- InChI
- InChI=1S/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H
- InChI Key
- LQNUZADURLCDLV-UHFFFAOYSA-N
- Formula
- C6H5NO2
- SMILES
- O=[N+]([O-])c1ccccc1
- Molecular Weight1
- 123.11
- CAS
- 98-95-3
- Other Names
-
- Essence of Mirbane
- Essence of Myrbane
- Mirbane oil
- NCI-C60082
- NITROBENZENE
- NITROBENZOL
- NSC 9573
- Nitrobenzeen
- Nitrobenzen
- Oil of Mirbane
- Oil of Myrbane
- Rcra waste number U169
- UN 1662
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- EA : Electron affinity (eV).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- NFPA Safety : NFPA Safety Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- csound,fluid : Speed of sound in fluid (m/s).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tboil : Boiling point at given pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Tfus : Melting point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| PAff | 800.30 | kJ/mol | NIST |
| BasG | 769.50 | kJ/mol | NIST |
| ΔcH°liquid | [-3096.00; -3073.80] | kJ/mol |
|
| ΔcH°liquid | -3088.08 ± 0.42 | kJ/mol | NIST |
| ΔcH°liquid | -3096.00 | kJ/mol | NIST |
| ΔcH°liquid | -3073.80 | kJ/mol | NIST |
| η | 0.0016860 | Pa×s | Ion Pai... |
| EA | [0.40; 1.18] | eV |
|
| EA | 1.00 ± 0.01 | eV | NIST |
| EA | 1.01 ± 0.10 | eV | NIST |
| EA | 1.00 ± 0.06 | eV | NIST |
| EA | 1.00 ± 0.02 | eV | NIST |
| EA | 1.02 ± 0.05 | eV | NIST |
| EA | 1.18 ± 0.05 | eV | NIST |
| EA | 1.10 | eV | NIST |
| EA | 0.70 ± 0.20 | eV | NIST |
| EA | Outlier 0.40 | eV | NIST |
| ΔfG° | 147.60 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | 68.53 ± 0.67 | kJ/mol | NIST |
| ΔfH°liquid | [-16.00; 12.50] | kJ/mol |
|
| ΔfH°liquid | 12.50 ± 0.54 | kJ/mol | NIST |
| ΔfH°liquid | -16.00 | kJ/mol | NIST |
| ΔfusH° | 16.70 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [54.50; 56.10] | kJ/mol |
|
| ΔvapH° | 54.50 | kJ/mol | NIST |
| ΔvapH° | 55.01 ± 0.02 | kJ/mol | NIST |
| ΔvapH° | 55.00 | kJ/mol | NIST |
| ΔvapH° | 56.10 ± 1.70 | kJ/mol | NIST |
| IE | [9.60; 10.80] | eV |
|
| IE | 9.94 ± 0.08 | eV | NIST |
| IE | 9.67 | eV | NIST |
| IE | 9.80 | eV | NIST |
| IE | 10.16 ± 0.08 | eV | NIST |
| IE | 9.92 | eV | NIST |
| IE | 10.16 ± 0.08 | eV | NIST |
| IE | 9.87 ± 0.05 | eV | NIST |
| IE | 9.93 | eV | NIST |
| IE | 9.60 | eV | NIST |
| IE | 9.99 | eV | NIST |
| IE | 9.99 ± 0.01 | eV | NIST |
| IE | 9.85 ± 0.03 | eV | NIST |
| IE | 9.94 ± 0.03 | eV | NIST |
| IE | 9.90 | eV | NIST |
| IE | 9.86 ± 0.05 | eV | NIST |
| IE | 9.90 ± 0.03 | eV | NIST |
| IE | 10.16 ± 0.04 | eV | NIST |
| IE | 9.70 ± 0.10 | eV | NIST |
| IE | 9.92 | eV | NIST |
| IE | 9.86 | eV | NIST |
| IE | 9.90 | eV | NIST |
| IE | 9.92 | eV | NIST |
| IE | 9.93 | eV | NIST |
| IE | Outlier 10.80 | eV | NIST |
| IE | 9.93 | eV | NIST |
| IE | 10.10 ± 0.10 | eV | NIST |
| IE | 9.88 ± 0.01 | eV | NIST |
| IE | 10.26 | eV | NIST |
| log10WS | [-1.81; -1.80] |
|
|
| log10WS | -1.81 | Aq. Sol... | |
| log10WS | -1.80 | Estimat... | |
| logPoct/wat | 1.595 | Crippen Calculated Property | |
| McVol | 89.060 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 1 | KDB | |
| NFPA Health | 3 | KDB | |
| NFPA Safety | 2 | KDB | |
| Pc | 4749.69 | kPa | Joback Calculated Property |
| Inp | [180.05; 1114.00] |
|
|
| Inp | 1049.40 | NIST | |
| Inp | 1058.30 | NIST | |
| Inp | 1066.70 | NIST | |
| Inp | 1049.20 | NIST | |
| Inp | 1057.40 | NIST | |
| Inp | 1068.50 | NIST | |
| Inp | 1048.20 | NIST | |
| Inp | 1054.00 | NIST | |
| Inp | 1103.00 | NIST | |
| Inp | 1103.00 | NIST | |
| Inp | 1085.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1114.00 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1088.00 | NIST | |
| Inp | 1100.00 | NIST | |
| Inp | 1100.00 | NIST | |
| Inp | 1088.80 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1081.00 | NIST | |
| Inp | 1059.00 | NIST | |
| Inp | 1046.00 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1056.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1047.00 | NIST | |
| Inp | 1059.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1084.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1046.00 | NIST | |
| Inp | 1057.00 | NIST | |
| Inp | 1046.00 | NIST | |
| Inp | 1046.00 | NIST | |
| Inp | Outlier 180.05 | NIST | |
| Inp | 1100.00 | NIST | |
| Inp | 1049.40 | NIST | |
| Inp | 1068.50 | NIST | |
| Inp | 1085.00 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1056.00 | NIST | |
| Inp | 1088.80 | NIST | |
| I | [1683.00; 1683.00] |
|
|
| I | 1683.00 | NIST | |
| I | 1683.00 | NIST | |
| I | 1683.00 | NIST | |
| S°liquid | 224.30 | J/mol×K | NIST |
| Tboil | [478.15; 485.09] | K |
|
| Tboil | 483.90 | K | KDB |
| Tboil | 483.80 ± 0.40 | K | NIST |
| Tboil | 484.00 ± 1.00 | K | NIST |
| Tboil | 484.20 ± 0.50 | K | NIST |
| Tboil | 483.70 ± 0.50 | K | NIST |
| Tboil | 484.00 | K | NIST |
| Tboil | 483.70 ± 0.50 | K | NIST |
| Tboil | 483.55 ± 0.40 | K | NIST |
| Tboil | 483.71 ± 0.40 | K | NIST |
| Tboil | 483.95 ± 0.70 | K | NIST |
| Tboil | 481.10 ± 1.00 | K | NIST |
| Tboil | 483.95 ± 0.50 | K | NIST |
| Tboil | 485.09 ± 0.25 | K | NIST |
| Tboil | 482.15 ± 1.00 | K | NIST |
| Tboil | 483.90 ± 0.50 | K | NIST |
| Tboil | 483.90 ± 0.30 | K | NIST |
| Tboil | 483.95 ± 0.30 | K | NIST |
| Tboil | 483.90 ± 0.30 | K | NIST |
| Tboil | 483.90 ± 0.50 | K | NIST |
| Tboil | 482.65 ± 0.50 | K | NIST |
| Tboil | 484.00 ± 0.40 | K | NIST |
| Tboil | 482.15 ± 2.00 | K | NIST |
| Tboil | 482.00 ± 2.00 | K | NIST |
| Tboil | 484.00 ± 0.35 | K | NIST |
| Tboil | 483.95 ± 1.00 | K | NIST |
| Tboil | Outlier 478.15 ± 1.50 | K | NIST |
| Tc | 769.26 | K | Joback Calculated Property |
| Tfus | [278.81; 278.82] | K |
|
| Tfus | 278.81 | K | KDB |
| Tfus | 278.82 | K | Aq. Sol... |
| Vc | 0.345 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [180.20; 230.26] | J/mol×K | [515.20; 769.26] |
|
| Cp,gas | 180.20 | J/mol×K | 515.20 | Joback Calculated Property |
| Cp,gas | 190.50 | J/mol×K | 557.54 | Joback Calculated Property |
| Cp,gas | 199.95 | J/mol×K | 599.89 | Joback Calculated Property |
| Cp,gas | 208.60 | J/mol×K | 642.23 | Joback Calculated Property |
| Cp,gas | 216.51 | J/mol×K | 684.57 | Joback Calculated Property |
| Cp,gas | 223.71 | J/mol×K | 726.92 | Joback Calculated Property |
| Cp,gas | 230.26 | J/mol×K | 769.26 | Joback Calculated Property |
| Cp,liquid | [176.00; 188.70] | J/mol×K | [293.00; 335.50] |
|
| Cp,liquid | 179.90 | J/mol×K | 293.00 | NIST |
| Cp,liquid | 180.20 | J/mol×K | 293.00 | NIST |
| Cp,liquid | 179.95 | J/mol×K | 293.15 | NIST |
| Cp,liquid | 186.73 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 177.80 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 186.69 | J/mol×K | 298.10 | NIST |
| Cp,liquid | 181.13 | J/mol×K | 298.15 | NIST |
| Cp,liquid | 176.00 | J/mol×K | 303.00 | NIST |
| Cp,liquid | 177.40 | J/mol×K | 303.00 | NIST |
| Cp,liquid | 177.30 | J/mol×K | 303.15 | NIST |
| Cp,liquid | 188.70 | J/mol×K | 335.50 | NIST |
| η | [0.0015286; 0.0019834] | Pa×s | [293.15; 308.15] |
|
| η | 0.0019834 | Pa×s | 293.15 | Densiti... |
| η | 0.0017910 | Pa×s | 298.15 | Thermop... |
| η | 0.0016860 | Pa×s | 298.15 | Thermop... |
| η | 0.0018095 | Pa×s | 298.15 | Densiti... |
| η | 0.0016595 | Pa×s | 303.15 | Densiti... |
| η | 0.0016187 | Pa×s | 303.15 | Thermop... |
| η | 0.0015543 | Pa×s | 308.15 | Thermop... |
| η | 0.0015430 | Pa×s | 308.15 | Thermop... |
| η | 0.0015286 | Pa×s | 308.15 | Densiti... |
| ΔfusH | [10.81; 12.12] | kJ/mol | [278.80; 278.90] |
|
| ΔfusH | 12.12 | kJ/mol | 278.80 | NIST |
| ΔfusH | 12.12 | kJ/mol | 278.80 | NIST |
| ΔfusH | 12.12 | kJ/mol | 278.80 | NIST |
| ΔfusH | 10.81 | kJ/mol | 278.90 | NIST |
| ΔvapH | [48.50; 56.10] | kJ/mol | [287.50; 445.00] |
|
| ΔvapH | 54.70 | kJ/mol | 287.50 | NIST |
| ΔvapH | 56.10 ± 0.42 | kJ/mol | 291.00 | NIST |
| ΔvapH | 52.50 | kJ/mol | 293.00 | NIST |
| ΔvapH | 54.30 | kJ/mol | 303.00 | NIST |
| ΔvapH | 48.90 | kJ/mol | 425.00 | NIST |
| ΔvapH | 48.50 | kJ/mol | 445.00 | NIST |
| Pvap | [95.30; 95.50] | kPa | [481.45; 483.05] |
|
| Pvap | 95.50 | kPa | 481.45 | Vapor-l... |
| Pvap | 95.30 | kPa | 483.05 | Vapor-l... |
| n0 | [1.54005; 1.55488] | [293.15; 318.15] |
|
|
| n0 | 1.55488 | 293.15 | A study... | |
| n0 | 1.54900 | 293.15 | Volumet... | |
| n0 | 1.55000 | 298.15 | Excess ... | |
| n0 | 1.55000 | 298.15 | Bubble ... | |
| n0 | 1.54930 | 298.15 | Physico... | |
| n0 | 1.54992 | 298.15 | Volumet... | |
| n0 | 1.55000 | 298.15 | Bubble ... | |
| n0 | 1.54746 | 303.15 | Volumet... | |
| n0 | 1.54760 | 303.15 | Excess ... | |
| n0 | 1.54500 | 308.15 | Volumet... | |
| n0 | 1.54250 | 313.15 | Volumet... | |
| n0 | 1.54005 | 318.15 | Volumet... | |
| ρl | [1163.32; 1212.99] | kg/m3 | [283.15; 333.15] |
|
| ρl | 1212.99 | kg/m3 | 283.15 | The den... |
| ρl | 1211.53 | kg/m3 | 288.15 | Volumet... |
| ρl | 1208.01 | kg/m3 | 288.15 | The den... |
| ρl | 1198.80 | kg/m3 | 293.15 | Isobari... |
| ρl | 1203.05 | kg/m3 | 293.15 | Theoret... |
| ρl | 1203.05 | kg/m3 | 293.15 | The den... |
| ρl | 1202.61 | kg/m3 | 293.15 | Volumet... |
| ρl | 1198.12 | kg/m3 | 298.15 | A combi... |
| ρl | 1198.01 | kg/m3 | 298.15 | Volumet... |
| ρl | 1198.91 | kg/m3 | 298.15 | Partial... |
| ρl | 1198.00 | kg/m3 | 298.15 | Bubble ... |
| ρl | 1198.36 | kg/m3 | 298.15 | Ionic s... |
| ρl | 1198.00 | kg/m3 | 298.15 | Bubble ... |
| ρl | 1198.20 | kg/m3 | 298.15 | The den... |
| ρl | 1198.20 | kg/m3 | 298.15 | The phy... |
| ρl | 1193.25 | kg/m3 | 303.15 | The den... |
| ρl | 1193.45 | kg/m3 | 303.15 | Studies... |
| ρl | 1193.50 | kg/m3 | 303.15 | Volumet... |
| ρl | 1193.15 | kg/m3 | 303.15 | Theoret... |
| ρl | 1193.40 | kg/m3 | 303.15 | Studies... |
| ρl | 1193.25 | kg/m3 | 303.15 | The phy... |
| ρl | 1189.60 | kg/m3 | 303.15 | Density... |
| ρl | 1188.29 | kg/m3 | 308.15 | Studies... |
| ρl | 1189.40 | kg/m3 | 308.15 | Density... |
| ρl | 1188.17 | kg/m3 | 308.15 | The phy... |
| ρl | 1183.69 | kg/m3 | 313.15 | Studies... |
| ρl | 1183.21 | kg/m3 | 313.15 | Theoret... |
| ρl | 1187.20 | kg/m3 | 313.15 | Density... |
| ρl | 1183.21 | kg/m3 | 313.15 | The phy... |
| ρl | 1178.24 | kg/m3 | 318.15 | The phy... |
| ρl | 1177.32 | kg/m3 | 318.15 | Studies... |
| ρl | 1173.26 | kg/m3 | 323.15 | The phy... |
| ρl | 1173.27 | kg/m3 | 323.15 | Theoret... |
| ρl | 1163.32 | kg/m3 | 333.15 | Theoret... |
| ΔfusS | [38.80; 43.48] | J/mol×K | [278.80; 278.90] |
|
| ΔfusS | 43.48 | J/mol×K | 278.80 | NIST |
| ΔfusS | 38.80 | J/mol×K | 278.90 | NIST |
| γ | [0.04; 0.04] | N/m | [303.15; 323.15] |
|
| γ | 0.04 | N/m | 303.15 | Thermo ... |
| γ | 0.04 | N/m | 313.15 | Thermo ... |
| γ | 0.04 | N/m | 323.15 | Thermo ... |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboil | 483.05 | K | 95.30 | Excess ... |
| Tfus | [299.74; 614.38] | K | [100000.00; 3000000.00] |
|
| Tfus | 299.74 | K | 100000.00 | Fusion ... |
| Tfus | 320.77 | K | 200000.00 | Fusion ... |
| Tfus | 340.02 | K | 300000.00 | Fusion ... |
| Tfus | 360.41 | K | 400000.00 | Fusion ... |
| Tfus | 378.61 | K | 500000.00 | Fusion ... |
| Tfus | 395.90 | K | 600000.00 | Fusion ... |
| Tfus | 412.30 | K | 700000.00 | Fusion ... |
| Tfus | 427.24 | K | 800000.00 | Fusion ... |
| Tfus | 442.98 | K | 900000.00 | Fusion ... |
| Tfus | 462.61 | K | 1000000.00 | Fusion ... |
| Tfus | 516.38 | K | 1500000.00 | Fusion ... |
| Tfus | 565.62 | K | 2000000.00 | Fusion ... |
| Tfus | 595.88 | K | 2500000.00 | Fusion ... |
| Tfus | 614.38 | K | 3000000.00 | Fusion ... |
Datasets
Speed of sound, m/s
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Frequency, MHz - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 100.00 | 2.0 | 1445.6 |
| Reference | |||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.63] | kPa | [359.28; 513.96] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.53379e+01 | |||
| Coefficient B | -4.64614e+03 | |||
| Coefficient C | -5.05750e+01 | |||
| Temperature range, min. | 359.28 | |||
| Temperature range, max. | 513.96 | |||
| Pvap | 1.33 | kPa | 359.28 | Calculated Property |
| Pvap | 2.95 | kPa | 376.47 | Calculated Property |
| Pvap | 6.02 | kPa | 393.65 | Calculated Property |
| Pvap | 11.49 | kPa | 410.84 | Calculated Property |
| Pvap | 20.67 | kPa | 428.03 | Calculated Property |
| Pvap | 35.33 | kPa | 445.21 | Calculated Property |
| Pvap | 57.75 | kPa | 462.40 | Calculated Property |
| Pvap | 90.75 | kPa | 479.59 | Calculated Property |
| Pvap | 137.72 | kPa | 496.77 | Calculated Property |
| Pvap | 202.63 | kPa | 513.96 | Calculated Property |
| Pvap | [6.43e-03; 4167.87] | kPa | [278.91; 719.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 1.29288e+02 | |||
| Coefficient B | -1.14658e+04 | |||
| Coefficient C | -1.66824e+01 | |||
| Coefficient D | 9.14721e-06 | |||
| Temperature range, min. | 278.91 | |||
| Temperature range, max. | 719.00 | |||
| Pvap | 6.43e-03 | kPa | 278.91 | Calculated Property |
| Pvap | 0.26 | kPa | 327.81 | Calculated Property |
| Pvap | 3.31 | kPa | 376.71 | Calculated Property |
| Pvap | 20.44 | kPa | 425.61 | Calculated Property |
| Pvap | 80.01 | kPa | 474.51 | Calculated Property |
| Pvap | 232.70 | kPa | 523.40 | Calculated Property |
| Pvap | 556.46 | kPa | 572.30 | Calculated Property |
| Pvap | 1169.96 | kPa | 621.20 | Calculated Property |
| Pvap | 2264.56 | kPa | 670.10 | Calculated Property |
| Pvap | 4167.87 | kPa | 719.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Benzene, nitro-.
Mixtures
- Benzene, nitro- + Triethylene glycol
- Benzene, nitro- + Ethanol, 2,2'-oxybis-
- Benzene, nitro- + Benzaldehyde
- Benzene, nitro- + Benzene, bromo-
- Benzene, nitro- + Formamide, N,N-dimethyl-
- Benzene, nitro- + Phenol, 2-methyl-
- Benzene, nitro- + Phenol, 3-methyl-
- Benzene, nitro- + p-Cresol
- Benzene, nitro- + Dimethyl Sulfoxide
- Benzene, nitro- + 2-Propenenitrile
- Benzene, nitro- + 1-Hexanol
- Benzene, nitro- + Tetrabutylammonium hexafluorophosphate
- Benzene, nitro- + Benzene
- Benzene, nitro- + Toluene
- Benzene, nitro- + Ethylbenzene
- Benzene, nitro- + Styrene
- Benzene, nitro- + o-Xylene
- Benzene, nitro- + Benzene, 1,3-dimethyl-
- Benzene, nitro- + p-Xylene
- Benzene, nitro- + Methyl Alcohol
Find more mixtures with Benzene, nitro-.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Thermophysical Properties For Diethylene Glycol + Nitrobenzene and Triethylene Glycol + (Chloro-, Bromo-, Nitro-) Benzene Systems at Different Temperatures
- Density, Viscosity, Sound Speed, and Thermoacoustical Parameters of Benzaldehyde with Chlorobenzene or Nitrobenzene at 303.15 K, 308.15 K, and 313.15 K
- Excess Gibbs energies of binary mixtures formed by nitrobenzene with selected compounds at 94.95 kPa
- Solution thermodynamics near the liquid liquid critical point I. First-order excess derivatives
- Vapor-liquid equilibrium for the binary mixtures of dimethylsulfoxide with substituted benzenes
- Excess enthalpies of dimethylsulfoxide with substituted benzenes at 298.15K
- Vapor-liquid equilibrium and excess Gibbs energies of some binary mixtures of acrylonitrile at 95.5 kPa
- Bubble point measurements of binary mixtures formed by 1-hexanol with selected nitro-compounds and substituted benzenes at 95.6 kPa
- Ionic solvation of tetrabutylammonium hexafluorophosphate in pure nitromethane, 1, 3-dioxolane and nitrobenzene: A comparative physicochemical study
- The liquid-liquid coexistence curves of {x nitrobenzene + (1 - x) 2-methylpentane} and {x nitrobenzene + (1 - x) isooctane} in the critical region
- Liquid-liquid equilibrium data for binary systems containing o-dichlorobenzene and nitrobenzene
- A study of densities and volumetric properties of binary mixtures containing nitrobenzene at T = (293.15 to 353.15) K
- Bubble point temperatures of the binary mixtures of nitrobenzene with C1 C4 aliphatic alcohols at 94.95 kPa
- Bubble points of the binary mixtures formed by ethylbenzene with some chloroaliphatics and substituted benzenes at p = 94.7 kPa
- Volumetric properties of dichloromethane with aniline or nitrobenzene at different temperatures: A theoretical and experimental study
- Volumetric properties of binary mixtures of tributylamine with benzene derivatives and comparison with ERAS model results at temperatures from (293.15 to 333.15) K
- Physico-chemical studies of sodium tetraphenylborate and tetrabutylammonium tetraphenylborate in pure nitrobenzene and nitromethane and their binaries probed by conductometry, refractometry and FT-IR spectroscopy
- Enthalpies of formation of nitromethane and nitrobenzene: New experiments vs. quantum chemical calculations
- The density, refractive index, and thermodynamic behaviour of binary mixtures of 1,3-Diethenyl-1,1,3,3-tetramethyldisiloxane with aromatic hydrocarbons
- A combined experimental and computational investigation of excess molar enthalpies of (nitrobenzene + alkanol) mixtures
- Ultrasonic and 31P NMR investigations of an acidic nuclear extractant with some monosubstituted benzenes
- The physicochemical properties of 1,3,5-trimethyl-1,3,5-tris(3,3,3-trifluoropropyl)cyclotrisiloxane with various aromatic hydrocarbons at T = (308.15 to 323.15) K
- Theoretical and experimental study on volumetric and electromagnetic properties of binary systems consisting of 1,2-dichloroethane with benzene and its derivatives at T = (293.15 to 333.15) K
- Studies on the importance of nature of substituent on the thermodynamic and transport properties of liquid mixtures at various temperatures
- Volumetric and refractive properties of 1,3,5,7-tetravinyl-1,3,5,7-tetramethylcyclotetrasiloxane with methoxybenzene, chlorobenzene, tert-butylbenzene and nitrobenzene at T = (298.15-318.15) K
- Studies of viscosities of dilute solutions of alkylamine in non-electrolyte solvents. II. Haloalkanes and other polar solvents
- Volumetric and electromagnetic properties of binary mixtures consist of benzene derivatives at different temperature and ternary mixtures with 1,2-dichloroethane at T = 293.15 K with application of the Prigogine-Flory-Patterson theory and PC-SAFT
- Bubble Temperature Measurements on the Binary Mixtures of n-Heptane or Nitrobenzene or Chlorobenzene with Some Chloroethanes and Chloroethylenes at (94.6 to 95.8) kPa
- Thermophysical Properties of Binary Mixtures of Cyclohexane + Nitrobenzene, Cyclohexanone + Nitrobenzene, and Cyclohexane + Cyclohexanone at (298.15, 303.15, and 308.15) K
- Temperature Dependences of Limiting Activity Coefficients and Henry s Law Constants for Nitrobenzene, Aniline, and Cyclohexylamine in Water
- Thermodynamics of Dissolution for Bis(triazine)-Bipyridine-Class Ligands in Different Diluents and Its Reflection on Extraction
- Densities and Viscosities of Binary and Ternary Mixtures of (Nitrobenzene + 1-Bromobutane), (1-Bromobutane + Methylcyclohexane), (Nitrobenzene + Methylcyclohexane), and (Methylcyclohexane + Nitrobenzene + 1-Bromobutane) from (293.15 to 308.15) K
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Isobaric Vapor Liquid Equilibrium Data of Acrylonitrile (1) + Heptan-1-ol (2), Acrylonitrile (1) + Ethanol (2), and Nitrobenzene (1) + Heptan-1-ol (2) at 96.5 kPa
- Excess Volumes of Binary Solutions of Methyl Formate, Ethyl Formate, Propyl Formate, and Benzyl Acetate with Bromo-, Chloro-, and Nitrobenzenes at (303.15, 308.15, and 313.15) K
- Fusion Curves and Enthalpy and Internal Energy Changes of Benzene, Nitrobenzene, Bromobenzene, and Chlorobenzene at Pressures up to 3500 MPa
- Thermo Physical Properties of 4-Hydroxy 4-Methyl Pentanone with Nitrobenzene or Ethyl Benzene at Temperatures of (303.15, 313.15, and 323.15) K and a Pressure of 0.1 MPa
- Assessing the Salting-Out Behavior of Nitrobenzene, 2-Nitrotoluene, and 3-Nitrotoluene from Solubility Values in Pure Water and Seawater at Temperatures between (277 and 314) K
- Liquid-Liquid Equilibria of Nitrobenzene-Inorganic Acid Systems at 298.15 K
- Ion Pair and Triple Ion Formation by Some Tetraalkylammonium Iodides in Binary Mixtures of Carbon Tetrachloride + Nitrobenzene
- Partial Molar Volumes of Butyltriethylammonium Iodide in Single Nonaqueous Solvents at 298.15 K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.