- InChI
- InChI=1S/C10H18O4/c1-3-13-9(11)7-5-6-8-10(12)14-4-2/h3-8H2,1-2H3
- InChI Key
- VIZORQUEIQEFRT-UHFFFAOYSA-N
- Formula
- C10H18O4
- SMILES
- CCOC(=O)CCCCC(=O)OCC
- Molecular Weight1
- 202.25
- CAS
- 141-28-6
- Other Names
-
- 1,6-Diethyl hexanedioate
- Adipic acid, diethyl ester
- DIETHYL HEXANEDIOATE
- Diethylester kyseliny adipove
- Ethyl adipate
- Ethyl «delta»-carboethoxyvalerate
- Ethyl «delta»-carboethoxyvalerate
- Hexanedioic acid, 1,6-diethyl ester
- Hexanedioic acid, diethyl ester
- NSC 19160
- diethyl 1,6-hexanedioate
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- D*i : Self diffusion coefficient (m2/s).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔfG° | -434.52 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -739.33 | kJ/mol | Joback Calculated Property |
| ΔfusH° | 27.23 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 56.17 | kJ/mol | Joback Calculated Property |
| log10WS | -1.68 | Aq. Sol... | |
| logPoct/wat | 1.673 | Crippen Calculated Property | |
| McVol | 166.640 | ml/mol | McGowan Calculated Property |
| Pc | 2298.11 | kPa | Joback Calculated Property |
| Inp | [1344.00; 1396.00] |
|
|
| Inp | 1368.00 | NIST | |
| Inp | 1349.00 | NIST | |
| Inp | 1345.50 | NIST | |
| Inp | 1353.60 | NIST | |
| Inp | 1386.00 | NIST | |
| Inp | Outlier 1396.00 | NIST | |
| Inp | 1354.00 | NIST | |
| Inp | 1353.00 | NIST | |
| Inp | 1352.00 | NIST | |
| Inp | 1350.00 | NIST | |
| Inp | 1368.00 | NIST | |
| Inp | 1352.00 | NIST | |
| Inp | 1383.00 | NIST | |
| Inp | Outlier 1396.00 | NIST | |
| Inp | 1344.00 | NIST | |
| Inp | 1358.00 | NIST | |
| Inp | 1344.00 | NIST | |
| Inp | 1368.00 | NIST | |
| Inp | 1349.00 | NIST | |
| Inp | 1354.00 | NIST | |
| Inp | 1345.50 | NIST | |
| Inp | 1352.00 | NIST | |
| Inp | 1383.00 | NIST | |
| I | [1858.00; 1897.00] |
|
|
| I | 1897.00 | NIST | |
| I | 1858.00 | NIST | |
| I | 1897.00 | NIST | |
| I | 1858.00 | NIST | |
| Tboil | [406.95; 524.20] | K |
|
| Tboil | 406.95 | K | KDB |
| Tboil | 518.30 | K | Liquid-... |
| Tboil | 518.40 | K | (Liquid... |
| Tboil | 518.35 | K | Liquid-... |
| Tboil | 524.20 | K | NIST |
| Tc | 697.00 | K | Critica... |
| Tfus | [239.70; 253.88] | K |
|
| Tfus | 253.35 | K | KDB |
| Tfus | 253.88 | K | Aq. Sol... |
| Tfus | 253.25 ± 0.50 | K | NIST |
| Tfus | 251.00 ± 2.00 | K | NIST |
| Tfus | 239.70 ± 0.60 | K | NIST |
| Vc | 0.643 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [415.69; 486.74] | J/mol×K | [580.78; 760.87] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 420 440 460 480 600 650 700 750 | ||||
| Cp,gas | 415.69 | J/mol×K | 580.78 | Joback Calculated Property |
| Cp,gas | 428.88 | J/mol×K | 610.80 | Joback Calculated Property |
| Cp,gas | 441.54 | J/mol×K | 640.81 | Joback Calculated Property |
| Cp,gas | 453.66 | J/mol×K | 670.83 | Joback Calculated Property |
| Cp,gas | 465.23 | J/mol×K | 700.84 | Joback Calculated Property |
| Cp,gas | 476.26 | J/mol×K | 730.86 | Joback Calculated Property |
| Cp,gas | 486.74 | J/mol×K | 760.87 | Joback Calculated Property |
| η | [0.0009400; 0.0045700] | Pa×s | [283.15; 373.15] |
|
|
T(K) Dynamic viscosity (Pa×s) 1.00e-3 1.50e-3 2.00e-3 2.50e-3 3.00e-3 3.50e-3 4.00e-3 4.50e-3 300 320 340 360 | ||||
| η | 0.0045700 | Pa×s | 283.15 | Influen... |
| η | 0.0039900 | Pa×s | 288.15 | Influen... |
| η | 0.0035100 | Pa×s | 293.15 | Influen... |
| η | 0.0031200 | Pa×s | 298.15 | Influen... |
| η | 0.0027900 | Pa×s | 303.15 | Influen... |
| η | 0.0025100 | Pa×s | 308.15 | Influen... |
| η | 0.0022800 | Pa×s | 313.15 | Influen... |
| η | 0.0020700 | Pa×s | 318.15 | Influen... |
| η | 0.0019000 | Pa×s | 323.15 | Influen... |
| η | 0.0017500 | Pa×s | 328.15 | Influen... |
| η | 0.0016100 | Pa×s | 333.15 | Influen... |
| η | 0.0014900 | Pa×s | 338.15 | Influen... |
| η | 0.0013900 | Pa×s | 343.15 | Influen... |
| η | 0.0012900 | Pa×s | 348.15 | Influen... |
| η | 0.0012100 | Pa×s | 353.15 | Influen... |
| η | 0.0011300 | Pa×s | 358.15 | Influen... |
| η | 0.0010600 | Pa×s | 363.15 | Influen... |
| η | 0.0010000 | Pa×s | 368.15 | Influen... |
| η | 0.0009400 | Pa×s | 373.15 | Influen... |
| ΔvapH | 57.50 | kJ/mol | 430.00 | NIST |
| Pvap | [2.20e-03; 0.11] | kPa | [303.50; 352.20] |
|
|
T(K) Vapor pressure (kPa) 0 0.02 0.04 0.06 0.08 0.1 320 340 | ||||
| Pvap | 2.20e-03 | kPa | 303.50 | Vapor P... |
| Pvap | 3.43e-03 | kPa | 308.20 | Vapor P... |
| Pvap | 5.23e-03 | kPa | 313.30 | Vapor P... |
| Pvap | 7.93e-03 | kPa | 318.20 | Vapor P... |
| Pvap | 0.01 | kPa | 323.10 | Vapor P... |
| Pvap | 0.02 | kPa | 328.20 | Vapor P... |
| Pvap | 0.02 | kPa | 329.60 | Vapor P... |
| Pvap | 0.03 | kPa | 333.20 | Vapor P... |
| Pvap | 0.03 | kPa | 335.20 | Vapor P... |
| Pvap | 0.04 | kPa | 338.20 | Vapor P... |
| Pvap | 0.05 | kPa | 340.20 | Vapor P... |
| Pvap | 0.06 | kPa | 343.20 | Vapor P... |
| Pvap | 0.07 | kPa | 346.20 | Vapor P... |
| Pvap | 0.09 | kPa | 349.10 | Vapor P... |
| Pvap | 0.11 | kPa | 352.20 | Vapor P... |
| D*i | [0.00; 0.00] | m2/s | [293.43; 338.47] |
|
|
T(K) Self diffusion coefficient (m2/s) 3.00e-10 4.00e-10 5.00e-10 6.00e-10 7.00e-10 8.00e-10 9.00e-10 300 310 320 330 | ||||
| D*i | 0.00 | m2/s | 293.43 | Self-di... |
| D*i | 0.00 | m2/s | 302.44 | Self-di... |
| D*i | 0.00 | m2/s | 311.45 | Self-di... |
| D*i | 0.00 | m2/s | 320.46 | Self-di... |
| D*i | 0.00 | m2/s | 329.45 | Self-di... |
| D*i | 0.00 | m2/s | 338.47 | Self-di... |
| γ | [0.02; 0.03] | N/m | [293.16; 373.14] |
|
|
T(K) Surface Tension (N/m) 0.02 0.03 0.03 0.03 0.03 300 320 340 360 | ||||
| γ | 0.03 | N/m | 293.16 | Surface... |
| γ | 0.03 | N/m | 298.09 | Surface... |
| γ | 0.03 | N/m | 303.17 | Surface... |
| γ | 0.03 | N/m | 308.11 | Surface... |
| γ | 0.03 | N/m | 313.18 | Surface... |
| γ | 0.03 | N/m | 318.15 | Surface... |
| γ | 0.03 | N/m | 323.17 | Surface... |
| γ | 0.03 | N/m | 328.12 | Surface... |
| γ | 0.03 | N/m | 333.16 | Surface... |
| γ | 0.03 | N/m | 338.16 | Surface... |
| γ | 0.03 | N/m | 343.15 | Surface... |
| γ | 0.03 | N/m | 348.13 | Surface... |
| γ | 0.03 | N/m | 353.16 | Surface... |
| γ | 0.03 | N/m | 358.13 | Surface... |
| γ | 0.03 | N/m | 363.13 | Surface... |
| γ | 0.02 | N/m | 368.15 | Surface... |
| γ | 0.02 | N/m | 373.14 | Surface... |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 283.15 | 100.00 | 0.0045 |
| 283.15 | 1000.00 | 0.0046 |
| 283.15 | 5000.00 | 0.0048 |
| 283.15 | 10000.00 | 0.0051 |
| 283.15 | 15000.00 | 0.0053 |
| 283.15 | 20000.00 | 0.0056 |
| 283.16 | 30000.00 | 0.0062 |
| 283.15 | 40000.00 | 0.0069 |
| 293.15 | 100.00 | 0.0035 |
| 293.15 | 1000.00 | 0.0035 |
| 293.15 | 5000.00 | 0.0037 |
| 293.15 | 10000.00 | 0.0039 |
| 293.15 | 15000.00 | 0.0041 |
| 293.15 | 20000.00 | 0.0043 |
| 293.15 | 30000.00 | 0.0047 |
| 293.15 | 40000.00 | 0.0052 |
| 303.15 | 100.00 | 0.0028 |
| 303.15 | 1000.00 | 0.0028 |
| 303.15 | 5000.00 | 0.0029 |
| 303.15 | 10000.00 | 0.0031 |
| 303.15 | 15000.00 | 0.0032 |
| 303.15 | 20000.00 | 0.0034 |
| 303.15 | 30000.00 | 0.0037 |
| 303.15 | 40000.00 | 0.0040 |
| 313.15 | 100.00 | 0.0023 |
| 313.16 | 1000.00 | 0.0023 |
| 313.15 | 5000.00 | 0.0024 |
| 313.15 | 10000.00 | 0.0025 |
| 313.15 | 15000.00 | 0.0026 |
| 313.15 | 20000.00 | 0.0027 |
| 313.15 | 30000.00 | 0.0030 |
| 313.15 | 40000.00 | 0.0033 |
| 323.15 | 100.00 | 0.0019 |
| 323.15 | 1000.00 | 0.0019 |
| 323.15 | 5000.00 | 0.0020 |
| 323.15 | 10000.00 | 0.0021 |
| 323.15 | 15000.00 | 0.0022 |
| 323.15 | 20000.00 | 0.0022 |
| 323.15 | 30000.00 | 0.0025 |
| 323.15 | 40000.00 | 0.0027 |
| 333.15 | 100.00 | 0.0016 |
| 333.15 | 1000.00 | 0.0016 |
| 333.15 | 5000.00 | 0.0017 |
| 333.15 | 10000.00 | 0.0017 |
| 333.15 | 15000.00 | 0.0018 |
| 333.15 | 20000.00 | 0.0019 |
| 333.15 | 30000.00 | 0.0021 |
| 333.15 | 40000.00 | 0.0022 |
| 343.15 | 100.00 | 0.0014 |
| 343.15 | 1000.00 | 0.0014 |
| 343.15 | 5000.00 | 0.0014 |
| 343.15 | 10000.00 | 0.0015 |
| 343.15 | 15000.00 | 0.0016 |
| 343.15 | 20000.00 | 0.0016 |
| 343.15 | 30000.00 | 0.0018 |
| 343.15 | 40000.00 | 0.0019 |
| 353.15 | 100.00 | 0.0012 |
| 353.14 | 1000.00 | 0.0012 |
| 353.15 | 5000.00 | 0.0012 |
| 353.15 | 10000.00 | 0.0013 |
| 353.15 | 15000.00 | 0.0014 |
| 353.15 | 20000.00 | 0.0014 |
| 353.15 | 30000.00 | 0.0015 |
| 353.15 | 40000.00 | 0.0017 |
| 363.15 | 100.00 | 0.0010 |
| 363.15 | 1000.00 | 0.0010 |
| 363.15 | 5000.00 | 0.0011 |
| 363.15 | 10000.00 | 0.0011 |
| 363.15 | 15000.00 | 0.0012 |
| 363.15 | 20000.00 | 0.0012 |
| 363.15 | 30000.00 | 0.0013 |
| 363.15 | 40000.00 | 0.0015 |
| Reference | ||
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 100.00 | 0.0028 |
| 303.15 | 4520.00 | 0.0029 |
| 303.15 | 9610.00 | 0.0031 |
| 303.15 | 14700.00 | 0.0032 |
| 303.15 | 19790.00 | 0.0033 |
| 313.15 | 100.00 | 0.0023 |
| 313.15 | 4520.00 | 0.0023 |
| 313.15 | 9630.00 | 0.0025 |
| 313.15 | 14750.00 | 0.0026 |
| 313.15 | 19890.00 | 0.0027 |
| 323.15 | 100.00 | 0.0018 |
| 323.15 | 4520.00 | 0.0019 |
| 323.15 | 9600.00 | 0.0020 |
| 323.15 | 14690.00 | 0.0021 |
| 323.15 | 19710.00 | 0.0022 |
| 333.15 | 100.00 | 0.0016 |
| 333.15 | 4520.00 | 0.0016 |
| 333.15 | 9630.00 | 0.0017 |
| 333.15 | 14710.00 | 0.0018 |
| 333.15 | 19710.00 | 0.0019 |
| 343.15 | 100.00 | 0.0014 |
| 343.15 | 4510.00 | 0.0014 |
| 343.15 | 9600.00 | 0.0015 |
| 343.15 | 14700.00 | 0.0015 |
| 343.15 | 19700.00 | 0.0016 |
| 353.15 | 100.00 | 0.0012 |
| 353.15 | 4520.00 | 0.0012 |
| 353.15 | 9620.00 | 0.0013 |
| 353.15 | 14710.00 | 0.0013 |
| 353.15 | 19680.00 | 0.0014 |
| 363.15 | 100.00 | 0.0010 |
| 363.15 | 4520.00 | 0.0011 |
| 363.15 | 9610.00 | 0.0011 |
| 363.15 | 14700.00 | 0.0012 |
| 363.15 | 19710.00 | 0.0012 |
| 373.15 | 100.00 | 0.0009 |
| 373.15 | 4520.00 | 0.0010 |
| 373.15 | 9620.00 | 0.0010 |
| 373.15 | 14680.00 | 0.0010 |
| 373.15 | 19910.00 | 0.0011 |
| Reference | ||
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 100.00 | 1006.6 |
| 293.15 | 10000.00 | 1013.1 |
| 293.15 | 20000.00 | 1019.4 |
| 293.15 | 30000.00 | 1025.3 |
| 293.15 | 40000.00 | 1030.9 |
| 293.15 | 50000.00 | 1036.2 |
| 293.15 | 60000.00 | 1041.2 |
| 293.15 | 70000.00 | 1046.0 |
| 293.15 | 80000.00 | 1050.8 |
| 293.15 | 90000.00 | 1055.2 |
| 293.15 | 100000.00 | 1059.6 |
| 293.15 | 110000.00 | 1063.8 |
| 293.15 | 120000.00 | 1067.9 |
| 293.15 | 130000.00 | 1071.8 |
| 293.15 | 140000.00 | 1075.7 |
| 303.15 | 100.00 | 997.0 |
| 303.15 | 10000.00 | 1003.9 |
| 303.15 | 20000.00 | 1010.4 |
| 303.15 | 30000.00 | 1016.6 |
| 303.15 | 40000.00 | 1022.5 |
| 303.15 | 50000.00 | 1028.0 |
| 303.15 | 60000.00 | 1033.3 |
| 303.15 | 70000.00 | 1038.3 |
| 303.15 | 80000.00 | 1043.2 |
| 303.15 | 90000.00 | 1047.8 |
| 303.15 | 100000.00 | 1052.3 |
| 303.15 | 110000.00 | 1056.5 |
| 303.15 | 120000.00 | 1060.9 |
| 303.15 | 130000.00 | 1064.8 |
| 303.15 | 140000.00 | 1068.9 |
| 313.15 | 100.00 | 987.7 |
| 313.15 | 10000.00 | 994.9 |
| 313.15 | 20000.00 | 1001.8 |
| 313.15 | 30000.00 | 1008.3 |
| 313.15 | 40000.00 | 1014.3 |
| 313.15 | 50000.00 | 1020.1 |
| 313.15 | 60000.00 | 1025.6 |
| 313.15 | 70000.00 | 1030.8 |
| 313.15 | 80000.00 | 1035.9 |
| 313.15 | 90000.00 | 1040.7 |
| 313.15 | 100000.00 | 1045.1 |
| 313.15 | 110000.00 | 1049.5 |
| 313.15 | 120000.00 | 1053.9 |
| 313.15 | 130000.00 | 1058.1 |
| 313.15 | 140000.00 | 1062.1 |
| 323.15 | 100.00 | 978.3 |
| 323.15 | 10000.00 | 986.2 |
| 323.15 | 20000.00 | 993.4 |
| 323.15 | 30000.00 | 1000.1 |
| 323.15 | 40000.00 | 1006.4 |
| 323.15 | 50000.00 | 1012.4 |
| 323.15 | 60000.00 | 1018.0 |
| 323.15 | 70000.00 | 1023.4 |
| 323.15 | 80000.00 | 1028.6 |
| 323.15 | 90000.00 | 1033.6 |
| 323.15 | 100000.00 | 1038.3 |
| 323.15 | 110000.00 | 1042.8 |
| 323.15 | 120000.00 | 1047.4 |
| 323.15 | 130000.00 | 1051.6 |
| 323.15 | 140000.00 | 1055.8 |
| 333.15 | 100.00 | 969.0 |
| 333.15 | 10000.00 | 977.1 |
| 333.15 | 20000.00 | 984.8 |
| 333.15 | 30000.00 | 991.7 |
| 333.15 | 40000.00 | 998.3 |
| 333.15 | 50000.00 | 1004.6 |
| 333.15 | 60000.00 | 1010.4 |
| 333.15 | 70000.00 | 1016.0 |
| 333.15 | 80000.00 | 1021.3 |
| 333.15 | 90000.00 | 1026.4 |
| 333.15 | 100000.00 | 1031.3 |
| 333.15 | 110000.00 | 1035.9 |
| 333.15 | 120000.00 | 1040.4 |
| 333.15 | 130000.00 | 1045.0 |
| 333.15 | 140000.00 | 1049.3 |
| 343.15 | 100.00 | 959.8 |
| 343.15 | 10000.00 | 968.2 |
| 343.15 | 20000.00 | 976.1 |
| 343.15 | 30000.00 | 983.3 |
| 343.15 | 40000.00 | 990.3 |
| 343.15 | 50000.00 | 996.7 |
| 343.15 | 60000.00 | 1002.9 |
| 343.15 | 70000.00 | 1008.7 |
| 343.15 | 80000.00 | 1014.3 |
| 343.15 | 90000.00 | 1019.5 |
| 343.15 | 100000.00 | 1024.6 |
| 343.15 | 110000.00 | 1029.5 |
| 343.15 | 120000.00 | 1034.2 |
| 343.15 | 130000.00 | 1038.5 |
| 343.15 | 140000.00 | 1042.9 |
| 353.15 | 100.00 | 949.7 |
| 353.15 | 10000.00 | 958.7 |
| 353.15 | 20000.00 | 967.0 |
| 353.15 | 30000.00 | 974.8 |
| 353.15 | 40000.00 | 982.1 |
| 353.15 | 50000.00 | 989.0 |
| 353.15 | 60000.00 | 995.4 |
| 353.15 | 70000.00 | 1001.2 |
| 353.15 | 80000.00 | 1006.9 |
| 353.15 | 90000.00 | 1012.4 |
| 353.15 | 100000.00 | 1017.4 |
| 353.15 | 110000.00 | 1022.3 |
| 353.15 | 120000.00 | 1026.7 |
| 353.15 | 130000.00 | 1031.4 |
| 353.15 | 140000.00 | 1036.2 |
| 363.15 | 100.00 | 940.2 |
| 363.15 | 10000.00 | 949.9 |
| 363.15 | 20000.00 | 958.6 |
| 363.15 | 30000.00 | 966.6 |
| 363.15 | 40000.00 | 974.2 |
| 363.15 | 50000.00 | 981.3 |
| 363.15 | 60000.00 | 987.7 |
| 363.15 | 70000.00 | 994.0 |
| 363.15 | 80000.00 | 999.9 |
| 363.15 | 90000.00 | 1005.4 |
| 363.15 | 100000.00 | 1010.8 |
| 363.15 | 110000.00 | 1015.9 |
| 363.15 | 120000.00 | 1021.0 |
| 363.15 | 130000.00 | 1025.8 |
| 363.15 | 140000.00 | 1030.4 |
| 373.15 | 100.00 | 930.9 |
| 373.15 | 10000.00 | 940.9 |
| 373.15 | 20000.00 | 950.1 |
| 373.15 | 30000.00 | 958.8 |
| 373.15 | 40000.00 | 966.7 |
| 373.15 | 50000.00 | 973.6 |
| 373.15 | 60000.00 | 980.3 |
| 373.15 | 70000.00 | 986.7 |
| 373.15 | 80000.00 | 992.8 |
| 373.15 | 90000.00 | 998.7 |
| 373.15 | 100000.00 | 1004.1 |
| 373.15 | 110000.00 | 1009.3 |
| 373.15 | 120000.00 | 1014.3 |
| 373.15 | 130000.00 | 1019.3 |
| 373.15 | 140000.00 | 1023.9 |
| 383.15 | 100.00 | 921.3 |
| 383.15 | 10000.00 | 932.0 |
| 383.15 | 20000.00 | 941.7 |
| 383.15 | 30000.00 | 950.2 |
| 383.15 | 40000.00 | 958.5 |
| 383.15 | 50000.00 | 966.0 |
| 383.15 | 60000.00 | 973.0 |
| 383.15 | 70000.00 | 979.6 |
| 383.15 | 80000.00 | 986.0 |
| 383.15 | 90000.00 | 991.9 |
| 383.15 | 100000.00 | 997.6 |
| 383.15 | 110000.00 | 1003.0 |
| 383.15 | 120000.00 | 1008.3 |
| 383.15 | 130000.00 | 1013.1 |
| 383.15 | 140000.00 | 1017.8 |
| 393.15 | 100.00 | 911.6 |
| 393.15 | 10000.00 | 922.1 |
| 393.15 | 20000.00 | 932.2 |
| 393.15 | 30000.00 | 941.4 |
| 393.15 | 40000.00 | 949.8 |
| 393.15 | 50000.00 | 957.1 |
| 393.15 | 60000.00 | 964.3 |
| 393.15 | 70000.00 | 971.5 |
| 393.15 | 80000.00 | 978.0 |
| 393.15 | 90000.00 | 984.2 |
| 393.15 | 100000.00 | 990.1 |
| 393.15 | 110000.00 | 995.7 |
| 393.15 | 120000.00 | 1000.8 |
| 393.15 | 130000.00 | 1006.1 |
| 393.15 | 140000.00 | 1011.0 |
| 403.15 | 100.00 | 902.0 |
| 403.15 | 10000.00 | 912.7 |
| 403.15 | 20000.00 | 923.3 |
| 403.15 | 30000.00 | 933.2 |
| 403.15 | 40000.00 | 941.5 |
| 403.15 | 50000.00 | 949.8 |
| 403.15 | 60000.00 | 957.2 |
| 403.15 | 70000.00 | 964.4 |
| 403.15 | 80000.00 | 971.0 |
| 403.15 | 90000.00 | 977.3 |
| 403.15 | 100000.00 | 983.3 |
| 403.15 | 110000.00 | 989.0 |
| 403.15 | 120000.00 | 994.6 |
| 403.15 | 130000.00 | 999.7 |
| 403.15 | 140000.00 | 1004.7 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [0.11; 101.47] | kPa | [347.15; 513.15] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | -5.74435e+01 | |||
| Coefficient B | -3.29310e+03 | |||
| Coefficient C | 1.11549e+01 | |||
| Coefficient D | -4.30055e-06 | |||
| Temperature range, min. | 347.15 | |||
| Temperature range, max. | 513.15 | |||
|
T(K) Vapor pressure (kPa) 0 20 40 60 80 100 350 400 450 500 | ||||
| Pvap | 0.11 | kPa | 347.15 | Calculated Property |
| Pvap | 0.30 | kPa | 365.59 | Calculated Property |
| Pvap | 0.76 | kPa | 384.04 | Calculated Property |
| Pvap | 1.79 | kPa | 402.48 | Calculated Property |
| Pvap | 3.95 | kPa | 420.93 | Calculated Property |
| Pvap | 8.27 | kPa | 439.37 | Calculated Property |
| Pvap | 16.48 | kPa | 457.82 | Calculated Property |
| Pvap | 31.42 | kPa | 476.26 | Calculated Property |
| Pvap | 57.52 | kPa | 494.71 | Calculated Property |
| Pvap | 101.47 | kPa | 513.15 | Calculated Property |
Similar Compounds
Find more compounds similar to Diethyl adipate.
Mixtures
- Diethyl adipate + Butanoic acid + Water
- Diethyl adipate + Water
- Diethyl adipate + Propanoic acid + Water
- Diethyl adipate + Acetic acid + Water
- Diethyl adipate + Heptane
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Viscosity Measurements of Dialkyl Adipates in the Temperature Range of (283 to 363) K and up to 40 MPa
- Surface tension of diethyl carbonate, 1,2-dimethoxyethane and diethyl adipate
- Liquid-liquid equilibria of (water + butyric acid + diethyl succinate or diethyl glutarate or diethyl adipate) ternary systems
- Self-diffusivity measurements of dimethyl, diethyl, dipropyl, dibutyl, Bis(2-ethylhexyl) adipates from (293 - 339) K by a PGSE-NMR spin-echo technique
- Critical temperatures and pressures of some dicarboxylic acid diethyl esters
- (Liquid + liquid) equilibria of (water + propionic acid + diethyl succinate or diethyl glutarate or diethyl adipate) ternary systems
- Vapor Pressures and Enthalpies of Vaporization of a Series of the Symmetric Linear n-Alkyl Esters of Dicarboxylic Acids
- Influence of the Molecular Structure on the Volumetric Properties and Viscosities of Dialkyl Adipates (Dimethyl, Diethyl, and Diisobutyl Adipates)
- Liquid-Liquid Equilibria of (Water + Acetic Acid + Diethyl Succinate or Diethyl Glutarate or Diethyl Adipate) Ternary Systems
- Density of Diethyl Adipate using a New Vibrating Tube Densimeter from (293.15 to 403.15) K and up to 140 MPa. Calibration and Measurements
- Density and Viscosity Measurements of Diethyl Adipate from (303 to 373) K and up to 20 MPa
- Mutual Diffusion Coefficients of Diethyl Carbonate and Diethyl Adipate in Heptane at T = (278.15 to 338.15) K under Atmospheric Pressure
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- McGowan Method
- NIST Webbook
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.