- Name
- Indomethacin
- InChI
- InChI=1S/C19H16ClNO4/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,22,23)
- InChI Key
- CGIGDMFJXJATDK-UHFFFAOYSA-N
- Formula
- C19H16ClNO4
- SMILES
-
COc1ccc2c(c1)c(CC(=O)O)c(C)n2C
(=O)c1ccc(Cl)cc1 - Mol. Weight (g/mol)
- 357.79
- CAS
- 53-86-1
- Name
- Propylene Glycol
- InChI
- InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3
- InChI Key
- DNIAPMSPPWPWGF-UHFFFAOYSA-N
- Formula
- C3H8O2
- SMILES
- CC(O)CO
- Mol. Weight (g/mol)
- 76.09
- CAS
- 57-55-6
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Indomethacin (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mole fraction of Propylene Glycol (2) - Liquid | Mole fraction of Indomethacin (1) - Liquid |
| 293.15 | 0.1000 | 1.1190e-06 |
| 293.15 | 0.2000 | 1.6010e-06 |
| 293.15 | 0.3000 | 2.6930e-06 |
| 293.15 | 0.4000 | 5.0600e-06 |
| 293.15 | 0.5000 | 0.0000 |
| 293.15 | 0.6000 | 0.0000 |
| 293.15 | 0.7000 | 0.0001 |
| 293.15 | 0.7500 | 0.0001 |
| 293.15 | 0.8000 | 0.0002 |
| 293.15 | 0.8500 | 0.0003 |
| 293.15 | 0.9000 | 0.0005 |
| 293.15 | 0.9500 | 0.0008 |
| 293.15 | 1.0000 | 0.0014 |
| 298.15 | 0.1000 | 1.3370e-06 |
| 298.15 | 0.2000 | 1.9410e-06 |
| 298.15 | 0.3000 | 3.2300e-06 |
| 298.15 | 0.4000 | 5.9400e-06 |
| 298.15 | 0.5000 | 0.0000 |
| 298.15 | 0.6000 | 0.0000 |
| 298.15 | 0.7000 | 0.0001 |
| 298.15 | 0.7500 | 0.0001 |
| 298.15 | 0.8000 | 0.0002 |
| 298.15 | 0.8500 | 0.0004 |
| 298.15 | 0.9000 | 0.0006 |
| 298.15 | 0.9500 | 0.0010 |
| 298.15 | 1.0000 | 0.0017 |
| 303.15 | 0.1000 | 1.5820e-06 |
| 303.15 | 0.2000 | 2.3100e-06 |
| 303.15 | 0.3000 | 3.9200e-06 |
| 303.15 | 0.4000 | 7.6100e-06 |
| 303.15 | 0.5000 | 0.0000 |
| 303.15 | 0.6000 | 0.0000 |
| 303.15 | 0.7000 | 0.0001 |
| 303.15 | 0.7500 | 0.0002 |
| 303.15 | 0.8000 | 0.0003 |
| 303.15 | 0.8500 | 0.0005 |
| 303.15 | 0.9000 | 0.0008 |
| 303.15 | 0.9500 | 0.0015 |
| 303.15 | 1.0000 | 0.0023 |
| 308.15 | 0.1000 | 1.8740e-06 |
| 308.15 | 0.2000 | 2.8500e-06 |
| 308.15 | 0.3000 | 4.9400e-06 |
| 308.15 | 0.4000 | 9.5310e-06 |
| 308.15 | 0.5000 | 0.0000 |
| 308.15 | 0.6000 | 0.0001 |
| 308.15 | 0.7000 | 0.0002 |
| 308.15 | 0.7500 | 0.0003 |
| 308.15 | 0.8000 | 0.0004 |
| 308.15 | 0.8500 | 0.0007 |
| 308.15 | 0.9000 | 0.0012 |
| 308.15 | 0.9500 | 0.0019 |
| 308.15 | 1.0000 | 0.0029 |
| 308.15 | 0.4000 | 0.0000 |
| 313.15 | 0.1000 | 2.2680e-06 |
| 313.15 | 0.2000 | 3.3700e-06 |
| 313.15 | 0.3000 | 5.8300e-06 |
| 313.15 | 0.5000 | 0.0000 |
| 313.15 | 0.6000 | 0.0001 |
| 313.15 | 0.7000 | 0.0002 |
| 313.15 | 0.7500 | 0.0004 |
| 313.15 | 0.8000 | 0.0006 |
| 313.15 | 0.8500 | 0.0010 |
| 313.15 | 0.9000 | 0.0016 |
| 313.15 | 0.9500 | 0.0025 |
| 313.15 | 1.0000 | 0.0037 |
Mole fraction of Indomethacin (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Mole fraction of Propylene Glycol (2) - Liquid | Mole fraction of Indomethacin (1) - Liquid |
| 293.15 | 0.1000 | 1.1190e-06 |
| 293.15 | 0.2000 | 1.6010e-06 |
| 293.15 | 0.3000 | 2.6930e-06 |
| 293.15 | 0.4000 | 5.0600e-06 |
| 293.15 | 0.5000 | 0.0000 |
| 293.15 | 0.6000 | 0.0000 |
| 293.15 | 0.7000 | 0.0001 |
| 293.15 | 0.7500 | 0.0001 |
| 293.15 | 0.8000 | 0.0002 |
| 293.15 | 0.8500 | 0.0003 |
| 293.15 | 0.9000 | 0.0005 |
| 293.15 | 0.9500 | 0.0008 |
| 293.15 | 1.0000 | 0.0014 |
| 298.15 | 0.1000 | 1.3370e-06 |
| 298.15 | 0.2000 | 1.9410e-06 |
| 298.15 | 0.3000 | 3.2300e-06 |
| 298.15 | 0.4000 | 5.9400e-06 |
| 298.15 | 0.5000 | 0.0000 |
| 298.15 | 0.6000 | 0.0000 |
| 298.15 | 0.7000 | 0.0001 |
| 298.15 | 0.7500 | 0.0001 |
| 298.15 | 0.8000 | 0.0002 |
| 298.15 | 0.8500 | 0.0004 |
| 298.15 | 0.9000 | 0.0006 |
| 298.15 | 0.9500 | 0.0010 |
| 298.15 | 1.0000 | 0.0017 |
| 303.15 | 0.1000 | 1.5820e-06 |
| 303.15 | 0.2000 | 2.3100e-06 |
| 303.15 | 0.3000 | 3.9200e-06 |
| 303.15 | 0.4000 | 7.6100e-06 |
| 303.15 | 0.5000 | 0.0000 |
| 303.15 | 0.6000 | 0.0000 |
| 303.15 | 0.7000 | 0.0001 |
| 303.15 | 0.7500 | 0.0002 |
| 303.15 | 0.8000 | 0.0003 |
| 303.15 | 0.8500 | 0.0005 |
| 303.15 | 0.9000 | 0.0008 |
| 303.15 | 0.9500 | 0.0015 |
| 303.15 | 1.0000 | 0.0023 |
| 308.15 | 0.1000 | 1.8740e-06 |
| 308.15 | 0.2000 | 2.8500e-06 |
| 308.15 | 0.3000 | 4.9400e-06 |
| 308.15 | 0.4000 | 9.5310e-06 |
| 308.15 | 0.5000 | 0.0000 |
| 308.15 | 0.6000 | 0.0001 |
| 308.15 | 0.7000 | 0.0002 |
| 308.15 | 0.7500 | 0.0003 |
| 308.15 | 0.8000 | 0.0004 |
| 308.15 | 0.8500 | 0.0007 |
| 308.15 | 0.9000 | 0.0012 |
| 308.15 | 0.9500 | 0.0019 |
| 308.15 | 1.0000 | 0.0029 |
| 308.15 | 0.4000 | 0.0000 |
| 313.15 | 0.1000 | 2.2680e-06 |
| 313.15 | 0.2000 | 3.3700e-06 |
| 313.15 | 0.3000 | 5.8300e-06 |
| 313.15 | 0.5000 | 0.0000 |
| 313.15 | 0.6000 | 0.0001 |
| 313.15 | 0.7000 | 0.0002 |
| 313.15 | 0.7500 | 0.0004 |
| 313.15 | 0.8000 | 0.0006 |
| 313.15 | 0.8500 | 0.0010 |
| 313.15 | 0.9000 | 0.0016 |
| 313.15 | 0.9500 | 0.0025 |
| 313.15 | 1.0000 | 0.0037 |