- Name
- Tetraphenylporphyrin
- InChI
- InChI=1S/C44H30N4/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36/h1-28,45,48H/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-
- InChI Key
- YNHJECZULSZAQK-LWQDQPMZSA-N
- Formula
- C44H30N4
- SMILES
-
C1=Cc2nc1c(-c1ccccc1)c1ccc([nH
]1)c(-c1ccccc1)c1nc(c(-c3ccccc 3)c3ccc([nH]3)c2-c2ccccc2)C=C1 - Mol. Weight (g/mol)
- 614.74
- CAS
- 917-23-7
- Name
- Propanoic acid
- InChI
- InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)
- InChI Key
- XBDQKXXYIPTUBI-UHFFFAOYSA-N
- Formula
- C3H6O2
- SMILES
- CCC(=O)O
- Mol. Weight (g/mol)
- 74.08
- CAS
- 79-09-4
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Tetraphenylporphyrin (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mole fraction of Propanoic acid (2) - Liquid | Mole fraction of Tetraphenylporphyrin (1) - Liquid |
| 303.20 | 1.0000 | 0.0000 |
| 313.20 | 1.0000 | 0.0000 |
| 323.20 | 1.0000 | 0.0000 |
| 333.20 | 1.0000 | 0.0000 |
| 343.20 | 1.0000 | 0.0000 |
| 303.20 | 0.9226 | 0.0000 |
| 313.20 | 0.9226 | 0.0000 |
| 323.20 | 0.9226 | 0.0000 |
| 333.20 | 0.9226 | 0.0000 |
| 343.20 | 0.9226 | 0.0000 |
| 303.20 | 0.8537 | 0.0000 |
| 313.20 | 0.8537 | 0.0000 |
| 323.20 | 0.8537 | 0.0000 |
| 333.20 | 0.8537 | 0.0000 |
| 343.20 | 0.8537 | 0.0000 |
| 303.20 | 0.7920 | 9.1400e-06 |
| 313.20 | 0.7920 | 0.0000 |
| 323.20 | 0.7920 | 0.0000 |
| 333.20 | 0.7920 | 0.0000 |
| 343.20 | 0.7920 | 0.0000 |
| 303.20 | 0.7365 | 7.4200e-06 |
| 313.20 | 0.7365 | 8.2400e-06 |
| 323.20 | 0.7365 | 9.2100e-06 |
| 333.20 | 0.7365 | 0.0000 |
| 343.20 | 0.7365 | 0.0000 |
| 303.20 | 0.6865 | 6.1500e-06 |
| 313.20 | 0.6865 | 6.6900e-06 |
| 323.20 | 0.6865 | 7.1200e-06 |
| 333.20 | 0.6865 | 7.6200e-06 |
| 343.20 | 0.6865 | 8.3600e-06 |
Mole fraction of Tetraphenylporphyrin (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mole fraction of Propanoic acid (2) - Liquid | Mole fraction of Tetraphenylporphyrin (1) - Liquid |
| 303.20 | 1.0000 | 0.0000 |
| 313.20 | 1.0000 | 0.0000 |
| 323.20 | 1.0000 | 0.0000 |
| 333.20 | 1.0000 | 0.0000 |
| 343.20 | 1.0000 | 0.0000 |
| 303.20 | 0.9226 | 0.0000 |
| 313.20 | 0.9226 | 0.0000 |
| 323.20 | 0.9226 | 0.0000 |
| 333.20 | 0.9226 | 0.0000 |
| 343.20 | 0.9226 | 0.0000 |
| 303.20 | 0.8537 | 0.0000 |
| 313.20 | 0.8537 | 0.0000 |
| 323.20 | 0.8537 | 0.0000 |
| 333.20 | 0.8537 | 0.0000 |
| 343.20 | 0.8537 | 0.0000 |
| 303.20 | 0.7920 | 9.1400e-06 |
| 313.20 | 0.7920 | 0.0000 |
| 323.20 | 0.7920 | 0.0000 |
| 333.20 | 0.7920 | 0.0000 |
| 343.20 | 0.7920 | 0.0000 |
| 303.20 | 0.7365 | 7.4200e-06 |
| 313.20 | 0.7365 | 8.2400e-06 |
| 323.20 | 0.7365 | 9.2100e-06 |
| 333.20 | 0.7365 | 0.0000 |
| 343.20 | 0.7365 | 0.0000 |
| 303.20 | 0.6865 | 6.1500e-06 |
| 313.20 | 0.6865 | 6.6900e-06 |
| 323.20 | 0.6865 | 7.1200e-06 |
| 333.20 | 0.6865 | 7.6200e-06 |
| 343.20 | 0.6865 | 8.3600e-06 |