- Name
- p-Xylene
- InChI
- InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
- InChI Key
- URLKBWYHVLBVBO-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccc(C)cc1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 106-42-3
- Name
- Cyclooctane
- InChI
- InChI=1S/C8H16/c1-2-4-6-8-7-5-3-1/h1-8H2
- InChI Key
- WJTCGQSWYFHTAC-UHFFFAOYSA-N
- Formula
- C8H16
- SMILES
- C1CCCCCCC1
- Mol. Weight (g/mol)
- 112.21
- CAS
- 292-64-8
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4931 |
| 298.15 | 0.0534 | 1.4906 |
| 298.15 | 0.1004 | 1.4883 |
| 298.15 | 0.2025 | 1.4836 |
| 298.15 | 0.3030 | 1.4792 |
| 298.15 | 0.4020 | 1.4751 |
| 298.15 | 0.4986 | 1.4713 |
| 298.15 | 0.5990 | 1.4676 |
| 298.15 | 0.6981 | 1.4642 |
| 298.15 | 0.7968 | 1.4612 |
| 298.15 | 0.8926 | 1.4585 |
| 298.15 | 0.9504 | 1.4571 |
| 298.15 | 1.0000 | 1.456 |
| 313.15 | 0.0000 | 1.4844 |
| 313.15 | 0.0485 | 1.4825 |
| 313.15 | 0.0874 | 1.4808 |
| 313.15 | 0.1848 | 1.4765 |
| 313.15 | 0.2948 | 1.472 |
| 313.15 | 0.3853 | 1.4683 |
| 313.15 | 0.4829 | 1.4645 |
| 313.15 | 0.5809 | 1.4609 |
| 313.15 | 0.6837 | 1.4575 |
| 313.15 | 0.7877 | 1.4543 |
| 313.15 | 0.8888 | 1.4515 |
| 313.15 | 0.9413 | 1.4501 |
| 313.15 | 1.0000 | 1.4488 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4931 |
| 298.15 | 0.0534 | 1.4906 |
| 298.15 | 0.1004 | 1.4883 |
| 298.15 | 0.2025 | 1.4836 |
| 298.15 | 0.3030 | 1.4792 |
| 298.15 | 0.4020 | 1.4751 |
| 298.15 | 0.4986 | 1.4713 |
| 298.15 | 0.5990 | 1.4676 |
| 298.15 | 0.6981 | 1.4642 |
| 298.15 | 0.7968 | 1.4612 |
| 298.15 | 0.8926 | 1.4585 |
| 298.15 | 0.9504 | 1.4571 |
| 298.15 | 1.0000 | 1.456 |
| 313.15 | 0.0000 | 1.4844 |
| 313.15 | 0.0485 | 1.4825 |
| 313.15 | 0.0874 | 1.4808 |
| 313.15 | 0.1848 | 1.4765 |
| 313.15 | 0.2948 | 1.472 |
| 313.15 | 0.3853 | 1.4683 |
| 313.15 | 0.4829 | 1.4645 |
| 313.15 | 0.5809 | 1.4609 |
| 313.15 | 0.6837 | 1.4575 |
| 313.15 | 0.7877 | 1.4543 |
| 313.15 | 0.8888 | 1.4515 |
| 313.15 | 0.9413 | 1.4501 |
| 313.15 | 1.0000 | 1.4488 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 856.6 |
| 298.15 | 0.0534 | 854.3 |
| 298.15 | 0.1004 | 852.6 |
| 298.15 | 0.2025 | 848.8 |
| 298.15 | 0.3030 | 845.4 |
| 298.15 | 0.4020 | 842.4 |
| 298.15 | 0.4986 | 839.6 |
| 298.15 | 0.5990 | 837.1 |
| 298.15 | 0.6981 | 835.0 |
| 298.15 | 0.7968 | 833.3 |
| 298.15 | 0.8926 | 832.0 |
| 298.15 | 0.9504 | 831.5 |
| 298.15 | 1.0000 | 831.5 |
| 313.15 | 0.0000 | 843.5 |
| 313.15 | 0.0485 | 841.6 |
| 313.15 | 0.0874 | 840.2 |
| 313.15 | 0.1848 | 836.7 |
| 313.15 | 0.2948 | 833.2 |
| 313.15 | 0.3853 | 830.4 |
| 313.15 | 0.4829 | 827.7 |
| 313.15 | 0.5809 | 825.3 |
| 313.15 | 0.6837 | 823.1 |
| 313.15 | 0.7877 | 821.3 |
| 313.15 | 0.8888 | 820.0 |
| 313.15 | 0.9413 | 819.5 |
| 313.15 | 1.0000 | 819.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 856.6 |
| 298.15 | 0.0534 | 854.3 |
| 298.15 | 0.1004 | 852.6 |
| 298.15 | 0.2025 | 848.8 |
| 298.15 | 0.3030 | 845.4 |
| 298.15 | 0.4020 | 842.4 |
| 298.15 | 0.4986 | 839.6 |
| 298.15 | 0.5990 | 837.1 |
| 298.15 | 0.6981 | 835.0 |
| 298.15 | 0.7968 | 833.3 |
| 298.15 | 0.8926 | 832.0 |
| 298.15 | 0.9504 | 831.5 |
| 298.15 | 1.0000 | 831.5 |
| 313.15 | 0.0000 | 843.5 |
| 313.15 | 0.0485 | 841.6 |
| 313.15 | 0.0874 | 840.2 |
| 313.15 | 0.1848 | 836.7 |
| 313.15 | 0.2948 | 833.2 |
| 313.15 | 0.3853 | 830.4 |
| 313.15 | 0.4829 | 827.7 |
| 313.15 | 0.5809 | 825.3 |
| 313.15 | 0.6837 | 823.1 |
| 313.15 | 0.7877 | 821.3 |
| 313.15 | 0.8888 | 820.0 |
| 313.15 | 0.9413 | 819.5 |
| 313.15 | 1.0000 | 819.2 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1310.0 |
| 298.15 | 0.0534 | 1312.0 |
| 298.15 | 0.1004 | 1314.0 |
| 298.15 | 0.2025 | 1319.0 |
| 298.15 | 0.3030 | 1325.0 |
| 298.15 | 0.4020 | 1332.0 |
| 298.15 | 0.4986 | 1339.0 |
| 298.15 | 0.5990 | 1348.0 |
| 298.15 | 0.6981 | 1357.0 |
| 298.15 | 0.7968 | 1367.0 |
| 298.15 | 0.8926 | 1377.0 |
| 298.15 | 0.9504 | 1384.0 |
| 298.15 | 1.0000 | 1391.0 |
| 313.15 | 0.0000 | 1248.0 |
| 313.15 | 0.0485 | 1250.0 |
| 313.15 | 0.0874 | 1252.0 |
| 313.15 | 0.1848 | 1256.0 |
| 313.15 | 0.2948 | 1262.0 |
| 313.15 | 0.3853 | 1268.0 |
| 313.15 | 0.4829 | 1274.0 |
| 313.15 | 0.5809 | 1282.0 |
| 313.15 | 0.6837 | 1291.0 |
| 313.15 | 0.7877 | 1301.0 |
| 313.15 | 0.8888 | 1312.0 |
| 313.15 | 0.9413 | 1318.0 |
| 313.15 | 1.0000 | 1325.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1310.0 |
| 298.15 | 0.0534 | 1312.0 |
| 298.15 | 0.1004 | 1314.0 |
| 298.15 | 0.2025 | 1319.0 |
| 298.15 | 0.3030 | 1325.0 |
| 298.15 | 0.4020 | 1332.0 |
| 298.15 | 0.4986 | 1339.0 |
| 298.15 | 0.5990 | 1348.0 |
| 298.15 | 0.6981 | 1357.0 |
| 298.15 | 0.7968 | 1367.0 |
| 298.15 | 0.8926 | 1377.0 |
| 298.15 | 0.9504 | 1384.0 |
| 298.15 | 1.0000 | 1391.0 |
| 313.15 | 0.0000 | 1248.0 |
| 313.15 | 0.0485 | 1250.0 |
| 313.15 | 0.0874 | 1252.0 |
| 313.15 | 0.1848 | 1256.0 |
| 313.15 | 0.2948 | 1262.0 |
| 313.15 | 0.3853 | 1268.0 |
| 313.15 | 0.4829 | 1274.0 |
| 313.15 | 0.5809 | 1282.0 |
| 313.15 | 0.6837 | 1291.0 |
| 313.15 | 0.7877 | 1301.0 |
| 313.15 | 0.8888 | 1312.0 |
| 313.15 | 0.9413 | 1318.0 |
| 313.15 | 1.0000 | 1325.0 |