- InChI
- InChI=1S/C20H40O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h3-19H2,1-2H3
- InChI Key
- MVLVMROFTAUDAG-UHFFFAOYSA-N
- Formula
- C20H40O2
- SMILES
- CCCCCCCCCCCCCCCCCC(=O)OCC
- Molecular Weight1
- 312.53
- CAS
- 111-61-5
- Other Names
-
- ETHYL ESTER
- ETHYL N-OCTADECANOATE
- Ethyl ocatadecanoate
- Ethyl octadecanoate
- Ethyl octadecanoate (Ethyl stearate)
- Ethyl stearate
- Radia 7185
- STEARIC ACID
- Stearic acid, ethyl ester
- ΔcH°solid : Standard solid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔsubH : Enthalpy of sublimation at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔcH°solid | -12602.20 ± 1.80 | kJ/mol | NIST |
| ΔfG° | -116.40 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -700.93 | kJ/mol | Joback Calculated Property |
| ΔfusH° | 50.34 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 69.27 | kJ/mol | Joback Calculated Property |
| log10WS | -7.06 | Crippen Calculated Property | |
| logPoct/wat | 6.811 | Crippen Calculated Property | |
| McVol | 300.100 | ml/mol | McGowan Calculated Property |
| Pc | 1045.97 | kPa | Joback Calculated Property |
| Inp | [2171.00; 2207.00] |
|
|
| Inp | 2175.00 | NIST | |
| Inp | 2179.00 | NIST | |
| Inp | 2183.00 | NIST | |
| Inp | 2171.00 | NIST | |
| Inp | 2180.00 | NIST | |
| Inp | 2194.00 | NIST | |
| Inp | 2190.00 | NIST | |
| Inp | 2193.00 | NIST | |
| Inp | 2195.00 | NIST | |
| Inp | 2194.00 | NIST | |
| Inp | 2181.00 | NIST | |
| Inp | 2194.00 | NIST | |
| Inp | 2202.00 | NIST | |
| Inp | 2177.00 | NIST | |
| Inp | 2175.00 | NIST | |
| Inp | 2197.00 | NIST | |
| Inp | 2199.00 | NIST | |
| Inp | 2178.00 | NIST | |
| Inp | 2192.00 | NIST | |
| Inp | 2197.00 | NIST | |
| Inp | 2190.00 | NIST | |
| Inp | 2194.00 | NIST | |
| Inp | 2188.00 | NIST | |
| Inp | 2189.00 | NIST | |
| Inp | 2196.00 | NIST | |
| Inp | 2181.00 | NIST | |
| Inp | 2181.00 | NIST | |
| Inp | 2174.00 | NIST | |
| Inp | 2192.00 | NIST | |
| Inp | 2197.00 | NIST | |
| Inp | 2200.00 | NIST | |
| Inp | 2196.00 | NIST | |
| Inp | 2191.00 | NIST | |
| Inp | 2195.00 | NIST | |
| Inp | 2184.00 | NIST | |
| Inp | 2180.00 | NIST | |
| Inp | 2195.00 | NIST | |
| Inp | 2195.00 | NIST | |
| Inp | 2207.00 | NIST | |
| Inp | 2175.00 | NIST | |
| Inp | 2180.00 | NIST | |
| Inp | 2192.00 | NIST | |
| Inp | 2195.00 | NIST | |
| Inp | 2207.00 | NIST | |
| I | [2409.00; 2483.00] |
|
|
| I | 2446.00 | NIST | |
| I | 2444.00 | NIST | |
| I | 2459.00 | NIST | |
| I | 2458.00 | NIST | |
| I | 2467.00 | NIST | |
| I | 2429.00 | NIST | |
| I | 2442.00 | NIST | |
| I | 2425.00 | NIST | |
| I | 2450.00 | NIST | |
| I | 2458.00 | NIST | |
| I | 2424.00 | NIST | |
| I | 2451.00 | NIST | |
| I | 2458.00 | NIST | |
| I | 2455.00 | NIST | |
| I | 2467.00 | NIST | |
| I | 2409.00 | NIST | |
| I | 2416.00 | NIST | |
| I | 2483.00 | NIST | |
| I | 2464.00 | NIST | |
| I | 2430.00 | NIST | |
| I | 2467.00 | NIST | |
| I | 2467.00 | NIST | |
| I | 2409.00 | NIST | |
| Tboil | 733.29 | K | Joback Calculated Property |
| Tc | 904.52 | K | Joback Calculated Property |
| Tfus | [304.05; 307.40] | K |
|
| Tfus | 307.40 | K | Solid-l... |
| Tfus | 307.40 | K | Influen... |
| Tfus | 307.20 ± 2.00 | K | NIST |
| Tfus | 306.90 ± 0.50 | K | NIST |
| Tfus | 304.05 ± 0.40 | K | NIST |
| Tfus | 306.55 ± 0.30 | K | NIST |
| Tfus | 304.30 ± 1.50 | K | NIST |
| Vc | 1.179 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [908.52; 1013.17] | J/mol×K | [733.29; 904.52] |
|
| Cp,gas | 908.52 | J/mol×K | 733.29 | Joback Calculated Property |
| Cp,gas | 928.17 | J/mol×K | 761.83 | Joback Calculated Property |
| Cp,gas | 946.91 | J/mol×K | 790.37 | Joback Calculated Property |
| Cp,gas | 964.76 | J/mol×K | 818.91 | Joback Calculated Property |
| Cp,gas | 981.74 | J/mol×K | 847.45 | Joback Calculated Property |
| Cp,gas | 997.86 | J/mol×K | 875.99 | Joback Calculated Property |
| Cp,gas | 1013.17 | J/mol×K | 904.52 | Joback Calculated Property |
| η | [0.0019777; 0.0050823] | Pa×s | [313.15; 363.15] |
|
| η | 0.0050823 | Pa×s | 313.15 | Densiti... |
| η | 0.0045285 | Pa×s | 318.15 | Densiti... |
| η | 0.0040574 | Pa×s | 323.15 | Densiti... |
| η | 0.0036535 | Pa×s | 328.15 | Densiti... |
| η | 0.0033073 | Pa×s | 333.15 | Densiti... |
| η | 0.0030072 | Pa×s | 338.15 | Densiti... |
| η | 0.0027439 | Pa×s | 343.15 | Densiti... |
| η | 0.0025153 | Pa×s | 348.15 | Densiti... |
| η | 0.0023132 | Pa×s | 353.15 | Densiti... |
| η | 0.0021355 | Pa×s | 358.15 | Densiti... |
| η | 0.0019777 | Pa×s | 363.15 | Densiti... |
| ΔfusH | 59.83 | kJ/mol | 307.00 | NIST |
| ΔsubH | 161.40 | kJ/mol | 301.50 | NIST |
| ΔvapH | [92.20; 111.90] | kJ/mol | [298.00; 461.50] |
|
| ΔvapH | 109.30 | kJ/mol | 298.00 | A Compa... |
| ΔvapH | 106.80 | kJ/mol | 319.00 | NIST |
| ΔvapH | 92.20 | kJ/mol | 373.00 | Express... |
| ΔvapH | 111.90 | kJ/mol | 461.50 | NIST |
| Pvap | [1.33; 9.33] | kPa | [490.97; 533.97] |
|
| Pvap | 1.33 | kPa | 490.97 | Determi... |
| Pvap | 2.67 | kPa | 505.55 | Determi... |
| Pvap | 4.00 | kPa | 512.98 | Determi... |
| Pvap | 5.33 | kPa | 520.56 | Determi... |
| Pvap | 5.33 | kPa | 520.56 | Vapor l... |
| Pvap | 6.67 | kPa | 524.45 | Determi... |
| Pvap | 8.00 | kPa | 525.78 | Determi... |
| Pvap | 9.33 | kPa | 533.97 | Determi... |
| n0 | 1.43600 | 313.15 | (Vapor ... | |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | [472.20; 487.20] | K | [1.30; 2.00] |
|
| Tboilr | 472.20 | K | 1.30 | NIST |
| Tboilr | 487.20 | K | 2.00 | NIST |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.67] | kPa | [517.80; 648.64] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 2.02510e+01 | |||
| Coefficient B | -7.76715e+03 | |||
| Coefficient C | -1.28730e+02 | |||
| Temperature range, min. | 517.80 | |||
| Temperature range, max. | 648.64 | |||
| Pvap | 1.33 | kPa | 517.80 | Calculated Property |
| Pvap | 2.74 | kPa | 532.34 | Calculated Property |
| Pvap | 5.34 | kPa | 546.88 | Calculated Property |
| Pvap | 9.97 | kPa | 561.41 | Calculated Property |
| Pvap | 17.88 | kPa | 575.95 | Calculated Property |
| Pvap | 30.88 | kPa | 590.49 | Calculated Property |
| Pvap | 51.61 | kPa | 605.03 | Calculated Property |
| Pvap | 83.65 | kPa | 619.56 | Calculated Property |
| Pvap | 131.87 | kPa | 634.10 | Calculated Property |
| Pvap | 202.67 | kPa | 648.64 | Calculated Property |
| Pvap | [1.87e-06; 1.81e-05] | kPa | [310.15; 328.15] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 2.81930e+01 | |||
| Coefficient B | -1.28428e+04 | |||
| Coefficient C | 4.76766e-03 | |||
| Coefficient D | -8.25160e-09 | |||
| Temperature range, min. | 310.15 | |||
| Temperature range, max. | 328.15 | |||
| Pvap | 1.87e-06 | kPa | 310.15 | Calculated Property |
| Pvap | 2.44e-06 | kPa | 312.15 | Calculated Property |
| Pvap | 3.17e-06 | kPa | 314.15 | Calculated Property |
| Pvap | 4.11e-06 | kPa | 316.15 | Calculated Property |
| Pvap | 5.30e-06 | kPa | 318.15 | Calculated Property |
| Pvap | 6.82e-06 | kPa | 320.15 | Calculated Property |
| Pvap | 8.75e-06 | kPa | 322.15 | Calculated Property |
| Pvap | 1.12e-05 | kPa | 324.15 | Calculated Property |
| Pvap | 1.43e-05 | kPa | 326.15 | Calculated Property |
| Pvap | 1.81e-05 | kPa | 328.15 | Calculated Property |
Similar Compounds
Find more compounds similar to Octadecanoic acid, ethyl ester.
Mixtures
- Dodecanoic acid, ethyl ester + Octadecanoic acid, ethyl ester
- Hexadecanoic acid, ethyl ester + Octadecanoic acid, ethyl ester
- Dodecanoic acid, ethyl ester + Hexadecanoic acid, ethyl ester + Octadecanoic acid, ethyl ester
- Ethanol + Octadecanoic acid, ethyl ester
- Octadecanoic acid, ethyl ester + Nonanoic acid, 3-methylbutyl ester
- Isoamyl laurate + Octadecanoic acid, ethyl ester
- Ethanol + Octadecanoic acid, ethyl ester + Glycerin
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Crippen Method
- Solid-liquid equilibrium in ternary mixtures of ethyl laurate, ethyl palmitate and ethyl stearate
- Determination of the vapor pressure of ethyl esters by Differential Scanning Calorimetry
- (Vapor + liquid) equilibrium for the binary systems {water + glycerol} and {ethanol + glycerol, ethyl stearate, and ethyl palmitate} at low pressures
- (Liquid + liquid) equilibrium for the system {ethyl stearate(1) + ethanol(2) + glycerol(3)}
- Vapor liquid equilibrium of fatty acid ethyl esters determined using DSC
- Express thermo-gravimetric method for the vaporization enthalpies appraisal for very low volatile molecular and ionic compounds.
- A Comparison of Results by Correlation Gas Chromatography with Another Gas Chromatographic Retention Time Technique. The Effects of Retention Time Coincidence on Vaporization Enthalpy and Vapor Pressure
- Influence of Additives (Isoamyl Laurate or Isoamyl Nonanoate) in the Solid-Liquid Equilibrium of Fatty Acid Ethyl Esters
- Densities and Viscosities of Fatty Acid Methyl and Ethyl Esters
- Joback Method
- KDB
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.