- InChI
- InChI=1S/C17H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2-16H2,1H3,(H,18,19)
- InChI Key
- KEMQGTRYUADPNZ-UHFFFAOYSA-N
- Formula
- C17H34O2
- SMILES
- CCCCCCCCCCCCCCCCC(=O)O
- Molecular Weight1
- 270.45
- CAS
- 506-12-7
- Other Names
-
- Margaric acid
- Margarinic acid
- N-MARGARIC ACID
- Normal-heptadecanoic acid
- n-Heptadecanoic acid
- n-Heptadecoic acid
- n-Heptadecylic acid
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,solid : Solid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔsubH : Enthalpy of sublimation at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔcH°liquid | -10624.40 ± 1.70 | kJ/mol | NIST |
| ΔfG° | -173.48 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -659.02 | kJ/mol | Joback Calculated Property |
| ΔfusH° | 45.47 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 76.86 | kJ/mol | Joback Calculated Property |
| log10WS | -6.04 | Crippen Calculated Property | |
| logPoct/wat | 5.942 | Crippen Calculated Property | |
| McVol | 257.830 | ml/mol | McGowan Calculated Property |
| Pc | 1393.90 ± 85.00 | kPa | NIST |
| Inp | [337.00; 2086.00] |
|
|
| Inp | 2080.00 | NIST | |
| Inp | 2086.00 | NIST | |
| Inp | 2038.00 | NIST | |
| Inp | 2039.00 | NIST | |
| Inp | 2038.00 | NIST | |
| Inp | 2069.00 | NIST | |
| Inp | 2068.00 | NIST | |
| Inp | 2070.00 | NIST | |
| Inp | 2071.00 | NIST | |
| Inp | 2080.00 | NIST | |
| Inp | 2065.00 | NIST | |
| Inp | 2047.00 | NIST | |
| Inp | 2044.00 | NIST | |
| Inp | 2059.00 | NIST | |
| Inp | 2039.00 | NIST | |
| Inp | 2077.00 | NIST | |
| Inp | 2022.00 | NIST | |
| Inp | 2077.00 | NIST | |
| Inp | Outlier 351.50 | NIST | |
| Inp | Outlier 351.70 | NIST | |
| Inp | Outlier 337.00 | NIST | |
| Inp | 2039.00 | NIST | |
| I | [2968.00; 3027.00] |
|
|
| I | 3027.00 | NIST | |
| I | 2974.00 | NIST | |
| I | 2981.00 | NIST | |
| I | 2975.00 | NIST | |
| I | 2968.00 | NIST | |
| I | 2979.00 | NIST | |
| I | 2975.00 | NIST | |
| I | 3027.00 | NIST | |
| I | 2974.00 | NIST | |
| Tboil | 734.41 | K | Joback Calculated Property |
| Tc | 795.08 ± 3.00 | K | NIST |
| Tfus | [323.40; 334.40] | K |
|
| Tfus | 334.15 ± 0.35 | K | NIST |
| Tfus | 333.00 ± 0.30 | K | NIST |
| Tfus | 333.00 ± 0.30 | K | NIST |
| Tfus | 333.00 ± 0.40 | K | NIST |
| Tfus | 334.40 ± 0.05 | K | NIST |
| Tfus | Outlier 323.40 ± 2.00 | K | NIST |
| Tfus | 332.80 ± 2.00 | K | NIST |
| Tfus | 333.00 ± 3.00 | K | NIST |
| Ttriple | 334.25 ± 0.02 | K | NIST |
| Vc | 1.012 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [777.09; 865.23] | J/mol×K | [734.41; 905.00] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 780 800 820 840 860 750 800 850 900 | ||||
| Cp,gas | 777.09 | J/mol×K | 734.41 | Joback Calculated Property |
| Cp,gas | 793.61 | J/mol×K | 762.84 | Joback Calculated Property |
| Cp,gas | 809.36 | J/mol×K | 791.27 | Joback Calculated Property |
| Cp,gas | 824.37 | J/mol×K | 819.70 | Joback Calculated Property |
| Cp,gas | 838.67 | J/mol×K | 848.13 | Joback Calculated Property |
| Cp,gas | 852.28 | J/mol×K | 876.56 | Joback Calculated Property |
| Cp,gas | 865.23 | J/mol×K | 905.00 | Joback Calculated Property |
| Cp,solid | 475.74 | J/mol×K | 298.15 | NIST |
| η | [0.0000294; 0.0029520] | Pa×s | [392.10; 734.41] |
|
|
T(K) Dynamic viscosity (Pa×s) 0 5.00e-4 1.00e-3 1.50e-3 2.00e-3 2.50e-3 3.00e-3 400 500 600 700 | ||||
| η | 0.0029520 | Pa×s | 392.10 | Joback Calculated Property |
| η | 0.0008408 | Pa×s | 449.15 | Joback Calculated Property |
| η | 0.0003178 | Pa×s | 506.20 | Joback Calculated Property |
| η | 0.0001463 | Pa×s | 563.25 | Joback Calculated Property |
| η | 0.0000777 | Pa×s | 620.31 | Joback Calculated Property |
| η | 0.0000459 | Pa×s | 677.36 | Joback Calculated Property |
| η | 0.0000294 | Pa×s | 734.41 | Joback Calculated Property |
| ΔfusH | [7.44; 51.90] | kJ/mol | [329.20; 334.30] |
|
|
T(K) Enthalpy of fusion at a given temperature (kJ/mol) 10 20 30 40 50 330 332 334 | ||||
| ΔfusH | 7.44 | kJ/mol | 329.20 | NIST |
| ΔfusH | 51.90 | kJ/mol | 333.00 | NIST |
| ΔfusH | 46.50 | kJ/mol | 333.50 | NIST |
| ΔfusH | 51.33 | kJ/mol | 334.30 | NIST |
| ΔfusH | 51.33 | kJ/mol | 334.30 | NIST |
| ΔsubH | [151.00; 168.00] | kJ/mol | [291.00; 303.50] |
|
| ΔsubH | 151.00 | kJ/mol | 291.00 | NIST |
| ΔsubH | 168.00 | kJ/mol | 303.50 | NIST |
| ΔvapH | [100.70; 127.30] | kJ/mol | [298.00; 543.00] |
|
| ΔvapH | 127.30 | kJ/mol | 298.00 | Vapor P... |
| ΔvapH | 112.70 ± 2.00 | kJ/mol | 369.50 | NIST |
| ΔvapH | 100.70 | kJ/mol | 543.00 | NIST |
| ΔfusS | [22.59; 153.55] | J/mol×K | [329.20; 334.30] |
|
| ΔfusS | 22.59 | J/mol×K | 329.20 | NIST |
| ΔfusS | 153.55 | J/mol×K | 334.30 | NIST |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | 500.20 | K | 13.30 | NIST |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.66] | kPa | [491.56; 663.87] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.61967e+01 | |||
| Coefficient B | -5.93946e+03 | |||
| Coefficient C | -1.18222e+02 | |||
| Temperature range, min. | 491.56 | |||
| Temperature range, max. | 663.87 | |||
|
T(K) Vapor pressure (kPa) 0 50 100 150 200 500 550 600 650 | ||||
| Pvap | 1.33 | kPa | 491.56 | Calculated Property |
| Pvap | 2.90 | kPa | 510.71 | Calculated Property |
| Pvap | 5.86 | kPa | 529.85 | Calculated Property |
| Pvap | 11.12 | kPa | 549.00 | Calculated Property |
| Pvap | 20.00 | kPa | 568.14 | Calculated Property |
| Pvap | 34.27 | kPa | 587.29 | Calculated Property |
| Pvap | 56.31 | kPa | 606.43 | Calculated Property |
| Pvap | 89.12 | kPa | 625.58 | Calculated Property |
| Pvap | 136.42 | kPa | 644.72 | Calculated Property |
| Pvap | 202.66 | kPa | 663.87 | Calculated Property |
| Pvap | [0.13; 102.74] | kPa | [449.15; 637.15] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 5.21328e+02 | |||
| Coefficient B | -3.99733e+04 | |||
| Coefficient C | -7.20295e+01 | |||
| Coefficient D | 2.74316e-05 | |||
| Temperature range, min. | 449.15 | |||
| Temperature range, max. | 637.15 | |||
|
T(K) Vapor pressure (kPa) 0 20 40 60 80 100 450 500 550 600 | ||||
| Pvap | 0.13 | kPa | 449.15 | Calculated Property |
| Pvap | 0.43 | kPa | 470.04 | Calculated Property |
| Pvap | 1.22 | kPa | 490.93 | Calculated Property |
| Pvap | 2.99 | kPa | 511.82 | Calculated Property |
| Pvap | 6.53 | kPa | 532.71 | Calculated Property |
| Pvap | 12.92 | kPa | 553.59 | Calculated Property |
| Pvap | 23.65 | kPa | 574.48 | Calculated Property |
| Pvap | 40.54 | kPa | 595.37 | Calculated Property |
| Pvap | 65.92 | kPa | 616.26 | Calculated Property |
| Pvap | 102.74 | kPa | 637.15 | Calculated Property |
Similar Compounds
Find more compounds similar to Heptadecanoic acid.
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Crippen Method
- Vapor Pressures and Vaporization, Sublimation, and Fusion Enthalpies of Some Fatty Acids
- Joback Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.