- Name
- Benzene
- InChI
- InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H
- InChI Key
- UHOVQNZJYSORNB-UHFFFAOYSA-N
- Formula
- C6H6
- SMILES
- c1ccccc1
- Mol. Weight (g/mol)
- 78.11
- CAS
- 71-43-2
- Name
- Trichloromethane
- InChI
- InChI=1S/CHCl3/c2-1(3)4/h1H
- InChI Key
- HEDRZPFGACZZDS-UHFFFAOYSA-N
- Formula
- CHCl3
- SMILES
- ClC(Cl)Cl
- Mol. Weight (g/mol)
- 119.38
- CAS
- 67-66-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- ρl - Mass density, kg/m3 (2)
- Binary diffusion coefficient, m2/s (2)
- Vapor Liquid Equilibrium at Constant Pressure (2)
- Vapor Liquid Equilibrium at Constant Temperature
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.33 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Trichloromethane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 884.246 |
| 288.15 | 0.1001 | 939.224 |
| 288.15 | 0.2000 | 995.529 |
| 288.15 | 0.3072 | 1057.295 |
| 288.15 | 0.3995 | 1111.961 |
| 288.15 | 0.4997 | 1172.451 |
| 288.15 | 0.6000 | 1234.482 |
| 288.15 | 0.6652 | 1275.682 |
| 288.15 | 0.7991 | 1362.317 |
| 288.15 | 0.8009 | 1363.447 |
| 288.15 | 0.9000 | 1429.592 |
| 288.15 | 1.0000 | 1498.077 |
| 293.15 | 0.0000 | 878.918 |
| 293.15 | 0.1001 | 933.584 |
| 293.15 | 0.2000 | 989.568 |
| 293.15 | 0.3072 | 1050.963 |
| 293.15 | 0.3995 | 1105.286 |
| 293.15 | 0.4997 | 1165.384 |
| 293.15 | 0.6000 | 1226.992 |
| 293.15 | 0.6652 | 1267.904 |
| 293.15 | 0.7991 | 1353.909 |
| 293.15 | 0.8009 | 1355.031 |
| 293.15 | 0.9000 | 1420.676 |
| 293.15 | 1.0000 | 1488.638 |
| 298.15 | 0.0000 | 873.582 |
| 298.15 | 0.1001 | 927.935 |
| 298.15 | 0.2000 | 983.589 |
| 298.15 | 0.3072 | 1044.608 |
| 298.15 | 0.3995 | 1098.581 |
| 298.15 | 0.4997 | 1158.284 |
| 298.15 | 0.6000 | 1219.472 |
| 298.15 | 0.6652 | 1260.092 |
| 298.15 | 0.7991 | 1345.461 |
| 298.15 | 0.8009 | 1346.576 |
| 298.15 | 0.9000 | 1411.713 |
| 298.15 | 1.0000 | 1479.148 |
| 303.15 | 0.0000 | 868.233 |
| 303.15 | 0.1001 | 922.271 |
| 303.15 | 0.2000 | 977.59 |
| 303.15 | 0.3072 | 1038.228 |
| 303.15 | 0.3995 | 1091.845 |
| 303.15 | 0.4997 | 1151.153 |
| 303.15 | 0.6000 | 1211.919 |
| 303.15 | 0.6652 | 1252.24 |
| 303.15 | 0.7991 | 1336.966 |
| 303.15 | 0.8009 | 1338.088 |
| 303.15 | 0.9000 | 1402.703 |
| 303.15 | 1.0000 | 1469.612 |
| 308.15 | 0.0000 | 862.871 |
| 308.15 | 0.1001 | 916.586 |
| 308.15 | 0.2000 | 971.567 |
| 308.15 | 0.3072 | 1031.818 |
| 308.15 | 0.3995 | 1085.078 |
| 308.15 | 0.4997 | 1143.984 |
| 308.15 | 0.6000 | 1204.331 |
| 308.15 | 0.6652 | 1244.341 |
| 308.15 | 0.7991 | 1328.421 |
| 308.15 | 0.8009 | 1329.56 |
| 308.15 | 0.9000 | 1393.631 |
| 308.15 | 1.0000 | 1460.025 |
| 313.15 | 0.0000 | 857.498 |
| 313.15 | 0.1001 | 910.883 |
| 313.15 | 0.2000 | 965.527 |
| 313.15 | 0.3072 | 1025.378 |
| 313.15 | 0.3995 | 1078.273 |
| 313.15 | 0.4997 | 1136.781 |
| 313.15 | 0.6000 | 1196.741 |
| 313.15 | 0.6652 | 1236.407 |
| 313.15 | 0.7991 | 1319.824 |
| 313.15 | 0.8009 | 1321.038 |
| 313.15 | 0.9000 | 1384.52 |
| 313.15 | 1.0000 | 1450.413 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.33 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Trichloromethane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 884.246 |
| 288.15 | 0.1001 | 939.224 |
| 288.15 | 0.2000 | 995.529 |
| 288.15 | 0.3072 | 1057.295 |
| 288.15 | 0.3995 | 1111.961 |
| 288.15 | 0.4997 | 1172.451 |
| 288.15 | 0.6000 | 1234.482 |
| 288.15 | 0.6652 | 1275.682 |
| 288.15 | 0.7991 | 1362.317 |
| 288.15 | 0.8009 | 1363.447 |
| 288.15 | 0.9000 | 1429.592 |
| 288.15 | 1.0000 | 1498.077 |
| 293.15 | 0.0000 | 878.918 |
| 293.15 | 0.1001 | 933.584 |
| 293.15 | 0.2000 | 989.568 |
| 293.15 | 0.3072 | 1050.963 |
| 293.15 | 0.3995 | 1105.286 |
| 293.15 | 0.4997 | 1165.384 |
| 293.15 | 0.6000 | 1226.992 |
| 293.15 | 0.6652 | 1267.904 |
| 293.15 | 0.7991 | 1353.909 |
| 293.15 | 0.8009 | 1355.031 |
| 293.15 | 0.9000 | 1420.676 |
| 293.15 | 1.0000 | 1488.638 |
| 298.15 | 0.0000 | 873.582 |
| 298.15 | 0.1001 | 927.935 |
| 298.15 | 0.2000 | 983.589 |
| 298.15 | 0.3072 | 1044.608 |
| 298.15 | 0.3995 | 1098.581 |
| 298.15 | 0.4997 | 1158.284 |
| 298.15 | 0.6000 | 1219.472 |
| 298.15 | 0.6652 | 1260.092 |
| 298.15 | 0.7991 | 1345.461 |
| 298.15 | 0.8009 | 1346.576 |
| 298.15 | 0.9000 | 1411.713 |
| 298.15 | 1.0000 | 1479.148 |
| 303.15 | 0.0000 | 868.233 |
| 303.15 | 0.1001 | 922.271 |
| 303.15 | 0.2000 | 977.59 |
| 303.15 | 0.3072 | 1038.228 |
| 303.15 | 0.3995 | 1091.845 |
| 303.15 | 0.4997 | 1151.153 |
| 303.15 | 0.6000 | 1211.919 |
| 303.15 | 0.6652 | 1252.24 |
| 303.15 | 0.7991 | 1336.966 |
| 303.15 | 0.8009 | 1338.088 |
| 303.15 | 0.9000 | 1402.703 |
| 303.15 | 1.0000 | 1469.612 |
| 308.15 | 0.0000 | 862.871 |
| 308.15 | 0.1001 | 916.586 |
| 308.15 | 0.2000 | 971.567 |
| 308.15 | 0.3072 | 1031.818 |
| 308.15 | 0.3995 | 1085.078 |
| 308.15 | 0.4997 | 1143.984 |
| 308.15 | 0.6000 | 1204.331 |
| 308.15 | 0.6652 | 1244.341 |
| 308.15 | 0.7991 | 1328.421 |
| 308.15 | 0.8009 | 1329.56 |
| 308.15 | 0.9000 | 1393.631 |
| 308.15 | 1.0000 | 1460.025 |
| 313.15 | 0.0000 | 857.498 |
| 313.15 | 0.1001 | 910.883 |
| 313.15 | 0.2000 | 965.527 |
| 313.15 | 0.3072 | 1025.378 |
| 313.15 | 0.3995 | 1078.273 |
| 313.15 | 0.4997 | 1136.781 |
| 313.15 | 0.6000 | 1196.741 |
| 313.15 | 0.6652 | 1236.407 |
| 313.15 | 0.7991 | 1319.824 |
| 313.15 | 0.8009 | 1321.038 |
| 313.15 | 0.9000 | 1384.52 |
| 313.15 | 1.0000 | 1450.413 |
Binary diffusion coefficient, m2/s [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Mole fraction of Benzene (1) - Liquid | Pressure, kPa - Liquid | Temperature, K - Liquid | Binary diffusion coefficient, m2/s - Liquid |
| 0.0000 | 101.00 | 298.15 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Mole fraction of Benzene (1) - Liquid | Pressure, kPa - Liquid | Temperature, K - Liquid | Binary diffusion coefficient, m2/s - Liquid |
| 0.0000 | 101.00 | 298.15 | 0.0000 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.33 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of Trichloromethane (2) - Liquid | y1[mol/mol] of Trichloromethane (2) - Vapour |
| 353.15 | 0.0500 | 0.0600 |
| 352.95 | 0.0800 | 0.1000 |
| 352.35 | 0.1200 | 0.1500 |
| 351.65 | 0.2000 | 0.2700 |
| 350.15 | 0.3200 | 0.4450 |
| 349.45 | 0.3800 | 0.5200 |
| 348.45 | 0.4500 | 0.6100 |
| 346.65 | 0.5600 | 0.7100 |
| 345.45 | 0.6400 | 0.7800 |
| 342.15 | 0.7800 | 0.8900 |
| 341.15 | 0.8200 | 0.9100 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.33 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of Trichloromethane (2) - Liquid | y1[mol/mol] of Trichloromethane (2) - Vapour |
| 352.35 | 0.0600 | 0.0890 |
| 352.15 | 0.0680 | 0.1000 |
| 351.55 | 0.1160 | 0.1670 |
| 351.05 | 0.1330 | 0.1900 |
| 350.05 | 0.1930 | 0.2700 |
| 349.35 | 0.2290 | 0.3160 |
| 348.85 | 0.2660 | 0.3610 |
| 347.85 | 0.3180 | 0.4290 |
| 347.55 | 0.3330 | 0.4430 |
| 346.45 | 0.3880 | 0.5080 |
| 345.35 | 0.4430 | 0.5700 |
| 344.75 | 0.4670 | 0.6010 |
| 343.95 | 0.5170 | 0.6520 |
| 342.85 | 0.5700 | 0.7020 |
| 341.45 | 0.6370 | 0.7620 |
| 340.15 | 0.7000 | 0.8140 |
| 338.55 | 0.7830 | 0.8750 |
| 337.25 | 0.8530 | 0.9220 |
| 335.75 | 0.9340 | 0.9680 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 298.2 (VLE)
| Fixed | Measured | |
|---|---|---|
| P [kPa] - VLE | x1[mol/mol] of Trichloromethane (2) - Liquid | y1[mol/mol] of Trichloromethane (2) - Vapour |
| 14.119 | 0.1340 | 0.2180 |
| 15.732 | 0.2840 | 0.4240 |
| 16.732 | 0.3600 | 0.5300 |
| 20.718 | 0.6280 | 0.8040 |
| 22.665 | 0.7400 | 0.8860 |
| 24.785 | 0.8660 | 0.9500 |
Sources
- Dortmund Data Bank Vapor-Liquid Equilibrium Data
- Volumetric properties of the ternary system ethanol + chloroform + benzene at temperature range (288.15 313.15) K: Experimental data, correlation and prediction by cubic EOS
- Diffusion Coefficients of Organic Compounds at Infinite Dilution in Mixtures Involving Associating Compounds. Experimental Determination and Modeling by Group Contribution Methods