- InChI
- InChI=1S/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3
- InChI Key
- YKYONYBAUNKHLG-UHFFFAOYSA-N
- Formula
- C5H10O2
- SMILES
- CCCOC(C)=O
- Molecular Weight1
- 102.13
- CAS
- 109-60-4
- Other Names
-
- 1-Acetoxypropane
- 1-Propyl acetate
- Acetate de propyle normal
- Acetic acid n-propyl ester
- Acetic acid, propyl ester
- CH3COOCH2CH2CH3
- NSC 72025
- Octan propylu
- Propyl acetate
- Propyl ester of acetic acid
- Propyl ethanoate
- Propylester kyseliny octove
- UN 1276
- ethanoic acid, propyl ester
- n-Propanol acetate
- n-Propyl ethanoate
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tboil : Boiling point at given pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| PAff | 836.60 | kJ/mol | NIST |
| BasG | 805.60 | kJ/mol | NIST |
| η | 0.0005510 | Pa×s | Densiti... |
| ΔfG° | -242.70 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -391.33 | kJ/mol | Joback Calculated Property |
| ΔfusH° | 11.49 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [34.30; 39.80] | kJ/mol |
|
| ΔvapH° | 39.77 | kJ/mol | NIST |
| ΔvapH° | 37.70 | kJ/mol | NIST |
| ΔvapH° | 39.80 ± 0.10 | kJ/mol | NIST |
| ΔvapH° | 39.10 ± 0.20 | kJ/mol | NIST |
| ΔvapH° | 39.10 ± 0.20 | kJ/mol | NIST |
| ΔvapH° | Outlier 34.30 ± 0.04 | kJ/mol | NIST |
| IE | [9.92; 10.04] | eV |
|
| IE | 10.04 ± 0.03 | eV | NIST |
| IE | 9.92 | eV | NIST |
| log10WS | [-0.72; -0.72] |
|
|
| log10WS | -0.72 | Aq. Sol... | |
| log10WS | -0.72 | Estimat... | |
| logPoct/wat | 0.959 | Crippen Calculated Property | |
| McVol | 88.750 | ml/mol | McGowan Calculated Property |
| Pc | [3335.00; 3530.00] | kPa |
|
| Pc | 3335.00 ± 81.06 | kPa | NIST |
| Pc | 3365.10 ± 40.00 | kPa | NIST |
| Pc | 3530.00 ± 101.32 | kPa | NIST |
| ρc | [290.05; 296.39] | kg/m3 |
|
| ρc | 295.67 ± 5.11 | kg/m3 | NIST |
| ρc | 296.39 ± 4.09 | kg/m3 | NIST |
| ρc | 290.05 ± 6.13 | kg/m3 | NIST |
| Inp | [646.00; 735.00] |
|
|
| Inp | 696.30 | NIST | |
| Inp | 684.60 | NIST | |
| Inp | 705.64 | NIST | |
| Inp | 698.31 | NIST | |
| Inp | 708.40 | NIST | |
| Inp | 706.70 | NIST | |
| Inp | 705.40 | NIST | |
| Inp | 676.00 | NIST | |
| Inp | 685.00 | NIST | |
| Inp | 676.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 711.00 | NIST | |
| Inp | 685.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 729.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 693.00 | NIST | |
| Inp | 669.00 | NIST | |
| Inp | 695.80 | NIST | |
| Inp | Outlier 653.00 | NIST | |
| Inp | Outlier 653.00 | NIST | |
| Inp | Outlier 654.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 707.00 | NIST | |
| Inp | Outlier 646.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 683.00 | NIST | |
| Inp | Outlier 648.00 | NIST | |
| Inp | Outlier 654.00 | NIST | |
| Inp | 698.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 697.00 | NIST | |
| Inp | 694.00 | NIST | |
| Inp | 694.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 713.00 | NIST | |
| Inp | 712.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 713.00 | NIST | |
| Inp | 698.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 707.00 | NIST | |
| Inp | 694.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 704.00 | NIST | |
| Inp | 728.00 | NIST | |
| Inp | 728.00 | NIST | |
| Inp | 685.00 | NIST | |
| Inp | 707.00 | NIST | |
| Inp | 712.00 | NIST | |
| Inp | 690.00 | NIST | |
| Inp | 694.00 | NIST | |
| Inp | 693.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | 690.00 | NIST | |
| Inp | 688.00 | NIST | |
| Inp | 694.00 | NIST | |
| Inp | 697.00 | NIST | |
| Inp | 706.00 | NIST | |
| Inp | 682.00 | NIST | |
| Inp | Outlier 657.00 | NIST | |
| Inp | Outlier 660.00 | NIST | |
| Inp | 708.00 | NIST | |
| Inp | 715.00 | NIST | |
| Inp | 720.10 | NIST | |
| Inp | 682.00 | NIST | |
| Inp | 712.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 714.00 | NIST | |
| Inp | 707.00 | NIST | |
| Inp | 683.00 | NIST | |
| Inp | 689.00 | NIST | |
| Inp | 694.00 | NIST | |
| Inp | 719.00 | NIST | |
| Inp | 694.00 | NIST | |
| Inp | 697.00 | NIST | |
| Inp | 697.00 | NIST | |
| Inp | 728.00 | NIST | |
| Inp | Outlier 735.00 | NIST | |
| Inp | 713.00 | NIST | |
| Inp | Outlier 649.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 707.00 | NIST | |
| Inp | 708.00 | NIST | |
| Inp | 694.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | Outlier 659.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 665.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 716.00 | NIST | |
| Inp | 717.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 693.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 704.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 708.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 694.00 | NIST | |
| Inp | 698.00 | NIST | |
| Inp | 728.00 | NIST | |
| I | [928.00; 996.00] |
|
|
| I | 943.00 | NIST | |
| I | 992.00 | NIST | |
| I | 981.00 | NIST | |
| I | 978.00 | NIST | |
| I | 994.00 | NIST | |
| I | 944.00 | NIST | |
| I | 970.00 | NIST | |
| I | 986.00 | NIST | |
| I | 976.00 | NIST | |
| I | 996.00 | NIST | |
| I | 980.00 | NIST | |
| I | 947.00 | NIST | |
| I | 969.00 | NIST | |
| I | 992.00 | NIST | |
| I | 996.00 | NIST | |
| I | 941.00 | NIST | |
| I | 977.00 | NIST | |
| I | 968.00 | NIST | |
| I | 983.00 | NIST | |
| I | 972.00 | NIST | |
| I | 952.00 | NIST | |
| I | 952.00 | NIST | |
| I | 957.00 | NIST | |
| I | 957.00 | NIST | |
| I | 976.00 | NIST | |
| I | 977.00 | NIST | |
| I | 992.00 | NIST | |
| I | Outlier 935.00 | NIST | |
| I | 982.00 | NIST | |
| I | 939.00 | NIST | |
| I | 960.00 | NIST | |
| I | 970.00 | NIST | |
| I | 995.00 | NIST | |
| I | 969.00 | NIST | |
| I | 982.00 | NIST | |
| I | Outlier 928.00 | NIST | |
| I | 962.00 | NIST | |
| I | 967.00 | NIST | |
| I | 971.00 | NIST | |
| I | 969.00 | NIST | |
| I | 979.00 | NIST | |
| I | 970.00 | NIST | |
| I | 968.60 | NIST | |
| I | 962.00 | NIST | |
| I | 973.00 | NIST | |
| I | 974.00 | NIST | |
| I | 976.00 | NIST | |
| I | 976.00 | NIST | |
| I | 992.00 | NIST | |
| I | 961.00 | NIST | |
| I | 982.00 | NIST | |
| I | Outlier 935.00 | NIST | |
| I | Outlier 935.00 | NIST | |
| I | 945.00 | NIST | |
| I | 976.00 | NIST | |
| I | 977.00 | NIST | |
| I | 984.00 | NIST | |
| I | 984.00 | NIST | |
| I | 966.00 | NIST | |
| I | 971.00 | NIST | |
| I | 973.00 | NIST | |
| I | Outlier 932.00 | NIST | |
| I | 942.00 | NIST | |
| I | 984.00 | NIST | |
| I | 962.00 | NIST | |
| I | 984.00 | NIST | |
| I | 963.00 | NIST | |
| I | 990.00 | NIST | |
| I | 990.00 | NIST | |
| I | 990.00 | NIST | |
| I | 986.00 | NIST | |
| I | 975.00 | NIST | |
| I | 950.00 | NIST | |
| I | 995.00 | NIST | |
| I | 969.00 | NIST | |
| I | 968.00 | NIST | |
| I | 957.00 | NIST | |
| Tboil | [370.65; 375.65] | K |
|
| Tboil | 374.80 | K | Heterog... |
| Tboil | 374.20 | K | Experim... |
| Tboil | 374.62 | K | Isobari... |
| Tboil | 374.65 | K | Isobari... |
| Tboil | 374.80 | K | NIST |
| Tboil | 374.00 | K | NIST |
| Tboil | 374.70 | K | NIST |
| Tboil | 374.70 ± 0.30 | K | NIST |
| Tboil | 374.28 ± 0.20 | K | NIST |
| Tboil | 374.75 | K | NIST |
| Tboil | 374.62 ± 0.50 | K | NIST |
| Tboil | 374.20 ± 2.00 | K | NIST |
| Tboil | 374.85 ± 0.50 | K | NIST |
| Tboil | 374.75 ± 0.50 | K | NIST |
| Tboil | 373.90 ± 1.00 | K | NIST |
| Tboil | 372.65 ± 1.00 | K | NIST |
| Tboil | 374.83 ± 0.30 | K | NIST |
| Tboil | 374.50 ± 1.00 | K | NIST |
| Tboil | Outlier 370.65 ± 1.00 | K | NIST |
| Tboil | 374.75 ± 1.00 | K | NIST |
| Tboil | 374.75 ± 1.00 | K | NIST |
| Tboil | 374.69 ± 0.08 | K | NIST |
| Tboil | 375.00 ± 3.00 | K | NIST |
| Tboil | 374.75 ± 0.50 | K | NIST |
| Tboil | 374.80 ± 0.50 | K | NIST |
| Tboil | 374.80 ± 0.40 | K | NIST |
| Tboil | 374.80 ± 0.50 | K | NIST |
| Tboil | 374.75 ± 1.00 | K | NIST |
| Tboil | 374.62 ± 1.00 | K | NIST |
| Tboil | 375.15 ± 1.00 | K | NIST |
| Tboil | 373.65 ± 1.00 | K | NIST |
| Tboil | 373.95 ± 0.50 | K | NIST |
| Tboil | 374.70 ± 1.00 | K | NIST |
| Tboil | 375.30 ± 1.00 | K | NIST |
| Tboil | 374.70 ± 0.50 | K | NIST |
| Tboil | 373.00 ± 2.00 | K | NIST |
| Tboil | 375.00 ± 1.50 | K | NIST |
| Tboil | 373.95 ± 1.00 | K | NIST |
| Tboil | 375.65 ± 1.00 | K | NIST |
| Tboil | 375.20 ± 0.70 | K | NIST |
| Tboil | Outlier 371.00 ± 3.00 | K | NIST |
| Tboil | 375.13 ± 1.00 | K | NIST |
| Tc | 568.66 | K | Joback Calculated Property |
| Tfus | [178.15; 179.55] | K |
|
| Tfus | 179.55 | K | Aq. Sol... |
| Tfus | 178.15 | K | NIST |
| Tfus | 178.15 ± 0.60 | K | NIST |
| Vc | 0.340 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [153.64; 178.95] | J/mol×K | [375.00; 450.00] |
|
| Cp,gas | 153.64 | J/mol×K | 375.00 | NIST |
| Cp,gas | 162.33 | J/mol×K | 400.00 | NIST |
| Cp,gas | 171.19 | J/mol×K | 425.00 | NIST |
| Cp,gas | 178.95 | J/mol×K | 450.00 | NIST |
| Cp,liquid | [194.10; 196.07] | J/mol×K | [298.00; 298.15] |
|
| Cp,liquid | 194.10 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 196.07 | J/mol×K | 298.15 | NIST |
| η | [0.0004329; 0.0004878] | Pa×s | [303.15; 313.15] |
|
| η | 0.0004878 | Pa×s | 303.15 | Densiti... |
| η | 0.0004595 | Pa×s | 308.15 | Densiti... |
| η | 0.0004329 | Pa×s | 313.15 | Densiti... |
| ΔvapH | [33.90; 38.60] | kJ/mol | [313.00; 458.00] |
|
|
T(K) Enthalpy of vaporization at a given temperature (kJ/mol) 34 35 36 37 38 39 350 400 450 | ||||
| ΔvapH | 38.60 ± 0.10 | kJ/mol | 313.00 | NIST |
| ΔvapH | 36.90 | kJ/mol | 335.00 | NIST |
| ΔvapH | 36.70 | kJ/mol | 335.00 | NIST |
| ΔvapH | 36.90 ± 0.10 | kJ/mol | 336.00 | NIST |
| ΔvapH | 38.20 | kJ/mol | 343.00 | NIST |
| ΔvapH | 35.30 ± 0.10 | kJ/mol | 343.00 | NIST |
| ΔvapH | 36.40 ± 0.10 | kJ/mol | 344.00 | NIST |
| ΔvapH | 35.80 ± 0.10 | kJ/mol | 351.00 | NIST |
| ΔvapH | 38.10 | kJ/mol | 352.50 | NIST |
| ΔvapH | 37.00 | kJ/mol | 352.50 | NIST |
| ΔvapH | 34.80 ± 0.10 | kJ/mol | 363.00 | NIST |
| ΔvapH | 33.92 | kJ/mol | 374.70 | NIST |
| ΔvapH | 33.90 | kJ/mol | 375.00 | NIST |
| ΔvapH | 34.80 | kJ/mol | 458.00 | NIST |
| Pvap | [0.50; 101.40] | kPa | [263.15; 374.80] |
|
|
T(K) Vapor pressure (kPa) 0 20 40 60 80 100 300 350 | ||||
| Pvap | 0.50 | kPa | 263.15 | Isother... |
| Pvap | 1.01 | kPa | 273.15 | Isother... |
| Pvap | 1.91 | kPa | 283.15 | Isother... |
| Pvap | 3.43 | kPa | 293.15 | Isother... |
| Pvap | 4.51 | kPa | 298.15 | Isother... |
| Pvap | 4.51 | kPa | 298.15 | Isother... |
| Pvap | 5.87 | kPa | 303.15 | Isother... |
| Pvap | 9.64 | kPa | 313.15 | Isother... |
| Pvap | 9.65 | kPa | 313.15 | Isother... |
| Pvap | 9.59 | kPa | 313.15 | Total V... |
| Pvap | 15.25 | kPa | 323.15 | Isother... |
| Pvap | 15.25 | kPa | 323.15 | Isother... |
| Pvap | 16.09 | kPa | 323.15 | Vapor-L... |
| Pvap | 22.20 | kPa | 331.70 | Phase e... |
| Pvap | 23.33 | kPa | 333.15 | Isother... |
| Pvap | 24.01 | kPa | 333.15 | Vapor-L... |
| Pvap | 23.33 | kPa | 333.15 | Isother... |
| Pvap | 31.10 | kPa | 340.16 | Phase e... |
| Pvap | 34.64 | kPa | 343.15 | Isother... |
| Pvap | 34.99 | kPa | 343.15 | Vapor-L... |
| Pvap | 41.80 | kPa | 348.06 | Phase e... |
| Pvap | 50.07 | kPa | 353.15 | Isother... |
| Pvap | 50.07 | kPa | 353.15 | Isother... |
| Pvap | 49.92 | kPa | 353.15 | Vapor-L... |
| Pvap | 50.40 | kPa | 353.27 | Phase e... |
| Pvap | 62.70 | kPa | 359.55 | Phase e... |
| Pvap | 70.64 | kPa | 363.15 | Isother... |
| Pvap | 70.64 | kPa | 363.15 | Isother... |
| Pvap | 71.00 | kPa | 363.29 | Phase e... |
| Pvap | 81.40 | kPa | 367.42 | Phase e... |
| Pvap | 91.50 | kPa | 371.07 | Phase e... |
| Pvap | 101.00 | kPa | 374.20 | Experim... |
| Pvap | 101.40 | kPa | 374.29 | Phase e... |
| Pvap | 101.30 | kPa | 374.62 | Isobari... |
| Pvap | 101.30 | kPa | 374.65 | Isobari... |
| Pvap | 101.00 | kPa | 374.80 | Heterog... |
| n0 | [1.37170; 1.38660] | [288.20; 318.20] |
|
|
|
T(K) Refractive Index 1.38 1.38 1.39 290 300 310 | ||||
| n0 | 1.38660 | 288.20 | Experim... | |
| n0 | 1.38181 | 298.15 | Vapor-L... | |
| n0 | 1.38180 | 298.15 | Multipr... | |
| n0 | 1.38150 | 298.15 | Isobari... | |
| n0 | 1.38210 | 298.15 | Isobari... | |
| n0 | 1.38406 | 298.15 | Isobari... | |
| n0 | 1.38300 | 298.20 | Experim... | |
| n0 | 1.38280 | 298.20 | Vapor l... | |
| n0 | 1.37920 | 303.15 | Correla... | |
| n0 | 1.37920 | 303.20 | Experim... | |
| n0 | 1.37410 | 313.15 | Density... | |
| n0 | 1.37210 | 318.15 | Thermod... | |
| n0 | 1.37200 | 318.15 | Multipr... | |
| n0 | 1.37170 | 318.20 | Experim... | |
| ρl | [859.52; 893.20] | kg/m3 | [288.15; 318.15] |
|
|
T(K) Liquid Density (kg/m3) 860 865 870 875 880 885 890 895 290 300 310 | ||||
| ρl | 893.20 | kg/m3 | 288.15 | Thermal... |
| ρl | 887.97 | kg/m3 | 293.15 | Volumet... |
| ρl | 887.80 | kg/m3 | 293.15 | Liquid-... |
| ρl | 888.96 | kg/m3 | 293.15 | Volumet... |
| ρl | 889.00 | kg/m3 | 293.20 | Ternary... |
| ρl | 883.37 | kg/m3 | 298.15 | Volumet... |
| ρl | 882.08 | kg/m3 | 298.15 | Thermod... |
| ρl | 882.80 | kg/m3 | 298.15 | Isobari... |
| ρl | 882.40 | kg/m3 | 298.15 | Experim... |
| ρl | 886.00 | kg/m3 | 298.15 | Isobari... |
| ρl | 882.05 | kg/m3 | 298.15 | Thermal... |
| ρl | 882.21 | kg/m3 | 298.15 | Volumet... |
| ρl | 882.19 | kg/m3 | 298.15 | Liquid-... |
| ρl | 881.51 | kg/m3 | 298.20 | Liquid-... |
| ρl | 876.54 | kg/m3 | 303.15 | Volumet... |
| ρl | 877.42 | kg/m3 | 303.15 | Volumet... |
| ρl | 876.56 | kg/m3 | 303.15 | Liquid-... |
| ρl | 876.55 | kg/m3 | 303.15 | Excess ... |
| ρl | 870.90 | kg/m3 | 308.15 | Liquid-... |
| ρl | 870.87 | kg/m3 | 308.15 | Thermal... |
| ρl | 870.81 | kg/m3 | 308.15 | Volumet... |
| ρl | 871.78 | kg/m3 | 308.15 | Volumet... |
| ρl | 866.12 | kg/m3 | 313.15 | Volumet... |
| ρl | 865.21 | kg/m3 | 313.15 | Liquid-... |
| ρl | 864.95 | kg/m3 | 313.15 | Volumet... |
| ρl | 859.52 | kg/m3 | 318.15 | Thermal... |
| γ | [0.02; 0.02] | N/m | [298.15; 313.15] |
|
|
T(K) Surface Tension (N/m) 0.02 0.02 0.02 0.02 0.02 300 305 310 | ||||
| γ | 0.02 | N/m | 298.15 | Densiti... |
| γ | 0.02 | N/m | 298.15 | Surface... |
| γ | 0.02 | N/m | 298.15 | Densiti... |
| γ | 0.02 | N/m | 303.15 | Densiti... |
| γ | 0.02 | N/m | 303.15 | Densiti... |
| γ | 0.02 | N/m | 303.15 | Densiti... |
| γ | 0.02 | N/m | 308.15 | Densiti... |
| γ | 0.02 | N/m | 308.15 | Densiti... |
| γ | 0.02 | N/m | 313.15 | Densiti... |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboil | [322.62; 374.66] | K | [14.90; 101.26] |
|
|
P(kPa) Boiling point at given pressure (K) 320 330 340 350 360 370 50 100 | ||||
| Tboil | 322.62 | K | 14.90 | Study o... |
| Tboil | 325.01 | K | 16.60 | Study o... |
| Tboil | 327.77 | K | 18.56 | Study o... |
| Tboil | 329.58 | K | 20.00 | Study o... |
| Tboil | 334.71 | K | 24.75 | Study o... |
| Tboil | 337.78 | K | 27.99 | Study o... |
| Tboil | 341.96 | K | 33.06 | Study o... |
| Tboil | 345.55 | K | 37.76 | Study o... |
| Tboil | 347.21 | K | 40.07 | Study o... |
| Tboil | 350.05 | K | 44.38 | Study o... |
| Tboil | 352.73 | K | 48.69 | Study o... |
| Tboil | 355.66 | K | 54.33 | Study o... |
| Tboil | 358.60 | K | 60.03 | Study o... |
| Tboil | 361.80 | K | 66.87 | Study o... |
| Tboil | 364.80 | K | 73.94 | Study o... |
| Tboil | 367.13 | K | 79.95 | Study o... |
| Tboil | 369.07 | K | 85.25 | Study o... |
| Tboil | 371.41 | K | 91.51 | Study o... |
| Tboil | 374.66 | K | 101.26 | Study o... |
Datasets
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 100.00 | 882.0 |
| 298.15 | 1000.00 | 882.5 |
| 298.15 | 2000.00 | 883.4 |
| 298.15 | 3000.00 | 884.3 |
| 298.15 | 3300.00 | 884.6 |
| 298.15 | 5000.00 | 886.4 |
| 298.15 | 10000.00 | 890.7 |
| 298.15 | 15000.00 | 894.8 |
| 298.15 | 20000.00 | 898.7 |
| 298.15 | 25000.00 | 902.5 |
| 298.15 | 30000.00 | 906.9 |
| 298.15 | 35000.00 | 911.7 |
| 303.15 | 100.00 | 876.2 |
| 303.15 | 1000.00 | 876.8 |
| 303.15 | 2000.00 | 877.7 |
| 303.15 | 3000.00 | 878.8 |
| 303.15 | 3300.00 | 879.0 |
| 303.15 | 5000.00 | 880.8 |
| 303.15 | 10000.00 | 885.3 |
| 303.15 | 15000.00 | 889.5 |
| 303.15 | 20000.00 | 893.5 |
| 303.15 | 25000.00 | 897.4 |
| 303.15 | 30000.00 | 902.0 |
| 303.15 | 35000.00 | 906.9 |
| 308.15 | 100.00 | 870.5 |
| 308.15 | 1000.00 | 871.2 |
| 308.15 | 2000.00 | 872.2 |
| 308.15 | 3000.00 | 873.2 |
| 308.15 | 3300.00 | 873.4 |
| 308.15 | 5000.00 | 875.3 |
| 308.15 | 10000.00 | 879.9 |
| 308.15 | 15000.00 | 884.3 |
| 308.15 | 20000.00 | 888.4 |
| 308.15 | 25000.00 | 892.4 |
| 308.15 | 30000.00 | 897.2 |
| 308.15 | 35000.00 | 902.3 |
| 313.15 | 100.00 | 864.9 |
| 313.15 | 1000.00 | 865.5 |
| 313.15 | 2000.00 | 866.6 |
| 313.15 | 3000.00 | 867.6 |
| 313.15 | 3300.00 | 867.9 |
| 313.15 | 5000.00 | 869.9 |
| 313.15 | 10000.00 | 874.7 |
| 313.15 | 15000.00 | 879.2 |
| 313.15 | 20000.00 | 883.5 |
| 313.15 | 25000.00 | 887.6 |
| 313.15 | 30000.00 | 892.6 |
| 313.15 | 35000.00 | 897.7 |
| 318.15 | 100.00 | 859.3 |
| 318.15 | 1000.00 | 859.8 |
| 318.15 | 2000.00 | 860.9 |
| 318.15 | 3000.00 | 862.1 |
| 318.15 | 3300.00 | 862.4 |
| 318.15 | 5000.00 | 864.4 |
| 318.15 | 10000.00 | 869.4 |
| 318.15 | 15000.00 | 874.1 |
| 318.15 | 20000.00 | 878.5 |
| 318.15 | 25000.00 | 882.8 |
| 318.15 | 30000.00 | 887.9 |
| 318.15 | 35000.00 | 893.2 |
| 323.15 | 100.00 | 853.6 |
| 323.15 | 1000.00 | 854.8 |
| 323.15 | 2000.00 | 855.8 |
| 323.15 | 3000.00 | 856.9 |
| 323.15 | 3300.00 | 857.1 |
| 323.15 | 5000.00 | 859.0 |
| 323.15 | 10000.00 | 864.1 |
| 323.15 | 15000.00 | 869.0 |
| 323.15 | 20000.00 | 873.5 |
| 323.15 | 25000.00 | 877.9 |
| 323.15 | 30000.00 | 883.2 |
| 323.15 | 35000.00 | 888.8 |
| 328.15 | 100.00 | 848.0 |
| 328.15 | 1000.00 | 848.7 |
| 328.15 | 2000.00 | 849.9 |
| 328.15 | 3000.00 | 851.0 |
| 328.15 | 3300.00 | 851.3 |
| 328.15 | 5000.00 | 853.7 |
| 328.15 | 10000.00 | 859.0 |
| 328.15 | 15000.00 | 864.0 |
| 328.15 | 20000.00 | 868.7 |
| 328.15 | 25000.00 | 873.3 |
| 328.15 | 30000.00 | 878.8 |
| 328.15 | 35000.00 | 884.4 |
| 333.15 | 100.00 | 842.5 |
| 333.15 | 1000.00 | 843.6 |
| 333.15 | 2000.00 | 844.8 |
| 333.15 | 3000.00 | 845.9 |
| 333.15 | 3300.00 | 846.2 |
| 333.15 | 5000.00 | 848.3 |
| 333.15 | 10000.00 | 853.9 |
| 333.15 | 15000.00 | 859.0 |
| 333.15 | 20000.00 | 863.9 |
| 333.15 | 25000.00 | 868.6 |
| 333.15 | 30000.00 | 874.3 |
| 333.15 | 35000.00 | 880.1 |
| 338.15 | 100.00 | 836.7 |
| 338.15 | 1000.00 | 838.0 |
| 338.15 | 2000.00 | 839.2 |
| 338.15 | 3000.00 | 840.5 |
| 338.15 | 3300.00 | 840.8 |
| 338.15 | 5000.00 | 842.8 |
| 338.15 | 10000.00 | 848.6 |
| 338.15 | 15000.00 | 853.9 |
| 338.15 | 20000.00 | 859.0 |
| 338.15 | 25000.00 | 863.8 |
| 338.15 | 30000.00 | 869.6 |
| 338.15 | 35000.00 | 875.5 |
| 343.15 | 100.00 | 831.2 |
| 343.15 | 1000.00 | 832.3 |
| 343.15 | 2000.00 | 833.7 |
| 343.15 | 3000.00 | 834.9 |
| 343.15 | 3300.00 | 835.3 |
| 343.15 | 5000.00 | 837.6 |
| 343.15 | 10000.00 | 843.6 |
| 343.15 | 15000.00 | 849.1 |
| 343.15 | 20000.00 | 854.3 |
| 343.15 | 25000.00 | 859.2 |
| 343.15 | 30000.00 | 865.0 |
| 343.15 | 35000.00 | 871.2 |
| 348.15 | 100.00 | 825.6 |
| 348.15 | 1000.00 | 826.8 |
| 348.15 | 2000.00 | 828.1 |
| 348.15 | 3000.00 | 829.5 |
| 348.15 | 3300.00 | 829.9 |
| 348.15 | 5000.00 | 832.2 |
| 348.15 | 10000.00 | 838.3 |
| 348.15 | 15000.00 | 844.1 |
| 348.15 | 20000.00 | 849.5 |
| 348.15 | 25000.00 | 854.5 |
| 348.15 | 30000.00 | 860.6 |
| 348.15 | 35000.00 | 866.8 |
| 353.15 | 100.00 | 820.0 |
| 353.15 | 1000.00 | 821.2 |
| 353.15 | 2000.00 | 822.6 |
| 353.15 | 3000.00 | 824.0 |
| 353.15 | 3300.00 | 824.4 |
| 353.15 | 5000.00 | 826.9 |
| 353.15 | 10000.00 | 833.3 |
| 353.15 | 15000.00 | 838.8 |
| 353.15 | 20000.00 | 844.8 |
| 353.15 | 25000.00 | 850.0 |
| 353.15 | 30000.00 | 856.4 |
| 353.15 | 35000.00 | 862.7 |
| 358.15 | 100.00 | 811.6 |
| 358.15 | 1000.00 | 812.9 |
| 358.15 | 2000.00 | 814.4 |
| 358.15 | 3000.00 | 815.8 |
| 358.15 | 3300.00 | 816.3 |
| 358.15 | 5000.00 | 818.6 |
| 358.15 | 10000.00 | 825.3 |
| 358.15 | 15000.00 | 831.5 |
| 358.15 | 20000.00 | 837.2 |
| 358.15 | 25000.00 | 842.8 |
| 363.15 | 100.00 | 804.8 |
| 363.15 | 1000.00 | 806.9 |
| 363.15 | 2000.00 | 808.4 |
| 363.15 | 3000.00 | 810.0 |
| 363.15 | 3300.00 | 810.4 |
| 363.15 | 5000.00 | 812.9 |
| 363.15 | 10000.00 | 819.9 |
| 363.15 | 15000.00 | 826.2 |
| 363.15 | 20000.00 | 832.1 |
| 363.15 | 25000.00 | 837.7 |
| 363.15 | 30000.00 | 844.4 |
| 368.15 | 1000.00 | 801.0 |
| 368.15 | 2000.00 | 802.7 |
| 368.15 | 3000.00 | 804.3 |
| 368.15 | 3300.00 | 804.8 |
| 368.15 | 5000.00 | 807.4 |
| 368.15 | 10000.00 | 814.6 |
| 368.15 | 15000.00 | 821.2 |
| 368.15 | 20000.00 | 827.3 |
| 368.15 | 25000.00 | 833.1 |
| 373.15 | 1000.00 | 795.5 |
| 373.15 | 2000.00 | 797.2 |
| 373.15 | 3000.00 | 798.9 |
| 373.15 | 3300.00 | 799.5 |
| 373.15 | 5000.00 | 802.3 |
| 373.15 | 10000.00 | 809.8 |
| 373.15 | 15000.00 | 816.6 |
| 373.15 | 20000.00 | 822.9 |
| 373.15 | 25000.00 | 828.9 |
| 378.15 | 1000.00 | 789.4 |
| 378.15 | 2000.00 | 791.3 |
| 378.15 | 3000.00 | 793.0 |
| 378.15 | 3300.00 | 793.6 |
| 378.15 | 5000.00 | 796.3 |
| 378.15 | 10000.00 | 803.3 |
| 378.15 | 15000.00 | 811.3 |
| 378.15 | 20000.00 | 817.7 |
| 378.15 | 25000.00 | 824.0 |
| 378.15 | 30000.00 | 831.2 |
| 383.15 | 1000.00 | 783.6 |
| 383.15 | 2000.00 | 785.5 |
| 383.15 | 3000.00 | 787.3 |
| 383.15 | 3300.00 | 788.2 |
| 383.15 | 5000.00 | 791.2 |
| 383.15 | 10000.00 | 799.2 |
| 383.15 | 15000.00 | 806.6 |
| 383.15 | 20000.00 | 813.2 |
| 383.15 | 25000.00 | 819.7 |
| 388.15 | 1000.00 | 777.9 |
| 388.15 | 2000.00 | 779.8 |
| 388.15 | 3000.00 | 781.6 |
| 388.15 | 3300.00 | 782.1 |
| 388.15 | 5000.00 | 785.4 |
| 388.15 | 10000.00 | 793.8 |
| 388.15 | 15000.00 | 801.5 |
| 388.15 | 20000.00 | 808.5 |
| 388.15 | 25000.00 | 815.2 |
| 388.15 | 30000.00 | 823.2 |
| 393.15 | 1000.00 | 771.8 |
| 393.15 | 2000.00 | 773.9 |
| 393.15 | 3000.00 | 775.9 |
| 393.15 | 3300.00 | 776.4 |
| 393.15 | 5000.00 | 779.7 |
| 393.15 | 10000.00 | 788.6 |
| 393.15 | 15000.00 | 796.5 |
| 393.15 | 20000.00 | 803.8 |
| 393.15 | 25000.00 | 810.7 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.64] | kPa | [276.65; 398.87] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.46116e+01 | |||
| Coefficient B | -3.24092e+03 | |||
| Coefficient C | -5.03900e+01 | |||
| Temperature range, min. | 276.65 | |||
| Temperature range, max. | 398.87 | |||
|
T(K) Vapor pressure (kPa) 0 50 100 150 200 300 350 400 | ||||
| Pvap | 1.33 | kPa | 276.65 | Calculated Property |
| Pvap | 3.00 | kPa | 290.23 | Calculated Property |
| Pvap | 6.19 | kPa | 303.81 | Calculated Property |
| Pvap | 11.86 | kPa | 317.39 | Calculated Property |
| Pvap | 21.35 | kPa | 330.97 | Calculated Property |
| Pvap | 36.38 | kPa | 344.55 | Calculated Property |
| Pvap | 59.16 | kPa | 358.13 | Calculated Property |
| Pvap | 92.33 | kPa | 371.71 | Calculated Property |
| Pvap | 138.98 | kPa | 385.29 | Calculated Property |
| Pvap | 202.64 | kPa | 398.87 | Calculated Property |
| Pvap | [2.14e-05; 3330.47] | kPa | [178.15; 549.40] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 9.54327e+01 | |||
| Coefficient B | -7.93197e+03 | |||
| Coefficient C | -1.19486e+01 | |||
| Coefficient D | 8.27424e-06 | |||
| Temperature range, min. | 178.15 | |||
| Temperature range, max. | 549.40 | |||
|
T(K) Vapor pressure (kPa) 0 500 1000 1500 2000 2500 3000 3500 200 300 400 500 | ||||
| Pvap | 2.14e-05 | kPa | 178.15 | Calculated Property |
| Pvap | 8.78e-03 | kPa | 219.40 | Calculated Property |
| Pvap | 0.40 | kPa | 260.65 | Calculated Property |
| Pvap | 5.40 | kPa | 301.90 | Calculated Property |
| Pvap | 34.25 | kPa | 343.15 | Calculated Property |
| Pvap | 135.12 | kPa | 384.40 | Calculated Property |
| Pvap | 389.33 | kPa | 425.65 | Calculated Property |
| Pvap | 907.07 | kPa | 466.90 | Calculated Property |
| Pvap | 1827.15 | kPa | 508.15 | Calculated Property |
| Pvap | 3330.47 | kPa | 549.40 | Calculated Property |
Similar Compounds
Find more compounds similar to n-Propyl acetate.
Mixtures
- Trichloroethylene + n-Propyl acetate
- 1-Propanol + Carbon dioxide + n-Propyl acetate
- n-Propyl acetate + Simvastatin
- n-Propyl acetate + Diethyl sulfide
- n-Propyl acetate + Water
- Furfural + n-Propyl acetate + Water
- 1-Butanol + n-Propyl acetate
- 1-Propanol + n-Propyl acetate
- 1-Propanol + n-Propyl acetate + Water
- Isopropyl Alcohol + n-Propyl acetate
- Isopropyl Alcohol + n-Propyl acetate + Water
- 2-Propanone, 1-hydroxy- + n-Propyl acetate + Water
- Heptane + n-Propyl acetate
- n-Propyl acetate + Nonane
- Undecane + n-Propyl acetate
- Tridecane + n-Propyl acetate
- Pentadecane + n-Propyl acetate
- Heptadecane + n-Propyl acetate
- n-Propyl acetate + Benzene, 1,2,4-trimethyl-
- n-Propyl acetate + Mesitylene
Find more mixtures with n-Propyl acetate.
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Excess Volumes and Excess Isentropic Compressibilities of Binary Liquid Mixtures of Trichloroethylene with Esters at 303.15 K
- (Liquid + liquid) equilibria of (water + 1-propanol + solvent) at T = 298.2K
- Vapor liquid equilibria for the ternary mixture of carbon dioxide + 1-propanol + propyl acetate at elevated pressures
- Solubility and limiting activity coefficient of simvastatin in different organic solvents
- Isothermal vapor-liquid equilibria and excess enthalpies of binary mixtures of propyl ethanoate + 1-hexyne, +2-hexyne, +3-hexyne
- Phase equilibria on binary systems containing diethyl sulfide
- Liquid-liquid equilibrium for the ternary systems of water + acetyl acetone + propyl acetate at several temperatures
- Investigation on isobaric vapor-liquid equilibrium for acetic acid + water + (n-propyl acetate or iso-butyl acetate)
- Vapour-liquid and chemical equilibria in the ethyl ethanoate + ethanol + propyl ethanoate + propanol system accompanied with transesterification reaction
- Experimental and calculated liquid-liquid equilibrium data for water + furfural + solvents
- Solubility, liquid-liquid equilibrium and critical states for the system acetic acid + n-propanol + n-propyl acetate + water at 293.15 K and 303.15 K
- Temperature dependence of limiting activity coefficients, Henry's law constants, and related infinite dilution properties of C4-C6 isomeric n-alkyl ethanoates/ethyl n-alkanoates in water. Measurement, critical compilation, correlation, and recommended data
- Excess molar enthalpies for binary mixtures of n-propanol, acetic acid, and n-propyl acetate at 313.15 K and atmospheric pressure
- Isobaric (vapor+liquid) equilibrium for n-propyl acetate with 1-butanol or 2-butanol. Binary mixtures at 0.15 and 0.6 MPa
- Solution thermodynamics of simvastatin in pure solvents and binary solvent mixtures
- Liquid-liquid equilibrium of the ternary system water p propargyl alcohol p n-propyl acetate
- Heterogeneous azeotropic distillation for the separation of n-propanol + water mixture using n-propyl acetate as entrainer
- Experimental studies and thermodynamic analysis of isobaric vapor-liquid-liquid equilibria of 2-propanol + water system using n-propyl acetate and isopropyl acetate as entrainers
- Liquid-liquid equilibria and COSMO-SAC modeling of organic solvent/ ionic liquid - hydroxyacetone - water mixtures
- Thermodynamic properties of (an ester + an alkane). XVI. Experimental HEm and V Em values and a new correlation method for (an alkyl ethanoate + an n-alkane) at 318.15 K
- Densities, surface tensions, and derived surface thermodynamics properties of (trimethylbenzene + propyl acetate, or butyl acetate) from T = 298.15 K to 313.15 K
- Thermodynamic study of (alkyl esters + a,x-alkyl dihalides) VII. HE m and VE m for 20 binary mixtures {xCu 1H2u 1CO2C3H7 + (1 x)a,x-ClCH2(CH2)v 2CH2Cl}, where u = 1 to 4, a = 1 and v = x = 2 to 6. An analysis of behavior using the COSMO-RS methodology
- Solubility of diosgenin in different solvents
- Density, refraction index and vapor-liquid equilibria of N-methyl-2-hydroxyethylammonium butyrate plus (methyl acetate or ethyl acetate or propyl acetate) at several temperatures
- Solid-liquid phase equilibrium and mixing properties of 2-Cyano-4'-methylbiphenyl in pure solvents
- Measurement and correlation of solubility of boscalid with thermodynamic analysis in pure and binary solvents from 288.15 K to 313.15 K
- Experimental and correlated liquid-liquid equilibrium data for water-phosphoric acid-ester
- Liquid-liquid equilibrium for methyl butyl ketone + o-, m-, p-cresol + water ternary systems and COSMO-SAC predictions
- Isobaric vapor-liquid equilibrium of a ternary system of ethyl acetate + propyl acetate + dimethyl sulfoxide and binary systems of ethyl acetate + dimethyl sulfoxide and propyl acetate + dimethyl sulfoxide at 101.3 kPa
- Studies on liquid liquid interactions of some ternary mixtures by density, viscosity, ultrasonic speed and refractive index measurements
- Ternary and Quaternary Liquid-Liquid Equilibria for Systems of Methyl Butyl Ketone + Water + Hydroquinone + Phenol at 313.2 K and Atmospheric Pressure
- Measurement and Correlation of Solubility on Reactive Crystallization of Methyl D-(-)-4-Hydroxy-phenylglycinate
- Ternary Liquid Liquid Equilibrium of Azeotropes (Ester + Alcohol) with Different Ionic Liquids at T = 298.15 K
- Vapor-Liquid Equilibrium Data for Binary Mixtures of Dimethyl Carbonate with Methyl Acetate, Ethyl Acetate, n-Propyl Acetate, Isopropyl Acetate, n-Butyl Acetate, and Isoamyl Acetate at 93.13 kPa
- Solution Thermodynamics of Benzotriazole in Different Pure Solvents
- Isobaric Vapor-liquid Equilibrium for Three Binary Systems of Ethyl Acetate + Propyl Acetate, Ethyl Acetate + Propylene Carbonate, and Propyl Acetate + Propylene Carbonate at 101.3 kPa
- Liquid-Liquid Extraction of Cyclopentanone from Aqueous Solution with Methylcyclohexane or Propyl Acetate at Different Temperatures
- Isobaric Vapor-Liquid Equilibrium Data for Binary Systems of Anisole with Methyl Acetate, Ethyl Acetate, n-Propyl Acetate, and Isopropyl Acetate at 93.9 kPa
- Isobaric Vapor-Liquid Equilibrium for the Binary Systems of 1,2-Dichloroethane + sec-Butyl Acetate, n-Propyl Acetate, and tert-Butyl Acetate at 101.3 kPa
- Liquid-Liquid Equilibrium Data for the Systems n-Propyl Acetate or Isopropyl Acetate + n-Propanol or Isopropyl Alcohol + IL at 298.15 and 318.15 K and Atmospheric Pressure
- Volumetric and FT-IR Studies of the Binary Liquid Mixtures of Tributylamine and Alkyl Ester (C1-C5)
- Solubilities of 2,6-Dimethylnaphthalene in Six Pure Solvents and Two Binary Solvent Systems
- Isobaric Vapor-Liquid Equilibria of Binary Mixtures of Diethyl Carbonate with Methyl Acetate, n-Propyl Acetate, or Amyl Acetate at 100.17 kPa
- Study of Vapor-Liquid Equilibria for Acetic Acid + n-Propyl Acetate + Isopropyl Acetate Systems
- Solubility and Thermodynamic Modeling of Dimethyl Terephthalate in Pure Solvents and the Evaluation of the Mixing Properties of the Solutions
- Thermodynamic Properties of Mixtures Containing Precursors of Vitamin B5
- Total Vapor Pressure Measurements for 2-Ethoxyethanol with Methyl Acetate, Ethyl Acetate, Propyl Acetate, and Ethyl Propionate at 313.15 K and for 2-Ethoxyethanol with Methyl Formate at 308.15 K
- Measurement of Activity Coefficients at Infinite Dilution of Benzene, Toluene, Ethanol, Esters, Ketones, and Ethers at Various Temperatures in Water Using the Dilutor Technique
- Liquid-Liquid Equilibria for the Ternary System Water + Acetic Acid + Propyl Acetate
- Correlation and Prediction of Excess Quantities and Vapor-Liquid Equilibria of Alkyl Esters + tert-Butyl Alcohol: Experimental Data for Propyl Esters + tert-Butyl Alcohol
- Isothermal Vapor-Liquid Equilibria and Excess Enthalpies of (Propyl Ethanoate + Heptane), (Propyl Ethanoate + Cyclohexane), and (Propyl Ethanoate + 1-Hexene)
- PVT Property Measurements for Some Aliphatic Esters from (298 to 393) K and up to 35 MPa
- Densities and Surface Tensions of Propyl Acetate + Xylenes or + Ethylbenzene from (298.15 to 308.15) K
- Vapor-Liquid Equilibria in the Propyl Acetate + Ethanoic Acid Binary System from (323.15 to 353.15) K: Measurement with a Static Method and Modeling with the NRTL, Wilson, UNIQUAC, and COSMO-SAC Approaches
- Activity Coefficients at Infinite Dilution by GLC in Alkanediamines as Stationary Phases
- Thermal and Volumetric Properties of Four Aqueous Aroma Compounds at Infinite Dilution
- Crystal Structures, Reaction Rates, and Selected Physical Properties of Halo-Boronsubphthalocyanines (Halo = Fluoride, Chloride, and Bromide)
- Volumetric Properties of Binary Mixtures of N-Ethylformamide with Tetrahydropyran, 2-Pentanone, and Propylacetate from (293.15 to 313.15) K
- Multiproperty Correlation of Experimental Data of the Binaries Propyl Ethanoate + Alkanes (Pentane to Decane). New Experimental Information for Vapor Liquid Equilibrium and Mixing Properties
- Experimental Determination of Vapor Liquid Equilibria. Binary Systems of Methyl Acetate, Ethyl Acetate, and Propyl Acetate with 1-Propanol at 0.6 MPa
- Isobaric Vapor Liquid Equilibria of Binary Systems (Propyl Acetate + n-Pentanol), (Propyl Acetate + 1-Methyl-1-butanol), and (Propyl Acetate + 3-Methyl-1-butanol) at 101.3 kPa
- Isobaric Vapor Liquid Liquid Equilibria for the Ternary Systems Ethanol + Water + Propyl Acetate and 1-Propanol + Water + Propyl acetate
- Isobaric Vapor Liquid Equilibria of Binary Systems (Propyl Acetate + 2-Methylbutan-1-ol), (Propyl Acetate + Hexan-1-ol), and (Propyl Acetate + Heptan-1-ol) at 101.3 kPa
- Solubility of Anthracene in Binary Propyl Acetate + Alcohol Solvent Mixtures at 298.15 K
- Solubility of Lovastatin in Ethyl Acetate, Propyl Acetate, Isopropyl Acetate, Butyl Acetate, sec-Butyl Acetate, Isobutyl Acetate, tert-Butyl Acetate, and 2-Butanone, between (285 and 313) K
- Ternary Liquid-Liquid Equilibria for Systems Containing Alcohol or Acetic Acid + Ester + 1-Ethyl-3-methylimidazolium Hydrogen Sulfate at 313.2 K Using Headspace Gas Chromatography
- Densities, Viscosities, and Speeds of Sound of Binary Liquid Mixtures of Sulfolane with Ethyl Acetate, n-Propyl Acetate, and n-Butyl Acetate at Temperature of (303.15, 308.15, and 313.15) K
- Densities and Viscosities of Ternary Mixtures of Cyclohexane + Cyclohexanone + Some Alkyl Acetates at 298.15 K
- Surface Tension Data of Aqueous Binary Mixtures of Methyl, Ethyl, Propyl, and Butyl Acetates at 298.15 K
- Joback Method
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.