- InChI
- InChI=1S/C5H10O2/c1-3-4-5(6)7-2/h3-4H2,1-2H3
- InChI Key
- UUIQMZJEGPQKFD-UHFFFAOYSA-N
- Formula
- C5H10O2
- SMILES
- CCCC(=O)OC
- Molecular Weight1
- 102.13
- CAS
- 623-42-7
- Other Names
-
- Butyric acid, methyl ester
- Methyl butanoate
- Methyl butyrate
- Methyl ester of butanoic acid
- Methyl n-butanoate
- Methyl n-butyrate
- NSC 9380
- Propyl butyrate
- UN 1237
- n-Butyric acid methyl ester
- n-C3H7COOCH3
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.3800 | KDB | |
| PAff | 836.40 | kJ/mol | NIST |
| BasG | 805.40 | kJ/mol | NIST |
| ΔcH°liquid | -2900.00 | kJ/mol | NIST |
| μ | 1.70 | debye | KDB |
| ΔfG° | -242.70 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -391.33 | kJ/mol | Joback Calculated Property |
| ΔfusH° | 11.36 | kJ/mol | Phase e... |
| ΔvapH° | [39.00; 40.60] | kJ/mol |
|
| ΔvapH° | 39.33 | kJ/mol | NIST |
| ΔvapH° | 40.30 ± 0.50 | kJ/mol | NIST |
| ΔvapH° | 40.60 ± 0.10 | kJ/mol | NIST |
| ΔvapH° | 40.60 ± 0.20 | kJ/mol | NIST |
| ΔvapH° | 39.30 | kJ/mol | NIST |
| ΔvapH° | 39.00 ± 0.40 | kJ/mol | NIST |
| ΔvapH° | 40.40 | kJ/mol | NIST |
| ΔvapH° | 40.10 ± 0.40 | kJ/mol | NIST |
| ΔvapH° | 39.80 ± 0.30 | kJ/mol | NIST |
| ΔvapH° | 39.28 ± 0.22 | kJ/mol | NIST |
| ΔvapH° | 39.30 ± 0.20 | kJ/mol | NIST |
| IE | [10.07; 10.15] | eV |
|
| IE | 10.07 ± 0.03 | eV | NIST |
| IE | 10.15 | eV | NIST |
| log10WS | [-1.92; -0.82] |
|
|
| log10WS | -0.82 | Aq. Sol... | |
| log10WS | -1.92 | Estimat... | |
| logPoct/wat | 0.959 | Crippen Calculated Property | |
| McVol | 88.750 | ml/mol | McGowan Calculated Property |
| Pc | [3470.00; 3650.00] | kPa |
|
| Pc | 3470.00 | kPa | KDB |
| Pc | 3473.00 ± 81.06 | kPa | NIST |
| Pc | 3470.40 ± 40.00 | kPa | NIST |
| Pc | 3650.00 ± 202.65 | kPa | NIST |
| ρc | [291.08; 300.27] | kg/m3 |
|
| ρc | 300.17 ± 10.01 | kg/m3 | NIST |
| ρc | 300.27 ± 4.09 | kg/m3 | NIST |
| ρc | 291.08 ± 10.01 | kg/m3 | NIST |
| Inp | [676.00; 745.00] |
|
|
| Inp | 705.60 | NIST | |
| Inp | 719.90 | NIST | |
| Inp | 719.10 | NIST | |
| Inp | 718.90 | NIST | |
| Inp | 697.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 709.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 711.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 715.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 704.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 708.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 708.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 727.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | Outlier 740.00 | NIST | |
| Inp | Outlier 690.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 730.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 707.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 709.50 | NIST | |
| Inp | 707.20 | NIST | |
| Inp | 708.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 720.60 | NIST | |
| Inp | 728.00 | NIST | |
| Inp | 735.00 | NIST | |
| Inp | 731.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | Outlier 737.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 704.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 711.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | Outlier 676.00 | NIST | |
| Inp | 721.00 | NIST | |
| Inp | 728.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 698.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 722.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 722.00 | NIST | |
| Inp | 712.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 703.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 709.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | Outlier 745.00 | NIST | |
| Inp | 712.00 | NIST | |
| Inp | Outlier 745.00 | NIST | |
| Inp | 729.00 | NIST | |
| Inp | 722.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 715.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 726.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 720.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 704.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 704.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 705.60 | NIST | |
| Inp | 723.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 705.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 720.60 | NIST | |
| Inp | Outlier 737.00 | NIST | |
| Inp | Outlier 745.00 | NIST | |
| Inp | 725.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 721.00 | NIST | |
| Inp | 724.00 | NIST | |
| Inp | 712.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 730.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 709.50 | NIST | |
| I | [943.00; 1026.00] |
|
|
| I | 982.00 | NIST | |
| I | 997.00 | NIST | |
| I | 1008.00 | NIST | |
| I | 980.00 | NIST | |
| I | 975.00 | NIST | |
| I | 990.00 | NIST | |
| I | 992.00 | NIST | |
| I | 981.00 | NIST | |
| I | 993.00 | NIST | |
| I | 980.00 | NIST | |
| I | 998.00 | NIST | |
| I | 976.00 | NIST | |
| I | 989.00 | NIST | |
| I | 953.00 | NIST | |
| I | 993.00 | NIST | |
| I | 955.00 | NIST | |
| I | 958.00 | NIST | |
| I | 955.00 | NIST | |
| I | 979.00 | NIST | |
| I | 993.00 | NIST | |
| I | 985.00 | NIST | |
| I | 980.00 | NIST | |
| I | 969.00 | NIST | |
| I | 969.00 | NIST | |
| I | 978.00 | NIST | |
| I | 984.00 | NIST | |
| I | 961.00 | NIST | |
| I | 967.00 | NIST | |
| I | 977.00 | NIST | |
| I | 971.00 | NIST | |
| I | 982.00 | NIST | |
| I | 987.00 | NIST | |
| I | 989.00 | NIST | |
| I | 995.00 | NIST | |
| I | 973.00 | NIST | |
| I | 1001.00 | NIST | |
| I | 965.00 | NIST | |
| I | 971.00 | NIST | |
| I | 1000.00 | NIST | |
| I | Outlier 1026.00 | NIST | |
| I | 983.00 | NIST | |
| I | 981.00 | NIST | |
| I | 971.00 | NIST | |
| I | Outlier 943.00 | NIST | |
| I | 986.00 | NIST | |
| I | 982.00 | NIST | |
| I | 981.00 | NIST | |
| I | 992.00 | NIST | |
| I | 992.00 | NIST | |
| I | 989.00 | NIST | |
| I | 1000.00 | NIST | |
| I | 983.00 | NIST | |
| I | 983.00 | NIST | |
| I | 993.00 | NIST | |
| I | Outlier 945.00 | NIST | |
| I | 985.00 | NIST | |
| I | 975.00 | NIST | |
| I | 982.00 | NIST | |
| I | 984.00 | NIST | |
| I | 1004.00 | NIST | |
| I | 955.00 | NIST | |
| I | 994.00 | NIST | |
| I | 981.00 | NIST | |
| I | 983.00 | NIST | |
| I | 975.00 | NIST | |
| I | 974.00 | NIST | |
| I | 975.00 | NIST | |
| I | 975.00 | NIST | |
| I | 1000.00 | NIST | |
| I | 985.00 | NIST | |
| I | 980.00 | NIST | |
| I | 1004.00 | NIST | |
| I | 975.00 | NIST | |
| I | 985.00 | NIST | |
| I | 982.00 | NIST | |
| I | 992.00 | NIST | |
| I | 976.00 | NIST | |
| I | 958.00 | NIST | |
| I | 980.00 | NIST | |
| I | 961.00 | NIST | |
| I | 1001.00 | NIST | |
| Tboil | [369.05; 377.25] | K |
|
| Tboil | 375.90 | K | KDB |
| Tboil | 375.53 | K | Isobari... |
| Tboil | 375.50 | K | NIST |
| Tboil | 374.00 | K | NIST |
| Tboil | 375.90 | K | NIST |
| Tboil | 375.15 ± 2.00 | K | NIST |
| Tboil | 373.65 ± 1.00 | K | NIST |
| Tboil | 377.25 ± 1.00 | K | NIST |
| Tboil | 375.65 ± 1.00 | K | NIST |
| Tboil | 375.00 ± 2.00 | K | NIST |
| Tboil | 375.80 ± 0.50 | K | NIST |
| Tboil | 375.80 ± 0.50 | K | NIST |
| Tboil | 375.80 ± 1.00 | K | NIST |
| Tboil | 374.75 ± 1.00 | K | NIST |
| Tboil | 375.90 ± 1.00 | K | NIST |
| Tboil | 375.95 ± 1.00 | K | NIST |
| Tboil | 375.00 ± 2.00 | K | NIST |
| Tboil | 375.65 ± 1.00 | K | NIST |
| Tboil | 375.90 ± 1.00 | K | NIST |
| Tboil | 375.50 ± 1.50 | K | NIST |
| Tboil | 375.65 ± 1.00 | K | NIST |
| Tboil | 376.65 ± 1.00 | K | NIST |
| Tboil | Outlier 369.05 ± 1.00 | K | NIST |
| Tboil | Outlier 369.05 ± 1.00 | K | NIST |
| Tc | [544.70; 554.50] | K |
|
| Tc | 554.40 | K | KDB |
| Tc | 554.50 ± 1.00 | K | NIST |
| Tc | 554.50 ± 1.00 | K | NIST |
| Tc | 551.20 ± 3.00 | K | NIST |
| Tc | 544.70 ± 8.00 | K | NIST |
| Tfus | [184.55; 187.30] | K |
|
| Tfus | 184.55 | K | Aq. Sol... |
| Tfus | 187.30 | K | KDB |
| Vc | 0.340 | m3/kmol | KDB |
| Zc | 0.2559460 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [163.46; 210.46] | J/mol×K | [390.09; 568.66] |
|
| Cp,gas | 163.46 | J/mol×K | 390.09 | Joback Calculated Property |
| Cp,gas | 171.91 | J/mol×K | 419.85 | Joback Calculated Property |
| Cp,gas | 180.12 | J/mol×K | 449.61 | Joback Calculated Property |
| Cp,gas | 188.08 | J/mol×K | 479.38 | Joback Calculated Property |
| Cp,gas | 195.80 | J/mol×K | 509.14 | Joback Calculated Property |
| Cp,gas | 203.26 | J/mol×K | 538.90 | Joback Calculated Property |
| Cp,gas | 210.46 | J/mol×K | 568.66 | Joback Calculated Property |
| Cp,liquid | [198.16; 200.80] | J/mol×K | [298.15; 298.15] |
|
| Cp,liquid | 198.16 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 200.80 | J/mol×K | 298.15 | NIST |
| η | [0.0002744; 0.0027914] | Pa×s | [218.27; 390.09] |
|
| η | 0.0027914 | Pa×s | 218.27 | Joback Calculated Property |
| η | 0.0015155 | Pa×s | 246.91 | Joback Calculated Property |
| η | 0.0009341 | Pa×s | 275.54 | Joback Calculated Property |
| η | 0.0006307 | Pa×s | 304.18 | Joback Calculated Property |
| η | 0.0004556 | Pa×s | 332.82 | Joback Calculated Property |
| η | 0.0003466 | Pa×s | 361.45 | Joback Calculated Property |
| η | 0.0002744 | Pa×s | 390.09 | Joback Calculated Property |
| ΔvapH | [33.79; 42.80] | kJ/mol | [284.00; 460.00] |
|
| ΔvapH | 41.10 ± 0.20 | kJ/mol | 284.00 | NIST |
| ΔvapH | 42.80 | kJ/mol | 310.50 | NIST |
| ΔvapH | 38.40 | kJ/mol | 338.50 | NIST |
| ΔvapH | 36.90 | kJ/mol | 350.00 | NIST |
| ΔvapH | 36.40 | kJ/mol | 366.50 | NIST |
| ΔvapH | 33.79 | kJ/mol | 375.90 | NIST |
| ΔvapH | 34.20 | kJ/mol | 460.00 | NIST |
| Pvap | [1.06; 5.70] | kPa | [274.30; 303.20] |
|
| Pvap | 1.06 | kPa | 274.30 | Transpi... |
| Pvap | 1.29 | kPa | 276.40 | Transpi... |
| Pvap | 1.40 | kPa | 278.20 | Transpi... |
| Pvap | 1.49 | kPa | 279.40 | Transpi... |
| Pvap | 1.63 | kPa | 281.30 | Transpi... |
| Pvap | 1.71 | kPa | 281.60 | Transpi... |
| Pvap | 1.85 | kPa | 283.40 | Transpi... |
| Pvap | 1.96 | kPa | 283.70 | Transpi... |
| Pvap | 2.10 | kPa | 285.50 | Transpi... |
| Pvap | 2.24 | kPa | 285.80 | Transpi... |
| Pvap | 2.54 | kPa | 288.30 | Transpi... |
| Pvap | 2.52 | kPa | 288.30 | Transpi... |
| Pvap | 2.47 | kPa | 288.30 | Transpi... |
| Pvap | 2.93 | kPa | 290.30 | Transpi... |
| Pvap | 3.09 | kPa | 291.20 | Transpi... |
| Pvap | 2.94 | kPa | 291.20 | Transpi... |
| Pvap | 3.21 | kPa | 292.20 | Transpi... |
| Pvap | 3.38 | kPa | 293.20 | Transpi... |
| Pvap | 3.72 | kPa | 294.30 | Transpi... |
| Pvap | 4.07 | kPa | 295.30 | Transpi... |
| Pvap | 4.48 | kPa | 298.10 | Transpi... |
| Pvap | 5.22 | kPa | 300.20 | Transpi... |
| Pvap | 5.30 | kPa | 301.20 | Transpi... |
| Pvap | 5.70 | kPa | 303.20 | Transpi... |
| n0 | [1.37530; 1.38600] | [298.15; 318.15] |
|
|
| n0 | 1.38502 | 298.15 | Excess ... | |
| n0 | 1.38600 | 298.15 | Thermod... | |
| n0 | 1.38450 | 298.15 | A Study... | |
| n0 | 1.38470 | 298.15 | Vapor-L... | |
| n0 | 1.38470 | 298.15 | Vapor-L... | |
| n0 | 1.38510 | 298.15 | Measure... | |
| n0 | 1.37530 | 318.15 | Excess ... | |
| ρl | [741.06; 903.34] | kg/m3 | [288.15; 423.15] |
|
| ρl | 903.34 | kg/m3 | 288.15 | Thermal... |
| ρl | 898.00 | kg/m3 | 293.00 | KDB |
| ρl | 898.05 | kg/m3 | 293.15 | Experim... |
| ρl | 897.88 | kg/m3 | 293.15 | Thermal... |
| ρl | 892.62 | kg/m3 | 298.15 | Densiti... |
| ρl | 892.38 | kg/m3 | 298.15 | Thermal... |
| ρl | 886.86 | kg/m3 | 303.15 | Thermal... |
| ρl | 886.90 | kg/m3 | 303.15 | Experim... |
| ρl | 881.30 | kg/m3 | 308.15 | Thermal... |
| ρl | 875.74 | kg/m3 | 313.15 | Thermal... |
| ρl | 875.70 | kg/m3 | 313.15 | Experim... |
| ρl | 870.14 | kg/m3 | 318.15 | Thermal... |
| ρl | 863.41 | kg/m3 | 323.15 | Experim... |
| ρl | 853.04 | kg/m3 | 333.15 | Experim... |
| ρl | 841.50 | kg/m3 | 343.15 | Experim... |
| ρl | 829.80 | kg/m3 | 353.15 | Experim... |
| ρl | 817.71 | kg/m3 | 363.15 | Experim... |
| ρl | 806.03 | kg/m3 | 373.15 | Experim... |
| ρl | 793.68 | kg/m3 | 383.15 | Experim... |
| ρl | 780.99 | kg/m3 | 393.15 | Experim... |
| ρl | 767.63 | kg/m3 | 403.15 | Experim... |
| ρl | 754.74 | kg/m3 | 413.15 | Experim... |
| ρl | 741.06 | kg/m3 | 423.15 | Experim... |
| λ | [0.12; 0.15] | W/m×K | [283.34; 358.18] |
|
| λ | 0.15 | W/m×K | 283.34 | Experim... |
| λ | 0.14 | W/m×K | 288.30 | Experim... |
| λ | 0.14 | W/m×K | 293.39 | Experim... |
| λ | 0.14 | W/m×K | 297.41 | Experim... |
| λ | 0.14 | W/m×K | 298.44 | Experim... |
| λ | 0.14 | W/m×K | 301.30 | Experim... |
| λ | 0.14 | W/m×K | 305.42 | Experim... |
| λ | 0.14 | W/m×K | 309.31 | Experim... |
| λ | 0.14 | W/m×K | 313.29 | Experim... |
| λ | 0.13 | W/m×K | 318.38 | Experim... |
| λ | 0.13 | W/m×K | 323.35 | Experim... |
| λ | 0.13 | W/m×K | 328.55 | Experim... |
| λ | 0.13 | W/m×K | 333.25 | Experim... |
| λ | 0.13 | W/m×K | 338.40 | Experim... |
| λ | 0.12 | W/m×K | 343.25 | Experim... |
| λ | 0.12 | W/m×K | 348.24 | Experim... |
| λ | 0.12 | W/m×K | 353.35 | Experim... |
| λ | 0.12 | W/m×K | 358.18 | Experim... |
Datasets
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 100.00 | 898.42 |
| 293.15 | 1000.00 | 898.68 |
| 293.15 | 3000.00 | 900.65 |
| 293.15 | 5000.00 | 902.15 |
| 293.15 | 10000.00 | 906.55 |
| 293.15 | 15000.00 | 910.63 |
| 293.15 | 20000.00 | 914.51 |
| 293.15 | 25000.00 | 918.33 |
| 293.15 | 30000.00 | 921.95 |
| 293.15 | 35000.00 | 925.38 |
| 293.15 | 40000.00 | 928.67 |
| 293.15 | 50000.00 | 935.38 |
| 293.15 | 60000.00 | 941.12 |
| 303.15 | 100.00 | 886.68 |
| 303.15 | 1000.00 | 887.75 |
| 303.15 | 3000.00 | 889.67 |
| 303.15 | 5000.00 | 891.54 |
| 303.15 | 10000.00 | 895.99 |
| 303.15 | 15000.00 | 900.35 |
| 303.15 | 20000.00 | 904.45 |
| 303.15 | 25000.00 | 908.4 |
| 303.15 | 30000.00 | 912.18 |
| 303.15 | 35000.00 | 915.86 |
| 303.15 | 40000.00 | 919.34 |
| 303.15 | 50000.00 | 926.18 |
| 303.15 | 60000.00 | 932.54 |
| 313.15 | 100.00 | 875.83 |
| 313.15 | 1000.00 | 876.3 |
| 313.15 | 3000.00 | 878.42 |
| 313.15 | 5000.00 | 880.45 |
| 313.15 | 10000.00 | 885.34 |
| 313.15 | 15000.00 | 889.92 |
| 313.15 | 20000.00 | 894.25 |
| 313.15 | 25000.00 | 898.53 |
| 313.15 | 30000.00 | 902.47 |
| 313.15 | 35000.00 | 906.46 |
| 313.15 | 40000.00 | 910.02 |
| 313.15 | 50000.00 | 917.24 |
| 313.15 | 60000.00 | 923.73 |
| 323.15 | 100.00 | 864.35 |
| 323.15 | 1000.00 | 865.42 |
| 323.15 | 3000.00 | 867.62 |
| 323.15 | 5000.00 | 869.76 |
| 323.15 | 10000.00 | 875.02 |
| 323.15 | 15000.00 | 879.93 |
| 323.15 | 20000.00 | 884.63 |
| 323.15 | 25000.00 | 888.92 |
| 323.15 | 30000.00 | 893.19 |
| 323.15 | 35000.00 | 897.21 |
| 323.15 | 40000.00 | 901.15 |
| 323.15 | 50000.00 | 908.62 |
| 323.15 | 60000.00 | 915.65 |
| 333.15 | 100.00 | 853.11 |
| 333.15 | 1000.00 | 854.08 |
| 333.15 | 3000.00 | 856.55 |
| 333.15 | 5000.00 | 858.82 |
| 333.15 | 10000.00 | 864.28 |
| 333.15 | 15000.00 | 869.44 |
| 333.15 | 20000.00 | 874.46 |
| 333.15 | 25000.00 | 879.2 |
| 333.15 | 30000.00 | 883.56 |
| 333.15 | 35000.00 | 887.79 |
| 333.15 | 40000.00 | 892.1 |
| 333.15 | 50000.00 | 899.8 |
| 333.15 | 60000.00 | 906.96 |
| 343.15 | 100.00 | 841.05 |
| 343.15 | 1000.00 | 842.4 |
| 343.15 | 3000.00 | 844.95 |
| 343.15 | 5000.00 | 847.57 |
| 343.15 | 10000.00 | 853.35 |
| 343.15 | 15000.00 | 858.9 |
| 343.15 | 20000.00 | 864.31 |
| 343.15 | 25000.00 | 869.1 |
| 343.15 | 30000.00 | 873.89 |
| 343.15 | 35000.00 | 878.44 |
| 343.15 | 40000.00 | 882.65 |
| 343.15 | 50000.00 | 890.89 |
| 343.15 | 60000.00 | 898.16 |
| 353.15 | 100.00 | 829.58 |
| 353.15 | 1000.00 | 830.8 |
| 353.15 | 3000.00 | 833.71 |
| 353.15 | 5000.00 | 836.31 |
| 353.15 | 10000.00 | 842.65 |
| 353.15 | 15000.00 | 848.71 |
| 353.15 | 20000.00 | 854.19 |
| 353.15 | 25000.00 | 859.51 |
| 353.15 | 30000.00 | 864.51 |
| 353.15 | 35000.00 | 869.35 |
| 353.15 | 40000.00 | 873.76 |
| 353.15 | 50000.00 | 882.24 |
| 353.15 | 60000.00 | 890.18 |
| 363.15 | 100.00 | 817.31 |
| 363.15 | 1000.00 | 818.87 |
| 363.15 | 3000.00 | 821.94 |
| 363.15 | 5000.00 | 824.91 |
| 363.15 | 10000.00 | 831.48 |
| 363.15 | 15000.00 | 838.19 |
| 363.15 | 20000.00 | 843.84 |
| 363.15 | 25000.00 | 849.26 |
| 363.15 | 30000.00 | 854.68 |
| 363.15 | 35000.00 | 859.76 |
| 363.15 | 40000.00 | 864.61 |
| 363.15 | 50000.00 | 873.56 |
| 363.15 | 60000.00 | 881.85 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.63] | kPa | [277.56; 398.97] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.46637e+01 | |||
| Coefficient B | -3.24931e+03 | |||
| Coefficient C | -5.15380e+01 | |||
| Temperature range, min. | 277.56 | |||
| Temperature range, max. | 398.97 | |||
| Pvap | 1.33 | kPa | 277.56 | Calculated Property |
| Pvap | 3.00 | kPa | 291.05 | Calculated Property |
| Pvap | 6.18 | kPa | 304.54 | Calculated Property |
| Pvap | 11.83 | kPa | 318.03 | Calculated Property |
| Pvap | 21.29 | kPa | 331.52 | Calculated Property |
| Pvap | 36.30 | kPa | 345.01 | Calculated Property |
| Pvap | 59.05 | kPa | 358.50 | Calculated Property |
| Pvap | 92.20 | kPa | 371.99 | Calculated Property |
| Pvap | 138.87 | kPa | 385.48 | Calculated Property |
| Pvap | 202.63 | kPa | 398.97 | Calculated Property |
| Pvap | [1.01e-04; 3451.09] | kPa | [187.35; 554.50] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 9.73784e+01 | |||
| Coefficient B | -8.00472e+03 | |||
| Coefficient C | -1.22593e+01 | |||
| Coefficient D | 8.64840e-06 | |||
| Temperature range, min. | 187.35 | |||
| Temperature range, max. | 554.50 | |||
| Pvap | 1.01e-04 | kPa | 187.35 | Calculated Property |
| Pvap | 0.02 | kPa | 228.14 | Calculated Property |
| Pvap | 0.71 | kPa | 268.94 | Calculated Property |
| Pvap | 7.75 | kPa | 309.73 | Calculated Property |
| Pvap | 43.47 | kPa | 350.53 | Calculated Property |
| Pvap | 158.35 | kPa | 391.32 | Calculated Property |
| Pvap | 433.02 | kPa | 432.12 | Calculated Property |
| Pvap | 974.69 | kPa | 472.91 | Calculated Property |
| Pvap | 1919.85 | kPa | 513.71 | Calculated Property |
| Pvap | 3451.09 | kPa | 554.50 | Calculated Property |
Similar Compounds
Find more compounds similar to Butanoic acid, methyl ester.
Mixtures
- Butanoic acid, methyl ester + Propane, 1,2-dichloro-
- Butanoic acid, methyl ester + Ethane, 1,2-dibromo-
- Butanoic acid, methyl ester + Propane, 1,3-dibromo-
- Butanoic acid, methyl ester + Butane, 1,4-dibromo-
- Butanoic acid, methyl ester + Pentane, 1,5-dibromo-
- Butanoic acid, methyl ester + Hexane, 1,6-dibromo-
- Butanoic acid, methyl ester + Water
- Butanoic acid, methyl ester + Octane
- Butanoic acid, methyl ester + Pentane, 2,2,4-trimethyl-
- Butanoic acid, methyl ester + Acetic acid, methyl ester
- Butanoic acid, methyl ester + Octane + Acetic acid, methyl ester
- Butanoic acid, methyl ester + Pentane, 2,2,4-trimethyl- + Acetic acid, methyl ester
- Butanoic acid, methyl ester + Dodecane
- Butanoic acid, methyl ester + Dodecane + Decanoic acid, methyl ester
- Butanoic acid, methyl ester + Heptane
- 2-Propanol, 2-methyl- + Butanoic acid, methyl ester
- Butanoic acid, methyl ester + Acetonitrile
- Butanoic acid, methyl ester + Propanenitrile
- Butanoic acid, methyl ester + Nonane
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Transpiration method: Vapor pressures and enthalpies of vaporization of some low-boiling esters
- Excess molar volumes and excess molar enthalpies for binary mixtures of 1,2-dichloropropane with methyl ethanoate, methyl propanoate, and methyl butanoate at T = 298.15K
- Activity coefficients at infinite dilution of organic solvents and water in 1-butyl-3-methylimidazolium dicyanamide. A literature review of hexane/hex-1-ene separation
- High selective water/butan-1-ol separation on investigation of limiting activity coefficients with [P8,8,8,8][[NTf2] ionic liquid
- Separation of binary mixtures based on limiting activity coefficients data using specific ammonium-based ionic liquid and modelling of thermodynamic functions
- High-pressure liquid densities of fatty acid methyl esters: Measurement and prediction with the PC-SAFT equation of state
- Thermodynamics and activity coefficients at infinite dilution for organic solutes in the ionic liquid 1-butyl-1-methylpyrrolidinium dicyanamide
- New ionic liquid [P4,4,4,4][NTf2] in bio-butanol extraction on investigation of limiting activity coefficients
- Ammonium ionic liquids in extraction of bio-butan-1-ol from water phase using activity coefficients at infinite dilution
- Thermodynamic study of (alkyl esters + alpha,omega-alkyl dihalides) IV: Hex and Vex for 25 binary mixtures {xC(u-1)H(2u-1)CO2CH3 + (1-x)alpha,omega-BrCH2(CH2)(v-2)CH2Br}, where u = 1 to 5, alpha = 1 and v = omega = 2 to 6
- Phase equilibria and the thermodynamic properties of methyl and ethyl esters of carboxylic acids. 1. Methyl n-butanoate and ethyl propanoate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 4-(2-methoxyethyl)-4-methylmorpholinium bis(trifluoromethylsulfonyl)-amide
- Measurements of activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-hexyl-3-methylimidazolium tetracyanoborate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)-1-methylpiperidinium bis(trifluoromethylsulfonyl)-amide
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)-1-methylpyrrolidinium bis(trifluoromethylsulfonyl)-amide
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 4-(2-methoxyethyl)-4-methylmorpholinium trifluorotris(perfluoroethyl)phosphate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)- 1-methylpiperidinium trifluorotris(perfluoroethyl)phosphate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-methoxyethyl)- 1-methylpyrrolidinium trifluorotris(perfluoroethyl)phosphate
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 1-(2-hydroxyethyl)- 3-methylimidazolium trifluorotris(perfluoroethyl)phosphate
- Measurements of activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-butyl-1-methylpyrrolidinium tricyanomethanide
- Thermodynamics and activity coefficients at infinite dilution for organic solutes and water in the ionic liquid 1-butyl-1-methylmorpholinium tricyanomethanide
- Thermodynamics and activity coefficients at infinite dilution for organic solutes, water and diols in the ionic liquid choline bis(trifluoromethylsulfonyl)imide
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid 4-(3-hydroxypropyl)-4-methylmorpholinium bis(trifluoromethylsulfonyl)-amide
- Activity coefficients at infinite dilution for organic solutes and water in 1-ethyl-1-methylpyrrolidinium lactate
- Activity coefficients at infinite dilution, physicochemical and thermodynamic properties for organic solutes and water in the ionic liquid ethyl-dimethyl-(2-methoxyethyl)ammonium trifluorotris-(perfluoroethyl)phosphate
- A 1-alkylcyanopyridinium-based ionic liquid in the separation processes
- Thermodynamics and selectivity of separation based on activity coefficients at infinite dilution of various solutes in 1-allyl-3-methylimidazolium bis{(trifluoromethyl)sulfonyl}imide ionic liquid
- Thermodynamics and limiting activity coefficients measurements for organic solutes and water in the ionic liquid 1-dodecyl-3-methylimidzolium bis(trifluoromethylsulfonyl) imide
- Separation of binary mixtures hexane/hex-1-ene, cyclohexane/cyclohexene and ethylbenzene/styrene based on limiting activity coefficients
- Separation of water/butan-1-ol based on activity coefficients at infinite dilution in 1,3-didecyl-2-methylimidazolium dicyanamide ionic liquid
- Separation of binary mixtures hexane/hex-1-ene, cyclohexane/cyclohexene and ethylbenzene/styrene based on gamma infinity data measurements
- Activity coefficients at infinite dilution and physicochemical properties for organic solutes and water in the ionic liquid trihexyl-tetradecyl-phosphonium tricyanomethanide
- Densities and interfacial tensions for fatty acid methyl esters (from methyl formate to methyl heptanoate) + water demixed mixtures at atmospheric pressure conditions
- Thermodynamic study of molecular interaction-selectivity in separation processes based on limiting activity coefficients
- Experimental investigations on the liquid thermal conductivity of five saturated fatty acid methyl esters components of biodiesel
- The use of ionic liquids for separation of binary hydrocarbons mixtures based on gamma infinity data measurements
- A Study on Alkane + Ester + Ester Systems. Physicochemical Behavior of Binaries and Ternaries of Octane or Iso-octane with Methyl Esters (Ethanoate, Butanoate, Pentanoate)
- Experimental Investigation of the Thermophysical Properties of the Bio-Aviation Fuel Surrogates: Binary and Ternary Mixtures of n-Dodecane, Methyl Butyrate, and Methyl Decanoate
- Isobaric Vapor-Liquid Equilibria and Excess Properties for the Binary Systems of Methyl Esters + Heptane
- Excess Properties and Isobaric Vapor-Liquid Equilibria for Binary Mixtures of Methyl Esters + tert-Butanol
- Thermodynamic Properties of Mixtures Containing Ionic Liquids. 8. Activity Coefficients at Infinite Dilution of Hydrocarbons, Alcohols, Esters, and Aldehydes in 1-Hexyl-3-methylimidazolium Bis(trifluoromethylsulfonyl) Imide Using Gas-Liquid Chromatography
- Thermodynamic Properties of Mixtures Containing Ionic Liquids. 9. Activity Coefficients at Infinite Dilution of Hydrocarbons, Alcohols, Esters, and Aldehydes in Trimethyl-butylammonium Bis(trifluoromethylsulfonyl) Imide Using Gas-Liquid Chromatography and Static Method
- Vapor-Liquid Equilibrium Data for the Binary Methyl Esters (Butyrate, Pentanoate, and Hexanoate) (1) + Acetonitrile (2) Systems at 93.32 kPa
- Experimental Study of Thermodynamic Properties of Mixtures Containing Ionic Liquid 1-Ethyl-3-methylimidazolium Ethyl Sulfate Using Gas-Liquid Chromatography and Transpiration Method
- Vapor-Liquid Equilibrium Data for the Binary Methyl Esters (Butyrate, Pentanoate, and Hexanoate) (1) + Propanenitrile (2) Systems at 93.32 kPa
- Thermal and Volumetric Properties of Four Aqueous Aroma Compounds at Infinite Dilution
- Measurements and Correlations of the Isobaric Vapor Liquid Equilibria of Binary Mixtures and Excess Properties for Mixtures Containing an Alkyl (Methyl, Ethyl) Butanoate with an Alkane (Heptane, Nonane) at 101.3 kPa
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.