- InChI
- InChI=1S/C3H6Cl2/c1-3(5)2-4/h3H,2H2,1H3
- InChI Key
- KNKRKFALVUDBJE-UHFFFAOYSA-N
- Formula
- C3H6Cl2
- SMILES
- CC(Cl)CCl
- Molecular Weight1
- 112.99
- CAS
- 78-87-5
- Other Names
-
- 1,2-Dichloropropane
- Bichlorure de propylene
- CH3CHClCH2Cl
- Dichloropropane
- Dwuchloropropan
- ENT 15,406
- NCI-C55141
- NSC 1237
- Propylene chloride
- Propylene dichloride
- R 270da
- Rcra waste number U083
- «alpha»,«beta»-dichloropropane
- «alpha»,«beta»-dichloropropane
- ω : Acentric Factor.
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.2400 | KDB | |
| ΔcH°liquid | -1883.20 ± 8.40 | kJ/mol | NIST |
| μ | 1.90 | debye | KDB |
| ΔfG° | -83.15 | kJ/mol | KDB |
| ΔfH°gas | [-166.00; -162.80] | kJ/mol |
|
| ΔfH°gas | -166.00 | kJ/mol | KDB |
| ΔfH°gas | -162.80 ± 1.20 | kJ/mol | NIST |
| ΔfusH° | 8.40 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [36.10; 38.40] | kJ/mol |
|
| ΔvapH° | 36.30 ± 0.50 | kJ/mol | NIST |
| ΔvapH° | 36.20 ± 0.10 | kJ/mol | NIST |
| ΔvapH° | 38.40 ± 0.30 | kJ/mol | NIST |
| ΔvapH° | 36.30 | kJ/mol | NIST |
| ΔvapH° | 36.10 ± 0.10 | kJ/mol | NIST |
| IE | [10.73; 11.06] | eV |
|
| IE | 10.80 ± 0.10 | eV | NIST |
| IE | 10.73 | eV | NIST |
| IE | 10.73 | eV | NIST |
| IE | 10.87 ± 0.05 | eV | NIST |
| IE | 11.06 | eV | NIST |
| log10WS | [-1.60; -1.60] |
|
|
| log10WS | -1.60 | Aq. Sol... | |
| log10WS | -1.60 | Estimat... | |
| logPoct/wat | 1.852 | Crippen Calculated Property | |
| McVol | 77.610 | ml/mol | McGowan Calculated Property |
| Pc | [4450.00; 4650.00] | kPa |
|
| Pc | 4450.00 | kPa | KDB |
| Pc | 4650.00 ± 150.00 | kPa | NIST |
| ρc | 390.03 ± 14.69 | kg/m3 | NIST |
| Inp | [667.00; 703.00] |
|
|
| Inp | 672.00 | NIST | |
| Inp | 700.00 | NIST | |
| Inp | 695.00 | NIST | |
| Inp | 688.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 674.00 | NIST | |
| Inp | 688.00 | NIST | |
| Inp | 688.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | 703.00 | NIST | |
| Inp | 670.00 | NIST | |
| Inp | 684.00 | NIST | |
| Inp | 667.00 | NIST | |
| Inp | 679.00 | NIST | |
| I | [1044.00; 1058.00] |
|
|
| I | 1058.00 | NIST | |
| I | 1044.00 | NIST | |
| Tboil | [368.75; 374.65] | K |
|
| Tboil | 369.50 | K | KDB |
| Tboil | 369.60 | K | NIST |
| Tboil | 368.86 ± 0.20 | K | NIST |
| Tboil | 369.55 | K | NIST |
| Tboil | 369.15 ± 2.00 | K | NIST |
| Tboil | 369.15 ± 2.00 | K | NIST |
| Tboil | 370.55 ± 0.50 | K | NIST |
| Tboil | 371.15 ± 6.00 | K | NIST |
| Tboil | 369.15 ± 1.00 | K | NIST |
| Tboil | 369.30 ± 0.50 | K | NIST |
| Tboil | 369.70 ± 0.30 | K | NIST |
| Tboil | 369.35 ± 0.07 | K | NIST |
| Tboil | 371.15 ± 0.70 | K | NIST |
| Tboil | 369.95 ± 0.60 | K | NIST |
| Tboil | 370.20 ± 1.00 | K | NIST |
| Tboil | 369.95 ± 0.50 | K | NIST |
| Tboil | 368.75 ± 0.60 | K | NIST |
| Tboil | 370.65 ± 2.00 | K | NIST |
| Tboil | 369.95 ± 0.50 | K | NIST |
| Tboil | 369.65 ± 0.40 | K | NIST |
| Tboil | 368.80 ± 2.50 | K | NIST |
| Tboil | 369.95 ± 0.50 | K | NIST |
| Tboil | 369.97 ± 0.40 | K | NIST |
| Tboil | Outlier 374.65 ± 6.00 | K | NIST |
| Tc | [577.00; 578.00] | K |
|
| Tc | 577.00 | K | KDB |
| Tc | 578.00 ± 3.00 | K | NIST |
| Tfus | [172.62; 172.75] | K |
|
| Tfus | 172.70 | K | KDB |
| Tfus | 172.75 | K | NIST |
| Tfus | 172.62 ± 0.02 | K | NIST |
| Tfus | 172.73 ± 0.05 | K | NIST |
| Vc | 0.226 | m3/kmol | KDB |
| Zc | 0.2096310 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [110.03; 142.30] | J/mol×K | [342.46; 529.32] |
|
| Cp,gas | 110.03 | J/mol×K | 342.46 | Joback Calculated Property |
| Cp,gas | 116.04 | J/mol×K | 373.60 | Joback Calculated Property |
| Cp,gas | 121.79 | J/mol×K | 404.75 | Joback Calculated Property |
| Cp,gas | 127.29 | J/mol×K | 435.89 | Joback Calculated Property |
| Cp,gas | 132.53 | J/mol×K | 467.03 | Joback Calculated Property |
| Cp,gas | 137.54 | J/mol×K | 498.18 | Joback Calculated Property |
| Cp,gas | 142.30 | J/mol×K | 529.32 | Joback Calculated Property |
| Cp,liquid | [152.99; 162.80] | J/mol×K | [268.30; 339.77] |
|
| Cp,liquid | 153.32 | J/mol×K | 268.30 | Heat ca... |
| Cp,liquid | 152.99 | J/mol×K | 268.30 | Heat ca... |
| Cp,liquid | 154.15 | J/mol×K | 278.51 | Heat ca... |
| Cp,liquid | 153.90 | J/mol×K | 278.51 | Heat ca... |
| Cp,liquid | 155.40 | J/mol×K | 288.72 | Heat ca... |
| Cp,liquid | 155.15 | J/mol×K | 288.72 | Heat ca... |
| Cp,liquid | 154.40 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 156.64 | J/mol×K | 298.93 | Heat ca... |
| Cp,liquid | 156.81 | J/mol×K | 298.93 | Heat ca... |
| Cp,liquid | 157.73 | J/mol×K | 309.14 | Heat ca... |
| Cp,liquid | 158.06 | J/mol×K | 309.14 | Heat ca... |
| Cp,liquid | 159.22 | J/mol×K | 319.35 | Heat ca... |
| Cp,liquid | 159.39 | J/mol×K | 319.35 | Heat ca... |
| Cp,liquid | 161.05 | J/mol×K | 329.56 | Heat ca... |
| Cp,liquid | 161.22 | J/mol×K | 329.56 | Heat ca... |
| Cp,liquid | 162.80 | J/mol×K | 339.77 | Heat ca... |
| Cp,liquid | 162.80 | J/mol×K | 339.77 | Heat ca... |
| η | [0.0003384; 0.0063844] | Pa×s | [168.41; 342.46] |
|
| η | 0.0063844 | Pa×s | 168.41 | Joback Calculated Property |
| η | 0.0027307 | Pa×s | 197.42 | Joback Calculated Property |
| η | 0.0014519 | Pa×s | 226.43 | Joback Calculated Property |
| η | 0.0008911 | Pa×s | 255.44 | Joback Calculated Property |
| η | 0.0006042 | Pa×s | 284.44 | Joback Calculated Property |
| η | 0.0004402 | Pa×s | 313.45 | Joback Calculated Property |
| η | 0.0003384 | Pa×s | 342.46 | Joback Calculated Property |
| ΔfusH | [6.40; 6.40] | kJ/mol | [172.70; 172.70] |
|
| ΔfusH | 6.40 | kJ/mol | 172.70 | NIST |
| ΔfusH | 6.40 | kJ/mol | 172.70 | NIST |
| ΔvapH | [31.38; 39.40] | kJ/mol | [306.00; 369.50] |
|
| ΔvapH | 39.40 | kJ/mol | 306.00 | NIST |
| ΔvapH | 34.30 | kJ/mol | 330.50 | NIST |
| ΔvapH | 34.70 | kJ/mol | 345.00 | NIST |
| ΔvapH | 31.38 | kJ/mol | 369.50 | KDB |
| Pvap | [30.14; 61.07] | kPa | [333.15; 353.15] |
|
| Pvap | 30.14 | kPa | 333.15 | Vapor-L... |
| Pvap | 61.07 | kPa | 353.15 | Vapor-L... |
| n0 | [1.43653; 1.43830] | [293.10; 298.15] |
|
|
| n0 | 1.43830 | 293.10 | Vapor-L... | |
| n0 | 1.43656 | 298.15 | Excess ... | |
| n0 | 1.43656 | 298.15 | Excess ... | |
| n0 | 1.43653 | 298.15 | Excess ... | |
| ρl | [1149.10; 1150.00] | kg/m3 | [293.00; 298.15] |
|
| ρl | 1150.00 | kg/m3 | 293.00 | KDB |
| ρl | 1149.10 | kg/m3 | 298.15 | Speed o... |
| γ | 0.03 | N/m | 293.20 | KDB |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [267.39; 395.39] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.45124e+01 | |||
| Coefficient B | -3.33468e+03 | |||
| Coefficient C | -3.29610e+01 | |||
| Temperature range, min. | 267.39 | |||
| Temperature range, max. | 395.39 | |||
| Pvap | 1.33 | kPa | 267.39 | Calculated Property |
| Pvap | 3.01 | kPa | 281.61 | Calculated Property |
| Pvap | 6.21 | kPa | 295.83 | Calculated Property |
| Pvap | 11.92 | kPa | 310.06 | Calculated Property |
| Pvap | 21.45 | kPa | 324.28 | Calculated Property |
| Pvap | 36.54 | kPa | 338.50 | Calculated Property |
| Pvap | 59.37 | kPa | 352.72 | Calculated Property |
| Pvap | 92.56 | kPa | 366.95 | Calculated Property |
| Pvap | 139.17 | kPa | 381.17 | Calculated Property |
| Pvap | 202.65 | kPa | 395.39 | Calculated Property |
| Pvap | [8.27e-05; 4448.01] | kPa | [172.71; 577.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 5.79698e+01 | |||
| Coefficient B | -5.98019e+03 | |||
| Coefficient C | -6.37968e+00 | |||
| Coefficient D | 4.07190e-06 | |||
| Temperature range, min. | 172.71 | |||
| Temperature range, max. | 577.00 | |||
| Pvap | 8.27e-05 | kPa | 172.71 | Calculated Property |
| Pvap | 0.03 | kPa | 217.63 | Calculated Property |
| Pvap | 0.94 | kPa | 262.55 | Calculated Property |
| Pvap | 10.59 | kPa | 307.47 | Calculated Property |
| Pvap | 59.75 | kPa | 352.39 | Calculated Property |
| Pvap | 217.13 | kPa | 397.32 | Calculated Property |
| Pvap | 589.68 | kPa | 442.24 | Calculated Property |
| Pvap | 1312.00 | kPa | 487.16 | Calculated Property |
| Pvap | 2538.71 | kPa | 532.08 | Calculated Property |
| Pvap | 4448.01 | kPa | 577.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Propane, 1,2-dichloro-.
Mixtures
- Propane, 1,2-dichloro- + Ethanol, 2-(2-propoxyethoxy)-
- Propane, 1,2-dichloro- + Ethanol, 2-(2-butoxyethoxy)-
- Propane, 1,2-dichloro- + Ethanol, 2-[2-(2-methoxyethoxy)ethoxy]-
- Propane, 1,2-dichloro- + Ethanol, 2-[2-(2-ethoxyethoxy)ethoxy]-
- Propane, 1,2-dichloro- + Ethanol, 2-[2-(2-butoxyethoxy)ethoxy]-
- Propane, 1,2-dichloro- + Acetic acid, methyl ester
- Propane, 1,2-dichloro- + Methyl propionate
- Butanoic acid, methyl ester + Propane, 1,2-dichloro-
- Acetic acid, pentyl ester + Propane, 1,2-dichloro-
- 2-Ethoxyethyl acetate + Propane, 1,2-dichloro-
- Propane, 1,2-dichloro- + 2-Butoxyethyl acetate
- Benzene + Propane, 1,2-dichloro-
- Propane, 1,2-dichloro- + Cyclohexane
- Propane, 1,2-dichloro- + Butane, 2,2-dimethyl-
- n-Hexane + Propane, 1,2-dichloro-
- Propane, 1,2-dichloro- + Heptane
- Propane, 1,2-dichloro- + 1-Propene, 1,3-dichloro-, (Z)-
- Propane, 1,2-dichloro- + Bis(2-chloroisopropyl) ether
- 2-Propanol, 1-chloro- + Propane, 1,2-dichloro-
- Propane, 1,2-dichloro- + Pyridine
Find more mixtures with Propane, 1,2-dichloro-.
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Excess molar volumes and excess molar enthalpies of the binary mixtures of 1,2-dichloropropane with di- and triethylene glycol mono-alkyl ethers at T=298.15K
- Excess molar volumes and excess molar enthalpies for binary mixtures of 1,2-dichloropropane with methyl ethanoate, methyl propanoate, and methyl butanoate at T = 298.15K
- Heat capacities of selected chlorohydrocarbons
- Abraham model linear free energy relationships for describing the partitioning and solubility behavior of nonelectrolyte organic solutes dissolved in pyridine at 298.15 K
- Speed of sound as a function of temperature and pressure for propane derivatives
- Abraham model correlations for describing the thermodynamic properties of solute transfer into pentyl acetate based on headspace chromatographic and solubility measurements
- Excess molar volumes and excess molar enthalpies of binary mixtures for 1,2-dichloropropane + 2-alkoxyethanol acetates at 298.15K
- The Critical Temperatures of a Number of (i) (Chloroalkane (C3 C4) + Hydrocarbon (C6 C7)) Binary Mixtures and (ii) (Aromatic Halocarbon (Chlorobenzene, Fluorobenzene, 1,2-Dichlorobenzene, or 1,3-Dichlorobenzene) + Alkane (C8)) Binary Mixtures
- Vapor-Liquid Equilibria on Seven Binary Systems: Ethylene Oxide + 2-Methylpropane; Acetophenone + Phenol; cis-1,3-Dichloropropene + 1,2-Dichloropropane; 1,5-Hexadiene + Allyl Chloride; Isopropyl Acetate + Acetonitrile; Vinyl Chloride + Methyl Chloride; and 1,4-Butanediol + c-Butyrolactone
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Vapor-Liquid Equilibria of Selected Components in Propylene Oxide Production
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.