- InChI
- InChI=1S/C3H7Br/c1-3(2)4/h3H,1-2H3
- InChI Key
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N
- Formula
- C3H7Br
- SMILES
- CC(C)Br
- Molecular Weight1
- 122.99
- CAS
- 75-26-3
- Other Names
-
- 2-Bromopropane
- ISOPROPYL BROMIDE
- SEC-PROPYL BROMIDE
- UN 2344
- iso-C3H7Br
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- Inp : Non-polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ΔcH°liquid | -2051.90 ± 1.80 | kJ/mol | NIST |
| ΔfG° | -13.74 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | [-98.50; -95.60] | kJ/mol |
|
| ΔfH°gas | -95.60 ± 1.00 | kJ/mol | NIST |
| ΔfH°gas | -98.50 ± 1.90 | kJ/mol | NIST |
| ΔfH°gas | -98.50 ± 1.90 | kJ/mol | NIST |
| ΔfH°liquid | [-129.10; -129.00] | kJ/mol |
|
| ΔfH°liquid | -129.00 | kJ/mol | NIST |
| ΔfH°liquid | -129.10 ± 1.80 | kJ/mol | NIST |
| ΔfusH° | 5.29 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [30.20; 30.60] | kJ/mol |
|
| ΔvapH° | 30.33 | kJ/mol | NIST |
| ΔvapH° | 30.60 | kJ/mol | NIST |
| ΔvapH° | 30.20 ± 0.10 | kJ/mol | NIST |
| ΔvapH° | 30.20 ± 0.08 | kJ/mol | NIST |
| IE | [10.07; 10.40] | eV |
|
| IE | 10.10 ± 0.02 | eV | NIST |
| IE | 10.13 | eV | NIST |
| IE | 10.12 | eV | NIST |
| IE | 10.07 | eV | NIST |
| IE | Outlier 10.40 ± 0.10 | eV | NIST |
| IE | 10.12 ± 0.01 | eV | NIST |
| IE | 10.08 ± 0.01 | eV | NIST |
| log10WS | [-1.59; -1.59] |
|
|
| log10WS | -1.59 | Aq. Sol... | |
| log10WS | -1.59 | Estimat... | |
| logPoct/wat | 1.790 | Crippen Calculated Property | |
| McVol | 70.630 | ml/mol | McGowan Calculated Property |
| Pc | 4897.06 | kPa | Joback Calculated Property |
| Inp | [554.00; 591.00] |
|
|
| Inp | 554.00 | NIST | |
| Inp | 558.00 | NIST | |
| Inp | 562.00 | NIST | |
| Inp | 565.00 | NIST | |
| Inp | 582.00 | NIST | |
| Inp | 583.00 | NIST | |
| Inp | 591.00 | NIST | |
| Inp | 571.00 | NIST | |
| Inp | 565.00 | NIST | |
| Inp | 591.00 | NIST | |
| Inp | 554.00 | NIST | |
| Inp | 583.00 | NIST | |
| Inp | 571.00 | NIST | |
| Tboil | [332.00; 334.70] | K |
|
| Tboil | 332.50 | K | KDB |
| Tboil | 332.60 | K | NIST |
| Tboil | 332.60 | K | NIST |
| Tboil | 332.50 ± 0.50 | K | NIST |
| Tboil | 332.60 ± 0.50 | K | NIST |
| Tboil | 332.61 ± 0.20 | K | NIST |
| Tboil | 332.00 ± 2.00 | K | NIST |
| Tboil | 332.70 ± 0.30 | K | NIST |
| Tboil | 332.60 ± 0.60 | K | NIST |
| Tboil | 332.80 ± 0.50 | K | NIST |
| Tboil | 332.32 ± 0.20 | K | NIST |
| Tboil | 332.65 ± 0.60 | K | NIST |
| Tboil | 333.00 ± 0.50 | K | NIST |
| Tboil | 332.60 ± 0.15 | K | NIST |
| Tboil | Outlier 334.70 ± 0.80 | K | NIST |
| Tboil | Outlier 334.65 ± 2.00 | K | NIST |
| Tc | 532.00 | K | NIST |
| Tfus | [184.05; 184.55] | K |
|
| Tfus | 184.15 | K | KDB |
| Tfus | 184.20 ± 0.30 | K | NIST |
| Tfus | 184.55 ± 0.50 | K | NIST |
| Tfus | 184.05 ± 0.50 | K | NIST |
| Vc | 0.260 | m3/kmol | Joback Calculated Property |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [96.11; 130.79] | J/mol×K | [333.76; 524.35] |
|
|
T(K) Ideal gas heat capacity (J/mol×K) 95 100 105 110 115 120 125 130 350 400 450 500 | ||||
| Cp,gas | 96.11 | J/mol×K | 333.76 | Joback Calculated Property |
| Cp,gas | 102.61 | J/mol×K | 365.53 | Joback Calculated Property |
| Cp,gas | 108.81 | J/mol×K | 397.29 | Joback Calculated Property |
| Cp,gas | 114.71 | J/mol×K | 429.06 | Joback Calculated Property |
| Cp,gas | 120.34 | J/mol×K | 460.82 | Joback Calculated Property |
| Cp,gas | 125.69 | J/mol×K | 492.59 | Joback Calculated Property |
| Cp,gas | 130.79 | J/mol×K | 524.35 | Joback Calculated Property |
| Cp,liquid | [126.80; 135.60] | J/mol×K | [209.60; 298.15] |
|
| Cp,liquid | 126.80 | J/mol×K | 209.60 | NIST |
| Cp,liquid | 132.20 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 135.60 | J/mol×K | 298.15 | NIST |
| η | [0.0004194; 0.0004981] | Pa×s | [298.15; 318.15] |
|
|
T(K) Dynamic viscosity (Pa×s) 4.20e-4 4.40e-4 4.60e-4 4.80e-4 5.00e-4 300 305 310 315 | ||||
| η | 0.0004981 | Pa×s | 298.15 | Measure... |
| η | 0.0004835 | Pa×s | 303.15 | Measure... |
| η | 0.0004708 | Pa×s | 308.15 | Measure... |
| η | 0.0004389 | Pa×s | 313.15 | Measure... |
| η | 0.0004194 | Pa×s | 318.15 | Measure... |
| ΔfusH | [6.53; 6.55] | kJ/mol | [184.10; 184.10] |
|
| ΔfusH | 6.53 | kJ/mol | 184.10 | NIST |
| ΔfusH | 6.55 | kJ/mol | 184.10 | NIST |
| ΔfusH | 6.53 | kJ/mol | 184.10 | NIST |
| ΔvapH | [28.00; 33.40] | kJ/mol | [272.00; 338.00] |
|
|
T(K) Enthalpy of vaporization at a given temperature (kJ/mol) 28 29 30 31 32 33 280 300 320 | ||||
| ΔvapH | 33.40 | kJ/mol | 272.00 | NIST |
| ΔvapH | 32.10 | kJ/mol | 282.00 | NIST |
| ΔvapH | 30.90 | kJ/mol | 288.00 | NIST |
| ΔvapH | 29.80 ± 0.10 | kJ/mol | 305.00 | NIST |
| ΔvapH | 30.10 | kJ/mol | 315.50 | NIST |
| ΔvapH | 29.20 ± 0.10 | kJ/mol | 318.00 | NIST |
| ΔvapH | 28.50 ± 0.10 | kJ/mol | 330.00 | NIST |
| ΔvapH | 28.40 | kJ/mol | 331.60 | NIST |
| ΔvapH | 28.33 | kJ/mol | 332.60 | NIST |
| ΔvapH | 28.00 ± 0.10 | kJ/mol | 338.00 | NIST |
| ΔfusS | 35.50 | J/mol×K | 184.10 | NIST |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [241.05; 355.61] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.46798e+01 | |||
| Coefficient B | -3.07460e+03 | |||
| Coefficient C | -2.74180e+01 | |||
| Temperature range, min. | 241.05 | |||
| Temperature range, max. | 355.61 | |||
|
T(K) Vapor pressure (kPa) 0 50 100 150 200 250 300 350 | ||||
| Pvap | 1.33 | kPa | 241.05 | Calculated Property |
| Pvap | 3.00 | kPa | 253.78 | Calculated Property |
| Pvap | 6.17 | kPa | 266.51 | Calculated Property |
| Pvap | 11.82 | kPa | 279.24 | Calculated Property |
| Pvap | 21.28 | kPa | 291.97 | Calculated Property |
| Pvap | 36.28 | kPa | 304.69 | Calculated Property |
| Pvap | 59.02 | kPa | 317.42 | Calculated Property |
| Pvap | 92.17 | kPa | 330.15 | Calculated Property |
| Pvap | 138.86 | kPa | 342.88 | Calculated Property |
| Pvap | 202.65 | kPa | 355.61 | Calculated Property |
| Pvap | [7.07e-03; 5517.06] | kPa | [184.15; 532.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 7.00355e+01 | |||
| Coefficient B | -5.73559e+03 | |||
| Coefficient C | -8.46248e+00 | |||
| Coefficient D | 8.75295e-06 | |||
| Temperature range, min. | 184.15 | |||
| Temperature range, max. | 532.00 | |||
|
T(K) Vapor pressure (kPa) 0 1000 2000 3000 4000 5000 6000 200 300 400 500 | ||||
| Pvap | 7.07e-03 | kPa | 184.15 | Calculated Property |
| Pvap | 0.36 | kPa | 222.80 | Calculated Property |
| Pvap | 4.91 | kPa | 261.45 | Calculated Property |
| Pvap | 31.20 | kPa | 300.10 | Calculated Property |
| Pvap | 122.99 | kPa | 338.75 | Calculated Property |
| Pvap | 355.68 | kPa | 377.40 | Calculated Property |
| Pvap | 836.47 | kPa | 416.05 | Calculated Property |
| Pvap | 1709.28 | kPa | 454.70 | Calculated Property |
| Pvap | 3172.84 | kPa | 493.35 | Calculated Property |
| Pvap | 5517.06 | kPa | 532.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Propane, 2-bromo-.
Mixtures
- Propane, 2-bromo- + Acetic acid, pentyl ester
- Propane, 2-bromo- + Ethanol
- Propane, 2-bromo- + Pyridine
- Propane, 2-bromo- + Water
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Abraham model linear free energy relationships for describing the partitioning and solubility behavior of nonelectrolyte organic solutes dissolved in pyridine at 298.15 K
- Abraham model correlations for describing the thermodynamic properties of solute transfer into pentyl acetate based on headspace chromatographic and solubility measurements
- Measurement and Correlation of the Densities and Viscosities of 2-Bromopropane + Ethanol Binary Mixtures at Temperatures from (298.15 to 318.15) K
- Measurement and Correlation for Solubility of 2-Bromopropane and Thiourea in Water
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.