- InChI
- InChI=1S/C8H11N/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3
- InChI Key
- JLTDJTHDQAWBAV-UHFFFAOYSA-N
- Formula
- C8H11N
- SMILES
- CN(C)c1ccccc1
- Molecular Weight1
- 121.18
- CAS
- 121-69-7
- Other Names
-
- (Dimethylamino)benzene
- Aniline, N,N-dimethyl-
- DIMETHYLPHENYLAMINE
- Dimethylaniline
- Dwumetyloanilina
- N,N-(Dimethylamino)benzene
- N,N-Dimethylaniline
- N,N-Dimethylbenzenamine
- N,N-Dimethylbenzeneamine
- N,N-Dimethylphenylamine
- N,N-dimethylanilin
- NCI-C56428
- NL 63-10P
- NSC 7195
- UN 2253
- Versneller NL 63/10
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- csound,fluid : Speed of sound in fluid (m/s).
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.4110 | KDB | |
| PAff | 941.10 | kJ/mol | NIST |
| BasG | 909.20 | kJ/mol | NIST |
| ΔcH°liquid | [-4767.80; -4754.30] | kJ/mol |
|
| ΔcH°liquid | -4767.80 ± 3.20 | kJ/mol | NIST |
| ΔcH°liquid | -4754.30 | kJ/mol | NIST |
| μ | 1.60 | debye | KDB |
| ΔfG° | 231.40 | kJ/mol | KDB |
| ΔfH°gas | [84.10; 100.50] | kJ/mol |
|
| ΔfH°gas | 84.15 | kJ/mol | KDB |
| ΔfH°gas | 100.50 ± 3.40 | kJ/mol | NIST |
| ΔfH°gas | 84.10 | kJ/mol | NIST |
| ΔfH°liquid | [34.00; 47.70] | kJ/mol |
|
| ΔfH°liquid | 47.70 ± 3.40 | kJ/mol | NIST |
| ΔfH°liquid | 34.00 | kJ/mol | NIST |
| ΔfusH° | 13.54 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 37.72 | kJ/mol | Joback Calculated Property |
| IE | [7.10; 7.92] | eV |
|
| IE | 7.12 ± 0.02 | eV | NIST |
| IE | 7.15 | eV | NIST |
| IE | 7.78 | eV | NIST |
| IE | 7.10 ± 0.02 | eV | NIST |
| IE | 7.42 | eV | NIST |
| IE | 7.11 | eV | NIST |
| IE | 7.13 ± 0.04 | eV | NIST |
| IE | 7.20 | eV | NIST |
| IE | 7.10 ± 0.05 | eV | NIST |
| IE | 7.31 | eV | NIST |
| IE | 7.20 | eV | NIST |
| IE | 7.14 ± 0.03 | eV | NIST |
| IE | 7.35 | eV | NIST |
| IE | Outlier 7.92 | eV | NIST |
| IE | 7.60 | eV | NIST |
| IE | 7.37 | eV | NIST |
| IE | 7.51 | eV | NIST |
| log10WS | [-1.92; -1.92] |
|
|
| log10WS | -1.92 | Aq. Sol... | |
| log10WS | -1.92 | Estimat... | |
| logPoct/wat | 1.753 | Crippen Calculated Property | |
| McVol | 109.800 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 2 | KDB | |
| NFPA Health | 3 | KDB | |
| Pc | [3576.77; 3657.83] | kPa |
|
| Pc | 3630.00 | kPa | KDB |
| Pc | 3610.00 ± 91.19 | kPa | NIST |
| Pc | 3650.00 ± 91.19 | kPa | NIST |
| Pc | 3597.04 ± 151.99 | kPa | NIST |
| Pc | 3627.44 ± 151.99 | kPa | NIST |
| Pc | 3657.83 ± 151.99 | kPa | NIST |
| Pc | 3637.57 ± 151.99 | kPa | NIST |
| Pc | 3576.77 ± 151.99 | kPa | NIST |
| Inp | [1061.00; 1104.00] |
|
|
| Inp | 1083.90 | NIST | |
| Inp | 1094.50 | NIST | |
| Inp | 1074.00 | NIST | |
| Inp | 1087.00 | NIST | |
| Inp | 1087.00 | NIST | |
| Inp | 1100.00 | NIST | |
| Inp | 1103.00 | NIST | |
| Inp | 1065.40 | NIST | |
| Inp | 1062.37 | NIST | |
| Inp | 1062.07 | NIST | |
| Inp | 1063.00 | NIST | |
| Inp | 1062.71 | NIST | |
| Inp | 1100.00 | NIST | |
| Inp | 1104.00 | NIST | |
| Inp | 1086.00 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1062.00 | NIST | |
| Inp | 1067.00 | NIST | |
| Inp | 1086.10 | NIST | |
| Inp | 1073.00 | NIST | |
| Inp | 1061.00 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1080.00 | NIST | |
| Inp | 1065.40 | NIST | |
| Inp | 1100.00 | NIST | |
| Inp | 1083.90 | NIST | |
| Inp | 1068.00 | NIST | |
| Inp | 1104.00 | NIST | |
| I | [1569.90; 1605.00] |
|
|
| I | 1569.90 | NIST | |
| I | 1602.00 | NIST | |
| I | 1599.00 | NIST | |
| I | 1603.00 | NIST | |
| I | 1605.00 | NIST | |
| I | 1604.80 | NIST | |
| I | 1603.40 | NIST | |
| I | 1574.00 | NIST | |
| I | 1569.90 | NIST | |
| I | 1604.80 | NIST | |
| I | 1574.00 | NIST | |
| Tboil | 467.30 | K | KDB |
| Tc | 687.00 | K | KDB |
| Tfus | [272.00; 275.75] | K |
|
| Tfus | 275.60 | K | KDB |
| Tfus | 275.53 | K | Aq. Sol... |
| Tfus | 275.65 ± 0.30 | K | NIST |
| Tfus | Outlier 272.00 ± 1.00 | K | NIST |
| Tfus | 275.60 ± 0.30 | K | NIST |
| Tfus | 275.36 ± 0.25 | K | NIST |
| Tfus | 275.75 ± 0.20 | K | NIST |
| Tfus | 275.35 ± 0.40 | K | NIST |
| Tfus | 274.60 ± 0.14 | K | NIST |
| Tfus | 274.15 ± 0.30 | K | NIST |
| Vc | 0.394 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [204.33; 276.52] | J/mol×K | [421.56; 628.44] |
|
| Cp,gas | 204.33 | J/mol×K | 421.56 | Joback Calculated Property |
| Cp,gas | 218.35 | J/mol×K | 456.04 | Joback Calculated Property |
| Cp,gas | 231.52 | J/mol×K | 490.52 | Joback Calculated Property |
| Cp,gas | 243.89 | J/mol×K | 525.00 | Joback Calculated Property |
| Cp,gas | 255.49 | J/mol×K | 559.48 | Joback Calculated Property |
| Cp,gas | 266.35 | J/mol×K | 593.96 | Joback Calculated Property |
| Cp,gas | 276.52 | J/mol×K | 628.44 | Joback Calculated Property |
| Cp,liquid | [209.60; 214.60] | J/mol×K | [283.00; 302.40] |
|
| Cp,liquid | 212.10 | J/mol×K | 283.00 | NIST |
| Cp,liquid | 209.60 | J/mol×K | 289.00 | NIST |
| Cp,liquid | 212.10 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 214.60 | J/mol×K | 302.30 | NIST |
| Cp,liquid | 214.60 | J/mol×K | 302.40 | NIST |
| η | [0.0008259; 0.0016960] | Pa×s | [283.15; 343.15] |
|
| η | 0.0016960 | Pa×s | 283.15 | Densiti... |
| η | 0.0014390 | Pa×s | 293.15 | Densiti... |
| η | 0.0011743 | Pa×s | 303.15 | Densiti... |
| η | 0.0011700 | Pa×s | 303.15 | Densiti... |
| η | 0.0009823 | Pa×s | 313.15 | Densiti... |
| η | 0.0009810 | Pa×s | 313.15 | Densiti... |
| η | 0.0008259 | Pa×s | 323.15 | Densiti... |
| η | 0.0009280 | Pa×s | 323.15 | Densiti... |
| η | 0.0009110 | Pa×s | 333.15 | Densiti... |
| η | 0.0008410 | Pa×s | 343.15 | Densiti... |
| ΔfusH | [11.56; 11.56] | kJ/mol | [275.60; 275.60] |
|
| ΔfusH | 11.56 | kJ/mol | 275.60 | NIST |
| ΔfusH | 11.56 | kJ/mol | 275.60 | NIST |
| ΔvapH | [44.35; 53.70] | kJ/mol | [303.50; 465.70] |
|
| ΔvapH | 53.70 ± 0.50 | kJ/mol | 303.50 | NIST |
| ΔvapH | 47.60 | kJ/mol | 384.50 | NIST |
| ΔvapH | 49.20 | kJ/mol | 390.50 | NIST |
| ΔvapH | 44.35 | kJ/mol | 465.70 | NIST |
| Pvap | [5.16; 8.04] | kPa | [373.70; 384.96] |
|
| Pvap | 5.16 | kPa | 373.70 | Vapor-L... |
| Pvap | 8.04 | kPa | 384.96 | Vapor-L... |
| ρl | [923.50; 960.60] | kg/m3 | [288.15; 333.15] |
|
| ρl | 960.60 | kg/m3 | 288.15 | Excess ... |
| ρl | 956.00 | kg/m3 | 293.00 | KDB |
| ρl | 956.50 | kg/m3 | 293.15 | Excess ... |
| ρl | 952.30 | kg/m3 | 298.15 | Excess ... |
| ρl | 952.05 | kg/m3 | 298.15 | Cloud P... |
| ρl | 947.70 | kg/m3 | 303.15 | Volumet... |
| ρl | 948.18 | kg/m3 | 303.15 | Study o... |
| ρl | 948.20 | kg/m3 | 303.15 | Excess ... |
| ρl | 944.10 | kg/m3 | 308.15 | Excess ... |
| ρl | 943.50 | kg/m3 | 308.15 | Volumet... |
| ρl | 943.55 | kg/m3 | 308.15 | Study o... |
| ρl | 939.40 | kg/m3 | 313.15 | Volumet... |
| ρl | 940.00 | kg/m3 | 313.15 | Excess ... |
| ρl | 939.78 | kg/m3 | 313.15 | Study o... |
| ρl | 935.30 | kg/m3 | 318.15 | Study o... |
| ρl | 935.90 | kg/m3 | 318.15 | Excess ... |
| ρl | 931.80 | kg/m3 | 323.15 | Excess ... |
| ρl | 931.45 | kg/m3 | 323.15 | Study o... |
| ρl | 927.70 | kg/m3 | 328.15 | Excess ... |
| ρl | 923.50 | kg/m3 | 333.15 | Excess ... |
| csound,fluid | [1393.00; 1468.00] | m/s | [303.15; 323.15] |
|
| csound,fluid | 1468.00 | m/s | 303.15 | Thermod... |
| csound,fluid | 1431.00 | m/s | 313.15 | Thermod... |
| csound,fluid | 1393.00 | m/s | 323.15 | Thermod... |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | 350.20 | K | 1.70 | NIST |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.63] | kPa | [342.92; 495.81] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.50960e+01 | |||
| Coefficient B | -4.40969e+03 | |||
| Coefficient C | -4.51330e+01 | |||
| Temperature range, min. | 342.92 | |||
| Temperature range, max. | 495.81 | |||
| Pvap | 1.33 | kPa | 342.92 | Calculated Property |
| Pvap | 2.97 | kPa | 359.91 | Calculated Property |
| Pvap | 6.08 | kPa | 376.90 | Calculated Property |
| Pvap | 11.61 | kPa | 393.88 | Calculated Property |
| Pvap | 20.88 | kPa | 410.87 | Calculated Property |
| Pvap | 35.67 | kPa | 427.86 | Calculated Property |
| Pvap | 58.20 | kPa | 444.85 | Calculated Property |
| Pvap | 91.25 | kPa | 461.83 | Calculated Property |
| Pvap | 138.12 | kPa | 478.82 | Calculated Property |
| Pvap | 202.63 | kPa | 495.81 | Calculated Property |
| Pvap | [0.02; 3612.43] | kPa | [275.60; 687.15] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 4.20032e+01 | |||
| Coefficient B | -7.05985e+03 | |||
| Coefficient C | -3.63909e+00 | |||
| Coefficient D | 4.98882e-07 | |||
| Temperature range, min. | 275.60 | |||
| Temperature range, max. | 687.15 | |||
| Pvap | 0.02 | kPa | 275.60 | Calculated Property |
| Pvap | 0.40 | kPa | 321.33 | Calculated Property |
| Pvap | 3.84 | kPa | 367.06 | Calculated Property |
| Pvap | 21.48 | kPa | 412.78 | Calculated Property |
| Pvap | 82.31 | kPa | 458.51 | Calculated Property |
| Pvap | 240.53 | kPa | 504.24 | Calculated Property |
| Pvap | 575.43 | kPa | 549.97 | Calculated Property |
| Pvap | 1183.22 | kPa | 595.69 | Calculated Property |
| Pvap | 2164.57 | kPa | 641.42 | Calculated Property |
| Pvap | 3612.43 | kPa | 687.15 | Calculated Property |
Similar Compounds
Find more compounds similar to Benzenamine, N,N-dimethyl-.
Mixtures
- Benzyl alcohol + Benzenamine, N,N-dimethyl-
- Benzenamine, N,N-dimethyl- + Thiophene, tetrahydro-, 1,1-dioxide
- Diisopropyl ether + Benzenamine, N,N-dimethyl-
- Benzenamine, N,N-dimethyl- + Tetrahydrofuran
- 2-Pyridinamine, 3-methyl- + Benzenamine, N,N-dimethyl-
- Benzenamine, N,N-dimethyl- + Propanoic acid
- Benzenamine, N,N-dimethyl- + Water
- Benzenamine, N,N-dimethyl- + 1-Hexanol
- Benzenamine, N,N-dimethyl- + 1,4-Dioxane
- Benzenamine, N,N-dimethyl- + 1-Hexanol + 1,4-Dioxane
- Benzenamine, N,N-dimethyl- + Dimethyl Sulfoxide
- n-Hexane + Benzenamine, N,N-dimethyl- + Acetophenone
- n-Hexane + Benzenamine, N,N-dimethyl- + Ethanone, 1-(4-chlorophenyl)-
- n-Hexane + Benzenamine, N,N-dimethyl- + Ethanone, 1-(4-methylphenyl)-
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Spectroscopic and ultrasonic studies on the molecular interaction of certain aromatic amines with p-chloranil
- Study on thermo physical properties of binary mixture containing aromatic alcohol with aromatic, substituted aromatic amines at different temperatures interms of FT-IR, 1H NMR spectroscopic and DFT method
- Volumetric and transport properties of binary liquid mixtures of sulfolane with aniline, N,N-dimethylaniline and N,N-diethylaniline at different temperatures and atmospheric pressure
- Excess molar volumes and viscosity behaviour of binary mixtures of aniline/or N,N-dimethylaniline with imidazolium ionic liquids having triflate or bistriflamide anion
- Thermodynamic and acoustic properties of binary mixtures of ethers. IV. Diisopropyl ether or oxolane with N,N-dimethylaniline or N,Ndiethylaniline at 303.15, 313.15 and 323.15 K
- THERMODYNAMIC PROPERTIES OF DONOR ACCEPTOR COMPLEXES OF TERTIARY AMINE WITH ARYL KETONES IN HEXANE MEDIUM
- Vapor-Liquid Equilibrium for the Binary System of N,N-Dimethylaniline with 2-Amino-3-methylpyridine
- Densities and Viscosities of Binary Mixtures of Propanoic Acid with N,N-Dimethylaniline and N,N-Diethylaniline at T = (303.15, 313.15, and 323.15) K
- Cloud Point Phenomena in the (Aniline or N,N-Dimethylaniline + Water) Solutions, and Cosolvent Effects of Liquid Poly(ethylene glycol) Addition: Experimental Measurements and Modeling
- Densities and Viscosities for Binary and Ternary Mixtures of 1, 4-Dioxane + 1-Hexanol + N,N-Dimethylaniline from T ) (283.15 to 343.15) K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.