- InChI
- InChI=1S/C7H12O2/c1-3-5-6-9-7(8)4-2/h4H,2-3,5-6H2,1H3
- InChI Key
- CQEYYJKEWSMYFG-UHFFFAOYSA-N
- Formula
- C7H12O2
- SMILES
- C=CC(=O)OCCCC
- Molecular Weight1
- 128.17
- CAS
- 141-32-2
- Other Names
-
- 2-PROPENOIC ACID BUTYL ESTER
- ACRYLIC ACID BUTYL ESTER
- Acrylic acid, n-butyl ester
- BUTYL-2-PROPENOATE
- Butyl 2-propenoate
- Butyl acrylate
- Butylacrylate, inhibited
- Butylester kyseliny akrylove
- UN 2348
- acrylic acid, butyl ester
- butyl propenoate
- n-Butyl acrylate
- n-Butyl propenoate
- propenoic acid, butyl ester
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- NFPA Safety : NFPA Safety Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔcH°liquid | -4046.96 ± 0.58 | kJ/mol | NIST |
| ΔfG° | -138.02 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | [-381.10; -375.30] | kJ/mol |
|
| ΔfH°gas | -375.30 ± 0.80 | kJ/mol | NIST |
| ΔfH°gas | -381.10 | kJ/mol | NIST |
| ΔfH°liquid | [-428.40; -422.60] | kJ/mol |
|
| ΔfH°liquid | -422.60 ± 0.70 | kJ/mol | NIST |
| ΔfH°liquid | -428.40 | kJ/mol | NIST |
| ΔfusH° | 15.39 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [47.30; 47.31] | kJ/mol |
|
| ΔvapH° | 47.31 ± 0.33 | kJ/mol | NIST |
| ΔvapH° | 47.30 | kJ/mol | NIST |
| ΔvapH° | 47.30 ± 0.30 | kJ/mol | NIST |
| log10WS | -1.47 | Crippen Calculated Property | |
| logPoct/wat | 1.516 | Crippen Calculated Property | |
| McVol | 112.630 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 2 | KDB | |
| NFPA Health | 2 | KDB | |
| NFPA Safety | 2 | KDB | |
| Pc | [2840.00; 4540.00] | kPa |
|
| Pc | 2840.00 | kPa | Critica... |
| Pc | 4540.00 ± 350.00 | kPa | NIST |
| ρc | 299.79 ± 15.38 | kg/m3 | NIST |
| Inp | [850.00; 902.00] |
|
|
| Inp | 875.00 | NIST | |
| Inp | 876.00 | NIST | |
| Inp | 878.00 | NIST | |
| Inp | 873.00 | NIST | |
| Inp | Outlier 850.00 | NIST | |
| Inp | 861.00 | NIST | |
| Inp | 878.00 | NIST | |
| Inp | 878.00 | NIST | |
| Inp | 878.00 | NIST | |
| Inp | 883.00 | NIST | |
| Inp | 858.00 | NIST | |
| Inp | 902.00 | NIST | |
| Inp | 902.00 | NIST | |
| Inp | 892.00 | NIST | |
| Inp | 883.00 | NIST | |
| Inp | 875.00 | NIST | |
| Inp | 861.00 | NIST | |
| Inp | 892.00 | NIST | |
| I | [1169.00; 1197.00] |
|
|
| I | 1175.00 | NIST | |
| I | 1178.00 | NIST | |
| I | 1169.00 | NIST | |
| I | 1197.00 | NIST | |
| I | 1197.00 | NIST | |
| I | 1197.00 | NIST | |
| I | 1197.00 | NIST | |
| I | 1189.00 | NIST | |
| I | 1189.00 | NIST | |
| Tboil | [418.20; 421.95] | K |
|
| Tboil | 418.20 | K | NIST |
| Tboil | 420.20 | K | NIST |
| Tboil | 421.95 | K | NIST |
| Tc | 644.00 ± 3.00 | K | NIST |
| Tfus | [209.15; 209.50] | K |
|
| Tfus | 209.50 | K | NIST |
| Tfus | 209.50 ± 0.50 | K | NIST |
| Tfus | 209.15 | K | NIST |
| Vc | 0.432 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [222.85; 279.98] | J/mol×K | [432.53; 612.55] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 220 230 240 250 260 270 280 450 500 550 600 | ||||
| Cp,gas | 222.85 | J/mol×K | 432.53 | Joback Calculated Property |
| Cp,gas | 233.32 | J/mol×K | 462.53 | Joback Calculated Property |
| Cp,gas | 243.41 | J/mol×K | 492.54 | Joback Calculated Property |
| Cp,gas | 253.12 | J/mol×K | 522.54 | Joback Calculated Property |
| Cp,gas | 262.44 | J/mol×K | 552.54 | Joback Calculated Property |
| Cp,gas | 271.40 | J/mol×K | 582.54 | Joback Calculated Property |
| Cp,gas | 279.98 | J/mol×K | 612.55 | Joback Calculated Property |
| Cp,liquid | 251.00 | J/mol×K | 298.15 | NIST |
| η | [0.0002641; 0.0028577] | Pa×s | [239.05; 432.53] |
|
|
T(K) Dynamic viscosity (Pa×s) 5.00e-4 1.00e-3 1.50e-3 2.00e-3 2.50e-3 3.00e-3 250 300 350 400 | ||||
| η | 0.0028577 | Pa×s | 239.05 | Joback Calculated Property |
| η | 0.0015177 | Pa×s | 271.30 | Joback Calculated Property |
| η | 0.0009221 | Pa×s | 303.54 | Joback Calculated Property |
| η | 0.0006165 | Pa×s | 335.79 | Joback Calculated Property |
| η | 0.0004423 | Pa×s | 368.04 | Joback Calculated Property |
| η | 0.0003347 | Pa×s | 400.28 | Joback Calculated Property |
| η | 0.0002641 | Pa×s | 432.53 | Joback Calculated Property |
| ΔfusH | [17.31; 17.31] | kJ/mol | [209.50; 209.50] |
|
| ΔfusH | 17.31 | kJ/mol | 209.50 | NIST |
| ΔfusH | 17.31 | kJ/mol | 209.50 | NIST |
| ΔfusH | 17.31 | kJ/mol | 209.50 | NIST |
| ΔvapH | [40.00; 45.70] | kJ/mol | [346.50; 368.50] |
|
| ΔvapH | 44.80 | kJ/mol | 346.50 | NIST |
| ΔvapH | 45.70 ± 0.30 | kJ/mol | 368.50 | NIST |
| ΔvapH | 42.80 ± 0.30 | kJ/mol | 368.50 | NIST |
| ΔvapH | 40.00 ± 0.30 | kJ/mol | 368.50 | NIST |
| n0 | [1.40690; 1.41190] | [298.15; 313.15] |
|
|
| n0 | 1.41190 | 298.15 | Volumet... | |
| n0 | 1.41020 | 303.15 | Volumet... | |
| n0 | 1.40840 | 308.15 | Volumet... | |
| n0 | 1.40690 | 313.15 | Volumet... | |
| ρl | [853.75; 913.92] | kg/m3 | [278.15; 338.15] |
|
|
T(K) Liquid Density (kg/m3) 850 860 870 880 890 900 910 280 300 320 | ||||
| ρl | 913.92 | kg/m3 | 278.15 | Thermop... |
| ρl | 911.47 | kg/m3 | 280.65 | Thermop... |
| ρl | 908.99 | kg/m3 | 283.15 | Thermop... |
| ρl | 906.51 | kg/m3 | 285.65 | Thermop... |
| ρl | 903.60 | kg/m3 | 288.15 | Densiti... |
| ρl | 904.04 | kg/m3 | 288.15 | Thermop... |
| ρl | 901.56 | kg/m3 | 290.65 | Thermop... |
| ρl | 899.07 | kg/m3 | 293.15 | Thermop... |
| ρl | 898.85 | kg/m3 | 293.15 | Densiti... |
| ρl | 896.59 | kg/m3 | 295.65 | Thermop... |
| ρl | 893.96 | kg/m3 | 298.15 | Densiti... |
| ρl | 894.10 | kg/m3 | 298.15 | Densiti... |
| ρl | 894.10 | kg/m3 | 298.15 | Thermop... |
| ρl | 894.10 | kg/m3 | 298.15 | Densiti... |
| ρl | 893.95 | kg/m3 | 298.15 | Volumet... |
| ρl | 891.61 | kg/m3 | 300.65 | Thermop... |
| ρl | 889.35 | kg/m3 | 303.15 | Densiti... |
| ρl | 889.11 | kg/m3 | 303.15 | Thermop... |
| ρl | 886.61 | kg/m3 | 305.65 | Thermop... |
| ρl | 884.11 | kg/m3 | 308.15 | Thermop... |
| ρl | 884.60 | kg/m3 | 308.15 | Densiti... |
| ρl | 881.61 | kg/m3 | 310.65 | Thermop... |
| ρl | 879.85 | kg/m3 | 313.15 | Densiti... |
| ρl | 879.10 | kg/m3 | 313.15 | Thermop... |
| ρl | 876.58 | kg/m3 | 315.65 | Thermop... |
| ρl | 874.07 | kg/m3 | 318.15 | Thermop... |
| ρl | 875.10 | kg/m3 | 318.15 | Densiti... |
| ρl | 871.55 | kg/m3 | 320.65 | Thermop... |
| ρl | 869.02 | kg/m3 | 323.15 | Thermop... |
| ρl | 866.49 | kg/m3 | 325.65 | Thermop... |
| ρl | 863.95 | kg/m3 | 328.15 | Thermop... |
| ρl | 861.41 | kg/m3 | 330.65 | Thermop... |
| ρl | 858.86 | kg/m3 | 333.15 | Thermop... |
| ρl | 856.31 | kg/m3 | 335.65 | Thermop... |
| ρl | 853.75 | kg/m3 | 338.15 | Thermop... |
| ΔfusS | 82.61 | J/mol×K | 209.50 | NIST |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.64] | kPa | [317.14; 442.18] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.57206e+01 | |||
| Coefficient B | -3.99833e+03 | |||
| Coefficient C | -5.80630e+01 | |||
| Temperature range, min. | 317.14 | |||
| Temperature range, max. | 442.18 | |||
|
T(K) Vapor pressure (kPa) 0 50 100 150 200 350 400 | ||||
| Pvap | 1.33 | kPa | 317.14 | Calculated Property |
| Pvap | 2.92 | kPa | 331.03 | Calculated Property |
| Pvap | 5.94 | kPa | 344.93 | Calculated Property |
| Pvap | 11.32 | kPa | 358.82 | Calculated Property |
| Pvap | 20.36 | kPa | 372.71 | Calculated Property |
| Pvap | 34.84 | kPa | 386.61 | Calculated Property |
| Pvap | 57.08 | kPa | 400.50 | Calculated Property |
| Pvap | 89.99 | kPa | 414.39 | Calculated Property |
| Pvap | 137.11 | kPa | 428.29 | Calculated Property |
| Pvap | 202.64 | kPa | 442.18 | Calculated Property |
| Pvap | [2.25e-04; 2641.37] | kPa | [208.55; 598.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 6.67290e+01 | |||
| Coefficient B | -7.34218e+03 | |||
| Coefficient C | -7.50837e+00 | |||
| Coefficient D | 4.00837e-06 | |||
| Temperature range, min. | 208.55 | |||
| Temperature range, max. | 598.00 | |||
|
T(K) Vapor pressure (kPa) 0 500 1000 1500 2000 2500 200 400 600 | ||||
| Pvap | 2.25e-04 | kPa | 208.55 | Calculated Property |
| Pvap | 0.03 | kPa | 251.82 | Calculated Property |
| Pvap | 0.60 | kPa | 295.09 | Calculated Property |
| Pvap | 5.81 | kPa | 338.37 | Calculated Property |
| Pvap | 31.22 | kPa | 381.64 | Calculated Property |
| Pvap | 113.70 | kPa | 424.91 | Calculated Property |
| Pvap | 316.53 | kPa | 468.18 | Calculated Property |
| Pvap | 728.07 | kPa | 511.46 | Calculated Property |
| Pvap | 1458.75 | kPa | 554.73 | Calculated Property |
| Pvap | 2641.37 | kPa | 598.00 | Calculated Property |
Similar Compounds
Find more compounds similar to 2-Propenoic acid, butyl ester.
Mixtures
- 1-Butanol, 3-methyl-, acetate + 2-Propenoic acid, butyl ester
- Benzene + 2-Propenoic acid, butyl ester
- Toluene + 2-Propenoic acid, butyl ester
- 2-Propenoic acid, butyl ester + o-Xylene
- Benzene, 1,3-dimethyl- + 2-Propenoic acid, butyl ester
- p-Xylene + 2-Propenoic acid, butyl ester
- 2-Propenoic acid, butyl ester + Mesitylene
- Methyl methacrylate + 2-Propenoic acid, butyl ester
- Toluene + Methyl methacrylate + 2-Propenoic acid, butyl ester
- Formamide, N,N-dimethyl- + 2-Propenoic acid, butyl ester
- N,N-Dimethylacetamide + 2-Propenoic acid, butyl ester
- Acetonitrile + 2-Propenoic acid, butyl ester
- 2-Propenoic acid, butyl ester + Tetrahydrofuran
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Crippen Method
- Volumetric Properties of 3-Methylbutyl Ethanoate with Ethyl Acrylate, Butyl Acrylate, Methyl Methacrylate, and Styrene at 25 C
- Volumetric, Viscometric, Ultrasonic, and Refractive Index Properties of Liquid Mixtures of Benzene with Industrially Important Monomers at Different Temperatures
- Densities and Volumetric Properties of Binary Mixtures of Butyl Acrylate with Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene at Temperatures from 288.15 K to 318.15 K
- Densities and volumes of mixing of the ternary system toluene + butyl acrylate + methyl methacrylate and its binaries at 298.15 K
- Ultrasonic velocities, densities, and excess molar volumes of binary mixtures of N,N-dimethyl formamide with methyl acrylate, or ethyl acrylate, or butyl acrylate, or 2-ethyl hexyl acrylate at T = 308.15 K
- Densities and volumetric properties of binary mixtures of N,N-dimethylformamide/N,N-dimethylacetamide with some alkyl acrylates at temperatures from 288.15 K to 318.15 K
- Densities and volumetric properties of (acetonitrile + alkyl acrylate monomer) binary mixtures at temperatures from 293.15 K to 318.15 K
- Temperature and concentration dependence of volumetric properties of (tetrahydrofuran + methyl acrylate, or + ethyl acrylate, or + n-butyl acrylate, or + tert-butyl acrylate) binary mixtures
- Critical Point and Vapor Pressure Measurements for 17 Compounds by a Low Residence Time Flow Method
- Thermophysical Properties of Three Compounds from the Acrylate Family
- Joback Method
- KDB
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.