylene at T = (298.15 and 308.15) K
- Measurement of activity coefficients at infinite dilution of organic solutes in the ionic liquid 1-hexyl-1,4-diaza[2.2.2]bicyclooctanium bis(trifluoromethylsulfonyl)imide using gas-liquid chromatography
- Physicochemical study of intermolecular interactions in 1,4-dioxane + aromatic hydrocarbons binary mixtures at different temperatures by using ultrasonic and viscometric methods
- Liquid-liquid equilibrium for methyl butyl ketone + o-, m-, p-cresol + water ternary systems and COSMO-SAC predictions
- Solubility of 2-Ethylanthraquinone in Binary Mixtures of Oligooxymethylene Dimethyl Ethers with Different Number of CH2O Groups of n = 2, 3, and 4 from 293.15 to 343.15 K
- Densities and Dynamic Viscosities of Alicyclic Cyclohexane with Toluene, o-Xylene, and Mesitylene at T = (303.15 to 323.15) K and Atmospheric Pressure
- Thermal Conductivity and Thermal Diffusivity of Twenty-Nine Liquids: Alkenes, Cyclic (Alkanes, Alkenes, Alkadienes, Aromatics), and Deuterated Hydrocarbons
- Excess Molar volumes and Surface Tensions of Trimethylbenzene with Tetrahydrofuran Tetrachloromethane and Dimethylsulfoxide at 298.15 K
- Excess Molar Volumes and Surface Tensions of 1,2,4-Trimethylbenzene and 1,3,5-Trimethylbenzene with 1-Butanol, 2-Methyl-1-propanol, 2-Butanol, and 2-Methyl-2-propanol at 298.15 K
- Excess Molar Volumes and Surface Tensions of Trimethylbenzene + Ethylene Glycol Ester at 298.15 K and 313.15 K
- Liquid-Liquid Equilibria Measurements for Ternary System of Hexadecane + 1,3,5-Trimethylbenzene + N-Methyl-2-pyrrolidone
- Densities and Surface Tensions of Trimethylbenzene + Dimethyl Carbonate or + Diethyl Carbonate at 298.15 K and 313.15 K
- Viscosities, Densities, and Speeds of Sound of Binary Mixtures of Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene with Anisole at (288.15, 293.15, 298.15, and 303.15) K
- Excess Molar Volumes and Surface Tensions of 1,2,4- Trimethylbenzene and 1,3,5- Trimethylbenzene with 1,1-Diethoxyethane and 2,2-Dimethoxypropane at (298.15, 308.15, and 313.15) K
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Limiting Binary Diffusivities of Aniline, Styrene, and Mesitylene in Supercritical Carbon Dioxide
- Excess Enthalpies of (N-Methylformamide or N-Methylacetamide) + Aromatic Compounds at 303.15 K
- Refractive Indices of Binary Mixtures of Tetrahydrofuran with Aromatic Hydrocarbon at Temperatures from (288.15 to 318.15) K
- Excess Molar Volumes and Surface Tensions of 1,2,4-Trimethylbenzene and 1,3,5-Trimethylbenzene with Isopropyl Acetate and Isobutyl Acetate at (298.15, 308.15, and 313.15) K
- Shear Viscosity of Mixtures of r-Tocopherol with Nonpolar Solvents
- Densities, Refractive Indices, and Excess Properties of Binary Mixtures of 1,4-Dioxane with Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene at Temperatures from (288.15 to 318.15) K
- Density, Speed of Sound, and Refractive Index for Binary Mixtures Containing Cycloalkanes with o-Xylene, m-Xylene, p-Xylene, and Mesitylene at T = (298.15 and 313.15) K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.