- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Propanoic acid, 2-hydroxy-, ethyl ester
- InChI
- InChI=1S/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3
- InChI Key
- LZCLXQDLBQLTDK-UHFFFAOYSA-N
- Formula
- C5H10O3
- SMILES
- CCOC(=O)C(C)O
- Mol. Weight (g/mol)
- 118.13
- CAS
- 97-64-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mass fraction (2)
- Pc - Critical pressure, kPa (4)
- Pvap - Vapor or sublimation pressure, kPa (2)
- ρl - Mass density, kg/m3 (2)
- Tboil - Boiling temperature at pressure P, K (2)
- Tc - Critical temperature, K (4)
- Vapor or sublimation pressure, kPa (4)
Mass fraction of Carbon dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass fraction of Carbon dioxide (1) - Liquid |
| 311.00 | 1200.00 | 0.0320 |
| 311.00 | 2000.00 | 0.0740 |
| 311.00 | 2800.00 | 0.1030 |
| 311.00 | 3800.00 | 0.1470 |
| 311.00 | 4500.00 | 0.1880 |
| 311.00 | 6200.00 | 0.2880 |
| 311.00 | 6800.00 | 0.3440 |
| 311.00 | 7000.00 | 0.3540 |
| 311.00 | 7800.00 | 0.4190 |
| 318.00 | 1200.00 | 0.0290 |
| 318.00 | 2800.00 | 0.0960 |
| 318.00 | 3800.00 | 0.1300 |
| 318.00 | 6200.00 | 0.2100 |
| 318.00 | 7000.00 | 0.2650 |
| 318.00 | 7800.00 | 0.3180 |
| 318.00 | 8100.00 | 0.3580 |
| 323.00 | 1200.00 | 0.0290 |
| 323.00 | 2000.00 | 0.0650 |
| 323.00 | 2800.00 | 0.0870 |
| 323.00 | 3900.00 | 0.1190 |
| 323.00 | 4900.00 | 0.1400 |
| 323.00 | 6200.00 | 0.1790 |
| 323.00 | 7000.00 | 0.1980 |
| 323.00 | 8100.00 | 0.2990 |
Mass fraction of Carbon dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass fraction of Carbon dioxide (1) - Liquid |
| 311.00 | 1200.00 | 0.0320 |
| 311.00 | 2000.00 | 0.0740 |
| 311.00 | 2800.00 | 0.1030 |
| 311.00 | 3800.00 | 0.1470 |
| 311.00 | 4500.00 | 0.1880 |
| 311.00 | 6200.00 | 0.2880 |
| 311.00 | 6800.00 | 0.3440 |
| 311.00 | 7000.00 | 0.3540 |
| 311.00 | 7800.00 | 0.4190 |
| 318.00 | 1200.00 | 0.0290 |
| 318.00 | 2800.00 | 0.0960 |
| 318.00 | 3800.00 | 0.1300 |
| 318.00 | 6200.00 | 0.2100 |
| 318.00 | 7000.00 | 0.2650 |
| 318.00 | 7800.00 | 0.3180 |
| 318.00 | 8100.00 | 0.3580 |
| 323.00 | 1200.00 | 0.0290 |
| 323.00 | 2000.00 | 0.0650 |
| 323.00 | 2800.00 | 0.0870 |
| 323.00 | 3900.00 | 0.1190 |
| 323.00 | 4900.00 | 0.1400 |
| 323.00 | 6200.00 | 0.1790 |
| 323.00 | 7000.00 | 0.1980 |
| 323.00 | 8100.00 | 0.2990 |
Critical pressure, kPa [ref]
| Mole fraction of Carbon dioxide (1) - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 0.9637 | 10810.00 |
| 0.9520 | 15450.00 |
Critical pressure, kPa [ref]
| Mole fraction of Carbon dioxide (1) - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 0.8800 | 13200.00 |
| 0.8800 | 14440.00 |
| 0.9110 | 10530.00 |
| 0.9110 | 11990.00 |
| 0.9560 | 9510.00 |
Mole fraction of Carbon dioxide (1)
Critical pressure, kPa
10000
11000
12000
13000
14000
0.88
0.9
0.9199999999999999
0.94
Critical pressure, kPa [ref]
| Mole fraction of Carbon dioxide (1) - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 0.9637 | 10810.00 |
| 0.9520 | 15450.00 |
Critical pressure, kPa [ref]
| Mole fraction of Carbon dioxide (1) - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 0.8800 | 13200.00 |
| 0.8800 | 14440.00 |
| 0.9110 | 10530.00 |
| 0.9110 | 11990.00 |
| 0.9560 | 9510.00 |
Mole fraction of Carbon dioxide (1)
Critical pressure, kPa
10000
11000
12000
13000
14000
0.88
0.9
0.9199999999999999
0.94
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 323.20 | 0.4150 | 4540.00 |
| 323.20 | 0.4740 | 5030.00 |
| 323.20 | 0.5210 | 5620.00 |
| 323.20 | 0.5660 | 5950.00 |
| 323.20 | 0.6250 | 6750.00 |
| 323.20 | 0.6640 | 7000.00 |
| 323.20 | 0.7000 | 7450.00 |
| 323.20 | 0.7300 | 7700.00 |
| 323.20 | 0.7840 | 8220.00 |
| 323.20 | 0.8310 | 8470.00 |
| 323.20 | 0.8800 | 8750.00 |
| 323.20 | 0.9110 | 9030.00 |
| 323.20 | 0.9340 | 9200.00 |
| 333.20 | 0.4150 | 5170.00 |
| 333.20 | 0.4740 | 5730.00 |
| 333.20 | 0.5210 | 6410.00 |
| 333.20 | 0.5660 | 6860.00 |
| 333.20 | 0.6250 | 7820.00 |
| 333.20 | 0.6640 | 8120.00 |
| 333.20 | 0.7000 | 8620.00 |
| 333.20 | 0.7300 | 8930.00 |
| 333.20 | 0.7840 | 9550.00 |
| 333.20 | 0.8310 | 9940.00 |
| 333.20 | 0.8800 | 10260.00 |
| 343.20 | 0.4150 | 5740.00 |
| 343.20 | 0.4740 | 6460.00 |
| 343.20 | 0.5210 | 7230.00 |
| 343.20 | 0.5660 | 7760.00 |
| 343.20 | 0.6250 | 8820.00 |
| 343.20 | 0.6640 | 9230.00 |
| 343.20 | 0.7000 | 9840.00 |
| 343.20 | 0.7300 | 10230.00 |
| 343.20 | 0.7840 | 10970.00 |
| 343.20 | 0.8310 | 11400.00 |
| 343.20 | 0.8800 | 11800.00 |
| 353.20 | 0.4150 | 6310.00 |
| 353.20 | 0.4740 | 7120.00 |
| 353.20 | 0.5210 | 8010.00 |
| 353.20 | 0.5660 | 8680.00 |
| 353.20 | 0.6250 | 9800.00 |
| 353.20 | 0.6640 | 10350.00 |
| 353.20 | 0.7000 | 11030.00 |
| 353.20 | 0.7300 | 11540.00 |
| 353.20 | 0.7840 | 12350.00 |
| 353.20 | 0.8310 | 12810.00 |
| 363.20 | 0.4150 | 6910.00 |
| 363.20 | 0.4740 | 7720.00 |
| 363.20 | 0.5210 | 8840.00 |
| 363.20 | 0.5660 | 9550.00 |
| 363.20 | 0.6250 | 10810.00 |
| 363.20 | 0.6640 | 11440.00 |
| 363.20 | 0.7000 | 12230.00 |
| 363.20 | 0.7300 | 12640.00 |
| 363.20 | 0.7840 | 13670.00 |
| 363.20 | 0.8310 | 14140.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 323.20 | 0.4150 | 4540.00 |
| 323.20 | 0.4740 | 5030.00 |
| 323.20 | 0.5210 | 5620.00 |
| 323.20 | 0.5660 | 5950.00 |
| 323.20 | 0.6250 | 6750.00 |
| 323.20 | 0.6640 | 7000.00 |
| 323.20 | 0.7000 | 7450.00 |
| 323.20 | 0.7300 | 7700.00 |
| 323.20 | 0.7840 | 8220.00 |
| 323.20 | 0.8310 | 8470.00 |
| 323.20 | 0.8800 | 8750.00 |
| 323.20 | 0.9110 | 9030.00 |
| 323.20 | 0.9340 | 9200.00 |
| 333.20 | 0.4150 | 5170.00 |
| 333.20 | 0.4740 | 5730.00 |
| 333.20 | 0.5210 | 6410.00 |
| 333.20 | 0.5660 | 6860.00 |
| 333.20 | 0.6250 | 7820.00 |
| 333.20 | 0.6640 | 8120.00 |
| 333.20 | 0.7000 | 8620.00 |
| 333.20 | 0.7300 | 8930.00 |
| 333.20 | 0.7840 | 9550.00 |
| 333.20 | 0.8310 | 9940.00 |
| 333.20 | 0.8800 | 10260.00 |
| 343.20 | 0.4150 | 5740.00 |
| 343.20 | 0.4740 | 6460.00 |
| 343.20 | 0.5210 | 7230.00 |
| 343.20 | 0.5660 | 7760.00 |
| 343.20 | 0.6250 | 8820.00 |
| 343.20 | 0.6640 | 9230.00 |
| 343.20 | 0.7000 | 9840.00 |
| 343.20 | 0.7300 | 10230.00 |
| 343.20 | 0.7840 | 10970.00 |
| 343.20 | 0.8310 | 11400.00 |
| 343.20 | 0.8800 | 11800.00 |
| 353.20 | 0.4150 | 6310.00 |
| 353.20 | 0.4740 | 7120.00 |
| 353.20 | 0.5210 | 8010.00 |
| 353.20 | 0.5660 | 8680.00 |
| 353.20 | 0.6250 | 9800.00 |
| 353.20 | 0.6640 | 10350.00 |
| 353.20 | 0.7000 | 11030.00 |
| 353.20 | 0.7300 | 11540.00 |
| 353.20 | 0.7840 | 12350.00 |
| 353.20 | 0.8310 | 12810.00 |
| 363.20 | 0.4150 | 6910.00 |
| 363.20 | 0.4740 | 7720.00 |
| 363.20 | 0.5210 | 8840.00 |
| 363.20 | 0.5660 | 9550.00 |
| 363.20 | 0.6250 | 10810.00 |
| 363.20 | 0.6640 | 11440.00 |
| 363.20 | 0.7000 | 12230.00 |
| 363.20 | 0.7300 | 12640.00 |
| 363.20 | 0.7840 | 13670.00 |
| 363.20 | 0.8310 | 14140.00 |
Mass density, kg/m3 [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 308.00 | 0.1000 | 8000.00 | 1023.4 |
| 308.00 | 0.1000 | 10000.00 | 1024.6 |
| 308.00 | 0.1000 | 12000.00 | 1025.5 |
| 308.00 | 0.1000 | 14000.00 | 1026.6 |
| 308.00 | 0.1000 | 16000.00 | 1027.9 |
| 308.00 | 0.1000 | 18000.00 | 1029.1 |
| 308.00 | 0.1000 | 20000.00 | 1030.5 |
| 308.00 | 0.1000 | 22000.00 | 1032.0 |
| 308.00 | 0.1000 | 24000.00 | 1033.7 |
| 308.00 | 0.1000 | 26000.00 | 1035.4 |
| 308.00 | 0.1000 | 28000.00 | 1037.2 |
| 308.00 | 0.1000 | 30000.00 | 1039.2 |
| 308.00 | 0.2000 | 8000.00 | 1021.8 |
| 308.00 | 0.2000 | 10000.00 | 1023.3 |
| 308.00 | 0.2000 | 12000.00 | 1024.3 |
| 308.00 | 0.2000 | 14000.00 | 1025.6 |
| 308.00 | 0.2000 | 16000.00 | 1026.8 |
| 308.00 | 0.2000 | 18000.00 | 1028.2 |
| 308.00 | 0.2000 | 20000.00 | 1029.8 |
| 308.00 | 0.2000 | 22000.00 | 1031.4 |
| 308.00 | 0.2000 | 24000.00 | 1033.1 |
| 308.00 | 0.2000 | 26000.00 | 1035.0 |
| 308.00 | 0.2000 | 28000.00 | 1036.7 |
| 308.00 | 0.2000 | 30000.00 | 1039.1 |
| 308.00 | 0.3000 | 8000.00 | 1019.8 |
| 308.00 | 0.3000 | 10000.00 | 1021.4 |
| 308.00 | 0.3000 | 12000.00 | 1022.7 |
| 308.00 | 0.3000 | 14000.00 | 1024.1 |
| 308.00 | 0.3000 | 16000.00 | 1025.6 |
| 308.00 | 0.3000 | 18000.00 | 1026.9 |
| 308.00 | 0.3000 | 20000.00 | 1028.7 |
| 308.00 | 0.3000 | 22000.00 | 1030.6 |
| 308.00 | 0.3000 | 24000.00 | 1032.4 |
| 308.00 | 0.3000 | 26000.00 | 1034.4 |
| 308.00 | 0.3000 | 28000.00 | 1036.5 |
| 308.00 | 0.3000 | 30000.00 | 1038.7 |
| 308.00 | 0.4000 | 8000.00 | 1015.3 |
| 308.00 | 0.4000 | 10000.00 | 1017.0 |
| 308.00 | 0.4000 | 12000.00 | 1018.5 |
| 308.00 | 0.4000 | 14000.00 | 1020.3 |
| 308.00 | 0.4000 | 16000.00 | 1022.0 |
| 308.00 | 0.4000 | 18000.00 | 1023.7 |
| 308.00 | 0.4000 | 20000.00 | 1025.8 |
| 308.00 | 0.4000 | 22000.00 | 1027.9 |
| 308.00 | 0.4000 | 24000.00 | 1030.0 |
| 308.00 | 0.4000 | 26000.00 | 1032.2 |
| 308.00 | 0.4000 | 28000.00 | 1034.3 |
| 308.00 | 0.4000 | 30000.00 | 1037.0 |
| 308.00 | 0.5000 | 8000.00 | 1010.0 |
| 308.00 | 0.5000 | 10000.00 | 1011.8 |
| 308.00 | 0.5000 | 12000.00 | 1013.8 |
| 308.00 | 0.5000 | 14000.00 | 1015.9 |
| 308.00 | 0.5000 | 16000.00 | 1018.0 |
| 308.00 | 0.5000 | 18000.00 | 1020.2 |
| 308.00 | 0.5000 | 20000.00 | 1022.5 |
| 308.00 | 0.5000 | 22000.00 | 1024.7 |
| 308.00 | 0.5000 | 24000.00 | 1027.3 |
| 308.00 | 0.5000 | 26000.00 | 1029.8 |
| 308.00 | 0.5000 | 28000.00 | 1032.3 |
| 308.00 | 0.5000 | 30000.00 | 1034.9 |
| 323.00 | 0.1000 | 10000.00 | 1007.2 |
| 323.00 | 0.1000 | 12000.00 | 1009.0 |
| 323.00 | 0.1000 | 14000.00 | 1010.7 |
| 323.00 | 0.1000 | 16000.00 | 1012.3 |
| 323.00 | 0.1000 | 18000.00 | 1013.9 |
| 323.00 | 0.1000 | 20000.00 | 1015.4 |
| 323.00 | 0.1000 | 22000.00 | 1016.9 |
| 323.00 | 0.1000 | 24000.00 | 1018.3 |
| 323.00 | 0.1000 | 26000.00 | 1019.8 |
| 323.00 | 0.1000 | 28000.00 | 1021.1 |
| 323.00 | 0.1000 | 30000.00 | 1022.4 |
| 323.00 | 0.3000 | 10000.00 | 1002.3 |
| 323.00 | 0.3000 | 12000.00 | 1004.5 |
| 323.00 | 0.3000 | 14000.00 | 1006.6 |
| 323.00 | 0.3000 | 16000.00 | 1008.6 |
| 323.00 | 0.3000 | 18000.00 | 1010.6 |
| 323.00 | 0.3000 | 20000.00 | 1012.4 |
| 323.00 | 0.3000 | 22000.00 | 1014.2 |
| 323.00 | 0.3000 | 24000.00 | 1016.0 |
| 323.00 | 0.3000 | 26000.00 | 1017.7 |
| 323.00 | 0.3000 | 28000.00 | 1019.4 |
| 323.00 | 0.3000 | 30000.00 | 1020.9 |
| 323.00 | 0.5000 | 10000.00 | 990.5 |
| 323.00 | 0.5000 | 12000.00 | 993.0 |
| 323.00 | 0.5000 | 14000.00 | 995.9 |
| 323.00 | 0.5000 | 16000.00 | 998.6 |
| 323.00 | 0.5000 | 18000.00 | 1001.2 |
| 323.00 | 0.5000 | 20000.00 | 1003.7 |
| 323.00 | 0.5000 | 22000.00 | 1006.1 |
| 323.00 | 0.5000 | 24000.00 | 1008.4 |
| 323.00 | 0.5000 | 26000.00 | 1010.7 |
| 323.00 | 0.5000 | 28000.00 | 1012.9 |
| 323.00 | 0.5000 | 30000.00 | 1015.0 |
Mass density, kg/m3 [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 308.00 | 0.1000 | 8000.00 | 1023.4 |
| 308.00 | 0.1000 | 10000.00 | 1024.6 |
| 308.00 | 0.1000 | 12000.00 | 1025.5 |
| 308.00 | 0.1000 | 14000.00 | 1026.6 |
| 308.00 | 0.1000 | 16000.00 | 1027.9 |
| 308.00 | 0.1000 | 18000.00 | 1029.1 |
| 308.00 | 0.1000 | 20000.00 | 1030.5 |
| 308.00 | 0.1000 | 22000.00 | 1032.0 |
| 308.00 | 0.1000 | 24000.00 | 1033.7 |
| 308.00 | 0.1000 | 26000.00 | 1035.4 |
| 308.00 | 0.1000 | 28000.00 | 1037.2 |
| 308.00 | 0.1000 | 30000.00 | 1039.2 |
| 308.00 | 0.2000 | 8000.00 | 1021.8 |
| 308.00 | 0.2000 | 10000.00 | 1023.3 |
| 308.00 | 0.2000 | 12000.00 | 1024.3 |
| 308.00 | 0.2000 | 14000.00 | 1025.6 |
| 308.00 | 0.2000 | 16000.00 | 1026.8 |
| 308.00 | 0.2000 | 18000.00 | 1028.2 |
| 308.00 | 0.2000 | 20000.00 | 1029.8 |
| 308.00 | 0.2000 | 22000.00 | 1031.4 |
| 308.00 | 0.2000 | 24000.00 | 1033.1 |
| 308.00 | 0.2000 | 26000.00 | 1035.0 |
| 308.00 | 0.2000 | 28000.00 | 1036.7 |
| 308.00 | 0.2000 | 30000.00 | 1039.1 |
| 308.00 | 0.3000 | 8000.00 | 1019.8 |
| 308.00 | 0.3000 | 10000.00 | 1021.4 |
| 308.00 | 0.3000 | 12000.00 | 1022.7 |
| 308.00 | 0.3000 | 14000.00 | 1024.1 |
| 308.00 | 0.3000 | 16000.00 | 1025.6 |
| 308.00 | 0.3000 | 18000.00 | 1026.9 |
| 308.00 | 0.3000 | 20000.00 | 1028.7 |
| 308.00 | 0.3000 | 22000.00 | 1030.6 |
| 308.00 | 0.3000 | 24000.00 | 1032.4 |
| 308.00 | 0.3000 | 26000.00 | 1034.4 |
| 308.00 | 0.3000 | 28000.00 | 1036.5 |
| 308.00 | 0.3000 | 30000.00 | 1038.7 |
| 308.00 | 0.4000 | 8000.00 | 1015.3 |
| 308.00 | 0.4000 | 10000.00 | 1017.0 |
| 308.00 | 0.4000 | 12000.00 | 1018.5 |
| 308.00 | 0.4000 | 14000.00 | 1020.3 |
| 308.00 | 0.4000 | 16000.00 | 1022.0 |
| 308.00 | 0.4000 | 18000.00 | 1023.7 |
| 308.00 | 0.4000 | 20000.00 | 1025.8 |
| 308.00 | 0.4000 | 22000.00 | 1027.9 |
| 308.00 | 0.4000 | 24000.00 | 1030.0 |
| 308.00 | 0.4000 | 26000.00 | 1032.2 |
| 308.00 | 0.4000 | 28000.00 | 1034.3 |
| 308.00 | 0.4000 | 30000.00 | 1037.0 |
| 308.00 | 0.5000 | 8000.00 | 1010.0 |
| 308.00 | 0.5000 | 10000.00 | 1011.8 |
| 308.00 | 0.5000 | 12000.00 | 1013.8 |
| 308.00 | 0.5000 | 14000.00 | 1015.9 |
| 308.00 | 0.5000 | 16000.00 | 1018.0 |
| 308.00 | 0.5000 | 18000.00 | 1020.2 |
| 308.00 | 0.5000 | 20000.00 | 1022.5 |
| 308.00 | 0.5000 | 22000.00 | 1024.7 |
| 308.00 | 0.5000 | 24000.00 | 1027.3 |
| 308.00 | 0.5000 | 26000.00 | 1029.8 |
| 308.00 | 0.5000 | 28000.00 | 1032.3 |
| 308.00 | 0.5000 | 30000.00 | 1034.9 |
| 323.00 | 0.1000 | 10000.00 | 1007.2 |
| 323.00 | 0.1000 | 12000.00 | 1009.0 |
| 323.00 | 0.1000 | 14000.00 | 1010.7 |
| 323.00 | 0.1000 | 16000.00 | 1012.3 |
| 323.00 | 0.1000 | 18000.00 | 1013.9 |
| 323.00 | 0.1000 | 20000.00 | 1015.4 |
| 323.00 | 0.1000 | 22000.00 | 1016.9 |
| 323.00 | 0.1000 | 24000.00 | 1018.3 |
| 323.00 | 0.1000 | 26000.00 | 1019.8 |
| 323.00 | 0.1000 | 28000.00 | 1021.1 |
| 323.00 | 0.1000 | 30000.00 | 1022.4 |
| 323.00 | 0.3000 | 10000.00 | 1002.3 |
| 323.00 | 0.3000 | 12000.00 | 1004.5 |
| 323.00 | 0.3000 | 14000.00 | 1006.6 |
| 323.00 | 0.3000 | 16000.00 | 1008.6 |
| 323.00 | 0.3000 | 18000.00 | 1010.6 |
| 323.00 | 0.3000 | 20000.00 | 1012.4 |
| 323.00 | 0.3000 | 22000.00 | 1014.2 |
| 323.00 | 0.3000 | 24000.00 | 1016.0 |
| 323.00 | 0.3000 | 26000.00 | 1017.7 |
| 323.00 | 0.3000 | 28000.00 | 1019.4 |
| 323.00 | 0.3000 | 30000.00 | 1020.9 |
| 323.00 | 0.5000 | 10000.00 | 990.5 |
| 323.00 | 0.5000 | 12000.00 | 993.0 |
| 323.00 | 0.5000 | 14000.00 | 995.9 |
| 323.00 | 0.5000 | 16000.00 | 998.6 |
| 323.00 | 0.5000 | 18000.00 | 1001.2 |
| 323.00 | 0.5000 | 20000.00 | 1003.7 |
| 323.00 | 0.5000 | 22000.00 | 1006.1 |
| 323.00 | 0.5000 | 24000.00 | 1008.4 |
| 323.00 | 0.5000 | 26000.00 | 1010.7 |
| 323.00 | 0.5000 | 28000.00 | 1012.9 |
| 323.00 | 0.5000 | 30000.00 | 1015.0 |
Boiling temperature at pressure P, K [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
| 3610.00 | 0.4098 | 313.20 |
| 4180.00 | 0.4595 | 313.20 |
| 4980.00 | 0.5331 | 313.20 |
| 6380.00 | 0.7049 | 313.20 |
| 6810.00 | 0.7942 | 313.20 |
| 7800.00 | 0.9520 | 313.20 |
| 7860.00 | 0.9637 | 313.20 |
| 8040.00 | 0.9744 | 313.20 |
| 8100.00 | 0.9861 | 313.20 |
| 4550.00 | 0.4098 | 333.20 |
| 6350.00 | 0.5331 | 333.20 |
| 6830.00 | 0.5659 | 333.20 |
| 7420.00 | 0.6153 | 333.20 |
| 8340.00 | 0.6881 | 333.20 |
| 9610.00 | 0.7942 | 333.20 |
| 10930.00 | 0.9520 | 333.20 |
| 6100.00 | 0.4098 | 353.20 |
| 6830.00 | 0.4595 | 353.20 |
| 8210.00 | 0.5331 | 353.20 |
| 9530.00 | 0.6153 | 353.20 |
| 10670.00 | 0.6885 | 353.20 |
| 12480.00 | 0.7942 | 353.20 |
| 13590.00 | 0.9520 | 353.20 |
| 13390.00 | 0.9637 | 353.20 |
| 7380.00 | 0.4098 | 373.20 |
| 8260.00 | 0.4595 | 373.20 |
| 9910.00 | 0.5331 | 373.20 |
| 11620.00 | 0.6153 | 373.20 |
| 13880.00 | 0.7049 | 373.20 |
| 14550.00 | 0.7942 | 373.20 |
| 7910.00 | 0.4098 | 393.20 |
| 9720.00 | 0.4595 | 393.20 |
| 11100.00 | 0.5331 | 393.20 |
| 13500.00 | 0.6153 | 393.20 |
| 13620.00 | 0.6277 | 393.20 |
| 15950.00 | 0.7049 | 393.20 |
| 16860.00 | 0.7942 | 393.20 |
Boiling temperature at pressure P, K [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Mole fraction of Carbon dioxide (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
| 3610.00 | 0.4098 | 313.20 |
| 4180.00 | 0.4595 | 313.20 |
| 4980.00 | 0.5331 | 313.20 |
| 6380.00 | 0.7049 | 313.20 |
| 6810.00 | 0.7942 | 313.20 |
| 7800.00 | 0.9520 | 313.20 |
| 7860.00 | 0.9637 | 313.20 |
| 8040.00 | 0.9744 | 313.20 |
| 8100.00 | 0.9861 | 313.20 |
| 4550.00 | 0.4098 | 333.20 |
| 6350.00 | 0.5331 | 333.20 |
| 6830.00 | 0.5659 | 333.20 |
| 7420.00 | 0.6153 | 333.20 |
| 8340.00 | 0.6881 | 333.20 |
| 9610.00 | 0.7942 | 333.20 |
| 10930.00 | 0.9520 | 333.20 |
| 6100.00 | 0.4098 | 353.20 |
| 6830.00 | 0.4595 | 353.20 |
| 8210.00 | 0.5331 | 353.20 |
| 9530.00 | 0.6153 | 353.20 |
| 10670.00 | 0.6885 | 353.20 |
| 12480.00 | 0.7942 | 353.20 |
| 13590.00 | 0.9520 | 353.20 |
| 13390.00 | 0.9637 | 353.20 |
| 7380.00 | 0.4098 | 373.20 |
| 8260.00 | 0.4595 | 373.20 |
| 9910.00 | 0.5331 | 373.20 |
| 11620.00 | 0.6153 | 373.20 |
| 13880.00 | 0.7049 | 373.20 |
| 14550.00 | 0.7942 | 373.20 |
| 7910.00 | 0.4098 | 393.20 |
| 9720.00 | 0.4595 | 393.20 |
| 11100.00 | 0.5331 | 393.20 |
| 13500.00 | 0.6153 | 393.20 |
| 13620.00 | 0.6277 | 393.20 |
| 15950.00 | 0.7049 | 393.20 |
| 16860.00 | 0.7942 | 393.20 |
Critical temperature, K [ref]
| Mole fraction of Carbon dioxide (1) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.9637 | 333.20 |
| 0.9520 | 373.20 |
Critical temperature, K [ref]
| Mole fraction of Carbon dioxide (1) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.8800 | 353.20 |
| 0.8800 | 363.20 |
| 0.9110 | 333.20 |
| 0.9110 | 343.20 |
| 0.9560 | 323.20 |
Mole fraction of Carbon dioxide (1)
Critical temperature, K
320
330
340
350
360
0.88
0.9
0.9199999999999999
0.94
Critical temperature, K [ref]
| Mole fraction of Carbon dioxide (1) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.9637 | 333.20 |
| 0.9520 | 373.20 |
Critical temperature, K [ref]
| Mole fraction of Carbon dioxide (1) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.8800 | 353.20 |
| 0.8800 | 363.20 |
| 0.9110 | 333.20 |
| 0.9110 | 343.20 |
| 0.9560 | 323.20 |
Mole fraction of Carbon dioxide (1)
Critical temperature, K
320
330
340
350
360
0.88
0.9
0.9199999999999999
0.94
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Mole fraction of Carbon dioxide (1) - Gas | Vapor or sublimation pressure, kPa - Gas |
| 313.20 | 0.9937 | 8170.00 |
| 313.20 | 0.9949 | 8040.00 |
| 313.20 | 0.9955 | 7970.00 |
| 313.20 | 0.9965 | 7790.00 |
| 333.20 | 0.9744 | 10900.00 |
| 333.20 | 0.9861 | 10680.00 |
| 333.20 | 0.9901 | 10460.00 |
| 333.20 | 0.9934 | 8920.00 |
| 333.20 | 0.9951 | 7380.00 |
| 353.20 | 0.9637 | 13390.00 |
| 353.20 | 0.9744 | 12150.00 |
| 353.20 | 0.9861 | 12060.00 |
| 353.20 | 0.9901 | 10830.00 |
| 373.20 | 0.9637 | 14550.00 |
| 373.20 | 0.9744 | 12000.00 |
| 373.20 | 0.9861 | 12340.00 |
| 373.20 | 0.9901 | 11590.00 |
| 393.20 | 0.9520 | 15860.00 |
| 393.20 | 0.9861 | 12620.00 |
| 393.20 | 0.9744 | 12520.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Mole fraction of Carbon dioxide (1) - Gas | Vapor or sublimation pressure, kPa - Gas |
| 333.20 | 0.9340 | 10620.00 |
| 333.20 | 0.9560 | 10860.00 |
| 343.20 | 0.9340 | 12020.00 |
| 343.20 | 0.9560 | 12170.00 |
| 353.20 | 0.9110 | 13290.00 |
| 353.20 | 0.9340 | 13300.00 |
| 353.20 | 0.9560 | 13270.00 |
| 363.20 | 0.9110 | 14450.00 |
| 363.20 | 0.9340 | 14430.00 |
| 363.20 | 0.9560 | 14200.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Mole fraction of Carbon dioxide (1) - Gas | Vapor or sublimation pressure, kPa - Gas |
| 313.20 | 0.9937 | 8170.00 |
| 313.20 | 0.9949 | 8040.00 |
| 313.20 | 0.9955 | 7970.00 |
| 313.20 | 0.9965 | 7790.00 |
| 333.20 | 0.9744 | 10900.00 |
| 333.20 | 0.9861 | 10680.00 |
| 333.20 | 0.9901 | 10460.00 |
| 333.20 | 0.9934 | 8920.00 |
| 333.20 | 0.9951 | 7380.00 |
| 353.20 | 0.9637 | 13390.00 |
| 353.20 | 0.9744 | 12150.00 |
| 353.20 | 0.9861 | 12060.00 |
| 353.20 | 0.9901 | 10830.00 |
| 373.20 | 0.9637 | 14550.00 |
| 373.20 | 0.9744 | 12000.00 |
| 373.20 | 0.9861 | 12340.00 |
| 373.20 | 0.9901 | 11590.00 |
| 393.20 | 0.9520 | 15860.00 |
| 393.20 | 0.9861 | 12620.00 |
| 393.20 | 0.9744 | 12520.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Mole fraction of Carbon dioxide (1) - Gas | Vapor or sublimation pressure, kPa - Gas |
| 333.20 | 0.9340 | 10620.00 |
| 333.20 | 0.9560 | 10860.00 |
| 343.20 | 0.9340 | 12020.00 |
| 343.20 | 0.9560 | 12170.00 |
| 353.20 | 0.9110 | 13290.00 |
| 353.20 | 0.9340 | 13300.00 |
| 353.20 | 0.9560 | 13270.00 |
| 363.20 | 0.9110 | 14450.00 |
| 363.20 | 0.9340 | 14430.00 |
| 363.20 | 0.9560 | 14200.00 |
Sources
- High pressure phase behavior of the binary system (ethyl lactate + carbon dioxide)
- Density Measurements of CO2-Expanded Liquids
- High-Pressure Phase Behavior of Methyl Lactate and Ethyl Lactate in Supercritical Carbon Dioxide
- Solubility of CO2 in Ethyl Lactate and Modeling of the Phase Behavior of the CO2 + Ethyl Lactate Mixture