- InChI
- InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3
- InChI Key
- KWOLFJPFCHCOCG-UHFFFAOYSA-N
- Formula
- C8H8O
- SMILES
- CC(=O)c1ccccc1
- Molecular Weight1
- 120.15
- CAS
- 98-86-2
- Other Names
-
- 1-Phenyl-1-ethanone
- 1-Phenylethanone
- 1-phenylethanone (acetophenone)
- Acetofenon
- Acetophenon
- Acetylbenzene
- Acetylbenzol
- Benzene, acetyl-
- Benzoyl methide
- Dymex
- Ethanone, 1-phenyl-
- Hypnon
- Hypnone
- Ketone, methyl phenyl-
- Methyl phenyl ketone
- NSC 7635
- Phenyl methyl ketone
- Phenylethanone
- Rcra waste number U004
- USAF EK-496
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- Tig : Autoignition Temperature (K).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- EA : Electron affinity (eV).
- Tflash,cc : Flash Point (Closed Cup Method) (K).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- S°gas : Molar entropy at standard conditions (J/mol×K).
- csound,fluid : Speed of sound in fluid (m/s).
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Pressure Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.4200 | KDB | |
| PAff | [861.10; 863.50] | kJ/mol |
|
| PAff | 861.10 | kJ/mol | NIST |
| PAff | 863.50 ± 0.50 | kJ/mol | NIST |
| Tig | 843.15 | K | KDB |
| BasG | 829.30 | kJ/mol | NIST |
| ΔcH°liquid | [-4148.90; -4136.00] | kJ/mol |
|
| ΔcH°liquid | -4140.00 | kJ/mol | NIST |
| ΔcH°liquid | -4148.90 ± 0.88 | kJ/mol | NIST |
| ΔcH°liquid | -4136.00 | kJ/mol | NIST |
| μ | 3.00 | debye | KDB |
| EA | [0.33; 2.55] | eV |
|
| EA | 0.33 ± 0.00 | eV | NIST |
| EA | 0.33 ± 0.00 | eV | NIST |
| EA | 2.55 ± 0.03 | eV | NIST |
| Tflash,cc | 355.37 | K | KDB |
| ΔfG° | 1.84 | kJ/mol | KDB |
| ΔfH°gas | [-86.92; -86.70] | kJ/mol |
|
| ΔfH°gas | -86.92 | kJ/mol | KDB |
| ΔfH°gas | -86.70 ± 1.70 | kJ/mol | NIST |
| ΔfH°liquid | -142.50 ± 1.00 | kJ/mol | NIST |
| ΔfusH° | 12.12 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [52.70; 57.90] | kJ/mol |
|
| ΔvapH° | 55.40 ± 0.40 | kJ/mol | NIST |
| ΔvapH° | 53.40 | kJ/mol | NIST |
| ΔvapH° | 52.70 | kJ/mol | NIST |
| ΔvapH° | 57.90 | kJ/mol | NIST |
| ΔvapH° | 55.90 ± 1.30 | kJ/mol | NIST |
| IE | [8.90; 9.60] | eV |
|
| IE | 9.28 ± 0.03 | eV | NIST |
| IE | 9.10 ± 0.10 | eV | NIST |
| IE | 9.28 | eV | NIST |
| IE | 9.45 | eV | NIST |
| IE | 9.10 ± 0.10 | eV | NIST |
| IE | 9.10 | eV | NIST |
| IE | 9.50 | eV | NIST |
| IE | 9.30 ± 0.20 | eV | NIST |
| IE | 9.15 ± 0.03 | eV | NIST |
| IE | 9.27 ± 0.03 | eV | NIST |
| IE | 9.60 | eV | NIST |
| IE | 9.38 | eV | NIST |
| IE | 9.51 | eV | NIST |
| IE | 9.51 | eV | NIST |
| IE | 9.45 | eV | NIST |
| IE | 9.45 | eV | NIST |
| IE | 9.35 | eV | NIST |
| IE | Outlier 8.90 | eV | NIST |
| IE | 9.37 | eV | NIST |
| log10WS | [-1.28; -1.28] |
|
|
| log10WS | -1.28 | Aq. Sol... | |
| log10WS | -1.28 | Estimat... | |
| logPoct/wat | 1.889 | Crippen Calculated Property | |
| McVol | 101.390 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 2 | KDB | |
| NFPA Health | 1 | KDB | |
| Pc | [4010.00; 4400.00] | kPa |
|
| Pc | 4060.00 | kPa | KDB |
| Pc | 4400.00 ± 150.00 | kPa | NIST |
| Pc | 4010.00 ± 30.00 | kPa | NIST |
| ρc | [311.18; 314.79] | kg/m3 |
|
| ρc | 314.79 ± 12.01 | kg/m3 | NIST |
| ρc | 311.18 ± 6.01 | kg/m3 | NIST |
| Inp | [173.00; 1094.00] |
|
|
| Inp | 1077.00 | NIST | |
| Inp | 1038.40 | NIST | |
| Inp | 1033.40 | NIST | |
| Inp | 1040.20 | NIST | |
| Inp | 1028.30 | NIST | |
| Inp | 1030.50 | NIST | |
| Inp | 1043.10 | NIST | |
| Inp | 1044.70 | NIST | |
| Inp | 1058.50 | NIST | |
| Inp | 1043.10 | NIST | |
| Inp | 1066.10 | NIST | |
| Inp | 1060.30 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1049.00 | NIST | |
| Inp | 1047.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1078.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1045.00 | NIST | |
| Inp | 1045.00 | NIST | |
| Inp | 1058.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1044.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1049.00 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1042.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1053.00 | NIST | |
| Inp | 1080.00 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1025.20 | NIST | |
| Inp | 1071.60 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1035.00 | NIST | |
| Inp | 1043.10 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1060.37 | NIST | |
| Inp | 1065.80 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1043.90 | NIST | |
| Inp | 1044.00 | NIST | |
| Inp | 1093.00 | NIST | |
| Inp | 1060.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1037.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1068.40 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1058.00 | NIST | |
| Inp | 1055.10 | NIST | |
| Inp | 1055.10 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1088.00 | NIST | |
| Inp | 1086.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1049.00 | NIST | |
| Inp | 1046.00 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1052.00 | NIST | |
| Inp | 1055.00 | NIST | |
| Inp | 1058.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1049.00 | NIST | |
| Inp | 1050.00 | NIST | |
| Inp | 1051.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1058.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1040.00 | NIST | |
| Inp | 1047.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1079.00 | NIST | |
| Inp | 1056.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1029.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1035.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1064.00 | NIST | |
| Inp | 1060.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1064.00 | NIST | |
| Inp | 1080.00 | NIST | |
| Inp | 1035.00 | NIST | |
| Inp | 1080.00 | NIST | |
| Inp | 1040.00 | NIST | |
| Inp | 1039.00 | NIST | |
| Inp | 1026.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1071.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1057.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1059.00 | NIST | |
| Inp | 1037.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1074.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1032.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1046.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1027.00 | NIST | |
| Inp | 1057.00 | NIST | |
| Inp | 1042.00 | NIST | |
| Inp | 1042.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1038.00 | NIST | |
| Inp | 1043.00 | NIST | |
| Inp | 1033.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1029.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1026.00 | NIST | |
| Inp | 1070.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1039.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1072.00 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1075.00 | NIST | |
| Inp | 1094.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1059.00 | NIST | |
| Inp | 1066.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1034.00 | NIST | |
| Inp | 1064.00 | NIST | |
| Inp | 1078.00 | NIST | |
| Inp | 1055.00 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1064.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1043.00 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1060.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1037.00 | NIST | |
| Inp | 1077.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1077.00 | NIST | |
| Inp | 1072.40 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1074.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1043.00 | NIST | |
| Inp | 1091.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1060.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1045.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 1045.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1038.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1032.00 | NIST | |
| Inp | 1056.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1026.00 | NIST | |
| Inp | 1027.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | Outlier 175.06 | NIST | |
| Inp | Outlier 176.57 | NIST | |
| Inp | Outlier 173.90 | NIST | |
| Inp | Outlier 173.00 | NIST | |
| Inp | Outlier 176.26 | NIST | |
| Inp | 1076.00 | NIST | |
| Inp | 1069.00 | NIST | |
| Inp | 1065.00 | NIST | |
| Inp | 1059.00 | NIST | |
| Inp | 1078.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1048.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1041.00 | NIST | |
| Inp | 1056.00 | NIST | |
| Inp | Outlier 175.06 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1063.00 | NIST | |
| I | [1600.00; 1695.00] |
|
|
| I | 1655.00 | NIST | |
| I | Outlier 1600.00 | NIST | |
| I | 1606.00 | NIST | |
| I | 1636.00 | NIST | |
| I | 1645.00 | NIST | |
| I | 1628.00 | NIST | |
| I | 1636.00 | NIST | |
| I | 1627.00 | NIST | |
| I | 1652.00 | NIST | |
| I | 1652.00 | NIST | |
| I | 1609.00 | NIST | |
| I | 1621.00 | NIST | |
| I | 1624.00 | NIST | |
| I | 1609.00 | NIST | |
| I | 1607.00 | NIST | |
| I | 1657.00 | NIST | |
| I | 1643.00 | NIST | |
| I | 1657.00 | NIST | |
| I | 1638.00 | NIST | |
| I | 1643.00 | NIST | |
| I | 1621.00 | NIST | |
| I | 1629.00 | NIST | |
| I | 1669.00 | NIST | |
| I | 1647.00 | NIST | |
| I | 1651.00 | NIST | |
| I | 1651.00 | NIST | |
| I | 1632.00 | NIST | |
| I | 1632.00 | NIST | |
| I | 1655.00 | NIST | |
| I | 1660.00 | NIST | |
| I | 1655.00 | NIST | |
| I | 1623.00 | NIST | |
| I | 1656.00 | NIST | |
| I | 1661.00 | NIST | |
| I | 1628.00 | NIST | |
| I | 1660.00 | NIST | |
| I | 1661.00 | NIST | |
| I | 1660.00 | NIST | |
| I | 1664.00 | NIST | |
| I | 1656.00 | NIST | |
| I | 1639.00 | NIST | |
| I | 1619.00 | NIST | |
| I | 1660.00 | NIST | |
| I | 1645.00 | NIST | |
| I | 1645.00 | NIST | |
| I | 1630.00 | NIST | |
| I | Outlier 1689.00 | NIST | |
| I | Outlier 1690.00 | NIST | |
| I | 1655.00 | NIST | |
| I | 1654.00 | NIST | |
| I | 1662.00 | NIST | |
| I | 1627.00 | NIST | |
| I | 1671.00 | NIST | |
| I | 1660.00 | NIST | |
| I | 1670.00 | NIST | |
| I | 1671.00 | NIST | |
| I | Outlier 1694.00 | NIST | |
| I | 1647.00 | NIST | |
| I | 1667.00 | NIST | |
| I | 1680.00 | NIST | |
| I | 1654.00 | NIST | |
| I | 1644.00 | NIST | |
| I | 1638.00 | NIST | |
| I | 1679.00 | NIST | |
| I | Outlier 1693.00 | NIST | |
| I | 1660.00 | NIST | |
| I | 1640.00 | NIST | |
| I | 1659.00 | NIST | |
| I | 1650.00 | NIST | |
| I | 1645.00 | NIST | |
| I | 1667.00 | NIST | |
| I | 1650.00 | NIST | |
| I | 1671.00 | NIST | |
| I | 1624.00 | NIST | |
| I | 1644.00 | NIST | |
| I | 1671.00 | NIST | |
| I | 1656.00 | NIST | |
| I | 1660.00 | NIST | |
| I | 1609.00 | NIST | |
| I | 1627.00 | NIST | |
| I | 1609.00 | NIST | |
| I | 1615.00 | NIST | |
| I | Outlier 1600.00 | NIST | |
| I | 1615.00 | NIST | |
| I | 1650.00 | NIST | |
| I | 1649.00 | NIST | |
| I | 1665.00 | NIST | |
| I | 1660.00 | NIST | |
| I | 1660.00 | NIST | |
| I | 1657.00 | NIST | |
| I | 1628.00 | NIST | |
| I | 1650.00 | NIST | |
| I | 1620.00 | NIST | |
| I | 1667.00 | NIST | |
| I | 1625.00 | NIST | |
| I | 1611.00 | NIST | |
| I | 1637.00 | NIST | |
| I | 1637.00 | NIST | |
| I | 1669.00 | NIST | |
| I | 1668.00 | NIST | |
| I | 1668.00 | NIST | |
| I | 1621.00 | NIST | |
| I | 1634.00 | NIST | |
| I | 1645.00 | NIST | |
| I | 1646.00 | NIST | |
| I | 1627.00 | NIST | |
| I | 1637.00 | NIST | |
| I | 1667.00 | NIST | |
| I | 1627.00 | NIST | |
| I | 1627.00 | NIST | |
| I | 1657.00 | NIST | |
| I | Outlier 1695.00 | NIST | |
| I | 1667.00 | NIST | |
| I | 1643.00 | NIST | |
| I | 1643.00 | NIST | |
| I | 1627.00 | NIST | |
| I | 1636.00 | NIST | |
| S°gas | 372.88 | J/mol×K | NIST |
| Tboil | [474.00; 475.80] | K |
|
| Tboil | 475.00 | K | KDB |
| Tboil | 475.10 | K | Ternary... |
| Tboil | 475.80 | K | NIST |
| Tboil | 475.00 | K | NIST |
| Tboil | 474.85 | K | NIST |
| Tboil | 475.15 ± 0.35 | K | NIST |
| Tboil | 475.15 ± 0.30 | K | NIST |
| Tboil | Outlier 474.00 ± 1.50 | K | NIST |
| Tboil | Outlier 474.00 ± 3.00 | K | NIST |
| Tboil | 475.20 ± 0.50 | K | NIST |
| Tboil | 475.20 ± 0.50 | K | NIST |
| Tboil | 475.15 ± 0.50 | K | NIST |
| Tboil | 474.65 ± 1.00 | K | NIST |
| Tboil | 475.15 ± 1.00 | K | NIST |
| Tc | [709.50; 713.00] | K |
|
| Tc | 709.50 | K | KDB |
| Tc | 713.00 ± 2.00 | K | NIST |
| Tc | 709.60 ± 1.00 | K | NIST |
| Tc | 709.50 ± 0.60 | K | NIST |
| Tfus | [292.65; 293.65] | K |
|
| Tfus | 292.88 | K | Aq. Sol... |
| Tfus | 293.00 | K | KDB |
| Tfus | 293.00 | K | NIST |
| Tfus | 292.85 | K | NIST |
| Tfus | 292.65 ± 1.50 | K | NIST |
| Tfus | 293.00 ± 2.00 | K | NIST |
| Tfus | 292.77 ± 0.06 | K | NIST |
| Tfus | 292.75 ± 0.30 | K | NIST |
| Tfus | 293.15 ± 1.50 | K | NIST |
| Tfus | Outlier 293.65 ± 0.60 | K | NIST |
| Vc | 0.386 | m3/kmol | KDB |
| Zc | 0.2656590 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [192.32; 252.40] | J/mol×K | [462.99; 684.79] |
|
| Cp,gas | 192.32 | J/mol×K | 462.99 | Joback Calculated Property |
| Cp,gas | 204.10 | J/mol×K | 499.96 | Joback Calculated Property |
| Cp,gas | 215.13 | J/mol×K | 536.92 | Joback Calculated Property |
| Cp,gas | 225.45 | J/mol×K | 573.89 | Joback Calculated Property |
| Cp,gas | 235.08 | J/mol×K | 610.86 | Joback Calculated Property |
| Cp,gas | 244.05 | J/mol×K | 647.82 | Joback Calculated Property |
| Cp,gas | 252.40 | J/mol×K | 684.79 | Joback Calculated Property |
| Cp,liquid | 227.60 | J/mol×K | 303.20 | NIST |
| η | [0.0011150; 0.0016800] | Pa×s | [298.15; 318.15] |
|
| η | 0.0016788 | Pa×s | 298.15 | Excess ... |
| η | 0.0016530 | Pa×s | 298.15 | Density... |
| η | 0.0016530 | Pa×s | 298.15 | Viscosi... |
| η | 0.0016800 | Pa×s | 298.15 | Densiti... |
| η | 0.0016740 | Pa×s | 298.15 | Density... |
| η | 0.0016788 | Pa×s | 298.15 | Density... |
| η | 0.0015400 | Pa×s | 303.15 | Densiti... |
| η | 0.0015328 | Pa×s | 303.15 | Density... |
| η | 0.0015328 | Pa×s | 303.15 | Excess ... |
| η | 0.0015080 | Pa×s | 303.15 | Density... |
| η | 0.0015180 | Pa×s | 303.15 | Densiti... |
| η | 0.0014110 | Pa×s | 308.15 | Density... |
| η | 0.0014120 | Pa×s | 308.15 | Viscosi... |
| η | 0.0014100 | Pa×s | 308.15 | Densiti... |
| η | 0.0014073 | Pa×s | 308.15 | Excess ... |
| η | 0.0013790 | Pa×s | 308.15 | Density... |
| η | 0.0013780 | Pa×s | 308.15 | Densiti... |
| η | 0.0014073 | Pa×s | 308.15 | Density... |
| η | 0.0012660 | Pa×s | 313.15 | Density... |
| η | 0.0012910 | Pa×s | 313.15 | Densiti... |
| η | 0.0013100 | Pa×s | 313.15 | Densiti... |
| η | 0.0011170 | Pa×s | 318.15 | Viscosi... |
| η | 0.0011150 | Pa×s | 318.15 | Density... |
| ΔfusH | 16.65 | kJ/mol | 292.70 | NIST |
| ΔvapH | [41.90; 52.60] | kJ/mol | [393.00; 489.00] |
|
| ΔvapH | 51.20 | kJ/mol | 393.00 | NIST |
| ΔvapH | 41.90 | kJ/mol | 410.00 | NIST |
| ΔvapH | 47.50 ± 0.30 | kJ/mol | 440.00 | NIST |
| ΔvapH | 45.00 ± 0.40 | kJ/mol | 440.00 | NIST |
| ΔvapH | 42.20 ± 0.40 | kJ/mol | 440.00 | NIST |
| ΔvapH | 52.60 ± 0.40 | kJ/mol | 440.00 | NIST |
| ΔvapH | 50.10 ± 0.30 | kJ/mol | 440.00 | NIST |
| ΔvapH | 49.70 | kJ/mol | 489.00 | NIST |
| Pvap | [0.34; 32.02] | kPa | [323.27; 433.15] |
|
| Pvap | 0.34 | kPa | 323.27 | Isother... |
| Pvap | 3.57 | kPa | 373.10 | Vapor-L... |
| Pvap | 32.02 | kPa | 433.15 | Vapor-L... |
| n0 | [1.53080; 1.53700] | [293.10; 298.15] |
|
|
| n0 | 1.53700 | 293.10 | Isobari... | |
| n0 | 1.53420 | 293.15 | Bubble ... | |
| n0 | 1.53360 | 293.15 | Densiti... | |
| n0 | 1.53360 | 293.15 | Densiti... | |
| n0 | 1.53700 | 295.15 | Isobari... | |
| n0 | 1.53420 | 298.15 | Activit... | |
| n0 | 1.53080 | 298.15 | Densiti... | |
| ρl | [1019.43; 1032.00] | kg/m3 | [288.00; 303.15] |
|
| ρl | 1032.00 | kg/m3 | 288.00 | KDB |
| ρl | 1027.90 | kg/m3 | 293.20 | Modelin... |
| ρl | 1023.00 | kg/m3 | 298.15 | Binary ... |
| ρl | 1023.05 | kg/m3 | 298.15 | Liquid ... |
| ρl | 1023.10 | kg/m3 | 298.15 | Ultraso... |
| ρl | 1023.00 | kg/m3 | 298.15 | Liquid-... |
| ρl | 1019.43 | kg/m3 | 303.15 | Excess ... |
| csound,fluid | 1445.00 | m/s | 308.15 | Ultraso... |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | 340.00 | K | 0.70 | NIST |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 308.15 | 101.30 | 0.0014 |
| Reference | ||
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 100.00 | 1023.4 |
| 298.15 | 10000.00 | 1029.0 |
| 298.15 | 15000.00 | 1031.7 |
| 298.15 | 20000.00 | 1034.3 |
| 298.15 | 25000.00 | 1036.8 |
| 298.15 | 30000.00 | 1039.3 |
| 298.15 | 35000.00 | 1041.8 |
| 298.15 | 40000.00 | 1044.4 |
| 298.15 | 45000.00 | 1046.7 |
| 298.15 | 50000.00 | 1049.0 |
| 318.15 | 100.00 | 1005.9 |
| 318.15 | 10000.00 | 1012.2 |
| 318.15 | 15000.00 | 1015.2 |
| 318.15 | 20000.00 | 1018.1 |
| 318.15 | 25000.00 | 1020.9 |
| 318.15 | 30000.00 | 1023.6 |
| 318.15 | 35000.00 | 1026.4 |
| 318.15 | 40000.00 | 1028.8 |
| 318.15 | 45000.00 | 1031.5 |
| 318.15 | 50000.00 | 1034.0 |
| 348.15 | 100.00 | 979.6 |
| 348.15 | 10000.00 | 987.1 |
| 348.15 | 15000.00 | 990.5 |
| 348.15 | 20000.00 | 993.6 |
| 348.15 | 25000.00 | 996.9 |
| 348.15 | 30000.00 | 1000.1 |
| 348.15 | 35000.00 | 1003.1 |
| 348.15 | 40000.00 | 1006.1 |
| 348.15 | 45000.00 | 1009.0 |
| 348.15 | 50000.00 | 1011.7 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [351.57; 505.30] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.50213e+01 | |||
| Coefficient B | -4.37766e+03 | |||
| Coefficient C | -5.44530e+01 | |||
| Temperature range, min. | 351.57 | |||
| Temperature range, max. | 505.30 | |||
| Pvap | 1.33 | kPa | 351.57 | Calculated Property |
| Pvap | 2.97 | kPa | 368.65 | Calculated Property |
| Pvap | 6.09 | kPa | 385.73 | Calculated Property |
| Pvap | 11.64 | kPa | 402.81 | Calculated Property |
| Pvap | 20.95 | kPa | 419.89 | Calculated Property |
| Pvap | 35.77 | kPa | 436.98 | Calculated Property |
| Pvap | 58.34 | kPa | 454.06 | Calculated Property |
| Pvap | 91.42 | kPa | 471.14 | Calculated Property |
| Pvap | 138.26 | kPa | 488.22 | Calculated Property |
| Pvap | 202.65 | kPa | 505.30 | Calculated Property |
| Pvap | [0.04; 3943.61] | kPa | [292.80; 705.68] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 7.19273e+01 | |||
| Coefficient B | -8.64835e+03 | |||
| Coefficient C | -8.08769e+00 | |||
| Coefficient D | 3.32623e-06 | |||
| Temperature range, min. | 292.80 | |||
| Temperature range, max. | 705.68 | |||
| Pvap | 0.04 | kPa | 292.80 | Calculated Property |
| Pvap | 0.71 | kPa | 338.68 | Calculated Property |
| Pvap | 6.00 | kPa | 384.55 | Calculated Property |
| Pvap | 29.99 | kPa | 430.43 | Calculated Property |
| Pvap | 105.16 | kPa | 476.30 | Calculated Property |
| Pvap | 286.95 | kPa | 522.18 | Calculated Property |
| Pvap | 653.38 | kPa | 568.05 | Calculated Property |
| Pvap | 1302.52 | kPa | 613.93 | Calculated Property |
| Pvap | 2352.02 | kPa | 659.80 | Calculated Property |
| Pvap | 3943.61 | kPa | 705.68 | Calculated Property |
Similar Compounds
Find more compounds similar to Acetophenone.
Mixtures
- 1,2-Ethanediol + Acetophenone
- Formamide, N,N-dimethyl- + Acetophenone
- Butanoic acid + Acetophenone + Water
- Decane + Acetophenone
- Dodecane + Acetophenone
- Acetophenone + Tetradecane
- Hexadecane + Acetophenone
- Ethylbenzene + Acetophenone
- Acetophenone + Acetamide, N-methyl-
- Acetonitrile + Acetophenone
- Diethyl carbonate + Acetophenone
- Acetophenone + 1-Hexanol
- Toluene + Acetophenone
- Acetophenone + 1-Pentanol
- Propene + Acetophenone
- Acetophenone + Phenol
- Benzene, 1-chloro-2-methyl- + Acetophenone
- Benzene, 1-chloro-3-methyl- + Acetophenone
- Acetophenone + Benzene, 1-chloro-4-methyl-
- Benzene, 1-methyl-2-nitro- + Acetophenone
Find more mixtures with Acetophenone.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Binary liquid liquid equilibrium in the systems containing monofunctional benzene derivates and 1,2-ethanediol
- Activity coefficients and excess Gibbs energy of binary mixtures of N,N-dimethyl formamide with selected compounds at 95.5 kPa
- Ternary phase diagrams for aqueous mixtures of butyric acid with several solvents: experimental and correlated data
- Modeling extraction equilibria of butyric acid distributed between water and tri-n-butyl amine/diluent or tri-n-butyl phosphate/diluent system: Extension of the LSER approach
- Liquid liquid equilibria for acetophenone + n-alkane mixtures and characterization of acetophenone systems using DISQUAC
- Liquid-liquid equilibria for the extraction of furfural from aqueous solution using different solvents
- Bubble temperature measurements on seven binary mixtures formed by ethylbenzene at 94.7 kPa
- Excess molar volumes of (acetophenone + benzene, or toluene, or 1,3-xylene, or 1,3,5-trimethylbenzene) at temperatures (298.15 and 328.15) K
- Density and viscosity of binary liquid systems of N-methylacetamide with aromatic ketones at T = 308.15 K
- Ultrasonic studies on binary mixtures of some aromatic ketones with acetonitrile at T = 308.15 K
- Densities and derived thermodynamic properties of binary mixtures of diethylcarbonate, acetophenone, and 1-hexanol at T = (293.15 to 323.15) K for the liquid region and at ambient pressure
- Excess parameter studies on the binary mixtures of toluene with ketones at different temperatures
- PVT properties for binary ionic liquids of 1-methyl-1-propylpiperidinium bis(trifluoromethylsulfonyl)imide with anisole or acetophenone at pressures up to 50 MPa
- P-V-T properties of binary mixtures of the ionic liquid 1-butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide with anisole or acetophenone at elevated pressures
- EXCESS MOLAR ENTHALPIES OF DIBROMOMETHANE WITH ACETONITRILE,FURAN AND ACETOPHENONE 303.15 K
- THERMODYNAMIC PROPERTIES OF DONOR ACCEPTOR COMPLEXES OF TERTIARY AMINE WITH ARYL KETONES IN HEXANE MEDIUM
- Densities and Viscosities of Binary Mixtures of N,N-Dimethylformamide with Benzyl Alcohol and Acetophenone at (298.15, 303.15, 308.15, and 313.15) K
- Isothermal Vapor-Liquid Equilibrium and Excess Enthalpy Data for the Binary Systems Water + 1,2-Ethanediol and Propene + Acetophenone
- Ultrasonic Studies of Binary Mixtures of Some Aromatic Ketones with N-Methyl-acetamide at 308.15 K
- Pressure-Volume-Temperature Properties for 1-Octanol + Acetophenone, Poly(Propylene Glycol) + 1-Octanol + Acetophenone, and Poly(Ethylene Glycol) + Poly(Ethylene Glycol Methyl Ether) + Anisole
- Vapor-Liquid Equilibria on Seven Binary Systems: Ethylene Oxide + 2-Methylpropane; Acetophenone + Phenol; cis-1,3-Dichloropropene + 1,2-Dichloropropane; 1,5-Hexadiene + Allyl Chloride; Isopropyl Acetate + Acetonitrile; Vinyl Chloride + Methyl Chloride; and 1,4-Butanediol + c-Butyrolactone
- Excess Volumes, Speeds of Sound, Isentropic Compressibilities, and Viscosities of Binary Mixtures of Acetophenone with Chlorotoluenes and Nitrotoluenes at 303.15 K
- Density, Viscosity, and Speed of Sound of (1-Octanol + 2-Methoxyethanol), (1-Octanol + N,N-Dimethylacetamide), and (1-Octanol + Acetophenone) at Temperatures of (298.15, 308.15, and 318.15) K
- Densities, Viscosities, and Refractive Indices of Binary Mixtures of Diethyl Oxalate with Some Ketones at (303.15, 308.15, and 313.15) K
- Liquid-Liquid Equilibrium in Ternary Systems Containing Ethylene Glycol, Monofunctional Benzene Derivative, and Ethyl Acetate
- Isobaric Vapor Liquid Equilibrium Data for the Binary Mixtures 2-Methyl Propan-2-ol with Tetraethoxysilane and 1-Phenyl Ethanone at 95.5 kPa
- Density and Viscosity of Binary Mixtures of n-Butyl Acetate with Ketones at (298.15, 303.15, 308.15, and 313.15) K
- Isobaric Vapor Liquid Equilibrium Data for Binary Mixtures of 1-Phenylethanone with a Few Alcohols at 95.2 kPa
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Liquid-Liquid Equilibrium for the Ternary System Water + Ethylbenzene + Acetophenone and Water + Ethylbenzene + 1-Phenylethanol
- Densities, Viscosities, Speeds of Sound, and Refractive Indices for Binary Mixtures of Diethylcarbonate, Acetophenone, and 1-Hexanol at (293.15, 303.15, 313.15, and 323.15) K for the Liquid Region and at Ambient Pressure
- Viscosity, Density, and Speed of Sound for the Binary Mixtures of Formamide with 2-Methoxyethanol, Acetophenone, Acetonitrile, 1,2-Dimethoxyethane, and Dimethylsulfoxide at Different Temperatures
- Diffusion Coefficients of Organic Compounds at Infinite Dilution in Mixtures Involving Associating Compounds. Experimental Determination and Modeling by Group Contribution Methods
- Excess Molar Enthalpies of Acetophenone + (Methanol, + Ethanol, + 1-Propanol, and + 2-Propanol) at Different Temperatures and Pressures
- Determination and Correlation of Excess Molar Enthalpies of Eight Binary Systems Containing Acetophenone at Different Temperatures
- Solubilities of Terephthalic Acid, Phthalic Acid, and Isophthalic Acid in Tetrahydrofuran, Cyclohexanone, 1,2-Diethoxyethane, and Acetophenone
- Density and Viscosity of Ketones with Toluene at Different Temperatures and at Atmospheric Pressure
- Densities, Viscosities, and Refractive Indices of Binary Mixtures of Acetophenone and 2-Alkanols
- Solubilities of 1,1?-(Propane-1,3-diyl)-bis(3-methyl-1H-imidazolium-1-yl) Dihexafluorophosphate in Different Solvents
- Solubility of 1,1'-(Butane-1,4-diyl)-bis(3-methyl-1H-imidazolium-1-yl) Dihexafluorophosphate in Water, Acetophenone, Cyclohexanone, Acetylacetone, and 2-Butanone
- Solubility of 1,1'-(Butane-1,4-diyl)-bis(3-methylpyridinium) Dihexafluorophosphate in Different Solvents from (288.15 to 333.15) K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.