- Name
- n-Propyl acetate
- InChI
- InChI=1S/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3
- InChI Key
- YKYONYBAUNKHLG-UHFFFAOYSA-N
- Formula
- C5H10O2
- SMILES
- CCCOC(C)=O
- Mol. Weight (g/mol)
- 102.13
- CAS
- 109-60-4
- Name
- Thiophene, tetrahydro-, 1,1-dioxide
- InChI
- InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2
- InChI Key
- HXJUTPCZVOIRIF-UHFFFAOYSA-N
- Formula
- C4H8O2S
- SMILES
- O=S1(=O)CCCC1
- Mol. Weight (g/mol)
- 120.17
- CAS
- 126-33-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0000 | 0.0005 |
| 303.15 | 0.0247 | 0.0005 |
| 303.15 | 0.1746 | 0.0007 |
| 303.15 | 0.3110 | 0.0010 |
| 303.15 | 0.4416 | 0.0014 |
| 303.15 | 0.5468 | 0.0019 |
| 303.15 | 0.6489 | 0.0026 |
| 303.15 | 0.7639 | 0.0039 |
| 303.15 | 0.8733 | 0.0059 |
| 303.15 | 0.9823 | 0.0093 |
| 303.15 | 1.0000 | 0.0100 |
| 308.15 | 0.0000 | 0.0005 |
| 308.15 | 0.0247 | 0.0005 |
| 308.15 | 0.1746 | 0.0007 |
| 308.15 | 0.3110 | 0.0009 |
| 308.15 | 0.4416 | 0.0013 |
| 308.15 | 0.5468 | 0.0018 |
| 308.15 | 0.6489 | 0.0024 |
| 308.15 | 0.7639 | 0.0035 |
| 308.15 | 0.8733 | 0.0052 |
| 308.15 | 0.9823 | 0.0081 |
| 308.15 | 1.0000 | 0.0088 |
| 313.15 | 0.0000 | 0.0004 |
| 313.15 | 0.0247 | 0.0005 |
| 313.15 | 0.1746 | 0.0006 |
| 313.15 | 0.3110 | 0.0009 |
| 313.15 | 0.4416 | 0.0012 |
| 313.15 | 0.5468 | 0.0016 |
| 313.15 | 0.6489 | 0.0022 |
| 313.15 | 0.7639 | 0.0032 |
| 313.15 | 0.8733 | 0.0047 |
| 313.15 | 0.9823 | 0.0072 |
| 313.15 | 1.0000 | 0.0078 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0000 | 0.0005 |
| 303.15 | 0.0247 | 0.0005 |
| 303.15 | 0.1746 | 0.0007 |
| 303.15 | 0.3110 | 0.0010 |
| 303.15 | 0.4416 | 0.0014 |
| 303.15 | 0.5468 | 0.0019 |
| 303.15 | 0.6489 | 0.0026 |
| 303.15 | 0.7639 | 0.0039 |
| 303.15 | 0.8733 | 0.0059 |
| 303.15 | 0.9823 | 0.0093 |
| 303.15 | 1.0000 | 0.0100 |
| 308.15 | 0.0000 | 0.0005 |
| 308.15 | 0.0247 | 0.0005 |
| 308.15 | 0.1746 | 0.0007 |
| 308.15 | 0.3110 | 0.0009 |
| 308.15 | 0.4416 | 0.0013 |
| 308.15 | 0.5468 | 0.0018 |
| 308.15 | 0.6489 | 0.0024 |
| 308.15 | 0.7639 | 0.0035 |
| 308.15 | 0.8733 | 0.0052 |
| 308.15 | 0.9823 | 0.0081 |
| 308.15 | 1.0000 | 0.0088 |
| 313.15 | 0.0000 | 0.0004 |
| 313.15 | 0.0247 | 0.0005 |
| 313.15 | 0.1746 | 0.0006 |
| 313.15 | 0.3110 | 0.0009 |
| 313.15 | 0.4416 | 0.0012 |
| 313.15 | 0.5468 | 0.0016 |
| 313.15 | 0.6489 | 0.0022 |
| 313.15 | 0.7639 | 0.0032 |
| 313.15 | 0.8733 | 0.0047 |
| 313.15 | 0.9823 | 0.0072 |
| 313.15 | 1.0000 | 0.0078 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 883.7 |
| 303.15 | 0.0000 | 877.7 |
| 303.15 | 0.0247 | 886.9 |
| 303.15 | 0.1746 | 941.4 |
| 303.15 | 0.3110 | 992.9 |
| 303.15 | 0.4416 | 1043.1 |
| 303.15 | 0.5468 | 1084.6 |
| 303.15 | 0.6489 | 1124.9 |
| 303.15 | 0.7639 | 1169.5 |
| 303.15 | 0.8733 | 1212.3 |
| 303.15 | 0.9823 | 1255.4 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 873.1 |
| 308.15 | 0.0247 | 881.9 |
| 308.15 | 0.1746 | 935.8 |
| 308.15 | 0.3110 | 986.9 |
| 308.15 | 0.4416 | 1037.9 |
| 308.15 | 0.5468 | 1079.6 |
| 308.15 | 0.6489 | 1120.1 |
| 308.15 | 0.7639 | 1164.7 |
| 308.15 | 0.8733 | 1207.6 |
| 308.15 | 0.9823 | 1251.0 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 866.7 |
| 313.15 | 0.0247 | 875.7 |
| 313.15 | 0.1746 | 929.8 |
| 313.15 | 0.3110 | 981.3 |
| 313.15 | 0.4416 | 1032.4 |
| 313.15 | 0.5468 | 1074.0 |
| 313.15 | 0.6489 | 1114.1 |
| 313.15 | 0.7639 | 1159.4 |
| 313.15 | 0.8733 | 1202.2 |
| 313.15 | 0.9823 | 1245.4 |
| 313.15 | 1.0000 | 1251.6 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 883.7 |
| 303.15 | 0.0000 | 877.7 |
| 303.15 | 0.0247 | 886.9 |
| 303.15 | 0.1746 | 941.4 |
| 303.15 | 0.3110 | 992.9 |
| 303.15 | 0.4416 | 1043.1 |
| 303.15 | 0.5468 | 1084.6 |
| 303.15 | 0.6489 | 1124.9 |
| 303.15 | 0.7639 | 1169.5 |
| 303.15 | 0.8733 | 1212.3 |
| 303.15 | 0.9823 | 1255.4 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 873.1 |
| 308.15 | 0.0247 | 881.9 |
| 308.15 | 0.1746 | 935.8 |
| 308.15 | 0.3110 | 986.9 |
| 308.15 | 0.4416 | 1037.9 |
| 308.15 | 0.5468 | 1079.6 |
| 308.15 | 0.6489 | 1120.1 |
| 308.15 | 0.7639 | 1164.7 |
| 308.15 | 0.8733 | 1207.6 |
| 308.15 | 0.9823 | 1251.0 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 866.7 |
| 313.15 | 0.0247 | 875.7 |
| 313.15 | 0.1746 | 929.8 |
| 313.15 | 0.3110 | 981.3 |
| 313.15 | 0.4416 | 1032.4 |
| 313.15 | 0.5468 | 1074.0 |
| 313.15 | 0.6489 | 1114.1 |
| 313.15 | 0.7639 | 1159.4 |
| 313.15 | 0.8733 | 1202.2 |
| 313.15 | 0.9823 | 1245.4 |
| 313.15 | 1.0000 | 1251.6 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1156.0 |
| 303.15 | 0.0000 | 1149.0 |
| 303.15 | 0.0247 | 1154.0 |
| 303.15 | 0.1746 | 1214.0 |
| 303.15 | 0.3110 | 1266.0 |
| 303.15 | 0.4416 | 1322.0 |
| 303.15 | 0.5468 | 1368.0 |
| 303.15 | 0.6489 | 1419.0 |
| 303.15 | 0.7639 | 1474.0 |
| 303.15 | 0.8733 | 1530.0 |
| 303.15 | 0.9823 | 1579.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1139.0 |
| 308.15 | 0.0247 | 1147.0 |
| 308.15 | 0.1746 | 1203.0 |
| 308.15 | 0.3110 | 1257.0 |
| 308.15 | 0.4416 | 1312.0 |
| 308.15 | 0.5468 | 1359.0 |
| 308.15 | 0.6489 | 1410.0 |
| 308.15 | 0.7639 | 1469.0 |
| 308.15 | 0.8733 | 1521.0 |
| 308.15 | 0.9823 | 1573.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1126.0 |
| 313.15 | 0.0247 | 1134.0 |
| 313.15 | 0.1746 | 1189.0 |
| 313.15 | 0.3110 | 1243.0 |
| 313.15 | 0.4416 | 1301.0 |
| 313.15 | 0.5468 | 1352.0 |
| 313.15 | 0.6489 | 1401.0 |
| 313.15 | 0.7639 | 1458.0 |
| 313.15 | 0.8733 | 1510.0 |
| 313.15 | 0.9823 | 1555.0 |
| 313.15 | 1.0000 | 1558.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1156.0 |
| 303.15 | 0.0000 | 1149.0 |
| 303.15 | 0.0247 | 1154.0 |
| 303.15 | 0.1746 | 1214.0 |
| 303.15 | 0.3110 | 1266.0 |
| 303.15 | 0.4416 | 1322.0 |
| 303.15 | 0.5468 | 1368.0 |
| 303.15 | 0.6489 | 1419.0 |
| 303.15 | 0.7639 | 1474.0 |
| 303.15 | 0.8733 | 1530.0 |
| 303.15 | 0.9823 | 1579.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1139.0 |
| 308.15 | 0.0247 | 1147.0 |
| 308.15 | 0.1746 | 1203.0 |
| 308.15 | 0.3110 | 1257.0 |
| 308.15 | 0.4416 | 1312.0 |
| 308.15 | 0.5468 | 1359.0 |
| 308.15 | 0.6489 | 1410.0 |
| 308.15 | 0.7639 | 1469.0 |
| 308.15 | 0.8733 | 1521.0 |
| 308.15 | 0.9823 | 1573.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1126.0 |
| 313.15 | 0.0247 | 1134.0 |
| 313.15 | 0.1746 | 1189.0 |
| 313.15 | 0.3110 | 1243.0 |
| 313.15 | 0.4416 | 1301.0 |
| 313.15 | 0.5468 | 1352.0 |
| 313.15 | 0.6489 | 1401.0 |
| 313.15 | 0.7639 | 1458.0 |
| 313.15 | 0.8733 | 1510.0 |
| 313.15 | 0.9823 | 1555.0 |
| 313.15 | 1.0000 | 1558.0 |