- Name
- 1-Butanol, 3-methyl-
- InChI
- InChI=1S/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3
- InChI Key
- PHTQWCKDNZKARW-UHFFFAOYSA-N
- Formula
- C5H12O
- SMILES
- CC(C)CCO
- Mol. Weight (g/mol)
- 88.15
- CAS
- 123-51-3
- Name
- Acetic acid
- InChI
- InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
- InChI Key
- QTBSBXVTEAMEQO-UHFFFAOYSA-N
- Formula
- C2H4O2
- SMILES
- CC(=O)O
- Mol. Weight (g/mol)
- 60.05
- CAS
- 64-19-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (4)
- n0 - Refractive index (Na D-line) (6)
- ρl - Mass density, kg/m3 (6)
- csound,fluid - Speed of Sound, m/s (6)
Mole fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.3283 | 0.0000 |
| 293.20 | 0.3926 | 0.0842 |
| 293.20 | 0.4452 | 0.1334 |
| 293.20 | 0.5232 | 0.1745 |
| 293.20 | 0.5806 | 0.1814 |
| 293.20 | 0.6818 | 0.1730 |
| 293.20 | 0.7282 | 0.1608 |
| 293.20 | 0.7931 | 0.1410 |
| 293.20 | 0.8341 | 0.1259 |
| 293.20 | 0.8734 | 0.1059 |
| 293.20 | 0.9062 | 0.0817 |
| 293.20 | 0.9349 | 0.0563 |
| 293.20 | 0.9651 | 0.0283 |
| 293.20 | 0.9941 | 0.0000 |
| 313.20 | 0.3461 | 0.0000 |
| 313.20 | 0.4191 | 0.0767 |
| 313.20 | 0.4639 | 0.1219 |
| 313.20 | 0.5624 | 0.1628 |
| 313.20 | 0.6527 | 0.1661 |
| 313.20 | 0.7031 | 0.1575 |
| 313.20 | 0.7586 | 0.1430 |
| 313.20 | 0.8231 | 0.1226 |
| 313.20 | 0.8839 | 0.0954 |
| 313.20 | 0.9218 | 0.0676 |
| 313.20 | 0.9576 | 0.0350 |
| 313.20 | 0.9950 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9866 | 0.0129 | 0.0495 | 0.3634 |
| 293.20 | 0.9695 | 0.0265 | 0.0868 | 0.3991 |
| 293.20 | 0.9508 | 0.0410 | 0.1158 | 0.4322 |
| 293.20 | 0.9294 | 0.0572 | 0.1429 | 0.4709 |
| 293.20 | 0.9019 | 0.0770 | 0.1683 | 0.5221 |
| 293.20 | 0.8849 | 0.0887 | 0.1832 | 0.5751 |
| 313.20 | 0.9815 | 0.0178 | 0.0477 | 0.3856 |
| 313.20 | 0.9733 | 0.0242 | 0.0755 | 0.4146 |
| 313.20 | 0.9616 | 0.0332 | 0.1028 | 0.4482 |
| 313.20 | 0.9469 | 0.0442 | 0.1251 | 0.4816 |
| 313.20 | 0.9281 | 0.0578 | 0.1446 | 0.5193 |
| 313.20 | 0.9140 | 0.0676 | 0.1536 | 0.5418 |
Mole fraction of Acetic acid (2) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mole fraction of Acetic acid (2) - Liquid mixture 1 |
| 293.20 | 0.3283 | 0.0000 |
| 293.20 | 0.3926 | 0.0842 |
| 293.20 | 0.4452 | 0.1334 |
| 293.20 | 0.5232 | 0.1745 |
| 293.20 | 0.5806 | 0.1814 |
| 293.20 | 0.6818 | 0.1730 |
| 293.20 | 0.7282 | 0.1608 |
| 293.20 | 0.7931 | 0.1410 |
| 293.20 | 0.8341 | 0.1259 |
| 293.20 | 0.8734 | 0.1059 |
| 293.20 | 0.9062 | 0.0817 |
| 293.20 | 0.9349 | 0.0563 |
| 293.20 | 0.9651 | 0.0283 |
| 293.20 | 0.9941 | 0.0000 |
| 313.20 | 0.3461 | 0.0000 |
| 313.20 | 0.4191 | 0.0767 |
| 313.20 | 0.4639 | 0.1219 |
| 313.20 | 0.5624 | 0.1628 |
| 313.20 | 0.6527 | 0.1661 |
| 313.20 | 0.7031 | 0.1575 |
| 313.20 | 0.7586 | 0.1430 |
| 313.20 | 0.8231 | 0.1226 |
| 313.20 | 0.8839 | 0.0954 |
| 313.20 | 0.9218 | 0.0676 |
| 313.20 | 0.9576 | 0.0350 |
| 313.20 | 0.9950 | 0.0000 |
Temperature, K x Mole fraction [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 2 | Mole fraction of Acetic acid (2) - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 |
| 293.20 | 0.9866 | 0.0129 | 0.0495 | 0.3634 |
| 293.20 | 0.9695 | 0.0265 | 0.0868 | 0.3991 |
| 293.20 | 0.9508 | 0.0410 | 0.1158 | 0.4322 |
| 293.20 | 0.9294 | 0.0572 | 0.1429 | 0.4709 |
| 293.20 | 0.9019 | 0.0770 | 0.1683 | 0.5221 |
| 293.20 | 0.8849 | 0.0887 | 0.1832 | 0.5751 |
| 313.20 | 0.9815 | 0.0178 | 0.0477 | 0.3856 |
| 313.20 | 0.9733 | 0.0242 | 0.0755 | 0.4146 |
| 313.20 | 0.9616 | 0.0332 | 0.1028 | 0.4482 |
| 313.20 | 0.9469 | 0.0442 | 0.1251 | 0.4816 |
| 313.20 | 0.9281 | 0.0578 | 0.1446 | 0.5193 |
| 313.20 | 0.9140 | 0.0676 | 0.1536 | 0.5418 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.3283 | 1.403 |
| 293.20 | 0.3926 | 1.3992 |
| 293.20 | 0.4452 | 1.396 |
| 293.20 | 0.5232 | 1.3911 |
| 293.20 | 0.5806 | 1.3878 |
| 293.20 | 0.6818 | 1.3807 |
| 293.20 | 0.7282 | 1.3766 |
| 293.20 | 0.7931 | 1.3699 |
| 293.20 | 0.8341 | 1.3644 |
| 293.20 | 0.8734 | 1.3585 |
| 293.20 | 0.9062 | 1.3532 |
| 293.20 | 0.9349 | 1.3482 |
| 293.20 | 0.9651 | 1.3424 |
| 293.20 | 0.9941 | 1.336 |
| 313.20 | 0.3461 | 1.3946 |
| 313.20 | 0.4191 | 1.3916 |
| 313.20 | 0.4639 | 1.388 |
| 313.20 | 0.5624 | 1.3825 |
| 313.20 | 0.6527 | 1.3662 |
| 313.20 | 0.7031 | 1.3565 |
| 313.20 | 0.7586 | 1.3616 |
| 313.20 | 0.8231 | 1.3587 |
| 313.20 | 0.8839 | 1.3522 |
| 313.20 | 0.9218 | 1.3462 |
| 313.20 | 0.9576 | 1.34 |
| 313.20 | 0.9950 | 1.3325 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.3634 | 1.4009 |
| 293.20 | 0.3991 | 1.399 |
| 293.20 | 0.4322 | 1.397 |
| 293.20 | 0.4709 | 1.3947 |
| 293.20 | 0.5221 | 1.3916 |
| 293.20 | 0.5751 | 1.3881 |
| 313.20 | 0.3856 | 1.3928 |
| 313.20 | 0.4146 | 1.3912 |
| 313.20 | 0.4482 | 1.389 |
| 313.20 | 0.4816 | 1.3875 |
| 313.20 | 0.5193 | 1.385 |
| 313.20 | 0.5418 | 1.384 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
| 293.20 | 0.9866 | 1.3394 |
| 293.20 | 0.9695 | 1.3423 |
| 293.20 | 0.9508 | 1.3456 |
| 293.20 | 0.9294 | 1.3494 |
| 293.20 | 0.9019 | 1.3544 |
| 293.20 | 0.8849 | 1.357 |
| 313.20 | 0.9815 | 1.3353 |
| 313.20 | 0.9733 | 1.3375 |
| 313.20 | 0.9616 | 1.3401 |
| 313.20 | 0.9469 | 1.3428 |
| 313.20 | 0.9281 | 1.3458 |
| 313.20 | 0.9140 | 1.3476 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.3283 | 1.403 |
| 293.20 | 0.3926 | 1.3992 |
| 293.20 | 0.4452 | 1.396 |
| 293.20 | 0.5232 | 1.3911 |
| 293.20 | 0.5806 | 1.3878 |
| 293.20 | 0.6818 | 1.3807 |
| 293.20 | 0.7282 | 1.3766 |
| 293.20 | 0.7931 | 1.3699 |
| 293.20 | 0.8341 | 1.3644 |
| 293.20 | 0.8734 | 1.3585 |
| 293.20 | 0.9062 | 1.3532 |
| 293.20 | 0.9349 | 1.3482 |
| 293.20 | 0.9651 | 1.3424 |
| 293.20 | 0.9941 | 1.336 |
| 313.20 | 0.3461 | 1.3946 |
| 313.20 | 0.4191 | 1.3916 |
| 313.20 | 0.4639 | 1.388 |
| 313.20 | 0.5624 | 1.3825 |
| 313.20 | 0.6527 | 1.3662 |
| 313.20 | 0.7031 | 1.3565 |
| 313.20 | 0.7586 | 1.3616 |
| 313.20 | 0.8231 | 1.3587 |
| 313.20 | 0.8839 | 1.3522 |
| 313.20 | 0.9218 | 1.3462 |
| 313.20 | 0.9576 | 1.34 |
| 313.20 | 0.9950 | 1.3325 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Refractive index (Na D-line) - Liquid mixture 1 |
| 293.20 | 0.3634 | 1.4009 |
| 293.20 | 0.3991 | 1.399 |
| 293.20 | 0.4322 | 1.397 |
| 293.20 | 0.4709 | 1.3947 |
| 293.20 | 0.5221 | 1.3916 |
| 293.20 | 0.5751 | 1.3881 |
| 313.20 | 0.3856 | 1.3928 |
| 313.20 | 0.4146 | 1.3912 |
| 313.20 | 0.4482 | 1.389 |
| 313.20 | 0.4816 | 1.3875 |
| 313.20 | 0.5193 | 1.385 |
| 313.20 | 0.5418 | 1.384 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Refractive index (Na D-line) - Liquid mixture 2 |
| 293.20 | 0.9866 | 1.3394 |
| 293.20 | 0.9695 | 1.3423 |
| 293.20 | 0.9508 | 1.3456 |
| 293.20 | 0.9294 | 1.3494 |
| 293.20 | 0.9019 | 1.3544 |
| 293.20 | 0.8849 | 1.357 |
| 313.20 | 0.9815 | 1.3353 |
| 313.20 | 0.9733 | 1.3375 |
| 313.20 | 0.9616 | 1.3401 |
| 313.20 | 0.9469 | 1.3428 |
| 313.20 | 0.9281 | 1.3458 |
| 313.20 | 0.9140 | 1.3476 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.3283 | 825.92 |
| 293.20 | 0.3926 | 849.002 |
| 293.20 | 0.4452 | 868.893 |
| 293.20 | 0.5232 | 897.466 |
| 293.20 | 0.5806 | 915.183 |
| 293.20 | 0.6818 | 947.585 |
| 293.20 | 0.7282 | 962.304 |
| 293.20 | 0.7931 | 986.083 |
| 293.20 | 0.8341 | 1003.098 |
| 293.20 | 0.8734 | 1016.044 |
| 293.20 | 0.9062 | 1018.588 |
| 293.20 | 0.9349 | 1014.34 |
| 293.20 | 0.9651 | 1006.018 |
| 293.20 | 0.9941 | 994.103 |
| 313.20 | 0.3461 | 811.658 |
| 313.20 | 0.4191 | 833.527 |
| 313.20 | 0.4639 | 852.411 |
| 313.20 | 0.5624 | 886.125 |
| 313.20 | 0.6527 | 915.978 |
| 313.20 | 0.7031 | 931.753 |
| 313.20 | 0.7586 | 953.008 |
| 313.20 | 0.8231 | 972.947 |
| 313.20 | 0.8839 | 1000.572 |
| 313.20 | 0.9218 | 1004.613 |
| 313.20 | 0.9576 | 999.072 |
| 313.20 | 0.9950 | 988.406 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.3634 | 838.254 |
| 293.20 | 0.3991 | 850.093 |
| 293.20 | 0.4322 | 863.492 |
| 293.20 | 0.4709 | 877.657 |
| 293.20 | 0.5221 | 896.025 |
| 293.20 | 0.5751 | 914.665 |
| 313.20 | 0.3856 | 823.59 |
| 313.20 | 0.4146 | 833.545 |
| 313.20 | 0.4482 | 845.077 |
| 313.20 | 0.4816 | 857.78 |
| 313.20 | 0.5193 | 872.312 |
| 313.20 | 0.5418 | 883.532 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.20 | 0.9866 | 997.895 |
| 293.20 | 0.9695 | 1004.844 |
| 293.20 | 0.9508 | 1010.112 |
| 293.20 | 0.9294 | 1014.402 |
| 293.20 | 0.9019 | 1017.738 |
| 293.20 | 0.8849 | 1017.432 |
| 313.20 | 0.9815 | 992.089 |
| 313.20 | 0.9733 | 995.62 |
| 313.20 | 0.9616 | 998.95 |
| 313.20 | 0.9469 | 1002.116 |
| 313.20 | 0.9281 | 1004.115 |
| 313.20 | 0.9140 | 1004.333 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.3283 | 825.92 |
| 293.20 | 0.3926 | 849.002 |
| 293.20 | 0.4452 | 868.893 |
| 293.20 | 0.5232 | 897.466 |
| 293.20 | 0.5806 | 915.183 |
| 293.20 | 0.6818 | 947.585 |
| 293.20 | 0.7282 | 962.304 |
| 293.20 | 0.7931 | 986.083 |
| 293.20 | 0.8341 | 1003.098 |
| 293.20 | 0.8734 | 1016.044 |
| 293.20 | 0.9062 | 1018.588 |
| 293.20 | 0.9349 | 1014.34 |
| 293.20 | 0.9651 | 1006.018 |
| 293.20 | 0.9941 | 994.103 |
| 313.20 | 0.3461 | 811.658 |
| 313.20 | 0.4191 | 833.527 |
| 313.20 | 0.4639 | 852.411 |
| 313.20 | 0.5624 | 886.125 |
| 313.20 | 0.6527 | 915.978 |
| 313.20 | 0.7031 | 931.753 |
| 313.20 | 0.7586 | 953.008 |
| 313.20 | 0.8231 | 972.947 |
| 313.20 | 0.8839 | 1000.572 |
| 313.20 | 0.9218 | 1004.613 |
| 313.20 | 0.9576 | 999.072 |
| 313.20 | 0.9950 | 988.406 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Mass density, kg/m3 - Liquid mixture 1 |
| 293.20 | 0.3634 | 838.254 |
| 293.20 | 0.3991 | 850.093 |
| 293.20 | 0.4322 | 863.492 |
| 293.20 | 0.4709 | 877.657 |
| 293.20 | 0.5221 | 896.025 |
| 293.20 | 0.5751 | 914.665 |
| 313.20 | 0.3856 | 823.59 |
| 313.20 | 0.4146 | 833.545 |
| 313.20 | 0.4482 | 845.077 |
| 313.20 | 0.4816 | 857.78 |
| 313.20 | 0.5193 | 872.312 |
| 313.20 | 0.5418 | 883.532 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Mass density, kg/m3 - Liquid mixture 2 |
| 293.20 | 0.9866 | 997.895 |
| 293.20 | 0.9695 | 1004.844 |
| 293.20 | 0.9508 | 1010.112 |
| 293.20 | 0.9294 | 1014.402 |
| 293.20 | 0.9019 | 1017.738 |
| 293.20 | 0.8849 | 1017.432 |
| 313.20 | 0.9815 | 992.089 |
| 313.20 | 0.9733 | 995.62 |
| 313.20 | 0.9616 | 998.95 |
| 313.20 | 0.9469 | 1002.116 |
| 313.20 | 0.9281 | 1004.115 |
| 313.20 | 0.9140 | 1004.333 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.3283 | 1277.6 |
| 293.20 | 0.3926 | 1283.0 |
| 293.20 | 0.4452 | 1291.05 |
| 293.20 | 0.5232 | 1307.85 |
| 293.20 | 0.5806 | 1323.1 |
| 293.20 | 0.6818 | 1359.33 |
| 293.20 | 0.7282 | 1381.71 |
| 293.20 | 0.7931 | 1427.27 |
| 293.20 | 0.8341 | 1468.18 |
| 293.20 | 0.8734 | 1509.78 |
| 293.20 | 0.9062 | 1533.05 |
| 293.20 | 0.9349 | 1540.21 |
| 293.20 | 0.9651 | 1533.04 |
| 293.20 | 0.9941 | 1509.69 |
| 313.20 | 0.3461 | 1214.61 |
| 313.20 | 0.4191 | 1222.28 |
| 313.20 | 0.4639 | 1233.19 |
| 313.20 | 0.5624 | 1257.07 |
| 313.20 | 0.6527 | 1287.48 |
| 313.20 | 0.7031 | 1294.9 |
| 313.20 | 0.7586 | 1323.88 |
| 313.20 | 0.8231 | 1441.26 |
| 313.20 | 0.8839 | 1496.75 |
| 313.20 | 0.9218 | 1533.7 |
| 313.20 | 0.9576 | 1548.47 |
| 313.20 | 0.9950 | 1543.86 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.3634 | 1280.58 |
| 293.20 | 0.3991 | 1284.75 |
| 293.20 | 0.4322 | 1288.48 |
| 293.20 | 0.4709 | 1295.03 |
| 293.20 | 0.5221 | 1306.34 |
| 293.20 | 0.5751 | 1321.18 |
| 313.20 | 0.3856 | 1219.55 |
| 313.20 | 0.4146 | 1222.69 |
| 313.20 | 0.4482 | 1227.57 |
| 313.20 | 0.4816 | 1234.82 |
| 313.20 | 0.5193 | 1243.95 |
| 313.20 | 0.5418 | 1249.55 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Speed of sound, m/s - Liquid mixture 2 |
| 293.20 | 0.9866 | 1523.62 |
| 293.20 | 0.9695 | 1533.13 |
| 293.20 | 0.9508 | 1539.03 |
| 293.20 | 0.9294 | 1540.15 |
| 293.20 | 0.9019 | 1534.2 |
| 293.20 | 0.8849 | 1520.43 |
| 313.20 | 0.9815 | 1547.97 |
| 313.20 | 0.9733 | 1549.67 |
| 313.20 | 0.9616 | 1548.84 |
| 313.20 | 0.9469 | 1544.89 |
| 313.20 | 0.9281 | 1536.13 |
| 313.20 | 0.9140 | 1526.63 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.3283 | 1277.6 |
| 293.20 | 0.3926 | 1283.0 |
| 293.20 | 0.4452 | 1291.05 |
| 293.20 | 0.5232 | 1307.85 |
| 293.20 | 0.5806 | 1323.1 |
| 293.20 | 0.6818 | 1359.33 |
| 293.20 | 0.7282 | 1381.71 |
| 293.20 | 0.7931 | 1427.27 |
| 293.20 | 0.8341 | 1468.18 |
| 293.20 | 0.8734 | 1509.78 |
| 293.20 | 0.9062 | 1533.05 |
| 293.20 | 0.9349 | 1540.21 |
| 293.20 | 0.9651 | 1533.04 |
| 293.20 | 0.9941 | 1509.69 |
| 313.20 | 0.3461 | 1214.61 |
| 313.20 | 0.4191 | 1222.28 |
| 313.20 | 0.4639 | 1233.19 |
| 313.20 | 0.5624 | 1257.07 |
| 313.20 | 0.6527 | 1287.48 |
| 313.20 | 0.7031 | 1294.9 |
| 313.20 | 0.7586 | 1323.88 |
| 313.20 | 0.8231 | 1441.26 |
| 313.20 | 0.8839 | 1496.75 |
| 313.20 | 0.9218 | 1533.7 |
| 313.20 | 0.9576 | 1548.47 |
| 313.20 | 0.9950 | 1543.86 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mole fraction of Water (3) - Liquid mixture 1 | Speed of sound, m/s - Liquid mixture 1 |
| 293.20 | 0.3634 | 1280.58 |
| 293.20 | 0.3991 | 1284.75 |
| 293.20 | 0.4322 | 1288.48 |
| 293.20 | 0.4709 | 1295.03 |
| 293.20 | 0.5221 | 1306.34 |
| 293.20 | 0.5751 | 1321.18 |
| 313.20 | 0.3856 | 1219.55 |
| 313.20 | 0.4146 | 1222.69 |
| 313.20 | 0.4482 | 1227.57 |
| 313.20 | 0.4816 | 1234.82 |
| 313.20 | 0.5193 | 1243.95 |
| 313.20 | 0.5418 | 1249.55 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 95 (Liquid mixture 2)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 2 | Mole fraction of Water (3) - Liquid mixture 2 | Speed of sound, m/s - Liquid mixture 2 |
| 293.20 | 0.9866 | 1523.62 |
| 293.20 | 0.9695 | 1533.13 |
| 293.20 | 0.9508 | 1539.03 |
| 293.20 | 0.9294 | 1540.15 |
| 293.20 | 0.9019 | 1534.2 |
| 293.20 | 0.8849 | 1520.43 |
| 313.20 | 0.9815 | 1547.97 |
| 313.20 | 0.9733 | 1549.67 |
| 313.20 | 0.9616 | 1548.84 |
| 313.20 | 0.9469 | 1544.89 |
| 313.20 | 0.9281 | 1536.13 |
| 313.20 | 0.9140 | 1526.63 |