- Name
- Decane
- InChI
- InChI=1S/C10H22/c1-3-5-7-9-10-8-6-4-2/h3-10H2,1-2H3
- InChI Key
- DIOQZVSQGTUSAI-UHFFFAOYSA-N
- Formula
- C10H22
- SMILES
- CCCCCCCCCC
- Mol. Weight (g/mol)
- 142.28
- CAS
- 124-18-5
- Name
- Ethyl Acetate
- InChI
- InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3
- InChI Key
- XEKOWRVHYACXOJ-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CCOC(C)=O
- Mol. Weight (g/mol)
- 88.11
- CAS
- 141-78-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Activity coefficient (2)
- Mole fraction (2)
- Excess molar enthalpy (molar enthalpy (4)
- ρl - Mass density, kg/m3 (2)
- Tboil - Boiling temperature at pressure P, K (2)
Activity coefficient of Ethyl Acetate (2) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Ethyl Acetate (2) - Liquid |
|---|---|
| 303.16 | 3.07 |
| 313.14 | 2.949 |
| 323.17 | 2.844 |
| 333.16 | 2.754 |
Activity coefficient of Ethyl Acetate (2) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Activity coefficient of Ethyl Acetate (2) - Liquid |
|---|---|
| 303.16 | 3.07 |
| 313.14 | 2.949 |
| 323.17 | 2.844 |
| 333.16 | 2.754 |
Mole fraction of Ethyl Acetate (2) [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of Ethyl Acetate (2) - Liquid | Mole fraction of Ethyl Acetate (2) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0260 | 0.3200 |
| 0.0470 | 0.5010 |
| 0.0730 | 0.6430 |
| 0.1180 | 0.7820 |
| 0.1860 | 0.8760 |
| 0.2580 | 0.9210 |
| 0.2960 | 0.9330 |
| 0.3930 | 0.9510 |
| 0.5290 | 0.9640 |
| 0.6050 | 0.9690 |
| 0.6820 | 0.9730 |
| 0.7640 | 0.9780 |
| 0.8190 | 0.9830 |
| 0.8590 | 0.9860 |
| 0.8880 | 0.9890 |
| 0.9250 | 0.9930 |
| 0.9510 | 0.9950 |
| 0.9800 | 0.9980 |
| 0.9900 | 0.9990 |
| 1.0000 | 1.0000 |
Mole fraction of Ethyl Acetate (2) [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of Ethyl Acetate (2) - Liquid | Mole fraction of Ethyl Acetate (2) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0260 | 0.3200 |
| 0.0470 | 0.5010 |
| 0.0730 | 0.6430 |
| 0.1180 | 0.7820 |
| 0.1860 | 0.8760 |
| 0.2580 | 0.9210 |
| 0.2960 | 0.9330 |
| 0.3930 | 0.9510 |
| 0.5290 | 0.9640 |
| 0.6050 | 0.9690 |
| 0.6820 | 0.9730 |
| 0.7640 | 0.9780 |
| 0.8190 | 0.9830 |
| 0.8590 | 0.9860 |
| 0.8880 | 0.9890 |
| 0.9250 | 0.9930 |
| 0.9510 | 0.9950 |
| 0.9800 | 0.9980 |
| 0.9900 | 0.9990 |
| 1.0000 | 1.0000 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Ethyl Acetate (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 363.15 | 1397.00 | 0.0952 | 0.4689 |
| 363.15 | 1397.00 | 0.1817 | 0.8284 |
| 363.15 | 1397.00 | 0.2607 | 1.091 |
| 363.15 | 1397.00 | 0.3332 | 1.2734 |
| 363.15 | 1397.00 | 0.3998 | 1.3949 |
| 363.15 | 1397.00 | 0.4614 | 1.4605 |
| 363.15 | 1397.00 | 0.5183 | 1.4898 |
| 363.15 | 1397.00 | 0.5712 | 1.4835 |
| 363.15 | 1397.00 | 0.6205 | 1.4505 |
| 363.15 | 1397.00 | 0.6665 | 1.4032 |
| 363.15 | 1397.00 | 0.7095 | 1.321 |
| 363.15 | 1397.00 | 0.7499 | 1.2235 |
| 363.15 | 1397.00 | 0.7878 | 1.1132 |
| 363.15 | 1397.00 | 0.8234 | 0.9858 |
| 363.15 | 1397.00 | 0.8571 | 0.8457 |
| 363.15 | 1397.00 | 0.8888 | 0.6993 |
| 363.15 | 1397.00 | 0.9189 | 0.5378 |
| 363.15 | 1397.00 | 0.9473 | 0.3631 |
| 363.15 | 1397.00 | 0.9743 | 0.1828 |
| 413.15 | 1342.00 | 0.0952 | 0.4839 |
| 413.15 | 1342.00 | 0.1817 | 0.8520 |
| 413.15 | 1342.00 | 0.2607 | 1.1223 |
| 413.15 | 1342.00 | 0.3332 | 1.3119 |
| 413.15 | 1342.00 | 0.3998 | 1.4458 |
| 413.15 | 1342.00 | 0.4614 | 1.5202 |
| 413.15 | 1342.00 | 0.5183 | 1.5526 |
| 413.15 | 1342.00 | 0.5713 | 1.5551 |
| 413.15 | 1342.00 | 0.6205 | 1.5186 |
| 413.15 | 1342.00 | 0.6665 | 1.4684 |
| 413.15 | 1342.00 | 0.7095 | 1.3771 |
| 413.15 | 1342.00 | 0.7499 | 1.2816 |
| 413.15 | 1342.00 | 0.7878 | 1.1589 |
| 413.15 | 1342.00 | 0.8234 | 1.0226 |
| 413.15 | 1342.00 | 0.8571 | 0.8754 |
| 413.15 | 1342.00 | 0.8888 | 0.7171 |
| 413.15 | 1342.00 | 0.9189 | 0.5498 |
| 413.15 | 1342.00 | 0.9473 | 0.3699 |
| 413.15 | 1342.00 | 0.9743 | 0.1951 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethyl Acetate (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 291.15 | 0.0986 | 0.6090 |
| 291.15 | 0.1909 | 1.029 |
| 291.15 | 0.2646 | 1.33 |
| 291.15 | 0.3377 | 1.556 |
| 291.15 | 0.4032 | 1.691 |
| 291.15 | 0.4608 | 1.764 |
| 291.15 | 0.5067 | 1.796 |
| 291.15 | 0.5523 | 1.813 |
| 291.15 | 0.5924 | 1.789 |
| 291.15 | 0.6147 | 1.76 |
| 291.15 | 0.6541 | 1.71 |
| 291.15 | 0.7009 | 1.628 |
| 291.15 | 0.7512 | 1.494 |
| 291.15 | 0.7956 | 1.327 |
| 291.15 | 0.8448 | 1.121 |
| 291.15 | 0.8927 | 0.8710 |
| 291.15 | 0.9375 | 0.5870 |
| 291.15 | 0.9684 | 0.2990 |
| 298.15 | 0.0884 | 0.4970 |
| 298.15 | 0.1770 | 0.9030 |
| 298.15 | 0.2587 | 1.211 |
| 298.15 | 0.3362 | 1.445 |
| 298.15 | 0.4005 | 1.579 |
| 298.15 | 0.4566 | 1.664 |
| 298.15 | 0.5101 | 1.709 |
| 298.15 | 0.5578 | 1.707 |
| 298.15 | 0.5984 | 1.684 |
| 298.15 | 0.6297 | 1.651 |
| 298.15 | 0.6727 | 1.595 |
| 298.15 | 0.7191 | 1.493 |
| 298.15 | 0.7636 | 1.377 |
| 298.15 | 0.8098 | 1.21 |
| 298.15 | 0.8591 | 1.006 |
| 298.15 | 0.9024 | 0.7760 |
| 298.15 | 0.9385 | 0.5190 |
| 298.15 | 0.9744 | 0.2490 |
| 318.15 | 0.0892 | 0.5680 |
| 318.15 | 0.1720 | 0.9470 |
| 318.15 | 0.2474 | 1.257 |
| 318.15 | 0.3208 | 1.48 |
| 318.15 | 0.3848 | 1.623 |
| 318.15 | 0.4412 | 1.711 |
| 318.15 | 0.4941 | 1.756 |
| 318.15 | 0.5409 | 1.76 |
| 318.15 | 0.5801 | 1.743 |
| 318.15 | 0.5985 | 1.724 |
| 318.15 | 0.6567 | 1.636 |
| 318.15 | 0.6942 | 1.566 |
| 318.15 | 0.7429 | 1.44 |
| 318.15 | 0.7959 | 1.268 |
| 318.15 | 0.8499 | 1.041 |
| 318.15 | 0.9018 | 0.7470 |
| 318.15 | 0.9554 | 0.4070 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Ethyl Acetate (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 363.15 | 1397.00 | 0.0952 | 0.4689 |
| 363.15 | 1397.00 | 0.1817 | 0.8284 |
| 363.15 | 1397.00 | 0.2607 | 1.091 |
| 363.15 | 1397.00 | 0.3332 | 1.2734 |
| 363.15 | 1397.00 | 0.3998 | 1.3949 |
| 363.15 | 1397.00 | 0.4614 | 1.4605 |
| 363.15 | 1397.00 | 0.5183 | 1.4898 |
| 363.15 | 1397.00 | 0.5712 | 1.4835 |
| 363.15 | 1397.00 | 0.6205 | 1.4505 |
| 363.15 | 1397.00 | 0.6665 | 1.4032 |
| 363.15 | 1397.00 | 0.7095 | 1.321 |
| 363.15 | 1397.00 | 0.7499 | 1.2235 |
| 363.15 | 1397.00 | 0.7878 | 1.1132 |
| 363.15 | 1397.00 | 0.8234 | 0.9858 |
| 363.15 | 1397.00 | 0.8571 | 0.8457 |
| 363.15 | 1397.00 | 0.8888 | 0.6993 |
| 363.15 | 1397.00 | 0.9189 | 0.5378 |
| 363.15 | 1397.00 | 0.9473 | 0.3631 |
| 363.15 | 1397.00 | 0.9743 | 0.1828 |
| 413.15 | 1342.00 | 0.0952 | 0.4839 |
| 413.15 | 1342.00 | 0.1817 | 0.8520 |
| 413.15 | 1342.00 | 0.2607 | 1.1223 |
| 413.15 | 1342.00 | 0.3332 | 1.3119 |
| 413.15 | 1342.00 | 0.3998 | 1.4458 |
| 413.15 | 1342.00 | 0.4614 | 1.5202 |
| 413.15 | 1342.00 | 0.5183 | 1.5526 |
| 413.15 | 1342.00 | 0.5713 | 1.5551 |
| 413.15 | 1342.00 | 0.6205 | 1.5186 |
| 413.15 | 1342.00 | 0.6665 | 1.4684 |
| 413.15 | 1342.00 | 0.7095 | 1.3771 |
| 413.15 | 1342.00 | 0.7499 | 1.2816 |
| 413.15 | 1342.00 | 0.7878 | 1.1589 |
| 413.15 | 1342.00 | 0.8234 | 1.0226 |
| 413.15 | 1342.00 | 0.8571 | 0.8754 |
| 413.15 | 1342.00 | 0.8888 | 0.7171 |
| 413.15 | 1342.00 | 0.9189 | 0.5498 |
| 413.15 | 1342.00 | 0.9473 | 0.3699 |
| 413.15 | 1342.00 | 0.9743 | 0.1951 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethyl Acetate (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 291.15 | 0.0986 | 0.6090 |
| 291.15 | 0.1909 | 1.029 |
| 291.15 | 0.2646 | 1.33 |
| 291.15 | 0.3377 | 1.556 |
| 291.15 | 0.4032 | 1.691 |
| 291.15 | 0.4608 | 1.764 |
| 291.15 | 0.5067 | 1.796 |
| 291.15 | 0.5523 | 1.813 |
| 291.15 | 0.5924 | 1.789 |
| 291.15 | 0.6147 | 1.76 |
| 291.15 | 0.6541 | 1.71 |
| 291.15 | 0.7009 | 1.628 |
| 291.15 | 0.7512 | 1.494 |
| 291.15 | 0.7956 | 1.327 |
| 291.15 | 0.8448 | 1.121 |
| 291.15 | 0.8927 | 0.8710 |
| 291.15 | 0.9375 | 0.5870 |
| 291.15 | 0.9684 | 0.2990 |
| 298.15 | 0.0884 | 0.4970 |
| 298.15 | 0.1770 | 0.9030 |
| 298.15 | 0.2587 | 1.211 |
| 298.15 | 0.3362 | 1.445 |
| 298.15 | 0.4005 | 1.579 |
| 298.15 | 0.4566 | 1.664 |
| 298.15 | 0.5101 | 1.709 |
| 298.15 | 0.5578 | 1.707 |
| 298.15 | 0.5984 | 1.684 |
| 298.15 | 0.6297 | 1.651 |
| 298.15 | 0.6727 | 1.595 |
| 298.15 | 0.7191 | 1.493 |
| 298.15 | 0.7636 | 1.377 |
| 298.15 | 0.8098 | 1.21 |
| 298.15 | 0.8591 | 1.006 |
| 298.15 | 0.9024 | 0.7760 |
| 298.15 | 0.9385 | 0.5190 |
| 298.15 | 0.9744 | 0.2490 |
| 318.15 | 0.0892 | 0.5680 |
| 318.15 | 0.1720 | 0.9470 |
| 318.15 | 0.2474 | 1.257 |
| 318.15 | 0.3208 | 1.48 |
| 318.15 | 0.3848 | 1.623 |
| 318.15 | 0.4412 | 1.711 |
| 318.15 | 0.4941 | 1.756 |
| 318.15 | 0.5409 | 1.76 |
| 318.15 | 0.5801 | 1.743 |
| 318.15 | 0.5985 | 1.724 |
| 318.15 | 0.6567 | 1.636 |
| 318.15 | 0.6942 | 1.566 |
| 318.15 | 0.7429 | 1.44 |
| 318.15 | 0.7959 | 1.268 |
| 318.15 | 0.8499 | 1.041 |
| 318.15 | 0.9018 | 0.7470 |
| 318.15 | 0.9554 | 0.4070 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethyl Acetate (2) - Liquid | Mass density, kg/m3 - Liquid |
| 291.15 | 0.0000 | 731.22 |
| 291.15 | 0.0174 | 732.37 |
| 291.15 | 0.0789 | 736.87 |
| 291.15 | 0.1457 | 742.14 |
| 291.15 | 0.2494 | 751.47 |
| 291.15 | 0.3508 | 762.27 |
| 291.15 | 0.4382 | 773.02 |
| 291.15 | 0.5149 | 783.83 |
| 291.15 | 0.5781 | 793.79 |
| 291.15 | 0.6446 | 805.51 |
| 291.15 | 0.7051 | 817.52 |
| 291.15 | 0.7648 | 830.7 |
| 291.15 | 0.8069 | 841.06 |
| 291.15 | 0.8553 | 854.05 |
| 291.15 | 0.8914 | 864.68 |
| 291.15 | 0.9318 | 877.69 |
| 291.15 | 0.9794 | 894.7 |
| 291.15 | 1.0000 | 902.88 |
| 298.15 | 0.0000 | 726.2 |
| 298.15 | 0.0319 | 728.3 |
| 298.15 | 0.1165 | 734.6 |
| 298.15 | 0.2048 | 741.9 |
| 298.15 | 0.2835 | 749.3 |
| 298.15 | 0.3475 | 756.1 |
| 298.15 | 0.4252 | 765.35 |
| 298.15 | 0.4873 | 773.59 |
| 298.15 | 0.5417 | 781.58 |
| 298.15 | 0.6031 | 791.53 |
| 298.15 | 0.6469 | 799.34 |
| 298.15 | 0.6957 | 808.8 |
| 298.15 | 0.7407 | 818.3 |
| 298.15 | 0.7800 | 827.2 |
| 298.15 | 0.8179 | 836.5 |
| 298.15 | 0.8516 | 845.4 |
| 298.15 | 0.8865 | 855.4 |
| 298.15 | 0.9207 | 866.1 |
| 298.15 | 0.9604 | 879.5 |
| 298.15 | 1.0000 | 894.4 |
| 318.15 | 0.0000 | 710.9 |
| 318.15 | 0.0117 | 711.52 |
| 318.15 | 0.0758 | 715.68 |
| 318.15 | 0.1539 | 721.34 |
| 318.15 | 0.2456 | 728.94 |
| 318.15 | 0.2848 | 732.56 |
| 318.15 | 0.3468 | 738.71 |
| 318.15 | 0.3714 | 741.31 |
| 318.15 | 0.4391 | 749.04 |
| 318.15 | 0.5160 | 758.96 |
| 318.15 | 0.5314 | 761.13 |
| 318.15 | 0.5878 | 769.54 |
| 318.15 | 0.6448 | 778.92 |
| 318.15 | 0.6940 | 787.77 |
| 318.15 | 0.7127 | 791.38 |
| 318.15 | 0.7829 | 806.2 |
| 318.15 | 0.8204 | 815.0 |
| 318.15 | 0.8538 | 823.5 |
| 318.15 | 0.8886 | 833.0 |
| 318.15 | 0.9198 | 842.3 |
| 318.15 | 0.9553 | 853.8 |
| 318.15 | 1.0000 | 869.6 |
| 328.15 | 0.0000 | 703.34 |
| 328.15 | 0.0347 | 705.37 |
| 328.15 | 0.1351 | 711.99 |
| 328.15 | 0.2340 | 719.58 |
| 328.15 | 0.3322 | 728.47 |
| 328.15 | 0.4166 | 737.37 |
| 328.15 | 0.4853 | 745.64 |
| 328.15 | 0.5551 | 755.09 |
| 328.15 | 0.6186 | 764.72 |
| 328.15 | 0.6774 | 774.65 |
| 328.15 | 0.7271 | 783.92 |
| 328.15 | 0.7735 | 793.4 |
| 328.15 | 0.8619 | 814.12 |
| 328.15 | 0.9041 | 825.66 |
| 328.15 | 0.9511 | 840.13 |
| 328.15 | 1.0000 | 857.17 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethyl Acetate (2) - Liquid | Mass density, kg/m3 - Liquid |
| 291.15 | 0.0000 | 731.22 |
| 291.15 | 0.0174 | 732.37 |
| 291.15 | 0.0789 | 736.87 |
| 291.15 | 0.1457 | 742.14 |
| 291.15 | 0.2494 | 751.47 |
| 291.15 | 0.3508 | 762.27 |
| 291.15 | 0.4382 | 773.02 |
| 291.15 | 0.5149 | 783.83 |
| 291.15 | 0.5781 | 793.79 |
| 291.15 | 0.6446 | 805.51 |
| 291.15 | 0.7051 | 817.52 |
| 291.15 | 0.7648 | 830.7 |
| 291.15 | 0.8069 | 841.06 |
| 291.15 | 0.8553 | 854.05 |
| 291.15 | 0.8914 | 864.68 |
| 291.15 | 0.9318 | 877.69 |
| 291.15 | 0.9794 | 894.7 |
| 291.15 | 1.0000 | 902.88 |
| 298.15 | 0.0000 | 726.2 |
| 298.15 | 0.0319 | 728.3 |
| 298.15 | 0.1165 | 734.6 |
| 298.15 | 0.2048 | 741.9 |
| 298.15 | 0.2835 | 749.3 |
| 298.15 | 0.3475 | 756.1 |
| 298.15 | 0.4252 | 765.35 |
| 298.15 | 0.4873 | 773.59 |
| 298.15 | 0.5417 | 781.58 |
| 298.15 | 0.6031 | 791.53 |
| 298.15 | 0.6469 | 799.34 |
| 298.15 | 0.6957 | 808.8 |
| 298.15 | 0.7407 | 818.3 |
| 298.15 | 0.7800 | 827.2 |
| 298.15 | 0.8179 | 836.5 |
| 298.15 | 0.8516 | 845.4 |
| 298.15 | 0.8865 | 855.4 |
| 298.15 | 0.9207 | 866.1 |
| 298.15 | 0.9604 | 879.5 |
| 298.15 | 1.0000 | 894.4 |
| 318.15 | 0.0000 | 710.9 |
| 318.15 | 0.0117 | 711.52 |
| 318.15 | 0.0758 | 715.68 |
| 318.15 | 0.1539 | 721.34 |
| 318.15 | 0.2456 | 728.94 |
| 318.15 | 0.2848 | 732.56 |
| 318.15 | 0.3468 | 738.71 |
| 318.15 | 0.3714 | 741.31 |
| 318.15 | 0.4391 | 749.04 |
| 318.15 | 0.5160 | 758.96 |
| 318.15 | 0.5314 | 761.13 |
| 318.15 | 0.5878 | 769.54 |
| 318.15 | 0.6448 | 778.92 |
| 318.15 | 0.6940 | 787.77 |
| 318.15 | 0.7127 | 791.38 |
| 318.15 | 0.7829 | 806.2 |
| 318.15 | 0.8204 | 815.0 |
| 318.15 | 0.8538 | 823.5 |
| 318.15 | 0.8886 | 833.0 |
| 318.15 | 0.9198 | 842.3 |
| 318.15 | 0.9553 | 853.8 |
| 318.15 | 1.0000 | 869.6 |
| 328.15 | 0.0000 | 703.34 |
| 328.15 | 0.0347 | 705.37 |
| 328.15 | 0.1351 | 711.99 |
| 328.15 | 0.2340 | 719.58 |
| 328.15 | 0.3322 | 728.47 |
| 328.15 | 0.4166 | 737.37 |
| 328.15 | 0.4853 | 745.64 |
| 328.15 | 0.5551 | 755.09 |
| 328.15 | 0.6186 | 764.72 |
| 328.15 | 0.6774 | 774.65 |
| 328.15 | 0.7271 | 783.92 |
| 328.15 | 0.7735 | 793.4 |
| 328.15 | 0.8619 | 814.12 |
| 328.15 | 0.9041 | 825.66 |
| 328.15 | 0.9511 | 840.13 |
| 328.15 | 1.0000 | 857.17 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of Ethyl Acetate (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 447.30 |
| 0.0260 | 433.02 |
| 0.0470 | 422.86 |
| 0.0730 | 412.23 |
| 0.1180 | 397.98 |
| 0.1860 | 383.62 |
| 0.2580 | 373.72 |
| 0.2960 | 370.71 |
| 0.3930 | 365.23 |
| 0.5290 | 360.76 |
| 0.6050 | 359.00 |
| 0.6820 | 357.59 |
| 0.7640 | 356.21 |
| 0.8190 | 354.55 |
| 0.8590 | 353.76 |
| 0.8880 | 352.95 |
| 0.9250 | 351.75 |
| 0.9510 | 351.40 |
| 0.9800 | 350.46 |
| 0.9900 | 350.37 |
| 1.0000 | 350.15 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of Ethyl Acetate (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 447.30 |
| 0.0260 | 433.02 |
| 0.0470 | 422.86 |
| 0.0730 | 412.23 |
| 0.1180 | 397.98 |
| 0.1860 | 383.62 |
| 0.2580 | 373.72 |
| 0.2960 | 370.71 |
| 0.3930 | 365.23 |
| 0.5290 | 360.76 |
| 0.6050 | 359.00 |
| 0.6820 | 357.59 |
| 0.7640 | 356.21 |
| 0.8190 | 354.55 |
| 0.8590 | 353.76 |
| 0.8880 | 352.95 |
| 0.9250 | 351.75 |
| 0.9510 | 351.40 |
| 0.9800 | 350.46 |
| 0.9900 | 350.37 |
| 1.0000 | 350.15 |
Sources
- Activity coefficient at infinite dilution, azeotropic data, excess enthalpies and solid liquid-equilibria for binary systems of alkanes and aromatics with esters
- Measurements of the Excess Properties and Vapor-Liquid Equilibria at 101.32 kPa for Mixtures of Ethyl Ethanoate + Alkanes (from C5 to C10)