- Name
- Cyclopentane
- InChI
- InChI=1S/C5H10/c1-2-4-5-3-1/h1-5H2
- InChI Key
- RGSFGYAAUTVSQA-UHFFFAOYSA-N
- Formula
- C5H10
- SMILES
- C1CCCC1
- Mol. Weight (g/mol)
- 70.13
- CAS
- 287-92-3
- Name
- Mesitylene
- InChI
- InChI=1S/C9H12/c1-7-4-8(2)6-9(3)5-7/h4-6H,1-3H3
- InChI Key
- AUHZEENZYGFFBQ-UHFFFAOYSA-N
- Formula
- C9H12
- SMILES
- Cc1cc(C)cc(C)c1
- Mol. Weight (g/mol)
- 120.19
- CAS
- 108-67-8
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4969 |
| 298.15 | 0.0383 | 1.4945 |
| 298.15 | 0.0884 | 1.491 |
| 298.15 | 0.1869 | 1.484 |
| 298.15 | 0.2531 | 1.4792 |
| 298.15 | 0.3849 | 1.4688 |
| 298.15 | 0.4879 | 1.4596 |
| 298.15 | 0.5891 | 1.4505 |
| 298.15 | 0.6926 | 1.4403 |
| 298.15 | 0.7807 | 1.4311 |
| 298.15 | 0.8901 | 1.4173 |
| 298.15 | 0.9487 | 1.4099 |
| 298.15 | 1.0000 | 1.4029 |
| 313.15 | 0.0000 | 1.4892 |
| 313.15 | 0.0414 | 1.4868 |
| 313.15 | 0.0948 | 1.4832 |
| 313.15 | 0.1986 | 1.4759 |
| 313.15 | 0.2985 | 1.4679 |
| 313.15 | 0.4078 | 1.4591 |
| 313.15 | 0.4703 | 1.4533 |
| 313.15 | 0.6043 | 1.4411 |
| 313.15 | 0.7006 | 1.4312 |
| 313.15 | 0.8048 | 1.42 |
| 313.15 | 0.9074 | 1.4065 |
| 313.15 | 0.9595 | 1.4001 |
| 313.15 | 1.0000 | 1.3946 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4969 |
| 298.15 | 0.0383 | 1.4945 |
| 298.15 | 0.0884 | 1.491 |
| 298.15 | 0.1869 | 1.484 |
| 298.15 | 0.2531 | 1.4792 |
| 298.15 | 0.3849 | 1.4688 |
| 298.15 | 0.4879 | 1.4596 |
| 298.15 | 0.5891 | 1.4505 |
| 298.15 | 0.6926 | 1.4403 |
| 298.15 | 0.7807 | 1.4311 |
| 298.15 | 0.8901 | 1.4173 |
| 298.15 | 0.9487 | 1.4099 |
| 298.15 | 1.0000 | 1.4029 |
| 313.15 | 0.0000 | 1.4892 |
| 313.15 | 0.0414 | 1.4868 |
| 313.15 | 0.0948 | 1.4832 |
| 313.15 | 0.1986 | 1.4759 |
| 313.15 | 0.2985 | 1.4679 |
| 313.15 | 0.4078 | 1.4591 |
| 313.15 | 0.4703 | 1.4533 |
| 313.15 | 0.6043 | 1.4411 |
| 313.15 | 0.7006 | 1.4312 |
| 313.15 | 0.8048 | 1.42 |
| 313.15 | 0.9074 | 1.4065 |
| 313.15 | 0.9595 | 1.4001 |
| 313.15 | 1.0000 | 1.3946 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 861.1 |
| 298.15 | 0.0383 | 857.8 |
| 298.15 | 0.0884 | 853.3 |
| 298.15 | 0.1869 | 843.9 |
| 298.15 | 0.2531 | 837.5 |
| 298.15 | 0.3849 | 823.5 |
| 298.15 | 0.4879 | 811.9 |
| 298.15 | 0.5891 | 799.5 |
| 298.15 | 0.6926 | 786.0 |
| 298.15 | 0.7807 | 774.0 |
| 298.15 | 0.8901 | 757.9 |
| 298.15 | 0.9487 | 748.6 |
| 298.15 | 1.0000 | 740.0 |
| 313.15 | 0.0000 | 848.8 |
| 313.15 | 0.0414 | 845.1 |
| 313.15 | 0.0948 | 840.2 |
| 313.15 | 0.1986 | 830.2 |
| 313.15 | 0.2985 | 819.9 |
| 313.15 | 0.4078 | 807.7 |
| 313.15 | 0.4703 | 800.3 |
| 313.15 | 0.6043 | 783.5 |
| 313.15 | 0.7006 | 770.4 |
| 313.15 | 0.8048 | 755.4 |
| 313.15 | 0.9074 | 739.7 |
| 313.15 | 0.9595 | 731.4 |
| 313.15 | 1.0000 | 725.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 861.1 |
| 298.15 | 0.0383 | 857.8 |
| 298.15 | 0.0884 | 853.3 |
| 298.15 | 0.1869 | 843.9 |
| 298.15 | 0.2531 | 837.5 |
| 298.15 | 0.3849 | 823.5 |
| 298.15 | 0.4879 | 811.9 |
| 298.15 | 0.5891 | 799.5 |
| 298.15 | 0.6926 | 786.0 |
| 298.15 | 0.7807 | 774.0 |
| 298.15 | 0.8901 | 757.9 |
| 298.15 | 0.9487 | 748.6 |
| 298.15 | 1.0000 | 740.0 |
| 313.15 | 0.0000 | 848.8 |
| 313.15 | 0.0414 | 845.1 |
| 313.15 | 0.0948 | 840.2 |
| 313.15 | 0.1986 | 830.2 |
| 313.15 | 0.2985 | 819.9 |
| 313.15 | 0.4078 | 807.7 |
| 313.15 | 0.4703 | 800.3 |
| 313.15 | 0.6043 | 783.5 |
| 313.15 | 0.7006 | 770.4 |
| 313.15 | 0.8048 | 755.4 |
| 313.15 | 0.9074 | 739.7 |
| 313.15 | 0.9595 | 731.4 |
| 313.15 | 1.0000 | 725.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1336.0 |
| 298.15 | 0.0383 | 1332.0 |
| 298.15 | 0.0884 | 1325.0 |
| 298.15 | 0.1869 | 1311.0 |
| 298.15 | 0.2531 | 1302.0 |
| 298.15 | 0.3849 | 1283.0 |
| 298.15 | 0.4879 | 1269.0 |
| 298.15 | 0.5891 | 1255.0 |
| 298.15 | 0.6926 | 1241.0 |
| 298.15 | 0.7807 | 1229.0 |
| 298.15 | 0.8901 | 1216.0 |
| 298.15 | 0.9487 | 1210.0 |
| 298.15 | 1.0000 | 1204.0 |
| 313.15 | 0.0000 | 1277.0 |
| 313.15 | 0.0414 | 1271.0 |
| 313.15 | 0.0948 | 1263.0 |
| 313.15 | 0.1986 | 1248.0 |
| 313.15 | 0.2985 | 1232.0 |
| 313.15 | 0.4078 | 1216.0 |
| 313.15 | 0.4703 | 1206.0 |
| 313.15 | 0.6043 | 1186.0 |
| 313.15 | 0.7006 | 1171.0 |
| 313.15 | 0.8048 | 1155.0 |
| 313.15 | 0.9074 | 1140.0 |
| 313.15 | 0.9595 | 1134.0 |
| 313.15 | 1.0000 | 1130.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclopentane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1336.0 |
| 298.15 | 0.0383 | 1332.0 |
| 298.15 | 0.0884 | 1325.0 |
| 298.15 | 0.1869 | 1311.0 |
| 298.15 | 0.2531 | 1302.0 |
| 298.15 | 0.3849 | 1283.0 |
| 298.15 | 0.4879 | 1269.0 |
| 298.15 | 0.5891 | 1255.0 |
| 298.15 | 0.6926 | 1241.0 |
| 298.15 | 0.7807 | 1229.0 |
| 298.15 | 0.8901 | 1216.0 |
| 298.15 | 0.9487 | 1210.0 |
| 298.15 | 1.0000 | 1204.0 |
| 313.15 | 0.0000 | 1277.0 |
| 313.15 | 0.0414 | 1271.0 |
| 313.15 | 0.0948 | 1263.0 |
| 313.15 | 0.1986 | 1248.0 |
| 313.15 | 0.2985 | 1232.0 |
| 313.15 | 0.4078 | 1216.0 |
| 313.15 | 0.4703 | 1206.0 |
| 313.15 | 0.6043 | 1186.0 |
| 313.15 | 0.7006 | 1171.0 |
| 313.15 | 0.8048 | 1155.0 |
| 313.15 | 0.9074 | 1140.0 |
| 313.15 | 0.9595 | 1134.0 |
| 313.15 | 1.0000 | 1130.0 |