- InChI
- InChI=1S/C8H24O2Si3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h1-8H3
- InChI Key
- CXQXSVUQTKDNFP-UHFFFAOYSA-N
- Formula
- C8H24O2Si3
- SMILES
-
C[Si](C)(C)O[Si](C)(C)O[Si](C)
(C)C - Molecular Weight1
- 236.53
- CAS
- 107-51-7
- Other Names
-
- 1,1,1,3,3,5,5,5-Octamethyltrisiloxane
- CO9816
- Dimethylbis(trimethylsiloxy)silane
- O9816
- Silane, dimethylbis(trimethylsiloxy)-
- [(CH3)3SiO]2Si(CH3)2
- octamethyltrisiloxane
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- Inp : Non-polar retention indices.
- csound,fluid : Speed of sound in fluid (m/s).
- Vm : Molar Volume (m3/mol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| IE | 10.04 | eV | NIST |
| log10WS | 3.92 | Crippen Calculated Property | |
| logPoct/wat | 3.391 | Crippen Calculated Property | |
| Inp | [1031.00; 1038.00] |
|
|
| Inp | 1031.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1034.00 | NIST | |
| Inp | 1034.00 | NIST | |
| Inp | 1038.00 | NIST | |
| Inp | 1038.00 | NIST | |
| Vm | 2.90e-04 | m3/mol | Thermod... |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ΔvapH | [40.20; 43.20] | kJ/mol | [381.00; 396.00] |
|
| ΔvapH | 40.20 | kJ/mol | 381.00 | NIST |
| ΔvapH | 43.20 | kJ/mol | 396.00 | NIST |
Datasets
Speed of sound, m/s
Operational condition: Frequency, MHz = 8 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Speed of sound, m/s - Liquid |
| 299.62 | 101.00 | 911.32 |
| 299.63 | 502.00 | 914.41 |
| 299.64 | 984.00 | 918.29 |
| 299.64 | 1480.00 | 922.14 |
| 299.65 | 2012.00 | 926.38 |
| 299.66 | 3441.00 | 937.36 |
| 299.69 | 5923.00 | 955.8 |
| 299.61 | 10196.00 | 986.47 |
| 299.68 | 20155.00 | 1050.26 |
| 299.71 | 30179.00 | 1107.31 |
| 349.91 | 111.00 | 742.97 |
| 349.69 | 558.00 | 748.58 |
| 349.65 | 1075.00 | 754.2 |
| 349.60 | 1556.00 | 759.34 |
| 349.59 | 2066.00 | 764.64 |
| 349.58 | 3704.00 | 781.0 |
| 349.61 | 6067.00 | 803.25 |
| 349.59 | 10127.00 | 839.26 |
| 349.61 | 20075.00 | 915.62 |
| 349.64 | 29800.00 | 980.01 |
| 399.96 | 508.00 | 588.68 |
| 399.96 | 993.00 | 595.83 |
| 399.96 | 1439.00 | 602.33 |
| 399.95 | 2018.00 | 610.77 |
| 399.96 | 3510.00 | 630.8 |
| 400.02 | 9928.00 | 704.99 |
| 400.15 | 19875.00 | 796.17 |
| 399.42 | 29701.00 | 873.39 |
| 449.99 | 492.00 | 436.7 |
| 449.96 | 1045.00 | 448.89 |
| 449.98 | 1523.00 | 458.69 |
| 450.01 | 1994.00 | 468.09 |
| 450.05 | 3497.00 | 495.73 |
| 450.09 | 6009.00 | 536.6 |
| 450.14 | 9983.00 | 591.45 |
| 450.22 | 20246.00 | 701.94 |
| 449.44 | 23518.00 | 734.5 |
| 499.04 | 1000.00 | 292.6 |
| 499.02 | 1521.00 | 313.47 |
| 498.96 | 1989.00 | 328.83 |
| 498.94 | 3487.00 | 373.05 |
| 499.00 | 5834.00 | 424.21 |
| 499.02 | 10178.00 | 498.23 |
| 499.05 | 16859.00 | 585.07 |
| 549.79 | 4484.00 | 279.71 |
| 549.74 | 6653.00 | 340.31 |
| 549.80 | 10050.00 | 411.61 |
| 549.84 | 12528.00 | 452.26 |
| 549.67 | 15312.00 | 492.6 |
| Reference | ||
Similar Compounds
Find more compounds similar to Trisiloxane, octamethyl-.
Mixtures
Sources
- Crippen Method
- Crippen Method
- Speed of Sound Measurements and Fundamental Equations of State for Octamethyltrisiloxane and Decamethyltetrasiloxane
- Bubble-Point Measurements and Modeling of Binary Mixtures of Linear Siloxanes
- Thermodynamic Study of Heptane + Silicone Mixtures. Excess Volumes and Enthalpies at 298.15 K
- NIST Webbook
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.