- InChI
- InChI=1S/C8H14O4/c1-11-7(9)5-3-4-6-8(10)12-2/h3-6H2,1-2H3
- InChI Key
- UDSFAEKRVUSQDD-UHFFFAOYSA-N
- Formula
- C8H14O4
- SMILES
- COC(=O)CCCCC(=O)OC
- Molecular Weight1
- 174.19
- CAS
- 627-93-0
- Other Names
-
- 1,6-Dimethylhexanedioate
- 1,6-hexanedioic acid, dimethyl ester
- Adipic acid, dimethyl ester
- Dimethyl adipate
- Dimethyl ester of hexanedioic acid
- Dimethyl hexanedioate
- Hexanedioic acid, methyl ester
- Methyl adipate
- dimethyl 1,6-hexanedioate
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- ΔcH°solid : Standard solid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- D*i : Self diffusion coefficient (m2/s).
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Pressure Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔcH°liquid | -4286.20 ± 3.20 | kJ/mol | NIST |
| ΔcH°solid | -4266.00 | kJ/mol | NIST |
| ΔfG° | -451.36 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -698.05 | kJ/mol | Joback Calculated Property |
| ΔfH°liquid | -862.80 ± 3.20 | kJ/mol | NIST |
| ΔfusH° | 22.05 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [67.10; 73.40] | kJ/mol |
|
| ΔvapH° | 67.10 ± 0.30 | kJ/mol | NIST |
| ΔvapH° | 69.00 ± 0.20 | kJ/mol | NIST |
| ΔvapH° | 73.40 | kJ/mol | NIST |
| log10WS | -0.90 | Crippen Calculated Property | |
| logPoct/wat | 0.893 | Crippen Calculated Property | |
| McVol | 138.460 | ml/mol | McGowan Calculated Property |
| Pc | 2500.00 | kPa | Vapor P... |
| Inp | [210.93; 1256.00] |
|
|
| Inp | 1243.00 | NIST | |
| Inp | 1242.00 | NIST | |
| Inp | 1241.00 | NIST | |
| Inp | 1207.00 | NIST | |
| Inp | 1205.00 | NIST | |
| Inp | 1204.00 | NIST | |
| Inp | 1202.00 | NIST | |
| Inp | 1234.00 | NIST | |
| Inp | 1223.00 | NIST | |
| Inp | 1208.20 | NIST | |
| Inp | 1246.00 | NIST | |
| Inp | 1206.00 | NIST | |
| Inp | 1235.00 | NIST | |
| Inp | 1256.00 | NIST | |
| Inp | 1243.00 | NIST | |
| Inp | 1205.00 | NIST | |
| Inp | 1213.00 | NIST | |
| Inp | 1246.70 | NIST | |
| Inp | 1213.00 | NIST | |
| Inp | 1212.00 | NIST | |
| Inp | 1211.00 | NIST | |
| Inp | 1215.00 | NIST | |
| Inp | 1206.00 | NIST | |
| Inp | 1206.00 | NIST | |
| Inp | 1206.00 | NIST | |
| Inp | 1212.00 | NIST | |
| Inp | 1223.00 | NIST | |
| Inp | 1213.00 | NIST | |
| Inp | Outlier 211.70 | NIST | |
| Inp | Outlier 210.93 | NIST | |
| Inp | 1213.00 | NIST | |
| Inp | 1243.00 | NIST | |
| Inp | 1204.00 | NIST | |
| Inp | 1206.00 | NIST | |
| I | [1777.00; 1819.00] |
|
|
| I | 1777.00 | NIST | |
| I | 1809.00 | NIST | |
| I | 1817.00 | NIST | |
| I | 1819.00 | NIST | |
| I | 1804.00 | NIST | |
| I | 1779.00 | NIST | |
| I | 1817.00 | NIST | |
| I | 1779.00 | NIST | |
| Tboil | [498.20; 508.00] | K |
|
| Tboil | 498.20 | K | Liquid ... |
| Tboil | 508.00 ± 4.00 | K | NIST |
| Tc | 718.73 | K | Joback Calculated Property |
| Tfus | [283.50; 283.50] | K |
|
| Tfus | 283.50 ± 0.60 | K | NIST |
| Tfus | 283.50 ± 1.00 | K | NIST |
| Vc | 0.531 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [322.22; 384.50] | J/mol×K | [535.02; 718.73] |
|
| Cp,gas | 322.22 | J/mol×K | 535.02 | Joback Calculated Property |
| Cp,gas | 333.68 | J/mol×K | 565.64 | Joback Calculated Property |
| Cp,gas | 344.72 | J/mol×K | 596.26 | Joback Calculated Property |
| Cp,gas | 355.33 | J/mol×K | 626.88 | Joback Calculated Property |
| Cp,gas | 365.50 | J/mol×K | 657.50 | Joback Calculated Property |
| Cp,gas | 375.23 | J/mol×K | 688.12 | Joback Calculated Property |
| Cp,gas | 384.50 | J/mol×K | 718.73 | Joback Calculated Property |
| η | [0.0009200; 0.0043900] | Pa×s | [283.15; 373.15] |
|
| η | 0.0043900 | Pa×s | 283.15 | Influen... |
| η | 0.0038200 | Pa×s | 288.15 | Influen... |
| η | 0.0033600 | Pa×s | 293.15 | Influen... |
| η | 0.0029800 | Pa×s | 298.15 | Influen... |
| η | 0.0026700 | Pa×s | 303.15 | Influen... |
| η | 0.0024000 | Pa×s | 308.15 | Influen... |
| η | 0.0021800 | Pa×s | 313.15 | Influen... |
| η | 0.0019900 | Pa×s | 318.15 | Influen... |
| η | 0.0018200 | Pa×s | 323.15 | Influen... |
| η | 0.0016800 | Pa×s | 328.15 | Influen... |
| η | 0.0015500 | Pa×s | 333.15 | Influen... |
| η | 0.0014400 | Pa×s | 338.15 | Influen... |
| η | 0.0013400 | Pa×s | 343.15 | Influen... |
| η | 0.0012500 | Pa×s | 348.15 | Influen... |
| η | 0.0011700 | Pa×s | 353.15 | Influen... |
| η | 0.0011000 | Pa×s | 358.15 | Influen... |
| η | 0.0010300 | Pa×s | 363.15 | Influen... |
| η | 0.0009700 | Pa×s | 368.15 | Influen... |
| η | 0.0009200 | Pa×s | 373.15 | Influen... |
| ΔvapH | [58.80; 74.60] | kJ/mol | [398.00; 441.00] |
|
| ΔvapH | 74.60 | kJ/mol | 398.00 | NIST |
| ΔvapH | 58.80 | kJ/mol | 441.00 | NIST |
| Pvap | [2.53e-03; 216.30] | kPa | [293.20; 531.44] |
|
| Pvap | 2.53e-03 | kPa | 293.20 | Thermod... |
| Pvap | 3.36e-03 | kPa | 296.20 | Thermod... |
| Pvap | 4.43e-03 | kPa | 299.20 | Thermod... |
| Pvap | 5.86e-03 | kPa | 302.20 | Thermod... |
| Pvap | 7.40e-03 | kPa | 305.20 | Thermod... |
| Pvap | 9.91e-03 | kPa | 308.20 | Thermod... |
| Pvap | 0.01 | kPa | 310.20 | Thermod... |
| Pvap | 0.01 | kPa | 313.30 | Thermod... |
| Pvap | 0.02 | kPa | 316.20 | Thermod... |
| Pvap | 0.02 | kPa | 319.30 | Thermod... |
| Pvap | 0.03 | kPa | 322.20 | Thermod... |
| Pvap | 0.04 | kPa | 325.30 | Thermod... |
| Pvap | 0.05 | kPa | 328.20 | Thermod... |
| Pvap | 0.06 | kPa | 331.20 | Thermod... |
| Pvap | 0.07 | kPa | 334.20 | Thermod... |
| Pvap | 0.51 | kPa | 353.15 | Vapor-L... |
| Pvap | 1.26 | kPa | 373.15 | Vapor-L... |
| Pvap | 1.92 | kPa | 383.15 | Vapor-L... |
| Pvap | 2.00 | kPa | 390.98 | Isobari... |
| Pvap | 4.33 | kPa | 403.15 | Vapor-L... |
| Pvap | 5.20 | kPa | 410.82 | Isobari... |
| Pvap | 5.93 | kPa | 413.15 | Vapor-L... |
| Pvap | 8.30 | kPa | 422.47 | Isobari... |
| Pvap | 8.37 | kPa | 423.15 | Vapor-L... |
| Pvap | 7.79 | kPa | 424.91 | Isobari... |
| Pvap | 10.00 | kPa | 431.20 | Isobari... |
| Pvap | 12.30 | kPa | 433.15 | Vapor-L... |
| Pvap | 14.56 | kPa | 441.21 | Isobari... |
| Pvap | 16.66 | kPa | 443.15 | Vapor-L... |
| Pvap | 20.00 | kPa | 450.08 | Isobari... |
| Pvap | 28.55 | kPa | 460.47 | Isobari... |
| Pvap | 44.63 | kPa | 474.33 | Isobari... |
| Pvap | 54.37 | kPa | 480.72 | Isobari... |
| Pvap | 68.77 | kPa | 488.62 | Isobari... |
| Pvap | 85.45 | kPa | 496.14 | Isobari... |
| Pvap | 99.00 | kPa | 501.00 | Isobari... |
| Pvap | 108.77 | kPa | 504.86 | Isobari... |
| Pvap | 131.95 | kPa | 512.00 | Isobari... |
| Pvap | 157.68 | kPa | 518.78 | Isobari... |
| Pvap | 179.21 | kPa | 523.92 | Isobari... |
| Pvap | 216.30 | kPa | 531.44 | Isobari... |
| n0 | [1.41614; 1.43050] | [288.15; 323.15] |
|
|
| n0 | 1.43050 | 288.15 | Experim... | |
| n0 | 1.42825 | 293.15 | Phase e... | |
| n0 | 1.42825 | 293.15 | (Liquid... | |
| n0 | 1.42825 | 293.15 | (Liquid... | |
| n0 | 1.42842 | 293.15 | Experim... | |
| n0 | 1.42825 | 293.20 | Liquid-... | |
| n0 | 1.42636 | 298.15 | Experim... | |
| n0 | 1.42429 | 303.15 | Experim... | |
| n0 | 1.42222 | 308.15 | Experim... | |
| n0 | 1.42017 | 313.15 | Experim... | |
| n0 | 1.41819 | 318.15 | Experim... | |
| n0 | 1.41614 | 323.15 | Experim... | |
| ρl | [1032.62; 1066.79] | kg/m3 | [288.15; 323.15] |
|
| ρl | 1066.79 | kg/m3 | 288.15 | Experim... |
| ρl | 1061.92 | kg/m3 | 293.15 | Experim... |
| ρl | 1061.93 | kg/m3 | 293.15 | Thermod... |
| ρl | 1061.93 | kg/m3 | 293.15 | Densiti... |
| ρl | 1057.05 | kg/m3 | 298.15 | Experim... |
| ρl | 1052.18 | kg/m3 | 303.15 | Experim... |
| ρl | 1047.30 | kg/m3 | 308.15 | Experim... |
| ρl | 1042.41 | kg/m3 | 313.15 | Experim... |
| ρl | 1037.52 | kg/m3 | 318.15 | Experim... |
| ρl | 1032.62 | kg/m3 | 323.15 | Experim... |
| D*i | [0.00; 0.00] | m2/s | [293.43; 338.47] |
|
| D*i | 0.00 | m2/s | 293.43 | Self-di... |
| D*i | 0.00 | m2/s | 302.44 | Self-di... |
| D*i | 0.00 | m2/s | 311.45 | Self-di... |
| D*i | 0.00 | m2/s | 320.46 | Self-di... |
| D*i | 0.00 | m2/s | 329.45 | Self-di... |
| D*i | 0.00 | m2/s | 338.47 | Self-di... |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | 382.70 | K | 1.90 | NIST |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 293.17 | 100.00 | 0.0033 |
| 293.17 | 1000.00 | 0.0033 |
| 293.15 | 5000.00 | 0.0035 |
| 293.15 | 10000.00 | 0.0036 |
| 293.15 | 15000.00 | 0.0038 |
| 293.15 | 20000.00 | 0.0040 |
| 293.15 | 30000.00 | 0.0043 |
| 293.15 | 40000.00 | 0.0047 |
| 303.17 | 100.00 | 0.0026 |
| 303.17 | 1000.00 | 0.0026 |
| 303.15 | 5000.00 | 0.0027 |
| 303.15 | 10000.00 | 0.0029 |
| 303.16 | 15000.00 | 0.0030 |
| 303.16 | 20000.00 | 0.0031 |
| 303.16 | 30000.00 | 0.0034 |
| 303.16 | 40000.00 | 0.0037 |
| 313.15 | 100.00 | 0.0021 |
| 313.14 | 1000.00 | 0.0022 |
| 313.15 | 5000.00 | 0.0022 |
| 313.15 | 10000.00 | 0.0023 |
| 313.14 | 15000.00 | 0.0024 |
| 313.14 | 20000.00 | 0.0025 |
| 313.14 | 30000.00 | 0.0027 |
| 313.15 | 40000.00 | 0.0030 |
| 323.15 | 100.00 | 0.0018 |
| 323.15 | 1000.00 | 0.0018 |
| 323.15 | 5000.00 | 0.0018 |
| 323.15 | 10000.00 | 0.0019 |
| 323.15 | 15000.00 | 0.0020 |
| 323.15 | 20000.00 | 0.0021 |
| 323.15 | 30000.00 | 0.0023 |
| 323.14 | 40000.00 | 0.0024 |
| 333.15 | 100.00 | 0.0015 |
| 333.15 | 1000.00 | 0.0015 |
| 333.15 | 5000.00 | 0.0016 |
| 333.15 | 10000.00 | 0.0016 |
| 333.15 | 15000.00 | 0.0017 |
| 333.15 | 20000.00 | 0.0018 |
| 333.15 | 30000.00 | 0.0019 |
| 333.14 | 40000.00 | 0.0020 |
| 343.15 | 100.00 | 0.0013 |
| 343.15 | 1000.00 | 0.0013 |
| 343.15 | 5000.00 | 0.0013 |
| 343.15 | 10000.00 | 0.0014 |
| 343.15 | 15000.00 | 0.0015 |
| 343.15 | 20000.00 | 0.0015 |
| 343.15 | 30000.00 | 0.0016 |
| 343.15 | 40000.00 | 0.0018 |
| 353.15 | 100.00 | 0.0011 |
| 353.16 | 1000.00 | 0.0011 |
| 353.15 | 5000.00 | 0.0012 |
| 353.15 | 10000.00 | 0.0012 |
| 353.15 | 15000.00 | 0.0013 |
| 353.15 | 20000.00 | 0.0013 |
| 353.15 | 30000.00 | 0.0014 |
| 353.15 | 40000.00 | 0.0015 |
| 363.15 | 100.00 | 0.0010 |
| 363.15 | 1000.00 | 0.0010 |
| 363.15 | 5000.00 | 0.0010 |
| 363.15 | 10000.00 | 0.0011 |
| 363.13 | 15000.00 | 0.0011 |
| 363.13 | 20000.00 | 0.0012 |
| 363.15 | 30000.00 | 0.0012 |
| 363.15 | 40000.00 | 0.0013 |
| Reference | ||
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 100.00 | 1061.2 |
| 293.15 | 4990.00 | 1064.2 |
| 293.15 | 10010.00 | 1067.3 |
| 293.15 | 20020.00 | 1073.2 |
| 293.15 | 25000.00 | 1076.0 |
| 293.15 | 14980.00 | 1070.3 |
| 293.15 | 7490.00 | 1065.8 |
| 293.15 | 5000.00 | 1064.3 |
| 293.15 | 2510.00 | 1062.8 |
| 323.15 | 100.00 | 1031.9 |
| 323.15 | 4990.00 | 1035.5 |
| 323.15 | 10060.00 | 1039.1 |
| 323.15 | 20020.00 | 1045.8 |
| 323.15 | 24990.00 | 1049.0 |
| 323.15 | 15010.00 | 1042.5 |
| 323.15 | 7490.00 | 1037.3 |
| 323.15 | 5000.00 | 1035.5 |
| 323.15 | 2540.00 | 1033.7 |
| 358.15 | 100.00 | 997.6 |
| 358.15 | 4980.00 | 1001.9 |
| 358.15 | 9980.00 | 1006.1 |
| 358.15 | 20030.00 | 1014.2 |
| 358.15 | 25000.00 | 1018.0 |
| 358.15 | 15030.00 | 1010.3 |
| 358.15 | 7500.00 | 1004.1 |
| 358.15 | 5020.00 | 1002.0 |
| 358.15 | 2500.00 | 999.8 |
| 303.15 | 100.00 | 1051.5 |
| 303.15 | 5010.00 | 1054.7 |
| 303.15 | 9990.00 | 1057.9 |
| 303.15 | 20000.00 | 1064.0 |
| 303.15 | 25000.00 | 1067.0 |
| 303.15 | 15010.00 | 1061.0 |
| 303.15 | 7510.00 | 1056.3 |
| 303.15 | 5010.00 | 1054.7 |
| 303.15 | 2510.00 | 1053.1 |
| 333.15 | 100.00 | 1022.1 |
| 333.15 | 5010.00 | 1026.0 |
| 333.15 | 10020.00 | 1029.7 |
| 333.15 | 20030.00 | 1036.8 |
| 333.15 | 24920.00 | 1040.1 |
| 333.15 | 15000.00 | 1033.2 |
| 333.15 | 7490.00 | 1027.8 |
| 333.15 | 5040.00 | 1026.0 |
| 333.15 | 2520.00 | 1024.1 |
| 293.15 | 100.00 | 1061.2 |
| 293.15 | 5020.00 | 1064.3 |
| 293.15 | 10020.00 | 1067.3 |
| 293.15 | 20240.00 | 1073.3 |
| 293.15 | 25010.00 | 1076.0 |
| 293.15 | 15030.00 | 1070.3 |
| 293.15 | 7570.00 | 1065.9 |
| 293.15 | 5030.00 | 1064.3 |
| 293.15 | 2540.00 | 1062.8 |
| 313.15 | 100.00 | 1041.8 |
| 313.15 | 5020.00 | 1045.2 |
| 313.15 | 10010.00 | 1048.5 |
| 313.15 | 20020.00 | 1054.9 |
| 313.15 | 25000.00 | 1058.0 |
| 313.15 | 15010.00 | 1051.7 |
| 313.15 | 7520.00 | 1046.8 |
| 313.15 | 5020.00 | 1045.1 |
| 313.15 | 2520.00 | 1043.5 |
| 343.15 | 100.00 | 1012.4 |
| 343.15 | 5010.00 | 1016.3 |
| 343.15 | 9990.00 | 1020.2 |
| 343.15 | 20000.00 | 1027.7 |
| 343.15 | 24990.00 | 1031.2 |
| 343.15 | 15010.00 | 1024.0 |
| 343.15 | 7530.00 | 1018.3 |
| 343.15 | 5000.00 | 1016.3 |
| 343.15 | 2500.00 | 1014.3 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.63] | kPa | [378.68; 537.32] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.73676e+01 | |||
| Coefficient B | -6.50271e+03 | |||
| Coefficient C | 2.04500e+00 | |||
| Temperature range, min. | 378.68 | |||
| Temperature range, max. | 537.32 | |||
| Pvap | 1.33 | kPa | 378.68 | Calculated Property |
| Pvap | 2.84 | kPa | 396.31 | Calculated Property |
| Pvap | 5.67 | kPa | 413.93 | Calculated Property |
| Pvap | 10.71 | kPa | 431.56 | Calculated Property |
| Pvap | 19.23 | kPa | 449.19 | Calculated Property |
| Pvap | 33.06 | kPa | 466.81 | Calculated Property |
| Pvap | 54.65 | kPa | 484.44 | Calculated Property |
| Pvap | 87.21 | kPa | 502.07 | Calculated Property |
| Pvap | 134.84 | kPa | 519.69 | Calculated Property |
| Pvap | 202.63 | kPa | 537.32 | Calculated Property |
Similar Compounds
Find more compounds similar to Hexanedioic acid, dimethyl ester.
Mixtures
- Hexanedioic acid, dimethyl ester + Water
- Acetic acid + Hexanedioic acid, dimethyl ester + Water
- Pentanoic acid, 4-oxo- + Hexanedioic acid, dimethyl ester + Water
- Pentanedioic acid, dimethyl ester + Hexanedioic acid, dimethyl ester
- Butanoic acid + Hexanedioic acid, dimethyl ester + Water
- Hexanedioic acid, dimethyl ester + Propanoic acid + Water
- Hexanedioic acid, dimethyl ester + Butanedioic acid, dimethyl ester
- 1-Butanol + Hexanedioic acid, dimethyl ester
- 2-Butanone + Hexanedioic acid, dimethyl ester
- Hexanedioic acid, dimethyl ester + 1,6-Hexanediol
- 1-Butanol + Hexanedioic acid, dimethyl ester + Tetrahydrofuran
- 2-Butanone + 1-Butanol + Hexanedioic acid, dimethyl ester
- Hexanedioic acid, dimethyl ester + Methyl Alcohol
- Formic acid + Hexanedioic acid, dimethyl ester + Water
- Choline chloride + 1,2-Ethanediol + Hexanedioic acid, dimethyl ester
- Hexanedioic acid + Hexanedioic acid, dimethyl ester + Methyl Alcohol
- Hexanedioic acid, dimethyl ester + Methyl Alcohol + Pentanedioic acid
- Butanedioic acid + Hexanedioic acid, dimethyl ester + Methyl Alcohol
- Hexanedioic acid + Hexanedioic acid, dimethyl ester
- Hexanedioic acid, dimethyl ester + Pentanedioic acid
Find more mixtures with Hexanedioic acid, dimethyl ester.
Sources
- Crippen Method
- Crippen Method
- Viscosity Measurements of Dialkyl Adipates in the Temperature Range of (283 to 363) K and up to 40 MPa
- Liquid liquid equilibria of the ternary system water + acetic acid + dimethyl adipate
- Liquid liquid equilibria of aqueous mixtures containing selected dibasic esters and/or methanol
- Phase equilibria of (water + levulinic acid + dibasic esters) ternary systems
- Viscosity and density measurements of compressed liquid dimethyl adipate using oscillating body techniques
- (Liquid + liquid) equilibria of the (water + carboxylic acid + dibasic esters mixture (DBE-2)) ternary systems
- Self-diffusivity measurements of dimethyl, diethyl, dipropyl, dibutyl, Bis(2-ethylhexyl) adipates from (293 - 339) K by a PGSE-NMR spin-echo technique
- (Liquid + liquid) equilibria of (water + butyric acid + dibasic esters) ternary systems
- (Liquid + liquid) equilibria of (water + propionic acid + dibasic esters) ternary systems
- Isobaric vapor-liquid equilibrium of three binary systems containing dimethyl succinate, dimethyl glutarate and dimethyl adipate at 2, 5.2 and 8.3 kPa
- Experimental Determination and Modeling of Densities, Refractive Indices of the Binary Mixtures of Dimethylphthalate (or Dimethyladipate) + 1-Butanol, or + 2-Butanol, or + 2-Butanone at T = (288.15 to 323.15) K
- Experimental Investigation of Interactions and Thermodynamic Properties of Poly(ethylene glycol) 200/400 + Dimethyl Adipate/Dimethyl Phthalate Binary Mixtures
- Thermophysical Properties and Solubility of Different Sugar-Derived Molecules in Deep Eutectic Solvents
- Measurement and Correlation for Solubilities of Adipic Acid, Glutaric Acid, and Succinic Acid in Dimethyl Adipate + Methanol Mixtures
- Isobaric Vapor-Liquid Equilibrium for the Binary System of Dimethyl Adipate and 1,6-Hexanediol at 10, 20, and 99 kPa
- Thermodynamic Properties of Mixtures Containing Ionic Liquids. 7. Activity Coefficients of Aliphatic and Aromatic Esters and Benzylamine in 1-Methyl-3-ethylimidazolium Bis(trifluoromethylsulfonyl) Imide Using the Transpiration Method
- Vapor Pressures, Enthalpies of Vaporization, and Critical Parameters of a Series of Linear Aliphatic Dimethyl Esters of Dicarboxylic Acids
- Influence of the Molecular Structure on the Volumetric Properties and Viscosities of Dialkyl Adipates (Dimethyl, Diethyl, and Diisobutyl Adipates)
- Thermodynamic and Spectroscopic Study of the Ternary System Dimethyladipate + Tetrahydrofuran +1-Butanol at T = (288.15 to 323.15) K
- Densities, Viscosities and Refractive Indices of the Ternary Mixture Dimethyladipate + 2-Butanone + 1-Butanol at T = (288.15 to 323.15) K
- Vapor-Liquid Equilibrium of Mixtures Containing Adipic Acid, Glutaric Acid, Dimethyl Adipate, Dimethyl Glutarate, Methanol, and Water
- Liquid-Liquid Equilibria for Ternary Systems of Water + Formic Acid + Dibasic Esters
- Joback Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.