Acetic acid, methyl ester Mixtures

Acetic acid, methyl ester

PDF Excel Molecule Calculator
Name
Acetic acid, methyl ester
InChI
InChI=1S/C3H6O2/c1-3(4)5-2/h1-2H3
InChI Key
KXKVLQRXCPHEJC-UHFFFAOYSA-N
Formula
C3H6O2
SMILES
COC(C)=O
Molecular Weight1
74.08
CAS
79-20-9
Other Names
  • Acetate de methyle
  • CH3COOCH3
  • DEVOTON
  • Ethyl ester of monoacetic acid
  • METHYL ACETIC ESTER
  • METHYL ETHANOATE
  • Methyl acetate
  • Methyl ester of acetic acid
  • Methylacetaat
  • Methylacetat
  • Methyle (acetate de)
  • Methylester kiseliny octove
  • Metile (acetato di)
  • NSC 405071
  • Tereton
  • UN 1231
  • ethanoic acid, methyl ester
ID Mixture
10-171-a 1-Propanol + Acetic acid, methyl ester
10-172-k 1-Butanol + Acetic acid, methyl ester
10-235-k Heptane + Acetic acid, methyl ester
10-240-d n-Hexane + Acetic acid, methyl ester
10-241-c Decane + Acetic acid, methyl ester
10-459-b Acetic acid, methyl ester + Methyl Alcohol
10-460-k Acetic acid, methyl ester + Water
10-461-j Acetic acid + Acetic acid, methyl ester
10-550-k Carbon dioxide + Acetic acid, methyl ester
10-780-e Acetic acid, methyl ester + Propanoic acid
10-782-c Methyl propionate + Acetic acid, methyl ester
10-784-a Methyl propionate + Acetic acid, methyl ester + Water
10-836-c Acetic acid, methyl ester + Simvastatin
10-971-c Propane, 1,2-dichloro- + Acetic acid, methyl ester
11-128-h Isopropyl acetate + Acetic acid, methyl ester
11-161-a Dimethyl sulfide + Acetic acid, methyl ester
11-266-e Acetic acid, methyl ester + 2-Propanol, 1-methoxy-
11-456-d Acetic acid, methyl ester + Phosphoramidic acid, phenyl-, diphenyl ester
11-557-b Dimethyl Sulfoxide + Acetic acid, methyl ester
11-559-k Dimethyl Sulfoxide + Acetic acid, methyl ester + Methyl Alcohol
11-578-j Acetic acid, methyl ester + Propanoic acid, 2-hydroxy-, ethyl ester
11-580-f Acetic acid, methyl ester + Propanoic acid, 2-hydroxy-, ethyl ester + Methyl Alcohol
11-733-f Lucirin TPO solid (2,4,6-trimethylbenzoyldiphenyl phosphine oxide) + Acetic acid, methyl ester
11-880-c Acetic acid, methyl ester + Nonane
11-881-b Undecane + Acetic acid, methyl ester
11-882-a Tridecane + Acetic acid, methyl ester
11-883-k Pentadecane + Acetic acid, methyl ester
11-884-j Heptadecane + Acetic acid, methyl ester
12-301-d Paraldehyde + Acetic acid, methyl ester
12-342-j Ethane, 1,2-dibromo- + Acetic acid, methyl ester
12-343-h Propane, 1,3-dibromo- + Acetic acid, methyl ester
12-344-g Acetic acid, methyl ester + Butane, 1,4-dibromo-
12-345-f Pentane, 1,5-dibromo- + Acetic acid, methyl ester
12-346-e Hexane, 1,6-dibromo- + Acetic acid, methyl ester
12-387-k Toluene + Acetic acid, butyl ester + Acetic acid, methyl ester
12-388-j Toluene + Heptanoic acid, methyl ester + Acetic acid, methyl ester
12-515-g Ethanol + Acetic acid, methyl ester
13-700-k Benzonitrile, 2-(4-methylphenyl)- + Acetic acid, methyl ester
13-798-c Ethyl Vanillin + Acetic acid, methyl ester
14-377-j Acetic acid, methyl ester + Tetrahydrofuran
14-536-b Methylene chloride + Acetic acid, methyl ester
14-541-f 1,3-Dioxolane + Methylene chloride + Acetic acid, methyl ester
14-906-a Acetic acid, methyl ester + 1,3-Isobenzofurandione, 5-chloro-
14-925-k Acetic acid, methyl ester + Vanillic acid
14-943-k Octane + Acetic acid, methyl ester
14-946-g Pentane, 2,2,4-trimethyl- + Acetic acid, methyl ester
14-947-f Methyl valerate + Acetic acid, methyl ester
14-948-e Butanoic acid, methyl ester + Acetic acid, methyl ester
14-949-d Octane + Methyl valerate + Acetic acid, methyl ester
14-950-b Butanoic acid, methyl ester + Octane + Acetic acid, methyl ester
14-951-a Methyl valerate + Pentane, 2,2,4-trimethyl- + Acetic acid, methyl ester
14-952-k Butanoic acid, methyl ester + Pentane, 2,2,4-trimethyl- + Acetic acid, methyl ester
15-128-d p-Coumaric acid + Acetic acid, methyl ester
15-155-d Ethanedione, diphenyl- + Acetic acid, methyl ester
15-453-c (E)-cinnamyl alcohol + Acetic acid, methyl ester
15-471-c Carbonic acid, dimethyl ester + Acetic acid, methyl ester
15-547-j 1H-Benzotriazole + Acetic acid, methyl ester
15-595-f Anisole + Acetic acid, methyl ester
15-667-f Benzophenone + Acetic acid, methyl ester
15-811-e Acetic acid, methyl ester + Niacinamide
15-823-b 2-Naphthalenecarboxylic acid, 3-hydroxy- + Acetic acid, methyl ester
15-871-j Glyburide + Acetic acid, methyl ester
15-892-f Isobutyl acetate + Acetic acid, methyl ester
15-893-e 1-Butanol, 3-methyl-, acetate + Acetic acid, methyl ester
15-894-d p-Xylene + Acetic acid, methyl ester
15-902-d Pyrazine, tetramethyl- + Acetic acid, methyl ester
16-022-k Tributylamine + Acetic acid, methyl ester
16-055-d Benzamide, 4-amino- + Acetic acid, methyl ester
16-087-j Acetamide, 2-cyano- + Acetic acid, methyl ester
16-162-e Diethyl carbonate + Acetic acid, methyl ester
16-240-h Benzenesulfonamide + Acetic acid, methyl ester
16-315-e Benzenesulfonamide, 2-methyl- + Acetic acid, methyl ester
16-380-c Acetic acid, methyl ester + Thiourea, N,N'-diethyl-
16-498-c Acetic acid, methyl ester + Ethanol, 2-ethoxy-
16-676-e 1,2-Ethanediol + Acetic acid, methyl ester
16-677-d Ethanol, 2,2'-oxybis- + Acetic acid, methyl ester
16-678-c Triethylene glycol + Acetic acid, methyl ester
16-679-b Propylene Glycol + Acetic acid, methyl ester
16-726-j Trichloroethylene + Acetic acid, methyl ester
16-737-g Tetrachloroethylene + Acetic acid, methyl ester
16-773-g 2-Propanol, 2-methyl- + Acetic acid, methyl ester
17-894-b 2-Propanol, 1-ethoxy- + Acetic acid, methyl ester
17-897-j 2-Propanol, 1-propoxy- + Acetic acid, methyl ester
17-900-d 2-Propanol, 1-butoxy- + Acetic acid, methyl ester
17-983-c Acetic acid, methyl ester + Benzoic acid, 3,4-dimethoxy-
18-006-f sec-Butyl acetate + Acetic acid, methyl ester
18-163-b Acetic acid, methyl ester + 2-Furancarboxylic acid
18-723-k Acetic acid, methyl ester + Cyclohexane
18-725-h Cyclohexanone + Acetic acid, methyl ester
18-728-e Cyclohexanone + Acetic acid, methyl ester + Cyclohexane
18-760-j Benzene + Acetic acid, methyl ester
19-647-d Phosphoramidic acid, benzyl-, diphenyl ester + Acetic acid, methyl ester
20-463-f Magnesium chloride + Acetic acid, methyl ester + Methyl Alcohol
20-751-f 1,2-Ethanediol + Tetramethylammonium chloride + Acetic acid, methyl ester
20-789-e Tetramethylammonium chloride + Glycerin + Acetic acid, methyl ester
23-096-a Benzoic acid + Acetic acid, methyl ester
23-271-f Acetic acid, methyl ester + Probenecid
23-501-k Acetic acid, methyl ester + 6-Aminohexanoic acid
24-011-c Isopropyl Alcohol + Acetic acid, methyl ester
24-012-b 1-Propanol, 2-methyl- + Acetic acid, methyl ester
24-013-a 1-Pentanol + Acetic acid, methyl ester
24-282-c 1H-1,2,4-Triazole + Acetic acid, methyl ester
24-291-c 1,2-Benzenedicarboxylic acid, 3-nitro- + Acetic acid, methyl ester
25-142-g Benzoic acid, 3,4-dihydroxy- + Acetic acid, methyl ester
25-412-g Betulin + Acetic acid, methyl ester
25-643-a Acetic acid, methyl ester + Lovastatin
25-894-c Captopril + Acetic acid, methyl ester
25-965-d 1-Octanol + Acetic acid, methyl ester
26-066-a 1-Propanol + Acetic acid, methyl ester + Water
26-394-g Decane + Acetic acid, methyl ester + Methyl Alcohol
26-395-f Undecane + Acetic acid, methyl ester + Methyl Alcohol
26-396-e Dodecane + Acetic acid, methyl ester + Methyl Alcohol
26-745-g Octane + Acetic acid, methyl ester + Methyl Alcohol
26-746-f Acetic acid, methyl ester + Nonane + Methyl Alcohol
26-796-a Toluene + Acetic acid, methyl ester + Water
26-797-k Benzene + Acetic acid, methyl ester + Water
26-890-f n-Hexane + Acetic acid, methyl ester + Methyl Alcohol
26-891-e Heptane + Acetic acid, methyl ester + Methyl Alcohol