- Name
- Methyl Isobutyl Ketone
- InChI
- InChI=1S/C6H12O/c1-5(2)4-6(3)7/h5H,4H2,1-3H3
- InChI Key
- NTIZESTWPVYFNL-UHFFFAOYSA-N
- Formula
- C6H12O
- SMILES
- CC(=O)CC(C)C
- Mol. Weight (g/mol)
- 100.16
- CAS
- 108-10-1
- Name
- Dimethyl Sulfoxide
- InChI
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- InChI Key
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N
- Formula
- C2H6OS
- SMILES
- CS(C)=O
- Mol. Weight (g/mol)
- 78.13
- CAS
- 67-68-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (4)
- Tboil - Boiling temperature at pressure P, K (2)
- Excess molar volume, m3/mol (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Methyl Isobutyl Ketone (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0387 | 0.1315 |
| 0.0839 | 0.2659 |
| 0.1332 | 0.3920 |
| 0.1874 | 0.4730 |
| 0.2391 | 0.5483 |
| 0.2901 | 0.5995 |
| 0.3377 | 0.6605 |
| 0.3804 | 0.6978 |
| 0.4029 | 0.7216 |
| 0.4617 | 0.7118 |
| 0.5304 | 0.6854 |
| 0.6116 | 0.6036 |
| 0.6917 | 0.4772 |
| 0.7918 | 0.2874 |
| 0.8370 | 0.2255 |
| 0.9237 | 0.1069 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Methyl Isobutyl Ketone (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0387 | 0.1315 |
| 0.0839 | 0.2659 |
| 0.1332 | 0.3920 |
| 0.1874 | 0.4730 |
| 0.2391 | 0.5483 |
| 0.2901 | 0.5995 |
| 0.3377 | 0.6605 |
| 0.3804 | 0.6978 |
| 0.4029 | 0.7216 |
| 0.4617 | 0.7118 |
| 0.5304 | 0.6854 |
| 0.6116 | 0.6036 |
| 0.6917 | 0.4772 |
| 0.7918 | 0.2874 |
| 0.8370 | 0.2255 |
| 0.9237 | 0.1069 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Isobutyl Ketone (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.48 |
| 293.15 | 0.1002 | 1.466 |
| 293.15 | 0.2004 | 1.455 |
| 293.15 | 0.3004 | 1.445 |
| 293.15 | 0.4007 | 1.436 |
| 293.15 | 0.4982 | 1.428 |
| 293.15 | 0.5999 | 1.42 |
| 293.15 | 0.6992 | 1.413 |
| 293.15 | 0.7995 | 1.407 |
| 293.15 | 0.8981 | 1.401 |
| 293.15 | 1.0000 | 1.396 |
| 303.15 | 0.0000 | 1.475 |
| 303.15 | 0.1002 | 1.462 |
| 303.15 | 0.2004 | 1.451 |
| 303.15 | 0.3004 | 1.441 |
| 303.15 | 0.4007 | 1.432 |
| 303.15 | 0.4982 | 1.423 |
| 303.15 | 0.5999 | 1.416 |
| 303.15 | 0.6992 | 1.409 |
| 303.15 | 0.7995 | 1.402 |
| 303.15 | 0.8981 | 1.397 |
| 303.15 | 1.0000 | 1.391 |
| 313.15 | 0.0000 | 1.47 |
| 313.15 | 0.1002 | 1.458 |
| 313.15 | 0.2004 | 1.446 |
| 313.15 | 0.3004 | 1.436 |
| 313.15 | 0.4007 | 1.427 |
| 313.15 | 0.4982 | 1.419 |
| 313.15 | 0.5999 | 1.411 |
| 313.15 | 0.6992 | 1.404 |
| 313.15 | 0.7995 | 1.398 |
| 313.15 | 0.8981 | 1.392 |
| 313.15 | 1.0000 | 1.387 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Isobutyl Ketone (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.48 |
| 293.15 | 0.1002 | 1.466 |
| 293.15 | 0.2004 | 1.455 |
| 293.15 | 0.3004 | 1.445 |
| 293.15 | 0.4007 | 1.436 |
| 293.15 | 0.4982 | 1.428 |
| 293.15 | 0.5999 | 1.42 |
| 293.15 | 0.6992 | 1.413 |
| 293.15 | 0.7995 | 1.407 |
| 293.15 | 0.8981 | 1.401 |
| 293.15 | 1.0000 | 1.396 |
| 303.15 | 0.0000 | 1.475 |
| 303.15 | 0.1002 | 1.462 |
| 303.15 | 0.2004 | 1.451 |
| 303.15 | 0.3004 | 1.441 |
| 303.15 | 0.4007 | 1.432 |
| 303.15 | 0.4982 | 1.423 |
| 303.15 | 0.5999 | 1.416 |
| 303.15 | 0.6992 | 1.409 |
| 303.15 | 0.7995 | 1.402 |
| 303.15 | 0.8981 | 1.397 |
| 303.15 | 1.0000 | 1.391 |
| 313.15 | 0.0000 | 1.47 |
| 313.15 | 0.1002 | 1.458 |
| 313.15 | 0.2004 | 1.446 |
| 313.15 | 0.3004 | 1.436 |
| 313.15 | 0.4007 | 1.427 |
| 313.15 | 0.4982 | 1.419 |
| 313.15 | 0.5999 | 1.411 |
| 313.15 | 0.6992 | 1.404 |
| 313.15 | 0.7995 | 1.398 |
| 313.15 | 0.8981 | 1.392 |
| 313.15 | 1.0000 | 1.387 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Isobutyl Ketone (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 1100.0 |
| 293.15 | 0.1002 | 1052.0 |
| 293.15 | 0.2004 | 1010.0 |
| 293.15 | 0.3004 | 973.0 |
| 293.15 | 0.4007 | 940.0 |
| 293.15 | 0.4982 | 912.0 |
| 293.15 | 0.5999 | 885.0 |
| 293.15 | 0.6992 | 861.0 |
| 293.15 | 0.7995 | 839.0 |
| 293.15 | 0.8981 | 819.0 |
| 293.15 | 1.0000 | 801.0 |
| 303.15 | 0.0000 | 1090.0 |
| 303.15 | 0.1002 | 1043.0 |
| 303.15 | 0.2004 | 1001.0 |
| 303.15 | 0.3004 | 964.0 |
| 303.15 | 0.4007 | 931.0 |
| 303.15 | 0.4982 | 902.0 |
| 303.15 | 0.5999 | 875.0 |
| 303.15 | 0.6992 | 851.0 |
| 303.15 | 0.7995 | 830.0 |
| 303.15 | 0.8981 | 810.0 |
| 303.15 | 1.0000 | 792.0 |
| 313.15 | 0.0000 | 1080.0 |
| 313.15 | 0.1002 | 1033.0 |
| 313.15 | 0.2004 | 991.0 |
| 313.15 | 0.3004 | 954.0 |
| 313.15 | 0.4007 | 921.0 |
| 313.15 | 0.4982 | 893.0 |
| 313.15 | 0.5999 | 866.0 |
| 313.15 | 0.6992 | 842.0 |
| 313.15 | 0.7995 | 820.0 |
| 313.15 | 0.8981 | 801.0 |
| 313.15 | 1.0000 | 782.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Isobutyl Ketone (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 1100.0 |
| 293.15 | 0.1002 | 1052.0 |
| 293.15 | 0.2004 | 1010.0 |
| 293.15 | 0.3004 | 973.0 |
| 293.15 | 0.4007 | 940.0 |
| 293.15 | 0.4982 | 912.0 |
| 293.15 | 0.5999 | 885.0 |
| 293.15 | 0.6992 | 861.0 |
| 293.15 | 0.7995 | 839.0 |
| 293.15 | 0.8981 | 819.0 |
| 293.15 | 1.0000 | 801.0 |
| 303.15 | 0.0000 | 1090.0 |
| 303.15 | 0.1002 | 1043.0 |
| 303.15 | 0.2004 | 1001.0 |
| 303.15 | 0.3004 | 964.0 |
| 303.15 | 0.4007 | 931.0 |
| 303.15 | 0.4982 | 902.0 |
| 303.15 | 0.5999 | 875.0 |
| 303.15 | 0.6992 | 851.0 |
| 303.15 | 0.7995 | 830.0 |
| 303.15 | 0.8981 | 810.0 |
| 303.15 | 1.0000 | 792.0 |
| 313.15 | 0.0000 | 1080.0 |
| 313.15 | 0.1002 | 1033.0 |
| 313.15 | 0.2004 | 991.0 |
| 313.15 | 0.3004 | 954.0 |
| 313.15 | 0.4007 | 921.0 |
| 313.15 | 0.4982 | 893.0 |
| 313.15 | 0.5999 | 866.0 |
| 313.15 | 0.6992 | 842.0 |
| 313.15 | 0.7995 | 820.0 |
| 313.15 | 0.8981 | 801.0 |
| 313.15 | 1.0000 | 782.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Volume fraction of Dimethyl Sulfoxide (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1172.0 |
| 0.0905 | 1199.0 |
| 0.1474 | 1221.0 |
| 0.2091 | 1244.0 |
| 0.3028 | 1276.0 |
| 0.4199 | 1322.0 |
| 0.4910 | 1343.0 |
| 0.5785 | 1369.0 |
| 0.8100 | 1418.0 |
| 0.8870 | 1438.0 |
| 1.0000 | 1475.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Isobutyl Ketone (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1504.7 |
| 293.15 | 0.1002 | 1453.8 |
| 293.15 | 0.2004 | 1409.2 |
| 293.15 | 0.3004 | 1371.9 |
| 293.15 | 0.4007 | 1338.7 |
| 293.15 | 0.4982 | 1311.8 |
| 293.15 | 0.5999 | 1287.1 |
| 293.15 | 0.6992 | 1266.1 |
| 293.15 | 0.7995 | 1246.5 |
| 293.15 | 0.8981 | 1229.3 |
| 293.15 | 1.0000 | 1212.3 |
| 303.15 | 0.0000 | 1471.0 |
| 303.15 | 0.1002 | 1418.9 |
| 303.15 | 0.2004 | 1373.8 |
| 303.15 | 0.3004 | 1336.0 |
| 303.15 | 0.4007 | 1302.9 |
| 303.15 | 0.4982 | 1275.3 |
| 303.15 | 0.5999 | 1249.8 |
| 303.15 | 0.6992 | 1227.9 |
| 303.15 | 0.7995 | 1207.5 |
| 303.15 | 0.8981 | 1189.2 |
| 303.15 | 1.0000 | 1171.4 |
| 313.15 | 0.0000 | 1437.4 |
| 313.15 | 0.1002 | 1384.7 |
| 313.15 | 0.2004 | 1339.2 |
| 313.15 | 0.3004 | 1300.8 |
| 313.15 | 0.4007 | 1267.1 |
| 313.15 | 0.4982 | 1238.9 |
| 313.15 | 0.5999 | 1212.7 |
| 313.15 | 0.6992 | 1190.0 |
| 313.15 | 0.7995 | 1168.9 |
| 313.15 | 0.8981 | 1149.9 |
| 313.15 | 1.0000 | 1131.4 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Volume fraction of Dimethyl Sulfoxide (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1172.0 |
| 0.0905 | 1199.0 |
| 0.1474 | 1221.0 |
| 0.2091 | 1244.0 |
| 0.3028 | 1276.0 |
| 0.4199 | 1322.0 |
| 0.4910 | 1343.0 |
| 0.5785 | 1369.0 |
| 0.8100 | 1418.0 |
| 0.8870 | 1438.0 |
| 1.0000 | 1475.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyl Isobutyl Ketone (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1504.7 |
| 293.15 | 0.1002 | 1453.8 |
| 293.15 | 0.2004 | 1409.2 |
| 293.15 | 0.3004 | 1371.9 |
| 293.15 | 0.4007 | 1338.7 |
| 293.15 | 0.4982 | 1311.8 |
| 293.15 | 0.5999 | 1287.1 |
| 293.15 | 0.6992 | 1266.1 |
| 293.15 | 0.7995 | 1246.5 |
| 293.15 | 0.8981 | 1229.3 |
| 293.15 | 1.0000 | 1212.3 |
| 303.15 | 0.0000 | 1471.0 |
| 303.15 | 0.1002 | 1418.9 |
| 303.15 | 0.2004 | 1373.8 |
| 303.15 | 0.3004 | 1336.0 |
| 303.15 | 0.4007 | 1302.9 |
| 303.15 | 0.4982 | 1275.3 |
| 303.15 | 0.5999 | 1249.8 |
| 303.15 | 0.6992 | 1227.9 |
| 303.15 | 0.7995 | 1207.5 |
| 303.15 | 0.8981 | 1189.2 |
| 303.15 | 1.0000 | 1171.4 |
| 313.15 | 0.0000 | 1437.4 |
| 313.15 | 0.1002 | 1384.7 |
| 313.15 | 0.2004 | 1339.2 |
| 313.15 | 0.3004 | 1300.8 |
| 313.15 | 0.4007 | 1267.1 |
| 313.15 | 0.4982 | 1238.9 |
| 313.15 | 0.5999 | 1212.7 |
| 313.15 | 0.6992 | 1190.0 |
| 313.15 | 0.7995 | 1168.9 |
| 313.15 | 0.8981 | 1149.9 |
| 313.15 | 1.0000 | 1131.4 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 95.3 (Liquid)
| Mole fraction of Methyl Isobutyl Ketone (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 461.00 |
| 0.0865 | 444.00 |
| 0.1725 | 431.20 |
| 0.2799 | 419.20 |
| 0.3989 | 409.20 |
| 0.5772 | 398.40 |
| 0.6947 | 393.20 |
| 0.8725 | 388.20 |
| 0.9275 | 387.30 |
| 1.0000 | 386.70 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 95.3 (Liquid)
| Mole fraction of Methyl Isobutyl Ketone (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 461.00 |
| 0.0865 | 444.00 |
| 0.1725 | 431.20 |
| 0.2799 | 419.20 |
| 0.3989 | 409.20 |
| 0.5772 | 398.40 |
| 0.6947 | 393.20 |
| 0.8725 | 388.20 |
| 0.9275 | 387.30 |
| 1.0000 | 386.70 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.1498 | 1.3500e-07 |
| 0.2346 | 2.5900e-07 |
| 0.3188 | 4.1200e-07 |
| 0.4347 | 5.6800e-07 |
| 0.5617 | 6.0800e-07 |
| 0.6307 | 5.6500e-07 |
| 0.7084 | 4.6800e-07 |
| 0.8001 | 3.1800e-07 |
| 0.8830 | 1.5600e-07 |
| 0.9329 | 7.2000e-08 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 303.15 (Liquid)
| Mole fraction of Dimethyl Sulfoxide (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.1498 | 1.3500e-07 |
| 0.2346 | 2.5900e-07 |
| 0.3188 | 4.1200e-07 |
| 0.4347 | 5.6800e-07 |
| 0.5617 | 6.0800e-07 |
| 0.6307 | 5.6500e-07 |
| 0.7084 | 4.6800e-07 |
| 0.8001 | 3.1800e-07 |
| 0.8830 | 1.5600e-07 |
| 0.9329 | 7.2000e-08 |
Sources
- Excess enthalpies and (vapour + liquid) equilibrium data for the binary mixtures of dimethylsulphoxide with ketones
- Excess molar volumes and ultrasonic studies of dimethylsulphoxide with ketones at T = 303.15 K
- Thermophysical approach to understand the nature of molecular interactions and structural factor between methyl isobutyl ketone and organic solvents mixtures