- Name
- Benzene, nitro-
- InChI
- InChI=1S/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H
- InChI Key
- LQNUZADURLCDLV-UHFFFAOYSA-N
- Formula
- C6H5NO2
- SMILES
- O=[N+]([O-])c1ccccc1
- Mol. Weight (g/mol)
- 123.11
- CAS
- 98-95-3
- Name
- 2-Pentanone, 4-hydroxy-4-methyl-
- InChI
- InChI=1S/C6H12O2/c1-5(7)4-6(2,3)8/h8H,4H2,1-3H3
- InChI Key
- SWXVUIWOUIDPGS-UHFFFAOYSA-N
- Formula
- C6H12O2
- SMILES
- CC(=O)CC(C)(C)O
- Mol. Weight (g/mol)
- 116.16
- CAS
- 123-42-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
- γ - Surface tension liquid-gas, N/m (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanone, 4-hydroxy-4-methyl- (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0000 | 0.0016 |
| 303.15 | 0.1248 | 0.0020 |
| 303.15 | 0.2389 | 0.0022 |
| 303.15 | 0.3446 | 0.0023 |
| 303.15 | 0.4921 | 0.0025 |
| 303.15 | 0.5853 | 0.0026 |
| 303.15 | 0.6427 | 0.0026 |
| 303.15 | 0.7532 | 0.0027 |
| 303.15 | 0.8226 | 0.0028 |
| 303.15 | 0.9349 | 0.0029 |
| 303.15 | 1.0000 | 0.0029 |
| 313.15 | 0.0000 | 0.0015 |
| 313.15 | 0.1248 | 0.0018 |
| 313.15 | 0.2389 | 0.0019 |
| 313.15 | 0.3446 | 0.0021 |
| 313.15 | 0.4921 | 0.0024 |
| 313.15 | 0.5853 | 0.0025 |
| 313.15 | 0.6427 | 0.0027 |
| 313.15 | 0.7532 | 0.0027 |
| 313.15 | 0.8226 | 0.0028 |
| 313.15 | 0.9349 | 0.0028 |
| 313.15 | 1.0000 | 0.0028 |
| 323.15 | 0.0000 | 0.0013 |
| 323.15 | 0.1248 | 0.0017 |
| 323.15 | 0.2389 | 0.0018 |
| 323.15 | 0.3446 | 0.0020 |
| 323.15 | 0.4921 | 0.0023 |
| 323.15 | 0.5853 | 0.0025 |
| 323.15 | 0.6427 | 0.0026 |
| 323.15 | 0.7532 | 0.0027 |
| 323.15 | 0.8226 | 0.0027 |
| 323.15 | 0.9349 | 0.0027 |
| 323.15 | 1.0000 | 0.0027 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanone, 4-hydroxy-4-methyl- (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0000 | 0.0016 |
| 303.15 | 0.1248 | 0.0020 |
| 303.15 | 0.2389 | 0.0022 |
| 303.15 | 0.3446 | 0.0023 |
| 303.15 | 0.4921 | 0.0025 |
| 303.15 | 0.5853 | 0.0026 |
| 303.15 | 0.6427 | 0.0026 |
| 303.15 | 0.7532 | 0.0027 |
| 303.15 | 0.8226 | 0.0028 |
| 303.15 | 0.9349 | 0.0029 |
| 303.15 | 1.0000 | 0.0029 |
| 313.15 | 0.0000 | 0.0015 |
| 313.15 | 0.1248 | 0.0018 |
| 313.15 | 0.2389 | 0.0019 |
| 313.15 | 0.3446 | 0.0021 |
| 313.15 | 0.4921 | 0.0024 |
| 313.15 | 0.5853 | 0.0025 |
| 313.15 | 0.6427 | 0.0027 |
| 313.15 | 0.7532 | 0.0027 |
| 313.15 | 0.8226 | 0.0028 |
| 313.15 | 0.9349 | 0.0028 |
| 313.15 | 1.0000 | 0.0028 |
| 323.15 | 0.0000 | 0.0013 |
| 323.15 | 0.1248 | 0.0017 |
| 323.15 | 0.2389 | 0.0018 |
| 323.15 | 0.3446 | 0.0020 |
| 323.15 | 0.4921 | 0.0023 |
| 323.15 | 0.5853 | 0.0025 |
| 323.15 | 0.6427 | 0.0026 |
| 323.15 | 0.7532 | 0.0027 |
| 323.15 | 0.8226 | 0.0027 |
| 323.15 | 0.9349 | 0.0027 |
| 323.15 | 1.0000 | 0.0027 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanone, 4-hydroxy-4-methyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 303.15 | 0.0000 | 1.5504 |
| 303.15 | 0.1248 | 1.5377 |
| 303.15 | 0.2389 | 1.5245 |
| 303.15 | 0.3446 | 1.5113 |
| 303.15 | 0.4921 | 1.4931 |
| 303.15 | 0.5853 | 1.4822 |
| 303.15 | 0.6427 | 1.474 |
| 303.15 | 0.7532 | 1.4601 |
| 303.15 | 0.8226 | 1.45 |
| 303.15 | 0.9349 | 1.43 |
| 303.15 | 1.0000 | 1.4239 |
| 313.15 | 0.0000 | 1.5476 |
| 313.15 | 0.1248 | 1.5351 |
| 313.15 | 0.2389 | 1.521 |
| 313.15 | 0.3446 | 1.508 |
| 313.15 | 0.4921 | 1.4897 |
| 313.15 | 0.5853 | 1.4782 |
| 313.15 | 0.6427 | 1.4706 |
| 313.15 | 0.7532 | 1.4548 |
| 313.15 | 0.8226 | 1.4456 |
| 313.15 | 0.9349 | 1.4261 |
| 313.15 | 1.0000 | 1.4198 |
| 323.15 | 0.0000 | 1.5435 |
| 323.15 | 0.1248 | 1.5304 |
| 323.15 | 0.2389 | 1.5268 |
| 323.15 | 0.3446 | 1.5048 |
| 323.15 | 0.4921 | 1.486 |
| 323.15 | 0.5853 | 1.475 |
| 323.15 | 0.6427 | 1.4675 |
| 323.15 | 0.7532 | 1.4503 |
| 323.15 | 0.8226 | 1.4412 |
| 323.15 | 0.9349 | 1.4215 |
| 323.15 | 1.0000 | 1.4151 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanone, 4-hydroxy-4-methyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 303.15 | 0.0000 | 1.5504 |
| 303.15 | 0.1248 | 1.5377 |
| 303.15 | 0.2389 | 1.5245 |
| 303.15 | 0.3446 | 1.5113 |
| 303.15 | 0.4921 | 1.4931 |
| 303.15 | 0.5853 | 1.4822 |
| 303.15 | 0.6427 | 1.474 |
| 303.15 | 0.7532 | 1.4601 |
| 303.15 | 0.8226 | 1.45 |
| 303.15 | 0.9349 | 1.43 |
| 303.15 | 1.0000 | 1.4239 |
| 313.15 | 0.0000 | 1.5476 |
| 313.15 | 0.1248 | 1.5351 |
| 313.15 | 0.2389 | 1.521 |
| 313.15 | 0.3446 | 1.508 |
| 313.15 | 0.4921 | 1.4897 |
| 313.15 | 0.5853 | 1.4782 |
| 313.15 | 0.6427 | 1.4706 |
| 313.15 | 0.7532 | 1.4548 |
| 313.15 | 0.8226 | 1.4456 |
| 313.15 | 0.9349 | 1.4261 |
| 313.15 | 1.0000 | 1.4198 |
| 323.15 | 0.0000 | 1.5435 |
| 323.15 | 0.1248 | 1.5304 |
| 323.15 | 0.2389 | 1.5268 |
| 323.15 | 0.3446 | 1.5048 |
| 323.15 | 0.4921 | 1.486 |
| 323.15 | 0.5853 | 1.475 |
| 323.15 | 0.6427 | 1.4675 |
| 323.15 | 0.7532 | 1.4503 |
| 323.15 | 0.8226 | 1.4412 |
| 323.15 | 0.9349 | 1.4215 |
| 323.15 | 1.0000 | 1.4151 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanone, 4-hydroxy-4-methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 1200.0 |
| 303.15 | 0.1248 | 1163.9 |
| 303.15 | 0.2389 | 1130.2 |
| 303.15 | 0.3446 | 1102.1 |
| 303.15 | 0.4921 | 1062.0 |
| 303.15 | 0.5853 | 1038.0 |
| 303.15 | 0.6427 | 1023.0 |
| 303.15 | 0.7532 | 995.6 |
| 303.15 | 0.8226 | 979.1 |
| 303.15 | 0.9349 | 943.3 |
| 303.15 | 1.0000 | 936.0 |
| 313.15 | 0.0000 | 1196.0 |
| 313.15 | 0.1248 | 1157.7 |
| 313.15 | 0.2389 | 1120.9 |
| 313.15 | 0.3446 | 1088.8 |
| 313.15 | 0.4921 | 1046.3 |
| 313.15 | 0.5853 | 1019.9 |
| 313.15 | 0.6427 | 1004.4 |
| 313.15 | 0.7532 | 975.5 |
| 313.15 | 0.8226 | 957.8 |
| 313.15 | 0.9349 | 920.0 |
| 313.15 | 1.0000 | 912.0 |
| 323.15 | 0.0000 | 1185.0 |
| 323.15 | 0.1248 | 1146.5 |
| 323.15 | 0.2389 | 1109.6 |
| 323.15 | 0.3446 | 1077.5 |
| 323.15 | 0.4921 | 1035.0 |
| 323.15 | 0.5853 | 999.9 |
| 323.15 | 0.6427 | 993.1 |
| 323.15 | 0.7532 | 964.3 |
| 323.15 | 0.8226 | 946.6 |
| 323.15 | 0.9349 | 910.0 |
| 323.15 | 1.0000 | 901.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanone, 4-hydroxy-4-methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 1200.0 |
| 303.15 | 0.1248 | 1163.9 |
| 303.15 | 0.2389 | 1130.2 |
| 303.15 | 0.3446 | 1102.1 |
| 303.15 | 0.4921 | 1062.0 |
| 303.15 | 0.5853 | 1038.0 |
| 303.15 | 0.6427 | 1023.0 |
| 303.15 | 0.7532 | 995.6 |
| 303.15 | 0.8226 | 979.1 |
| 303.15 | 0.9349 | 943.3 |
| 303.15 | 1.0000 | 936.0 |
| 313.15 | 0.0000 | 1196.0 |
| 313.15 | 0.1248 | 1157.7 |
| 313.15 | 0.2389 | 1120.9 |
| 313.15 | 0.3446 | 1088.8 |
| 313.15 | 0.4921 | 1046.3 |
| 313.15 | 0.5853 | 1019.9 |
| 313.15 | 0.6427 | 1004.4 |
| 313.15 | 0.7532 | 975.5 |
| 313.15 | 0.8226 | 957.8 |
| 313.15 | 0.9349 | 920.0 |
| 313.15 | 1.0000 | 912.0 |
| 323.15 | 0.0000 | 1185.0 |
| 323.15 | 0.1248 | 1146.5 |
| 323.15 | 0.2389 | 1109.6 |
| 323.15 | 0.3446 | 1077.5 |
| 323.15 | 0.4921 | 1035.0 |
| 323.15 | 0.5853 | 999.9 |
| 323.15 | 0.6427 | 993.1 |
| 323.15 | 0.7532 | 964.3 |
| 323.15 | 0.8226 | 946.6 |
| 323.15 | 0.9349 | 910.0 |
| 323.15 | 1.0000 | 901.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanone, 4-hydroxy-4-methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1413.0 |
| 303.15 | 0.1248 | 1395.0 |
| 303.15 | 0.2389 | 1378.0 |
| 303.15 | 0.3446 | 1363.0 |
| 303.15 | 0.4921 | 1341.0 |
| 303.15 | 0.5853 | 1327.0 |
| 303.15 | 0.6427 | 1317.0 |
| 303.15 | 0.7532 | 1298.0 |
| 303.15 | 0.8226 | 1287.0 |
| 303.15 | 0.9349 | 1263.0 |
| 303.15 | 1.0000 | 1256.0 |
| 313.15 | 0.0000 | 1318.0 |
| 313.15 | 0.1248 | 1304.0 |
| 313.15 | 0.2389 | 1290.0 |
| 313.15 | 0.3446 | 1277.0 |
| 313.15 | 0.4921 | 1258.0 |
| 313.15 | 0.5853 | 1244.0 |
| 313.15 | 0.6427 | 1236.0 |
| 313.15 | 0.7532 | 1221.0 |
| 313.15 | 0.8226 | 1211.0 |
| 313.15 | 0.9349 | 1190.0 |
| 313.15 | 1.0000 | 1183.0 |
| 323.15 | 0.0000 | 1221.0 |
| 323.15 | 0.1248 | 1212.0 |
| 323.15 | 0.2389 | 1201.0 |
| 323.15 | 0.3446 | 1192.0 |
| 323.15 | 0.4921 | 1178.0 |
| 323.15 | 0.5853 | 1169.0 |
| 323.15 | 0.6427 | 1163.0 |
| 323.15 | 0.7532 | 1152.0 |
| 323.15 | 0.8226 | 1144.0 |
| 323.15 | 0.9349 | 1128.0 |
| 323.15 | 1.0000 | 1121.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanone, 4-hydroxy-4-methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1413.0 |
| 303.15 | 0.1248 | 1395.0 |
| 303.15 | 0.2389 | 1378.0 |
| 303.15 | 0.3446 | 1363.0 |
| 303.15 | 0.4921 | 1341.0 |
| 303.15 | 0.5853 | 1327.0 |
| 303.15 | 0.6427 | 1317.0 |
| 303.15 | 0.7532 | 1298.0 |
| 303.15 | 0.8226 | 1287.0 |
| 303.15 | 0.9349 | 1263.0 |
| 303.15 | 1.0000 | 1256.0 |
| 313.15 | 0.0000 | 1318.0 |
| 313.15 | 0.1248 | 1304.0 |
| 313.15 | 0.2389 | 1290.0 |
| 313.15 | 0.3446 | 1277.0 |
| 313.15 | 0.4921 | 1258.0 |
| 313.15 | 0.5853 | 1244.0 |
| 313.15 | 0.6427 | 1236.0 |
| 313.15 | 0.7532 | 1221.0 |
| 313.15 | 0.8226 | 1211.0 |
| 313.15 | 0.9349 | 1190.0 |
| 313.15 | 1.0000 | 1183.0 |
| 323.15 | 0.0000 | 1221.0 |
| 323.15 | 0.1248 | 1212.0 |
| 323.15 | 0.2389 | 1201.0 |
| 323.15 | 0.3446 | 1192.0 |
| 323.15 | 0.4921 | 1178.0 |
| 323.15 | 0.5853 | 1169.0 |
| 323.15 | 0.6427 | 1163.0 |
| 323.15 | 0.7532 | 1152.0 |
| 323.15 | 0.8226 | 1144.0 |
| 323.15 | 0.9349 | 1128.0 |
| 323.15 | 1.0000 | 1121.0 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanone, 4-hydroxy-4-methyl- (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 303.15 | 0.0000 | 0.0409 |
| 303.15 | 0.1248 | 0.0398 |
| 303.15 | 0.2389 | 0.0387 |
| 303.15 | 0.3446 | 0.0375 |
| 303.15 | 0.4921 | 0.0359 |
| 303.15 | 0.5853 | 0.0347 |
| 303.15 | 0.6427 | 0.0340 |
| 303.15 | 0.7532 | 0.0327 |
| 303.15 | 0.8226 | 0.0317 |
| 303.15 | 0.9349 | 0.0295 |
| 303.15 | 1.0000 | 0.0294 |
| 313.15 | 0.0000 | 0.0382 |
| 313.15 | 0.1248 | 0.0374 |
| 313.15 | 0.2389 | 0.0366 |
| 313.15 | 0.3446 | 0.0356 |
| 313.15 | 0.4921 | 0.0343 |
| 313.15 | 0.5853 | 0.0334 |
| 313.15 | 0.6427 | 0.0328 |
| 313.15 | 0.7532 | 0.0317 |
| 313.15 | 0.8226 | 0.0310 |
| 313.15 | 0.9349 | 0.0294 |
| 313.15 | 1.0000 | 0.0289 |
| 323.15 | 0.0000 | 0.0365 |
| 323.15 | 0.1248 | 0.0358 |
| 323.15 | 0.2389 | 0.0350 |
| 323.15 | 0.3446 | 0.0343 |
| 323.15 | 0.4921 | 0.0331 |
| 323.15 | 0.5853 | 0.0323 |
| 323.15 | 0.6427 | 0.0318 |
| 323.15 | 0.7532 | 0.0317 |
| 323.15 | 0.8226 | 0.0301 |
| 323.15 | 0.9349 | 0.0288 |
| 323.15 | 1.0000 | 0.0281 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pentanone, 4-hydroxy-4-methyl- (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 303.15 | 0.0000 | 0.0409 |
| 303.15 | 0.1248 | 0.0398 |
| 303.15 | 0.2389 | 0.0387 |
| 303.15 | 0.3446 | 0.0375 |
| 303.15 | 0.4921 | 0.0359 |
| 303.15 | 0.5853 | 0.0347 |
| 303.15 | 0.6427 | 0.0340 |
| 303.15 | 0.7532 | 0.0327 |
| 303.15 | 0.8226 | 0.0317 |
| 303.15 | 0.9349 | 0.0295 |
| 303.15 | 1.0000 | 0.0294 |
| 313.15 | 0.0000 | 0.0382 |
| 313.15 | 0.1248 | 0.0374 |
| 313.15 | 0.2389 | 0.0366 |
| 313.15 | 0.3446 | 0.0356 |
| 313.15 | 0.4921 | 0.0343 |
| 313.15 | 0.5853 | 0.0334 |
| 313.15 | 0.6427 | 0.0328 |
| 313.15 | 0.7532 | 0.0317 |
| 313.15 | 0.8226 | 0.0310 |
| 313.15 | 0.9349 | 0.0294 |
| 313.15 | 1.0000 | 0.0289 |
| 323.15 | 0.0000 | 0.0365 |
| 323.15 | 0.1248 | 0.0358 |
| 323.15 | 0.2389 | 0.0350 |
| 323.15 | 0.3446 | 0.0343 |
| 323.15 | 0.4921 | 0.0331 |
| 323.15 | 0.5853 | 0.0323 |
| 323.15 | 0.6427 | 0.0318 |
| 323.15 | 0.7532 | 0.0317 |
| 323.15 | 0.8226 | 0.0301 |
| 323.15 | 0.9349 | 0.0288 |
| 323.15 | 1.0000 | 0.0281 |