Chemical Properties of 13,14-Dihydro-PGE2, MO-TMS, isomer # 1

13,14-Dihydro-PGE2, MO-TMS, isomer # 1

PDF Excel Molecule Calculator
InChI
InChI=1S/C30H61NO5Si3/c1-12-13-16-19-25(34-37(3,4)5)22-23-27-26(28(31-33-2)24-29(27)35-38(6,7)8)20-17-14-15-18-21-30(32)36-39(9,10)11/h14,17,25-27,29H,12-13,15-16,18-24H2,1-11H3/b17-14-,31-28?/t25-,26+,27+,29+/m1/s1
InChI Key
YYBVZVQKTPUOLR-ICGLSYABSA-N
Formula
C30H61NO5Si3
SMILES
CCCCCC(CCC1C(O[Si](C)(C)C)CC(=NOC)C1CC=CCCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C
Molecular Weight1
600.07
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry. Do not hesitate to contact us for your projects.

Physical Properties

Property Value Unit Source
log10WS -2.30 Crippen Calculated Property
logPoct/wat 8.920 Crippen Calculated Property
Inp 2706.00 NIST

Similar Compounds

13,14-Dihydro-PGE2, MO-TMS, isomer # 2. 13,14-Dihydro-15-keto-PGE2, MO-TMS, isomer # 1. 13,14-Dihydro-15-keto-PGE2, MO-TMS, isomer # 2. 13,14-Dihydro-PGE2, EO-TMS, isomer # 2. 13,14-Dihydro-PGE2, EO-TMS, isomer # 1. 13,14-Dihydro-15-keto-PGE2, EO-TMS, isomer # 4. 13,14-Dihydro-15-keto-PGE2, EO-TMS, isomer # 3. 13,14-Dihydro-15-keto-PGE2, EO-TMS, isomer # 1. 13,14-Dihydro-15-keto-PGE2, EO-TMS, isomer # 2. 13,14-Dihydro-PGE2, BO-TMS, isomer # 1. 13,14-Dihydro-PGE2, BO-TMS, isomer # 2. 13,14-Dihydro-15-keto-PGE2, BO-TMS, isomer # 3. 13,14-Dihydro-15-keto-PGE2, BO-TMS, isomer # 2. 13,14-Dihydro-15-keto-PGE2, BO-TMS, isomer # 1. 13,14-Dihydro-15-keto-PGE2, BO-TMS, isomer # 4.

Find more compounds similar to 13,14-Dihydro-PGE2, MO-TMS, isomer # 1.

Sources

Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.