- Name
- 2-Butanone
- InChI
- InChI=1S/C4H8O/c1-3-4(2)5/h3H2,1-2H3
- InChI Key
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- CCC(C)=O
- Mol. Weight (g/mol)
- 72.11
- CAS
- 78-93-3
- Name
- Tetrahydrofuran
- InChI
- InChI=1S/C4H8O/c1-2-4-5-3-1/h1-4H2
- InChI Key
- WYURNTSHIVDZCO-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- C1CCOC1
- Mol. Weight (g/mol)
- 72.11
- CAS
- 109-99-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 94.6 (Liquid)
| Mole fraction of Tetrahydrofuran (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 350.75 |
| 0.1810 | 346.05 |
| 0.3985 | 344.35 |
| 0.6120 | 341.75 |
| 0.8466 | 338.95 |
| 1.0000 | 337.15 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 94.6 (Liquid)
| Mole fraction of Tetrahydrofuran (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 350.75 |
| 0.1810 | 346.05 |
| 0.3985 | 344.35 |
| 0.6120 | 341.75 |
| 0.8466 | 338.95 |
| 1.0000 | 337.15 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Mole fraction of 2-Butanone (1) - Liquid | Vapor or sublimation pressure, kPa - Gas |
| 303.20 | 0.0000 | 26.60 |
| 303.20 | 0.1040 | 25.70 |
| 303.20 | 0.1060 | 25.70 |
| 303.20 | 0.1070 | 25.60 |
| 303.20 | 0.1820 | 25.00 |
| 303.20 | 0.1840 | 25.00 |
| 303.20 | 0.1890 | 24.90 |
| 303.20 | 0.1970 | 24.70 |
| 303.20 | 0.3700 | 23.00 |
| 303.20 | 0.3790 | 22.90 |
| 303.20 | 0.3940 | 22.70 |
| 303.20 | 0.5890 | 20.60 |
| 303.20 | 0.5930 | 20.50 |
| 303.10 | 0.6030 | 20.40 |
| 303.20 | 0.6230 | 20.10 |
| 303.20 | 0.7790 | 18.30 |
| 303.10 | 0.7870 | 18.20 |
| 303.20 | 0.8010 | 17.90 |
| 303.20 | 1.0000 | 15.10 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Mole fraction of 2-Butanone (1) - Liquid | Vapor or sublimation pressure, kPa - Gas |
| 303.20 | 0.0000 | 26.60 |
| 303.20 | 0.1040 | 25.70 |
| 303.20 | 0.1060 | 25.70 |
| 303.20 | 0.1070 | 25.60 |
| 303.20 | 0.1820 | 25.00 |
| 303.20 | 0.1840 | 25.00 |
| 303.20 | 0.1890 | 24.90 |
| 303.20 | 0.1970 | 24.70 |
| 303.20 | 0.3700 | 23.00 |
| 303.20 | 0.3790 | 22.90 |
| 303.20 | 0.3940 | 22.70 |
| 303.20 | 0.5890 | 20.60 |
| 303.20 | 0.5930 | 20.50 |
| 303.10 | 0.6030 | 20.40 |
| 303.20 | 0.6230 | 20.10 |
| 303.20 | 0.7790 | 18.30 |
| 303.10 | 0.7870 | 18.20 |
| 303.20 | 0.8010 | 17.90 |
| 303.20 | 1.0000 | 15.10 |
Sources
- Quaternary isothermal vapor-liquid equilibrium of the model biofuel 2-butanone + n-heptane + tetrahydrofuran + cyclohexane using Raman spectroscopic characterization
- Bubble-Temperature Measurements on Some Binary Mixtures Formed by Tetrahydrofuran or Amyl Alcohol with Hydrocarbons, Chlorohydrocarbons, or Butanols at (94.6 or 95.8) kPa