- InChI
- InChI=1S/C7H7NO/c1-6(9)7-4-2-3-5-8-7/h2-5H,1H3
- InChI Key
- AJKVQEKCUACUMD-UHFFFAOYSA-N
- Formula
- C7H7NO
- SMILES
- CC(=O)c1ccccn1
- Molecular Weight1
- 121.14
- CAS
- 1122-62-9
- Other Names
-
- Ketone, methyl 2-pyridyl
- Methyl 2-pyridyl ketone
- 2-Acetylpyridine
- 2-Pyridyl methyl ketone
- 2-Acetopyridine
- Acetyl pyridine
- 1-(2-pyridinyl)ethanone
- 2-AcetyIpyridine
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- Tboil : Normal Boiling Point Temperature (K).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔvapH° | 60.50 ± 0.30 | kJ/mol | NIST |
| IE | [8.90; 9.35] | eV |
|
| IE | 8.90 | eV | NIST |
| IE | 9.35 | eV | NIST |
| log10WS | -1.90 | Crippen Calculated Property | |
| logPoct/wat | 1.284 | Crippen Calculated Property | |
| McVol | 97.280 | ml/mol | McGowan Calculated Property |
| Inp | [991.00; 1057.00] |
|
|
| Inp | 999.00 | NIST | |
| Inp | 1057.00 | NIST | |
| Inp | 1001.00 | NIST | |
| Inp | 1026.00 | NIST | |
| Inp | 1026.00 | NIST | |
| Inp | 1050.00 | NIST | |
| Inp | 1030.00 | NIST | |
| Inp | 998.00 | NIST | |
| Inp | 1034.00 | NIST | |
| Inp | 1045.00 | NIST | |
| Inp | 1034.80 | NIST | |
| Inp | 1046.00 | NIST | |
| Inp | 1036.00 | NIST | |
| Inp | 1018.00 | NIST | |
| Inp | 1005.00 | NIST | |
| Inp | 1014.00 | NIST | |
| Inp | 991.00 | NIST | |
| Inp | 993.00 | NIST | |
| Inp | 998.00 | NIST | |
| Inp | 998.00 | NIST | |
| Inp | 1010.00 | NIST | |
| Inp | 1011.00 | NIST | |
| Inp | 1032.00 | NIST | |
| Inp | 1031.00 | NIST | |
| Inp | 1014.00 | NIST | |
| Inp | 999.00 | NIST | |
| Inp | 1032.00 | NIST | |
| Inp | 1050.00 | NIST | |
| I | [1552.00; 1618.00] |
|
|
| I | 1608.00 | NIST | |
| I | 1618.00 | NIST | |
| I | 1608.00 | NIST | |
| I | 1608.00 | NIST | |
| I | 1590.00 | NIST | |
| I | 1586.00 | NIST | |
| I | 1603.00 | NIST | |
| I | 1603.00 | NIST | |
| I | 1597.00 | NIST | |
| I | 1602.00 | NIST | |
| I | 1587.00 | NIST | |
| I | 1615.00 | NIST | |
| I | 1597.00 | NIST | |
| I | 1599.00 | NIST | |
| I | 1600.00 | NIST | |
| I | 1567.00 | NIST | |
| I | 1580.00 | NIST | |
| I | 1587.00 | NIST | |
| I | 1590.00 | NIST | |
| I | Outlier 1552.00 | NIST | |
| I | 1618.00 | NIST | |
| I | 1599.00 | NIST | |
| I | 1600.00 | NIST | |
| I | 1560.00 | NIST | |
| I | 1585.00 | NIST | |
| I | 1585.00 | NIST | |
| I | 1586.00 | NIST | |
| I | 1587.00 | NIST | |
| I | 1588.00 | NIST | |
| I | 1602.00 | NIST | |
| I | Outlier 1552.00 | NIST | |
| I | 1585.00 | NIST | |
| I | 1587.00 | NIST | |
| I | 1567.00 | NIST | |
| I | 1618.00 | NIST | |
| Tboil | [461.70; 465.20] | K |
|
| Tboil | 461.70 | K | NIST |
| Tboil | 465.20 | K | NIST |
| Tboil | 465.00 | K | NIST |
Similar Compounds
Find more compounds similar to Ethanone, 1-(2-pyridinyl)-.
Sources
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.